diff --git a/CHANGELOG b/CHANGELOG
index dcb5b8d268b4e671d74aca8de83a964019a8b8a1..7efcf9ae18b9b4bcb5651dbdb674f8c7ea7b1c20 100644
--- a/CHANGELOG
+++ b/CHANGELOG
@@ -1,9 +1,31 @@
==============
Changelog
==============
+2019-11-25 (version 1.10):
+ * improved matching of source images to sensors: matching can be specified in the settings dialog. Sensor matching
+ based on ground sampling distance + number of bands + data type and optionally wavelength and/or sensor name
+ * fixed copying of layer styles to maps of same sensor and map view type
+ * improved speed of mapping and layer buffering
+ * failed image sources are logged in the EO Time Series Viewer log panel
+ * Spectral Library Viewer better handles large collections of spectral profiles
+
+2019-10-02 (version 1.9):
+ * includes several smaller updates
+ * fixed error 'shortcutVisibleInContextMenu' error that occurred with Qt < 5.10
+ * enhanced wavelength extraction from GDAL metadata: wavelength can be specified per band
+
+2019-09-19 (version 1.8):
+ * updated spectral library module
+ * fixed #104: error in case of wrong spatial extent
+ * default CRS properly shown in map view settings
+ * user-defined CRS visible
+
2019-08-06 (version 1.7):
* increased contrast for default map view text
- * improved detect of wavelength information, e.g. from Pleiades, Sentinel-2 and RapidEye data
+ * improved reading of wavelength information, e.g. from Pleiades, Sentinel-2 and RapidEye data
+ * temporal profile plot: data gaps can be shown by breaks in the profile line, data source information is correctly shown for selected points only
+ * current extent can be copied via MapCanvas context menu
+ * fixed #102: move maps to date of interest selected in a temporal profile plot
2019-07-16 (version 1.6):
* re-design of map visualization: faster and more compact, the number of maps is fixed to n dates x m map views
@@ -37,7 +59,7 @@ Changelog
* fixed #97: TSV does not start (Linux)
2019-05-31 (version 1.2):
- * added SaveAllMapsDialog and menu option to export all maps as image files.
+ * added SaveAllMapsDialog and menu option to export all maps as image files.
* fixed #91: select Temporal Profile / Spectral Profile button activates the required map tools.
* fixed #92: map canvas context menu "copy to clipboard" options.
diff --git a/CHANGELOG.html b/CHANGELOG.html
index 8b782698577a1aa01f7ebe0503562d85e5cebaf6..182a2d06b324391afa7a1dc30635c1f3b9569fe8 100644
--- a/CHANGELOG.html
+++ b/CHANGELOG.html
@@ -3,7 +3,7 @@
<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="en" lang="en">
<head>
<meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
-<meta name="generator" content="Docutils 0.14: http://docutils.sourceforge.net/" />
+<meta name="generator" content="Docutils 0.15.2: http://docutils.sourceforge.net/" />
<title>Changelog</title>
<style type="text/css">
@@ -364,6 +364,40 @@ ul.auto-toc {
<h1 class="title">Changelog</h1>
<dl class="docutils">
+<dt>2019-11-25 (version 1.10):</dt>
+<dd><ul class="first last simple">
+<li>improved matching of source images to sensors: matching can be specified in the settings dialog. Sensor matching
+based on ground sampling distance + number of bands + data type and optionally wavelength and/or sensor name</li>
+<li>fixed copying of layer styles to maps of same sensor and map view type</li>
+<li>improved speed of mapping and layer buffering</li>
+<li>failed image sources are logged in teh EO Time Series Viewer log panel</li>
+<li>Spectral Library Viewer better handles large collections of spectral profiles</li>
+</ul>
+</dd>
+<dt>2019-10-02 (version 1.9):</dt>
+<dd><ul class="first last simple">
+<li>includes several smaller updates</li>
+<li>fixed error 'shortcutVisibleInContextMenu' error that occurred with Qt < 5.10</li>
+<li>enhanced wavelength extraction from GDAL metadata: wavelength can be specified per band</li>
+</ul>
+</dd>
+<dt>2019-09-19 (version 1.8):</dt>
+<dd><ul class="first last simple">
+<li>updated spectral library module</li>
+<li>fixed <a class="reference external" href="https://bitbucket.org/jakimowb/eo-time-series-viewer/issues/104">#104</a>: error in case of wrong spatial extent</li>
+<li>default CRS properly shown in map view settings</li>
+<li>user-defined CRS visible</li>
+</ul>
+</dd>
+<dt>2019-08-06 (version 1.7):</dt>
+<dd><ul class="first last simple">
+<li>increased contrast for default map view text</li>
+<li>improved reading of wavelength information, e.g. from Pleiades, Sentinel-2 and RapidEye data</li>
+<li>temporal profile plot: data gaps can be shown by breaks in the profile line, data source information is correctly shown for selected points only</li>
+<li>current extent can be copied via MapCanvas context menu</li>
+<li>fixed <a class="reference external" href="https://bitbucket.org/jakimowb/eo-time-series-viewer/issues/102">#102</a>: move maps to date of interest selected in a temporal profile plot</li>
+</ul>
+</dd>
<dt>2019-07-16 (version 1.6):</dt>
<dd><ul class="first last simple">
<li>re-design of map visualization: faster and more compact, the number of maps is fixed to n dates x m map views</li>
@@ -405,7 +439,7 @@ ul.auto-toc {
</dd>
<dt>2019-05-31 (version 1.2):</dt>
<dd><ul class="first last simple">
-<li>added SaveAllMapsDialog and menu option to export all maps as image files.</li>
+<li>added SaveAllMapsDialog and menu option to export all maps as image files.</li>
<li>fixed <a class="reference external" href="https://bitbucket.org/jakimowb/eo-time-series-viewer/issues/91">#91</a>: select Temporal Profile / Spectral Profile button activates the required map tools.</li>
<li>fixed <a class="reference external" href="https://bitbucket.org/jakimowb/eo-time-series-viewer/issues/92">#92</a>: map canvas context menu "copy to clipboard" options.</li>
</ul>
diff --git a/LICENSE.html b/LICENSE.html
index c30eb7ebdbad79e329625350927f37c09f940342..873098d576ae535fe583f50a6c5df3bd908ae6da 100644
--- a/LICENSE.html
+++ b/LICENSE.html
@@ -3,7 +3,7 @@
<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="en" lang="en">
<head>
<meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
-<meta name="generator" content="Docutils 0.14: http://docutils.sourceforge.net/" />
+<meta name="generator" content="Docutils 0.15.2: http://docutils.sourceforge.net/" />
<title><string></title>
<style type="text/css">
diff --git a/README.md b/README.md
index 9f5ea64e908863fd17892c757d4d20e6b88e63c0..e54be7f9c6d6e7c673a77f790b2f5f700095417b 100644
--- a/README.md
+++ b/README.md
@@ -3,7 +3,7 @@
The EO Time Series Viewer is a [http://www.qgis.org](QGIS) plugin to visualize time series of remote sensing images.
Its major purpose is to ease the visualization and labeling of images from multiple sensors.
-Please visit [Wiki](https://bitbucket.org/jakimowb/eo-time-series-viewer) for more information.
+Please visit http://eo-time-series-viewer.readthedocs.io/en/latest/ for more information.
## Licence and Use ##
diff --git a/bitbucket-pipelines.yml b/bitbucket-pipelines.yml
index abb6ec1128a99211357dad2070e4cf3d90fee182..921326779758f235c2cacffafeb01e138a79897b 100644
--- a/bitbucket-pipelines.yml
+++ b/bitbucket-pipelines.yml
@@ -14,14 +14,19 @@ pipelines:
- docker
- pip
script: # Modify the commands below to build your repository.
- - python -m pip install -r requirements.txt
- - python -m pip install nose2
+ - python3 -m pip install -r requirements.txt
+ - python3 -m pip install nose2
- apt-get update
- apt-get -y install xvfb
+ - apt-get -y install git-lfs
- Xvfb :1 -screen 0 1024x768x16 &> xvfb.log &
- ps aux | grep X
- DISPLAY=:1.0
- export DISPLAY
- mkdir test-reports
- - python make/setuprepository.py
- - python -m nose2 discover tests "test_*.py" > test-reports/test-report.txt
+ - git lfs install
+ - git lfs fetch
+ - git lfs pull
+ - git lfs checkout
+ - python3 make/setuprepository.py
+ - python3 -m nose2 discover tests "test_*.py" > test-reports/test-report.txt
diff --git a/doc/source/changelog.rst b/doc/source/changelog.rst
index 36f46eee72cef3cd8a8d3b191b6b1d11903db917..650f62af922fea85d3307fc6e399c367f4fe021a 100644
--- a/doc/source/changelog.rst
+++ b/doc/source/changelog.rst
@@ -1,9 +1,31 @@
==============
Changelog
==============
+2019-11-25 (version 1.10):
+ * improved matching of source images to sensors: matching can be specified in the settings dialog. Sensor matching
+ based on ground sampling distance + number of bands + data type and optionally wavelength and/or sensor name
+ * fixed copying of layer styles to maps of same sensor and map view type
+ * improved speed of mapping and layer buffering
+ * failed image sources are logged in teh EO Time Series Viewer log panel
+ * Spectral Library Viewer better handles large collections of spectral profiles
+
+2019-10-02 (version 1.9):
+ * includes several smaller updates
+ * fixed error 'shortcutVisibleInContextMenu' error that occurred with Qt < 5.10
+ * enhanced wavelength extraction from GDAL metadata: wavelength can be specified per band
+
+2019-09-19 (version 1.8):
+ * updated spectral library module
+ * fixed `#104 <https://bitbucket.org/jakimowb/eo-time-series-viewer/issues/104>`_: error in case of wrong spatial extent
+ * default CRS properly shown in map view settings
+ * user-defined CRS visible
+
2019-08-06 (version 1.7):
* increased contrast for default map view text
- * improved detect of wavelength information, e.g. from Pleiades, Sentinel-2 and RapidEye data
+ * improved reading of wavelength information, e.g. from Pleiades, Sentinel-2 and RapidEye data
+ * temporal profile plot: data gaps can be shown by breaks in the profile line, data source information is correctly shown for selected points only
+ * current extent can be copied via MapCanvas context menu
+ * fixed `#102 <https://bitbucket.org/jakimowb/eo-time-series-viewer/issues/102>`_: move maps to date of interest selected in a temporal profile plot
2019-07-16 (version 1.6):
* re-design of map visualization: faster and more compact, the number of maps is fixed to n dates x m map views
@@ -37,7 +59,7 @@ Changelog
* fixed `#97 <https://bitbucket.org/jakimowb/eo-time-series-viewer/issues/97>`_: TSV does not start (Linux)
2019-05-31 (version 1.2):
- * added SaveAllMapsDialog and menu option to export all maps as image files.
+ * added SaveAllMapsDialog and menu option to export all maps as image files.
* fixed `#91 <https://bitbucket.org/jakimowb/eo-time-series-viewer/issues/91>`_: select Temporal Profile / Spectral Profile button activates the required map tools.
* fixed `#92 <https://bitbucket.org/jakimowb/eo-time-series-viewer/issues/92>`_: map canvas context menu "copy to clipboard" options.
diff --git a/doc/source/changelog_visual.rst b/doc/source/changelog_visual.rst
index 31267035f471259a5c19177efe369229fba50447..bcc86d6e10bd16a55a94fc2e8f6afe317133f9dd 100644
--- a/doc/source/changelog_visual.rst
+++ b/doc/source/changelog_visual.rst
@@ -2,6 +2,88 @@
Visual Changelog
================
+Version 1.10
+------------
+
+* improved matching of source images to sensors: matching can be specified in the settings dialog. Sensor matching
+ based on ground sampling distance + number of bands + data type and optionally wavelength and/or sensor name
+
+ .. figure:: img/settings_sensor_matching.png
+
+* fixed copying of layer styles to maps of same sensor and map view type
+* improved speed of mapping and layer buffering
+* failed image sources are logged in teh EO Time Series Viewer log panel
+
+ .. figure:: img/changelog.1.10/logpanel_failed_datasource_message.png
+
+Version 1.9
+-----------
+* includes several smaller updates
+* fixed error 'shortcutVisibleInContextMenu' error that occurred with Qt < 5.10
+* enhanced wavelength extraction from GDAL metadata: wavelength can be specified per band
+
+Version 1.8
+-----------
+
+* updated spectral library module
+* fixed `#104 <https://bitbucket.org/jakimowb/eo-time-series-viewer/issues/104>`_: error in case of wrong spatial extent
+* default CRS properly shown in map view settings
+* user-defined CRS visible
+
+
+Version 1.7
+-----------
+
+* increased contrast for default map view text
+* improved reading of wavelength information, e.g. from Pleiades, Sentinel-2 and RapidEye data
+* temporal profile plot: data gaps can be shown by breaks in the profile line, data source information is correctly shown for selected points only
+* current extent can be copied via MapCanvas context menu
+* fixed `#102 <https://bitbucket.org/jakimowb/eo-time-series-viewer/issues/102>`_: move maps to date of interest selected in a temporal profile plot
+
+
+Version 1.6
+-----------
+
+* re-design of map visualization: faster and more compact, the number of maps is fixed to n dates x m map views
+* date, sensor or map view information can be plotted within each map and become available in screenshots
+* releases map layers that are not required any more
+* slider + buttons to navigate over time series
+* fixed preview in crosshair dialog
+
+Version 1.5
+-----------
+
+* closing the EO Time Series Viewer instance will release all of its resources
+* added "Lock Map Panel" to avoid unwanted resizing of central widget
+* fixed missing updates of time series tree view when adding / removing source images
+* map canvas context menu lists layers with spatial extent intersecting the cursor position only
+* fixes feature selection error
+* added quick label source image to label the path of raster layer
+
+Version 1.4
+-----------
+
+* adding vector layers with sublayers will add all sublayers
+* map canvas context menu "Focus on Spatial Extent" will hide maps without time series data for the current spatial extent
+
+.. image:: img/changelog.1.4/mapcanvas_contextmenu_focus_spatial_extent.png
+
+* labeling dock allows to iterate over vector features. the spatial map extent will be centered to each feature (`#26 <https://bitbucket.org/jakimowb/eo-time-series-viewer/issues/26>`_)
+
+.. image:: img/changelog.1.4/quick_labeling_goto_next_feature.png
+
+* added several convenience function to TimeSeriesViewer object
+* fixed a bug that did not allow to create new polygon features
+* temporal profile visualization: fixed icons to preview selected plot style, coordinate described by "<fid> <name>", e.g. "42 Deforested", fixed plot style preview
+* updated SpectralLibraryViewer
+* fixed spelling error in stacked band input dialog
+* MapViews can add raster layers that have been opened in QGIS, e.g. XYZ Tile with OpenStreetMap data
+
+
+Version 1.3
+-----------
+
+Bugfixes only
Version 1.2
-----------
diff --git a/doc/source/img/changelog.1.10/logpanel_failed_datasource_message.png b/doc/source/img/changelog.1.10/logpanel_failed_datasource_message.png
new file mode 100644
index 0000000000000000000000000000000000000000..51c4e7ec06270b2b5d91b697b971edf25722eb5d
Binary files /dev/null and b/doc/source/img/changelog.1.10/logpanel_failed_datasource_message.png differ
diff --git a/doc/source/img/changelog.1.4/mapcanvas_contextmenu_focus_spatial_extent.png b/doc/source/img/changelog.1.4/mapcanvas_contextmenu_focus_spatial_extent.png
new file mode 100644
index 0000000000000000000000000000000000000000..fe319c71f46c86ccec8ac97b8bade677a13f0cdc
Binary files /dev/null and b/doc/source/img/changelog.1.4/mapcanvas_contextmenu_focus_spatial_extent.png differ
diff --git a/doc/source/img/changelog.1.4/quick_labeling_goto_next_feature.png b/doc/source/img/changelog.1.4/quick_labeling_goto_next_feature.png
new file mode 100644
index 0000000000000000000000000000000000000000..65a65e3bec2eab0f1e6005d434eef0a8a81c97a2
Binary files /dev/null and b/doc/source/img/changelog.1.4/quick_labeling_goto_next_feature.png differ
diff --git a/doc/source/img/settings_dtg_precission.png b/doc/source/img/settings_dtg_precission.png
new file mode 100644
index 0000000000000000000000000000000000000000..b2408a8c1b4dd23aa78508f3f7eb167556673264
Binary files /dev/null and b/doc/source/img/settings_dtg_precission.png differ
diff --git a/doc/source/img/settings_sensor_matching.png b/doc/source/img/settings_sensor_matching.png
new file mode 100644
index 0000000000000000000000000000000000000000..73d4cc3b9559939fafaf032c5400701f2b1082de
Binary files /dev/null and b/doc/source/img/settings_sensor_matching.png differ
diff --git a/doc/source/index.rst b/doc/source/index.rst
index 38581fb96baff9ad6a1a17b913389d7bad9b27c6..51266fbdc54f485c230a8fdf683ed35b7c42cf75 100644
--- a/doc/source/index.rst
+++ b/doc/source/index.rst
@@ -6,14 +6,21 @@
EO Time Series Viewer
======================
+The Earth Observation Time Series Viewer (EOTSV) is a free-and-open source QGIS Plugin to visualize and label
+raster-based earth observation time series data.
+
.. image:: img/screenshot1.png
-The Earth Observation Time Series Viewer (EOTSV) is a free-and-open source QGIS Plugin to visualize raster-based earth observation time series data.
-* `Online documentation https://eo-time-series-viewer.readthedocs.io/en/latest/ <https://eo-time-series-viewer.readthedocs.io/en/latest/>`_
-* `Source Code https://bitbucket.org/jakimowb/eo-time-series-viewer <https://bitbucket.org/jakimowb/eo-time-series-viewer>`_
-* `Issue tracker https://bitbucket.org/jakimowb/eo-time-series-viewer/issues <https://bitbucket.org/jakimowb/eo-time-series-viewer/issues?status=new&status=open>`_
+
+.. table::
+
+ ==================== ================================================================================================
+ Online documentation https://eo-time-series-viewer.readthedocs.io/en/latest
+ Source Code https://bitbucket.org/jakimowb/eo-time-series-viewer
+ Issue tracker https://bitbucket.org/jakimowb/eo-time-series-viewer/issues
+ ==================== ================================================================================================
Features
@@ -28,7 +35,10 @@ Features
-.. seealso:: `EnMAP Box 3 <https://bitbucket.org/hu-geomatics/enmap-box/wiki/Home>`_ - Another QGIS Plugin developed at Humboldt-Universität zu Berlin
+.. seealso::
+ `Virtual Raster Builder <https://virtual-raster-builder.readthedocs.io/en/latest/>`_ - A QGIS Plugin to create Virtual Raster images.
+
+ `EnMAP Box 3 <https://enmap-box.readthedocs.io/en/latest/>`_ - A QGIS Plugin to visualize and process Multi- and Hyperspectral raster images.
License and Use
@@ -44,8 +54,7 @@ This program is free software; you can redistribute it and/or modify it under th
installation.rst
User Guide <user_guide.rst>
- Visual Changelog <changelog_visual.rst>
- Changelog <changelog.rst>
+ Changelog <changelog_visual.rst>
gallery.rst
License <LICENSE.md>
diff --git a/doc/source/screenshots.py b/doc/source/screenshots.py
index 0eb8a6bd35de241b4d9523c51a792906b025e8d9..03a4c3fe5523a61a83280e1b17d2168e2e828aef 100644
--- a/doc/source/screenshots.py
+++ b/doc/source/screenshots.py
@@ -25,15 +25,15 @@ DATE_OF_INTEREST = np.datetime64('2014-07-02')
TSV = TimeSeriesViewer()
TSV.show()
-TSV.spatialTemporalVis.setMapSize(QSize(300, 150))
+TSV.setMapSize(QSize(300, 150))
QApplication.processEvents()
#set up example settings
from example.Images import Img_2014_04_21_LC82270652014111LGN00_BOA, re_2014_06_25
if True:
- TSV.loadExampleTimeSeries()
- center = TSV.mTimeSeries.maxSpatialExtent().spatialCenter()
+ TSV.loadExampleTimeSeries(loadAsync=False)
+ center = TSV.timeSeries().maxSpatialExtent().spatialCenter()
else:
dirTestData = r'F:\TSData'
files = list(file_search(dirTestData, re.compile('\.tif$')))
diff --git a/eotimeseriesviewer/__init__.py b/eotimeseriesviewer/__init__.py
index 36175536466d547efbf9070f4cb550c3acd31d41..9d5424ad6c9ec5777950ac355b31fecb6ae046de 100644
--- a/eotimeseriesviewer/__init__.py
+++ b/eotimeseriesviewer/__init__.py
@@ -21,9 +21,10 @@
# noinspection PyPep8Naming
-__version__ = '1.7' # sub-subversion number is added automatically
+__version__ = '1.10' # sub-subversion number is added automatically
LICENSE = 'GNU GPL-3'
TITLE = 'EO Time Series Viewer'
+LOG_MESSAGE_TAG = TITLE
DESCRIPTION = 'Visualization of multi-sensor Earth observation time series data.'
HOMEPAGE = 'https://bitbucket.org/jakimowb/eo-time-series-viewer'
DOCUMENTATION = 'http://eo-time-series-viewer.readthedocs.io/en/latest/'
@@ -84,17 +85,13 @@ if not os.environ.get('READTHEDOCS') in ['True', 'TRUE', True]:
UI_DIRECTORIES.append(DIR_UI)
-def messageLog(msg, level=None):
+def messageLog(msg, level=Qgis.Info):
"""
Writes a log message to the QGIS EO TimeSeriesViewer log
:param msg: log message string
:param level: QgsMessageLog::MessageLevel with MessageLevel =[INFO | ALL | WARNING | CRITICAL | NONE]
"""
-
- if level is None:
- level = Qgis.Warning
-
- QgsApplication.instance().messageLog().logMessage(msg, 'EO TSV', level)
+ QgsApplication.instance().messageLog().logMessage(msg, LOG_MESSAGE_TAG, level)
def initResources():
"""
diff --git a/eotimeseriesviewer/__main__.py b/eotimeseriesviewer/__main__.py
index fa9e2e0b5569d8d00f325fd7a3622699c0321e6f..76367e497639ffa49efe5b7206ff223ebe942b07 100644
--- a/eotimeseriesviewer/__main__.py
+++ b/eotimeseriesviewer/__main__.py
@@ -17,9 +17,15 @@
***************************************************************************
"""
+import sys, os, pathlib
+
+
def run():
# add site-packages to sys.path
+ pluginDir = pathlib.Path(__file__).parents[1]
+ sys.path.append(pluginDir.as_posix())
+ print(pluginDir)
from eotimeseriesviewer.tests import initQgisApplication
import qgis.utils
@@ -35,7 +41,7 @@ def run():
from eotimeseriesviewer.main import TimeSeriesViewer
ts = TimeSeriesViewer()
- ts.run()
+ ts.show()
if not qgisIface:
qgsApp.exec_()
diff --git a/eotimeseriesviewer/dateparser.py b/eotimeseriesviewer/dateparser.py
index 52f27de599d9a08f4379dd71abc0ecb5854c3094..89c770f63c1a79b58530443f189beb812c6711ed 100644
--- a/eotimeseriesviewer/dateparser.py
+++ b/eotimeseriesviewer/dateparser.py
@@ -6,10 +6,10 @@ from qgis import *
from qgis.PyQt.QtCore import QDate
-#regular expression. compile them only once
+# regular expression. compile them only once
-#thanks user "funkwurm" in
-#http://stackoverflow.com/questions/28020805/regex-validate-correct-iso8601-date-string-with-time
+# thanks to user "funkwurm" in
+# http://stackoverflow.com/questions/28020805/regex-validate-correct-iso8601-date-string-with-time
regISODate1 = re.compile(r'(?:[1-9]\d{3}-(?:(?:0[1-9]|1[0-2])-(?:0[1-9]|1\d|2[0-8])|(?:0[13-9]|1[0-2])-(?:29|30)|(?:0[13578]|1[02])-31)|(?:[1-9]\d(?:0[48]|[2468][048]|[13579][26])|(?:[2468][048]|[13579][26])00)-02-29)T(?:[01]\d|2[0-3]):[0-5]\d:[0-5]\d(?:Z|[+-][01]\d:[0-5]\d)')
regISODate3 = re.compile(r'([\+-]?\d{4}(?!\d{2}\b))((-?)((0[1-9]|1[0-2])(\3([12]\d|0[1-9]|3[01]))?|W([0-4]\d|5[0-2])(-?[1-7])?|(00[1-9]|0[1-9]\d|[12]\d{2}|3([0-5]\d|6[1-6])))([T\s]((([01]\d|2[0-3])((:?)[0-5]\d)?|24\:?00)([\.,]\d+(?!:))?)?(\17[0-5]\d([\.,]\d+)?)?([zZ]|([\+-])([01]\d|2[0-3]):?([0-5]\d)?)?)?)?')
regISODate2 = re.compile(r'(19|20|21\d{4}(?!\d{2}\b))((-?)((0[1-9]|1[0-2])(\3([12]\d|0[1-9]|3[01]))?|W([0-4]\d|5[0-2])(-?[1-7])?|(00[1-9]|0[1-9]\d|[12]\d{2}|3([0-5]\d|6[1-6])))([T\s]((([01]\d|2[0-3])((:?)[0-5]\d)?|24\:?00)([\.,]\d+(?!:))?)?(\17[0-5]\d([\.,]\d+)?)?([zZ]|([\+-])([01]\d|2[0-3]):?([0-5]\d)?)?)?)?')
@@ -195,7 +195,8 @@ class ImageDateReaderDefault(ImageDateReader):
for key, value in md.items():
if self.regDateKeys.search(key):
try:
- dtg = np.datetime64(value)
+ # remove timezone characters from end of string, e.g. 'Z' in '2013-03-25T13:45:03.0Z'
+ dtg = np.datetime64(re.sub(r'\D+$', '', value))
return dtg
except Exception as ex:
pass
@@ -272,7 +273,7 @@ class ImageDateParserLandsat(ImageDateReader):
dateParserList = [c for c in ImageDateReader.__subclasses__()]
-dateParserList.insert(0, dateParserList.pop(dateParserList.index(ImageDateReaderDefault))) #set to first position
+dateParserList.insert(0, dateParserList.pop(dateParserList.index(ImageDateReaderDefault))) # set to first position
def parseDateFromDataSet(dataSet:gdal.Dataset)->np.datetime64:
assert isinstance(dataSet, gdal.Dataset)
@@ -282,12 +283,3 @@ def parseDateFromDataSet(dataSet:gdal.Dataset)->np.datetime64:
return dtg
return None
-
-if __name__ == '__main__':
-
- p = r'E:\_EnMAP\temp\temp_bj\landsat\37S\EB\LE71720342015009SG100\LE71720342015009SG100_sr.tif'
- p = r'D:\Repositories\QGIS_Plugins\hub-timeseriesviewer\example\Images\2012-04-07_LE72270652012098EDC00_BOA.bsq'
- ds = gdal.Open(p)
-
- print(datetime64FromYYYYMMDD('20141212'))
- print(parseDateFromDataSet(ds))
\ No newline at end of file
diff --git a/eotimeseriesviewer/externals/qps/__init__.py b/eotimeseriesviewer/externals/qps/__init__.py
index 5df16d52df4419048c895bcbe6ec4facd3ca99f9..d87ea698883a81bdf8435a5cfee9a55755fd5555 100644
--- a/eotimeseriesviewer/externals/qps/__init__.py
+++ b/eotimeseriesviewer/externals/qps/__init__.py
@@ -64,3 +64,8 @@ def registerEditorWidgets():
print(ex, file=sys.stderr)
+
+def initAll():
+
+ initResources()
+ registerEditorWidgets()
\ No newline at end of file
diff --git a/eotimeseriesviewer/externals/qps/classification/classificationscheme.py b/eotimeseriesviewer/externals/qps/classification/classificationscheme.py
index c2a31acf7f343a34d86d9920a9acffbd88397407..f9b120693360fb350b6b990ec15e2c3e8dc9f449 100644
--- a/eotimeseriesviewer/externals/qps/classification/classificationscheme.py
+++ b/eotimeseriesviewer/externals/qps/classification/classificationscheme.py
@@ -19,12 +19,13 @@
***************************************************************************
"""
-import os, json, pickle, warnings, csv, re, sys
+import os, json, pickle, warnings, csv, re, sys, typing
from qgis.core import *
from qgis.gui import *
from qgis.PyQt.QtCore import *
from qgis.PyQt.QtGui import *
from qgis.PyQt.QtWidgets import *
+from qgis.PyQt.QtXml import *
import numpy as np
from osgeo import gdal
from ..utils import gdalDataset, nextColor, loadUIFormClass, findMapLayer, registeredMapLayers
@@ -38,7 +39,7 @@ DEFAULT_FIRST_COLOR = QColor('#a6cee3')
MIMEDATA_KEY = 'hub-classscheme'
MIMEDATA_KEY_TEXT = 'text/plain'
MIMEDATA_INTERNAL_IDs = 'classinfo_ids'
-
+MIMEDATA_KEY_QGIS_STYLE = 'application/qgis.style'
MAX_UNIQUE_CLASSES = 100
def findMapLayersWithClassInfo()->list:
@@ -319,8 +320,22 @@ class ClassificationScheme(QAbstractTableModel):
cs.insertClasses(classes)
mimeData = QMimeData()
mimeData.setData(MIMEDATA_KEY, cs.qByteArray())
- mimeData.setData(MIMEDATA_INTERNAL_IDs, QByteArray(pickle.dumps([id(c) for c in classes ])))
+ mimeData.setData(MIMEDATA_INTERNAL_IDs, QByteArray(pickle.dumps([id(c) for c in classes])))
mimeData.setText(cs.toString())
+
+ renderer = self.featureRenderer()
+
+ doc = QDomDocument()
+ err = ''
+ for typeName in ['POLYGON']:
+ lyr = QgsVectorLayer('{}?crs=epsg:4326&field=id:integer'.format(typeName), cs.name(), 'memory')
+ assert isinstance(lyr, QgsVectorLayer) and lyr.isValid()
+ lyr.setRenderer(renderer.clone())
+ err = lyr.exportNamedStyle(doc)
+ xml = doc.toString()
+ s = ""
+ mimeData.setData(MIMEDATA_KEY_QGIS_STYLE, doc.toByteArray())
+ mimeData.setText(doc.toString())
return mimeData
def mimeTypes(self)->list:
@@ -578,17 +593,17 @@ class ClassificationScheme(QAbstractTableModel):
return cs
- def featureRenderer(self)->QgsCategorizedSymbolRenderer:
+ def featureRenderer(self, symbolType:typing.Union[QgsMarkerSymbol, QgsFillSymbol, QgsLineSymbol]=QgsFillSymbol)->QgsCategorizedSymbolRenderer:
"""
Returns the ClassificationScheme as QgsCategorizedSymbolRenderer
:return: ClassificationScheme
"""
- r = QgsCategorizedSymbolRenderer('dummy', [])
+ r = QgsCategorizedSymbolRenderer(self.name(), [])
for c in self:
assert isinstance(c, ClassInfo)
- symbol = QgsMarkerSymbol()
+ symbol = symbolType()
symbol.setColor(QColor(c.color()))
cat = QgsRendererCategory(c.label(), symbol, c.name(), render=True)
r.addCategory(cat)
@@ -989,10 +1004,11 @@ class ClassificationScheme(QAbstractTableModel):
if isinstance(ba, ClassificationScheme):
return ba
if MIMEDATA_KEY_TEXT in mimeData.formats():
-
ba = ClassificationScheme.fromQByteArray(mimeData.data(MIMEDATA_KEY_TEXT))
if isinstance(ba, ClassificationScheme):
return ba
+ if MIMEDATA_KEY_QGIS_STYLE in mimeData.formats():
+ s = ""
return None
@@ -1543,7 +1559,7 @@ class ClassificationSchemeWidget(QWidget, loadClassificationUI('classificationsc
a.triggered.connect(lambda _, lyr=layer, f=idx: self.onLoadClassesFromField(lyr, idx))
if isinstance(layer.renderer(), QgsCategorizedSymbolRenderer):
- a = m.addAction('Current Symbology'.format(layer.name()))
+ a = m.addAction('Current Symbols'.format(layer.name()))
a.triggered.connect(lambda _, lyr=layer: self.onLoadClassesFromRenderer(lyr))
@@ -1572,7 +1588,7 @@ class ClassificationSchemeWidget(QWidget, loadClassificationUI('classificationsc
def onClipboard(self, *args):
mimeData = QApplication.clipboard().mimeData()
- b = isinstance(mimeData, QMimeData) and MIMEDATA_KEY_TEXT in mimeData.formats()
+ b = isinstance(mimeData, QMimeData) and (MIMEDATA_KEY_TEXT in mimeData.formats() or MIMEDATA_KEY_QGIS_STYLE in mimeData.formats())
self.actionPasteClasses.setEnabled(b)
@@ -1765,6 +1781,7 @@ class ClassificationSchemeEditorConfigWidget(QgsEditorConfigWidget):
def setConfig(self, config:dict):
self.mLastConfig = config
cs = classSchemeFromConfig(config)
+ cs.setName(self.layer().fields()[self.field()].name())
self.mSchemeWidget.setClassificationScheme(cs)
def resetClassificationScheme(self):
@@ -1875,7 +1892,7 @@ class ClassificationSchemeWidgetFactory(QgsEditorWidgetFactory):
assert isinstance(field, QgsField)
if re.search('(int|float|double|text|string)', field.typeName(), re.I):
if re.search('class', field.name(), re.I):
- return 10
+ return 5 # should we return 10 for showing specialized support?
else:
return 5
else:
diff --git a/eotimeseriesviewer/externals/qps/layerproperties.py b/eotimeseriesviewer/externals/qps/layerproperties.py
index 322676cf3dd01eae12e8de2214eb5b48e624c77a..37f74eb6ef6ccba81bb241eab02b7e3a94b27add 100644
--- a/eotimeseriesviewer/externals/qps/layerproperties.py
+++ b/eotimeseriesviewer/externals/qps/layerproperties.py
@@ -21,7 +21,7 @@
import collections
import os
import re
-
+import typing
from osgeo import gdal, ogr, osr
import numpy as np
from qgis.gui import *
@@ -74,6 +74,59 @@ DUMMY_RASTERINTERFACE = QgsSingleBandGrayRenderer(None, 0)
MDF_QGIS_LAYER_STYLE = 'application/qgis.style'
MDF_TEXT_PLAIN = 'text/plain'
+def openRasterLayerSilent(uri, name, provider)->QgsRasterLayer:
+ """
+ Opens a QgsRasterLayer without asking for its CRS in case it is undefined.
+ :param uri: path
+ :param name: name of layer
+ :param provider: provider string
+ :return: QgsRasterLayer
+ """
+ key = '/Projections/defaultBehavior'
+ v = QgsSettings().value(key)
+ isPrompt = v == 'prompt'
+
+ if isPrompt:
+ # do not ask!
+ QgsSettings().setValue(key, 'useProject')
+
+ loptions = QgsRasterLayer.LayerOptions(loadDefaultStyle=False)
+ lyr = QgsRasterLayer(uri, name, provider, options=loptions)
+
+ if isPrompt:
+ QgsSettings().setValue(key, v)
+ return lyr
+
+class SubDataSetInputTableModel(QAbstractTableModel):
+
+ def __init__(self, *args, **kwds):
+ super(SubDataSetInputTableModel, self).__init__(*args, **kwds)
+
+ self.cnID = '#'
+ self.cnName = 'name'
+ self.cnPath = 'path'
+
+ self.cnSamples = 'ns'
+ self.cnLines = 'nl'
+ self.cnBands = 'nb'
+
+ self.mInputBands = []
+
+
+
+
+
+ def setSourceDataSet(self, ds:gdal.Dataset):
+ pass
+
+
+
+class SubDataSetSelectionDialog(QDialog, loadUI('subdatasetselectiondialog.ui')):
+
+
+ pass
+
+
def rendererFromXml(xml):
"""
Reads a string `text` and returns the first QgsRasterRenderer or QgsFeatureRenderer (if defined).
@@ -144,8 +197,9 @@ def defaultRasterRenderer(layer:QgsRasterLayer, bandIndices:list=None, sampleSiz
if not isinstance(bandIndices, list):
if nb >= 3:
+
if isinstance(defaultRenderer, QgsMultiBandColorRenderer):
- bandIndices = [defaultRenderer.redBand()-1, defaultRenderer.greenBand()-1, defaultRenderer.blueBand()-1]
+ bandIndices = defaultBands(layer)
else:
bandIndices = [2, 1, 0]
else:
@@ -154,9 +208,7 @@ def defaultRasterRenderer(layer:QgsRasterLayer, bandIndices:list=None, sampleSiz
assert isinstance(bandIndices, list)
# get band stats
- bandStats = [layer.dataProvider().bandStatistics(b + 1,
- stats=QgsRasterBandStats.All,
- sampleSize=256) for b in bandIndices]
+ bandStats = [layer.dataProvider().bandStatistics(b + 1, stats=QgsRasterBandStats.Min | QgsRasterBandStats.Max, sampleSize=sampleSize) for b in bandIndices]
dp = layer.dataProvider()
assert isinstance(dp, QgsRasterDataProvider)
@@ -187,7 +239,7 @@ def defaultRasterRenderer(layer:QgsRasterLayer, bandIndices:list=None, sampleSiz
ce.setMinimumValue(0)
ce.setMaximumValue(255)
else:
- vmin, vmax = layer.dataProvider().cumulativeCut(b, 0.02, 0.98)
+ vmin, vmax = layer.dataProvider().cumulativeCut(b, 0.02, 0.98, sampleSize=sampleSize)
ce.setMinimumValue(vmin)
ce.setMaximumValue(vmax)
@@ -207,7 +259,7 @@ def defaultRasterRenderer(layer:QgsRasterLayer, bandIndices:list=None, sampleSiz
assert isinstance(ce, QgsContrastEnhancement)
ce.setContrastEnhancementAlgorithm(QgsContrastEnhancement.StretchToMinimumMaximum, True)
- vmin, vmax = layer.dataProvider().cumulativeCut(b, 0.02, 0.98)
+ vmin, vmax = layer.dataProvider().cumulativeCut(b, 0.02, 0.98, sampleSize=sampleSize)
if dt == Qgis.Byte:
#standard RGB photo?
if False and layer.bandCount() == 3:
@@ -327,7 +379,12 @@ def pasteStyleFromClipboard(layer:QgsMapLayer):
layer.triggerRepaint()
-def subLayerDefinitions(mapLayer:QgsMapLayer)->list:
+def subLayerDefinitions(mapLayer:QgsMapLayer)->typing.List[QgsSublayersDialog.LayerDefinition]:
+ """
+
+ :param mapLayer:QgsMapLayer
+ :return: list of sublayer definitions
+ """
definitions = []
dp = mapLayer.dataProvider()
@@ -371,7 +428,7 @@ def subLayerDefinitions(mapLayer:QgsMapLayer)->list:
return definitions
-def subLayers(mapLayer:QgsMapLayer, subLayers:list=None)->list:
+def subLayers(mapLayer:QgsMapLayer, subLayers:list=None)->typing.List[QgsMapLayer]:
"""
Returns a list of QgsMapLayer instances extracted from the input QgsMapLayer.
Returns the "parent" QgsMapLayer in case no sublayers can be extracted
@@ -1327,22 +1384,38 @@ class RasterLayerProperties(QgsOptionsDialogBase, loadUI('rasterlayerpropertiesd
self.mRenderTypeComboBox.setModel(RASTERRENDERER_CREATE_FUNCTIONSV2)
renderer = self.mRasterLayer.renderer()
-
- for func in RASTERRENDERER_CREATE_FUNCTIONSV2.optionValues():
+ iCurrent = None
+ for i, constructor in enumerate(RASTERRENDERER_CREATE_FUNCTIONSV2.optionValues()):
extent = self.canvas.extent()
- w = func(self.mRasterLayer, extent)
+ w = constructor(self.mRasterLayer, extent)
w.setMapCanvas(self.canvas)
#w.sizePolicy().setVerticalPolicy(QSizePolicy.Maximum)
assert isinstance(w, QgsRasterRendererWidget)
+ w.setRasterLayer(self.mRasterLayer)
minMaxWidget = w.minMaxWidget()
if isinstance(minMaxWidget, QgsRasterMinMaxWidget):
minMaxWidget.setCollapsed(False)
w.setParent(self.mRendererStackedWidget)
w.setSizePolicy(QSizePolicy.Ignored, QSizePolicy.Ignored)
self.mRendererStackedWidget.addWidget(w)
- f2 = getattr(w, 'setFromRenderer', None)
- if f2:
- f2(renderer)
+
+ if type(w.renderer()) == type(renderer):
+ iCurrent = i
+
+ try:
+ w.setFromRenderer(renderer)
+
+ if isinstance(w, QgsSingleBandPseudoColorRendererWidget) and isinstance(renderer, QgsSingleBandPseudoColorRenderer):
+ w.setMin(renderer.classificationMin())
+ w.setMax(renderer.classificationMax())
+ elif isinstance(w, QgsSingleBandPseudoColorRendererWidget) and isinstance(renderer, QgsSingleBandGrayRenderer):
+ pass
+
+ except Exception as ex:
+ s = ""
+
+ if isinstance(iCurrent, int):
+ self.mRenderTypeComboBox.setCurrentIndex(iCurrent)
@@ -1383,7 +1456,7 @@ class RasterLayerProperties(QgsOptionsDialogBase, loadUI('rasterlayerpropertiesd
renderer = mRendererWidget.renderer()
assert isinstance(renderer, QgsRasterRenderer)
renderer.setOpacity(self.sliderOpacity.value() / 100.)
- self.mRasterLayer.setRenderer(renderer)
+ self.mRasterLayer.setRenderer(renderer.clone())
self.mRasterLayer.triggerRepaint()
self.setResult(QDialog.Accepted)
s = ""
@@ -1562,12 +1635,14 @@ def showLayerPropertiesDialog(layer:QgsMapLayer,
result = dialog.exec_()
return result
+
+
RASTERRENDERER_CREATE_FUNCTIONSV2 = OptionListModel()
#RASTERRENDERER_CREATE_FUNCTIONSV2.addOption(Option(MultiBandColorRendererWidget.create, name='multibandcolor'))
-RASTERRENDERER_CREATE_FUNCTIONSV2.addOption(Option(QgsMultiBandColorRendererWidget.create, name='multibandcolor (QGIS)'))
-RASTERRENDERER_CREATE_FUNCTIONSV2.addOption(Option(QgsPalettedRendererWidget.create, name='paletted'))
+RASTERRENDERER_CREATE_FUNCTIONSV2.addOption(Option(QgsMultiBandColorRendererWidget, name='multibandcolor (QGIS)'))
+RASTERRENDERER_CREATE_FUNCTIONSV2.addOption(Option(QgsPalettedRendererWidget, name='paletted'))
#RASTERRENDERER_CREATE_FUNCTIONSV2.addOption(Option(SingleBandGrayRendererWidget.create, name='singlegray'))
-RASTERRENDERER_CREATE_FUNCTIONSV2.addOption(Option(QgsSingleBandGrayRendererWidget.create, name='singlegray (QGIS)'))
+RASTERRENDERER_CREATE_FUNCTIONSV2.addOption(Option(QgsSingleBandGrayRendererWidget, name='singlegray (QGIS)'))
#RASTERRENDERER_CREATE_FUNCTIONSV2.addOption(Option(SingleBandPseudoColorRendererWidget.create, name='singlebandpseudocolor'))
-RASTERRENDERER_CREATE_FUNCTIONSV2.addOption(Option(QgsSingleBandPseudoColorRendererWidget.create, name='singlebandpseudocolor (QGIS)'))
+RASTERRENDERER_CREATE_FUNCTIONSV2.addOption(Option(QgsSingleBandPseudoColorRendererWidget, name='singlebandpseudocolor (QGIS)'))
diff --git a/eotimeseriesviewer/externals/qps/make/iconselect.py b/eotimeseriesviewer/externals/qps/make/iconselect.py
index f50c2f2136908a2fd086b9a4cab2d9226960f60a..a7e4b574cfdc4962b21678341115a2e6b3a4249d 100644
--- a/eotimeseriesviewer/externals/qps/make/iconselect.py
+++ b/eotimeseriesviewer/externals/qps/make/iconselect.py
@@ -3,7 +3,7 @@ from PyQt5.QtCore import *
from PyQt5.QtGui import *
from PyQt5.QtWidgets import *
from qgis.gui import QgsCollapsibleGroupBox
-from ..testing import initQgisApplication
+from qps.testing import initQgisApplication
STANDARD_ICONS = [
'SP_ArrowBack',
@@ -150,7 +150,7 @@ class AvailableIcons(QWidget):
def findResourceDirs(self, resource:QResource)->list:
dirs = []
for path in resource.children():
- r = QResource(resource.fileName() +'/'+ path)
+ r = QResource(resource.fileName() + '/' + path)
assert isinstance(r, QResource)
if r.isDir():
dirs.append(r.fileName())
diff --git a/eotimeseriesviewer/externals/qps/make/make.py b/eotimeseriesviewer/externals/qps/make/make.py
index 7ab8814a06ab44b630abc40a907d249ed13df0d4..b59e0523af7c3f4d9ce3610a0ce4b49ff390659b 100644
--- a/eotimeseriesviewer/externals/qps/make/make.py
+++ b/eotimeseriesviewer/externals/qps/make/make.py
@@ -5,8 +5,37 @@ app = initQgisApplication()
from ..utils import *
from osgeo import gdal, ogr, osr
-DIR_QGIS_REPO = r'C:\Users\geo_beja\Repositories\QGIS'
-DIR_REPO = dn(findUpwardPath(__file__, '.git'))
+DIR_QGIS_REPO = os.environ.get('DIR_QGIS_REPO')
+
+DIR_REPO = findUpwardPath(__file__, '.git')
+if not DIR_REPO is None:
+ DIR_REPO = dn(DIR_REPO)
+
+
+def remove_shortcutVisibleInContextMenu(rootDir):
+ """
+ This routine searches for *.ui files and removes the shortcutVisibleInContextMenu <property> from which causes errors with Qt < 5.10.
+ :param rootDir: str
+ """
+
+ uiFiles = file_search(rootDir, '*.ui', recursive=True)
+
+ regex = re.compile(r'<property name="shortcutVisibleInContextMenu">[^<]*<bool>true</bool>[^<]*</property>', re.MULTILINE)
+
+
+ for p in uiFiles:
+ assert isinstance(p, str)
+ assert os.path.isfile(p)
+
+ with open(p, encoding='utf-8') as f:
+ xml = f.read()
+
+ if 'shortcutVisibleInContextMenu' in xml:
+ print('remove "shortcutVisibleInContextMenu" properties from {}'.format(p))
+ xml = regex.sub('', xml)
+
+ with open(p, 'w', encoding='utf-8') as f:
+ f.write(xml)
def rasterize_vector_labels(pathRef, pathDst, pathShp, label_field, band_ref=1, label_layer=0):
@@ -156,7 +185,7 @@ def searchAndCompileResourceFiles(dirRoot:str, targetDir:str=None):
Defaults to the *.qrc's directory
"""
# find ui files
- assert os.path.isdir(dirRoot)
+ assert os.path.isdir(dirRoot), '"dirRoot" is not a directory: {}'.format(dirRoot)
ui_files = list(file_search(dirRoot, '*.ui', recursive=True))
qrcs = set()
@@ -179,13 +208,20 @@ def searchAndCompileResourceFiles(dirRoot:str, targetDir:str=None):
resourcefiles = list(qrcs)
assert len(resourcefiles) > 0
+ qrcFiles = []
+
for root_dir, f in resourcefiles:
pathQrc = os.path.normpath(jp(root_dir, f))
if not os.path.exists(pathQrc):
print('Resource file does not exist: {}'.format(pathQrc))
continue
- compileResourceFile(pathQrc, targetDir=targetDir)
+ if pathQrc not in qrcFiles:
+ qrcFiles.append(pathQrc)
+
+ print('Compile {} *.qrc files'.format(len(qrcFiles)))
+ for qrcFiles in qrcFiles:
+ compileResourceFile(qrcFiles, targetDir=targetDir)
def compileResourceFile(pathQrc:str, targetDir:str=None):
@@ -231,180 +267,6 @@ def fileNeedsUpdate(file1, file2):
else:
return os.path.getmtime(file1) > os.path.getmtime(file2)
-def createResourceIconPackage(dirIcons, pathResourceFile):
- import numpy as np
-
- pathInit = jp(dirIcons, '__init__.py')
- code = ['#!/usr/bin/env python',
- '"""',
- 'This file is auto-generated.',
- 'Do not edit manually, as changes might get overwritten.',
- '"""',
- '__author__ = "auto-generated by {}"'.format(os.path.relpath(__file__, DIR_REPO)),
- '__date__ = "{}"'.format(np.datetime64('now')),
- '',
- 'import sys, os',
- '',
- 'thisDir = os.path.dirname(__file__)',
- '# File path attributes:',
- ]
- files = list(file_search(dirIcons, '*.png', recursive=True))
-
- filePathAttributes = set()
-
- def addFiles(files, comment=None, numberPrefix='File'):
- if len(files) > 0:
- if comment:
- code.append('# ' + comment)
- for f in files:
- an, ext = os.path.splitext(os.path.basename(f))
- if re.search(r'^\d', an):
- an = numberPrefix + an
- an = re.sub(r'[-.]', '_', an)
-
- assert an not in filePathAttributes
- relpath = os.path.relpath(f, dirIcons)
- code.append("{} = os.path.join(thisDir,r'{}')".format(an, relpath))
- filePathAttributes.add(an)
- code.append('\n')
-
- raster = [f for f in files if re.search(r'.*\.(bsq|bip|bil|tif|tiff)$', f)]
- vector = [f for f in files if re.search(r'.*\.(shp|kml|kmz)$', f)]
-
- addFiles(raster, 'Raster files:', numberPrefix='Img_')
- addFiles(vector, 'Vector files:', numberPrefix='Shp_')
-
- # add self-test for file existence
- if len(filePathAttributes) > 0:
- code.extend(
- [
- "",
- "# self-test to check each file path attribute",
- "for a in dir(sys.modules[__name__]):",
- " v = getattr(sys.modules[__name__], a)",
- " if type(v) == str and os.path.isabs(v):",
- " if not os.path.exists(v):",
- " sys.stderr.write('Missing package attribute file: {}={}'.format(a, v))",
- "",
- "# cleanup",
- "del thisDir ",
- ]
- )
-
- open(pathInit, 'w').write('\n'.join(code))
- print('Created ' + pathInit)
-
-
-def createIconProvider(resourceFiles:list, pathIconProvider:str, className = 'IconProvider'):
-
- """
-
- class IconProvider:
- EnMAP_Logo = ':/enmapbox/icons/enmapbox.svg'
- Map_Link_Remove = ':/enmapbox/icons/link_open.svg'
- Map_Link = ':/enmapbox/icons/link_basic.svg'
- Map_Link_Center = ':/enmapbox/icons/link_center.svg'
-
- :param resourceFiles:
- :param pathIconProvider:
- :return:
- """
- info = ['#autogenerated file. do not modify']
- info.append('class {}:'.format(className))
-
- for file in resourceFiles:
- assert os.path.isfile(file)
- assert file.endswith('.qrc')
-
- xml = ''
- with open(file, encoding='utf8') as f:
- xml = f.read()
- #:/qps/ui/icons/classinfo.svg
- tree = ET.fromstring(xml)
- for xmlResource in tree.findall('qresource'):
- prefix = xmlResource.attrib['prefix']
- for xmlFile in xmlResource.findall('file'):
- uri = xmlFile.text
-
- uriSrc = ':/{}/{}'.format(prefix, uri)
-
- name, ext = os.path.splitext(uriSrc)
- varname = '_'.join([s for s in re.split(r'[ :/\.]+', name) if len(s) > 0])
- #name = ' '.join(re.split('[:/\.]', name))
- #name = ''.join(x for x in name.title() if not x.isspace())
- info.append(" {} = '{}'".format(varname, uriSrc))
-
-
-
-
-
-def createFilePackage(dirData):
- import numpy as np
- pathInit = jp(dirData, '__init__.py')
- code = ['#!/usr/bin/env python',
- '"""',
- 'This file is auto-generated.',
- 'Do not edit manually, as changes might get overwritten.',
- '"""',
- '__author__ = "auto-generated by {}"'.format(os.path.relpath(__file__, DIR_REPO)),
- '__date__ = "{}"'.format(np.datetime64('now')),
- '',
- 'import sys, os',
- '',
- 'thisDir = os.path.dirname(__file__)',
- '# File path attributes:',
- ]
- files = list(file_search(dirData, '*', recursive=True))
-
- filePathAttributes = set()
- def addFiles(files, comment=None, numberPrefix='File'):
- if len(files) > 0:
- if comment:
- code.append('# '+comment)
- for f in files:
- attributeName, ext = os.path.splitext(os.path.basename(f))
- #take care of leading numbers
- if re.search(r'^\d', attributeName):
- attributeName = numberPrefix+attributeName
- # append extension
- attributeName += ext
- #take care of not allowed characters
- attributeName = re.sub(r'[-.]', '_',attributeName)
-
-
-
- assert attributeName not in filePathAttributes, attributeName
- relpath = os.path.relpath(f, dirData)
- code.append("{} = os.path.join(thisDir,r'{}')".format(attributeName, relpath))
- filePathAttributes.add(attributeName)
- code.append('\n')
-
- raster = [f for f in files if re.search(r'.*\.(bsq|bip|bil|tif|tiff)$', f)]
- vector = [f for f in files if re.search(r'.*\.(shp|kml|kmz)$', f)]
-
- addFiles(raster, 'Raster files:', numberPrefix='Img_')
- addFiles(vector, 'Vector files:', numberPrefix='Shp_')
-
- #add self-test for file existence
- if len(filePathAttributes) > 0:
- code.extend(
- [
- "",
- "# self-test to check each file path attribute",
- "for a in dir(sys.modules[__name__]):",
- " v = getattr(sys.modules[__name__], a)",
- " if type(v) == str and os.path.isabs(v):" ,
- " if not os.path.exists(v):",
- " sys.stderr.write('Missing package attribute file: {}={}'.format(a, v))",
- "",
- "# cleanup",
- "del thisDir ",
- ]
- )
-
- open(pathInit, 'w').write('\n'.join(code))
- print('Created '+pathInit)
-
def compileQGISResourceFiles(pathQGISRepo:str, target:str=None):
"""
@@ -419,8 +281,9 @@ def compileQGISResourceFiles(pathQGISRepo:str, target:str=None):
pathQGISRepo = pathQGISRepo.strip("'").strip('"')
- assert os.path.isdir(pathQGISRepo)
- if not isinstance(target, str):
- target = jp(DIR_REPO, 'qgisresources')
- searchAndCompileResourceFiles(pathQGISRepo, targetDir=target)
-
+ if os.path.isdir(pathQGISRepo):
+ if not isinstance(target, str):
+ target = jp(DIR_REPO, 'qgisresources')
+ searchAndCompileResourceFiles(pathQGISRepo, targetDir=target)
+ else:
+ print('Unable to find local QGIS_REPOSITORY')
diff --git a/eotimeseriesviewer/externals/qps/make/updateexternals.py b/eotimeseriesviewer/externals/qps/make/updateexternals.py
index 6fd915c68d811e00ad5a71d999f79893f7007be5..fe7983d0490f75c8b1b99f8c6596b4119b871b5b 100644
--- a/eotimeseriesviewer/externals/qps/make/updateexternals.py
+++ b/eotimeseriesviewer/externals/qps/make/updateexternals.py
@@ -167,7 +167,7 @@ def updateRemoteLocations(locationsToUpdate:list):
for id in locationsToUpdate:
assert isinstance(id, str)
- assert id in REMOTEINFOS.keys()
+ assert id in REMOTEINFOS.keys(), 'Unknown remote location key "{}"'.format(id)
# check existing remotes
print('Remotes:')
diff --git a/eotimeseriesviewer/externals/qps/maptools.py b/eotimeseriesviewer/externals/qps/maptools.py
index be1c7e1d9addb26a1f2532f2c2e74730a4c71b54..326f32d3f9252544240add5170044ac3ef26dbcb 100644
--- a/eotimeseriesviewer/externals/qps/maptools.py
+++ b/eotimeseriesviewer/externals/qps/maptools.py
@@ -292,7 +292,7 @@ class PixelScaleExtentMapTool(QgsMapTool):
"""
def __init__(self, canvas):
super(PixelScaleExtentMapTool, self).__init__(canvas)
- #see defintion getThemePixmap(const QString &):QPixmap in qgsapplication.cpp
+
self.mCursor = createCursor(':/qps/ui/icons/cursor_zoom_pixelscale.svg')
self.setCursor(self.mCursor)
canvas.setCursor(self.mCursor)
@@ -363,7 +363,7 @@ class SpatialExtentMapTool(QgsMapToolEmitPoint):
sigSpatialExtentSelected = pyqtSignal(SpatialExtent)
def __init__(self, canvas:QgsMapCanvas):
- QgsMapToolEmitPoint.__init__(self, self.canvas)
+ super(SpatialExtentMapTool, self).__init__(canvas)
self.isEmittingPoint = False
self.rubberBand = QgsRubberBand(self.canvas(), QgsWkbTypes.PolygonGeometry)
self.setStyle(Qt.red, 1)
@@ -402,7 +402,7 @@ class SpatialExtentMapTool(QgsMapToolEmitPoint):
if crs is not None and rect is not None:
extent = SpatialExtent(crs, rect)
- self.rectangleDrawed.emit(extent)
+ self.sigSpatialExtentSelected.emit(extent)
def canvasMoveEvent(self, e):
diff --git a/eotimeseriesviewer/externals/qps/plotstyling/plotstylewidget.ui b/eotimeseriesviewer/externals/qps/plotstyling/plotstylewidget.ui
index f0fc7ebcf4b7e0ade832a104a4055075bc99a10c..1ad4f2f3b3d2d6ca38904c11a17b41904dec7d5c 100644
--- a/eotimeseriesviewer/externals/qps/plotstyling/plotstylewidget.ui
+++ b/eotimeseriesviewer/externals/qps/plotstyling/plotstylewidget.ui
@@ -6,14 +6,29 @@
<rect>
<x>0</x>
<y>0</y>
- <width>305</width>
- <height>204</height>
+ <width>249</width>
+ <height>146</height>
</rect>
</property>
<property name="windowTitle">
<string>Form</string>
</property>
<layout class="QGridLayout" name="gridLayout">
+ <property name="leftMargin">
+ <number>2</number>
+ </property>
+ <property name="topMargin">
+ <number>2</number>
+ </property>
+ <property name="rightMargin">
+ <number>2</number>
+ </property>
+ <property name="bottomMargin">
+ <number>2</number>
+ </property>
+ <property name="spacing">
+ <number>2</number>
+ </property>
<item row="3" column="3">
<widget class="QSpinBox" name="sbLinePenWidth">
<property name="enabled">
@@ -121,10 +136,10 @@
<height>16777215</height>
</size>
</property>
- <property name="colorDialogTitle">
+ <property name="colorDialogTitle" stdset="0">
<string>Select Map Canvas Background Color</string>
</property>
- <property name="color">
+ <property name="color" stdset="0">
<color>
<red>255</red>
<green>0</green>
@@ -166,10 +181,10 @@
<height>16777215</height>
</size>
</property>
- <property name="colorDialogTitle">
+ <property name="colorDialogTitle" stdset="0">
<string>Select Map Canvas Background Color</string>
</property>
- <property name="color">
+ <property name="color" stdset="0">
<color>
<red>255</red>
<green>0</green>
@@ -189,10 +204,10 @@
<height>16777215</height>
</size>
</property>
- <property name="colorDialogTitle">
+ <property name="colorDialogTitle" stdset="0">
<string>Select Map Canvas Background Color</string>
</property>
- <property name="color">
+ <property name="color" stdset="0">
<color>
<red>255</red>
<green>0</green>
@@ -225,7 +240,14 @@
</widget>
</item>
<item row="4" column="1" rowspan="4" colspan="3">
- <widget class="PlotWidget" name="plotWidget"/>
+ <widget class="PlotWidget" name="plotWidget">
+ <property name="sizePolicy">
+ <sizepolicy hsizetype="Preferred" vsizetype="Preferred">
+ <horstretch>0</horstretch>
+ <verstretch>0</verstretch>
+ </sizepolicy>
+ </property>
+ </widget>
</item>
<item row="4" column="0">
<widget class="QCheckBox" name="cbIsVisible">
diff --git a/eotimeseriesviewer/externals/qps/plotstyling/plotstyling.py b/eotimeseriesviewer/externals/qps/plotstyling/plotstyling.py
index 47a48624eb0a03d9dcc6b1deade158a6a74f701c..546268f00fde13ba92c03cf3bd2b44db786be841 100644
--- a/eotimeseriesviewer/externals/qps/plotstyling/plotstyling.py
+++ b/eotimeseriesviewer/externals/qps/plotstyling/plotstyling.py
@@ -21,7 +21,11 @@
# noinspection PyPep8Naming
import os, json, sys
+
+from qgis.PyQt.QtGui import *
+from qgis.PyQt.QtCore import *
from ..externals.pyqtgraph.graphicsItems.ScatterPlotItem import drawSymbol
+from ..externals.pyqtgraph.graphicsItems.PlotDataItem import PlotDataItem
from ..utils import *
from ..models import OptionListModel, Option, currentComboBoxValue, setCurrentComboBoxValue
from ..externals import pyqtgraph as pg
@@ -191,9 +195,26 @@ class PlotStyle(QObject):
"""
sigUpdated = pyqtSignal()
+ @staticmethod
+ def fromPlotDataItem( pdi:PlotDataItem):
+
+ ps = PlotStyle()
+ linePen = pg.mkPen(pdi.opts['pen'])
+
+ ps.linePen = linePen
+ ps.markerSymbol = pdi.opts['symbol']
+ ps.markerBrush = pg.mkBrush(pdi.opts['symbolBrush'])
+ ps.markerSize = pdi.opts['symbolSize']
+ ps.markerPen = pg.mkPen(pdi.opts['symbolPen'])
+ ps.mIsVisible = pdi.isVisible()
+
+ return ps
+
+
def __init__(self, **kwds):
plotStyle = kwds.get('plotStyle')
- if plotStyle: kwds.pop('plotStyle')
+ if plotStyle:
+ kwds.pop('plotStyle')
super(PlotStyle, self).__init__()
self.markerSymbol = MARKERSYMBOLS[0].mValue
@@ -221,6 +242,38 @@ class PlotStyle(QObject):
if plotStyle:
self.copyFrom(plotStyle)
+ def lineWidth(self)->int:
+ return self.linePen.width()
+
+ def setLineWidth(self, width:int):
+ self.linePen.setWidth(width)
+
+ def lineColor(self)->QColor:
+ return self.linePen.color()
+
+ def setLineColor(self, color:QColor):
+ if not isinstance(color, QColor):
+ color = QColor(color)
+ self.linePen.setColor(color)
+
+ def apply(self, pdi:PlotDataItem, updateItem:bool=True):
+
+ assert isinstance(pdi, PlotDataItem)
+
+ pdi.opts['pen'] = pg.mkPen(self.linePen)
+ pdi.opts['symbol'] = self.markerSymbol
+ pdi.opts['symbolPen'] = pg.mkPen(self.markerPen)
+ pdi.opts['symbolBrush'] = pg.mkBrush(self.markerBrush)
+ pdi.opts['symbolSize'] = self.markerSize
+
+ pdi.setVisible(self.mIsVisible)
+ if updateItem:
+ pdi.updateItems()
+
+
+
+
+
@staticmethod
def fromJSON(jsonString: str):
"""
@@ -312,6 +365,14 @@ class PlotStyle(QObject):
"""
return self.mIsVisible
+ def __copy__(self):
+ style = PlotStyle()
+ style.copyFrom(self)
+ return style
+
+ def clone(self):
+ return copy.copy(self)
+
def copyFrom(self, plotStyle):
"""
Copy plot settings from another plot style
@@ -434,7 +495,7 @@ class PlotStyle(QObject):
class PlotStyleWidget(QWidget, loadUI('plotstylewidget.ui')):
sigPlotStyleChanged = pyqtSignal(PlotStyle)
- def __init__(self, title='<#>', parent=None, x=None, y=None):
+ def __init__(self, title='<#>', parent=None, x=None, y=None, plotStyle:PlotStyle=PlotStyle()):
super(PlotStyleWidget, self).__init__(parent)
self.setupUi(self)
assert isinstance(self.plotWidget, pg.PlotWidget)
@@ -487,7 +548,7 @@ class PlotStyleWidget(QWidget, loadUI('plotstylewidget.ui')):
self.sbLinePenWidth.valueChanged.connect(self.refreshPreview)
self.mLastPlotStyle = None
self.cbIsVisible.toggled.connect(self.refreshPreview)
- self.setPlotStyle(PlotStyle())
+ self.setPlotStyle(plotStyle)
self.refreshPreview()
def toggleWidgetEnabled(self, cb: QComboBox, widgets: list):
@@ -502,6 +563,16 @@ class PlotStyleWidget(QWidget, loadUI('plotstylewidget.ui')):
assert isinstance(w, QWidget)
w.setEnabled(enabled)
+ def setPreviewVisible(self, b:bool):
+ """
+ Sets the visibility of the preview window.
+ :param b:
+ :type b:
+ """
+ assert isinstance(b, bool)
+ self.plotWidget.setVisible(b)
+
+
def refreshPreview(self, *args):
if not self.mBlockUpdates:
# log(': REFRESH NOW')
@@ -570,7 +641,7 @@ class PlotStyleWidget(QWidget, loadUI('plotstylewidget.ui')):
style.markerBrush.setColor(self.btnMarkerBrushColor.color())
- # style.linePen = pg.mkPen(color=self.btnLinePenColor.color(),
+ # style.linePen = pg.mkPen(plotStyle=self.btnLinePenColor.plotStyle(),
# width=self.sbLinePenWidth.value(),
# style=currentComboBoxValue(self.cbLinePenStyle))
style.linePen.setColor(self.btnLinePenColor.color())
diff --git a/eotimeseriesviewer/externals/qps/setup.py b/eotimeseriesviewer/externals/qps/setup.py
new file mode 100644
index 0000000000000000000000000000000000000000..d92bb6e0fa077fb9c336f1e095caf00fb3f9799c
--- /dev/null
+++ b/eotimeseriesviewer/externals/qps/setup.py
@@ -0,0 +1,26 @@
+import os, sys
+
+DIR_QGIS_REPO = os.environ.get('DIR_QGIS_REPO')
+
+def compileQPSResources():
+ pathQPSDir = os.path.dirname(__file__)
+ pathQPSRoot = os.path.dirname(pathQPSDir)
+
+ addSysPath = pathQPSRoot not in sys.path
+ if addSysPath:
+ sys.path.append(pathQPSRoot)
+
+ from qps.make.make import searchAndCompileResourceFiles, compileQGISResourceFiles
+ searchAndCompileResourceFiles(pathQPSDir)
+ if os.path.isdir(DIR_QGIS_REPO):
+ compileQGISResourceFiles(DIR_QGIS_REPO, None)
+
+ if addSysPath:
+ sys.path.remove(pathQPSRoot)
+
+
+
+if __name__ == "__main__":
+ compileQPSResources()
+
+
diff --git a/eotimeseriesviewer/externals/qps/speclib/__init__.py b/eotimeseriesviewer/externals/qps/speclib/__init__.py
index 234fbe77f70e5a796e2fadb684118375046dd0db..c13481683ab1032396601f75910f5430c2eaaec6 100644
--- a/eotimeseriesviewer/externals/qps/speclib/__init__.py
+++ b/eotimeseriesviewer/externals/qps/speclib/__init__.py
@@ -27,11 +27,22 @@
* *
***************************************************************************
"""
-import sys
+import sys, enum
from qgis.core import *
from qgis.gui import *
+
from qgis.PyQt.QtCore import QSettings
+class SpectralLibrarySettingsKey(enum.Enum):
+ CURRENT_PROFILE_STYLE = 1
+ DEFAULT_PROFILE_STYLE = 2
+ BACKGROUND_COLOR = 3
+ FOREGROUND_COLOR = 4
+ INFO_COLOR = 5
+ USE_VECTOR_RENDER_COLORS = 6
+
+
+
def speclibSettings()->QSettings:
"""
diff --git a/eotimeseriesviewer/externals/qps/speclib/artmo.py b/eotimeseriesviewer/externals/qps/speclib/artmo.py
new file mode 100644
index 0000000000000000000000000000000000000000..c037f50f2f77896b08aee58e4489fed555c4fe72
--- /dev/null
+++ b/eotimeseriesviewer/externals/qps/speclib/artmo.py
@@ -0,0 +1,136 @@
+
+import os, sys, re, pathlib, json, io, re, linecache, collections
+from qgis.PyQt.QtCore import *
+from qgis.PyQt.QtGui import *
+from qgis.PyQt.QtWidgets import *
+import csv as pycsv
+from .spectrallibraries import SpectralProfile, SpectralLibrary, AbstractSpectralLibraryIO, FIELD_FID, FIELD_VALUES, FIELD_NAME, findTypeFromString, createQgsField
+
+class ARTMOSpectralLibraryIO(AbstractSpectralLibraryIO):
+ """
+ I/O Interface for ARTMO CSV profile outputs.
+ See https://artmotoolbox.com/tools.html for details.
+ """
+ @staticmethod
+ def canRead(path:str):
+ """
+ Returns true if it can read the source defined by path
+ :param path: source uri
+ :return: True, if source is readable.
+ """
+ if not isinstance(path, str) and os.path.isfile(path):
+ return False
+
+ # check if an _meta.txt exists
+ pathMeta = os.path.splitext(path)[0] + '_meta.txt'
+ if not os.path.isfile(pathMeta):
+ return False
+
+ with open(pathMeta, 'r', encoding='utf-8') as f:
+ for line in f:
+ if re.search(r'Line 1, Column \d \.{3} end:', line, re.I):
+ return True
+
+ return False
+
+ @staticmethod
+ def readFrom(path, progressDialog:QProgressDialog=None)->SpectralLibrary:
+ """
+ Returns the SpectralLibrary read from "path"
+ :param path: source of SpectralLibrary
+ :return: SpectralLibrary
+ """
+ delimiter = ','
+ xUnit = 'nm'
+ bn = os.path.basename(path)
+
+ pathMeta = os.path.splitext(path)[0]+'_meta.txt'
+
+ assert os.path.isfile(path)
+ assert os.path.isfile(pathMeta)
+
+
+ with open(pathMeta, 'r', encoding='utf-8') as f:
+
+ meta = f.read()
+
+ header = re.search(r'Line (\d+).*Column (\d+) ... end: Wavelength', meta)
+ firstLine = int(header.group(1)) - 1
+ firstXValueColumn = int(header.group(2)) - 1
+
+ COLUMNS = collections.OrderedDict()
+ for c, name in re.findall(r'Column (\d+): ([^\t]+)', meta):
+ COLUMNS[int(c)-1] = name
+
+
+
+ speclib = SpectralLibrary()
+ speclib.startEditing()
+
+ for name in COLUMNS.values():
+ speclib.addAttribute(createQgsField(name, 1.0))
+ speclib.commitChanges()
+
+
+ profiles = []
+
+ with open(path, 'r', encoding='utf-8') as f:
+ for iLine, line in enumerate(f.readlines()):
+
+ if len(line) == 0:
+ continue
+
+ parts = line.split(delimiter)
+ if iLine == firstLine:
+ # read the header data
+
+ xValues = [float(v) for v in parts[firstXValueColumn:]]
+ elif iLine > firstLine:
+
+
+ yValues = [float(v) for v in parts[firstXValueColumn:]]
+ profile = SpectralProfile(fields=speclib.fields())
+
+ name = None
+ if name is None:
+ name = '{}:{}'.format(bn, len(profiles) +1)
+
+ profile.setName(name)
+
+ for iCol, name in COLUMNS.items():
+ profile.setAttribute(name, float(parts[iCol]))
+
+ profile.setValues(x=xValues, y=yValues, xUnit=xUnit)
+ profiles.append(profile)
+
+
+
+
+
+ speclib.startEditing()
+ speclib.addProfiles(profiles)
+ speclib.commitChanges()
+ return speclib
+
+
+ @staticmethod
+ def addImportActions(spectralLibrary: SpectralLibrary, menu: QMenu) -> list:
+
+ def read(speclib: SpectralLibrary):
+
+ path, filter = QFileDialog.getOpenFileName(caption='ARTMO CSV File',
+ filter='All type (*.*);;Text files (*.txt);; CSV (*.csv)')
+ if os.path.isfile(path):
+
+ sl = ARTMOSpectralLibraryIO.readFrom(path)
+ if isinstance(sl, SpectralLibrary):
+ speclib.startEditing()
+ speclib.beginEditCommand('Add ARTMO profiles from {}'.format(path))
+ speclib.addSpeclib(sl, True)
+ speclib.endEditCommand()
+ speclib.commitChanges()
+
+ m = menu.addAction('ARTMO')
+ m.setToolTip('Adds profiles from an ARTMO csv text file.')
+ m.triggered.connect(lambda *args, sl=spectralLibrary: read(sl))
+
diff --git a/eotimeseriesviewer/externals/qps/speclib/asd.py b/eotimeseriesviewer/externals/qps/speclib/asd.py
index b8d7ef8175ab50aa3bc9c8098fc373ece4f832a1..2c2f6f004a3c8ba9f1a16a96ec33ce0288281ad9 100644
--- a/eotimeseriesviewer/externals/qps/speclib/asd.py
+++ b/eotimeseriesviewer/externals/qps/speclib/asd.py
@@ -5,25 +5,498 @@
asd.py
Reading Spectral Profiles from ASD data
---------------------
- Date : Okt 2018
- Copyright : (C) 2018 by Benjamin Jakimow
+ Date : Aug 2019
+ Copyright : (C) 2019 by Benjamin Jakimow
Email : benjamin.jakimow@geo.hu-berlin.de
-***************************************************************************
-* *
-* This file is part of the EnMAP-Box. *
-* *
-* The EnMAP-Box is free software; you can redistribute it and/or modify *
-* it under the terms of the GNU General Public License as published by *
-* the Free Software Foundation; either version 3 of the License, or *
-* (at your option) any later version. *
-* *
-* The EnMAP-Box is distributed in the hope that it will be useful, *
-* but WITHOUT ANY WARRANTY; without even the implied warranty of *
-* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the *
-* GNU General Public License for more details. *
-* *
-* You should have received a copy of the GNU General Public License *
-* along with the EnMAP-Box. If not, see <http://www.gnu.org/licenses/>. *
-* *
-***************************************************************************
-"""
\ No newline at end of file
+"""
+
+import os, sys, re, pathlib, json, enum, struct, time, datetime, typing, collections
+import numpy as np
+import csv as pycsv
+from .spectrallibraries import *
+
+
+"""
+
+Offset Size Type Description Comment
+3 char co[3]; // File Version - as6
+3 157 char comments[157]; // comment field
+160 18 struct tm when; // time when spectrum was saved
+178 1 byte program_version; // ver. of the programcreatinf this file.
+// major ver in upper nibble, min in lower
+179 1 byte file_version; // spectrum file format version
+180 1 byte itime; // Not used after v2.00
+181 1 byte dc_corr; // 1 if DC subtracted, 0 if not
+182 4 time_t (==long) dc_time; // Time of last dc, seconds since 1/1/1970
+186 1 byte data_type; // see *_TYPE below
+187 4 time_t (==long) ref_time; // Time of last wr, seconds since 1/1/1970
+191 4 float ch1_wavel; // calibrated starting wavelength in nm
+195 4 float wavel_step; // calibrated wavelength step in nm
+199 1 byte data_format; // format of spectrum.
+200 1 byte old_dc_count; // Num of DC measurements in the avg
+201 1 byte old_ref_count; // Num of WR in the average
+202 1 byte old_sample_count; // Num of spec samples in the avg
+203 1 byte application; // Which application created APP_DATA
+204 2 ushort channels; // Num of channels in the detector
+206 128 APP_DATA app_data; // Application-specific data
+334 56 GPS_DATA gps_data; // GPS position, course, etc.
+390 4 ulong it; // The actual integration time in ms
+394 2 int fo; // The fo attachment's view in degrees
+396 2 int dcc; // The dark current correction value
+398 2 uint calibration; // calibration series
+400 2 uint instrument_num; // instrument number
+402 4 float ymin; // setting of the y axis' min value
+406 4 float ymax; // setting of the y axis' max value
+410 4 float xmin; // setting of the x axis' min value
+414 4 float xmax; // setting of the x axis' max value
+418 2 uint ip_numbits; // instrument's dynamic range
+420 1 byte xmode; // x axis mode. See *_XMODE
+421 4 byte flags[4]; // flags(0) = AVGFIX'ed
+// flags(1) see below
+425 2 unsigned dc_count; // Num of DC measurements in the avg
+427 2 unsigned ref_count; // Num of WR in the average
+429 2 unsigned sample_count; // Num of spec samples in the avg
+431 1 byte instrument; // Instrument type. See defs below
+432 4 ulong bulb; // The id number of the cal bulb
+436 2 uint swir1_gain; // gain setting for swir 1
+438 2 uint swir2_gain; // gain setting for swir 2
+440 2 uint swir1_offset; // offset setting for swir 1
+442 2 uint swir2_offset; // offset setting for swir 2
+444 4 float splice1_wavelength; // wavelength of VNIR and SWIR1 splice
+448 4 float splice2_wavelength; // wavelength of SWIR1 and SWIR2 splice
+452 27 float SmartDetectorType // Data from OL731 device
+479 5 byte spare[5]; // fill to 484 bytes
+"""
+
+ASD_VERSIONS = ['ASD', 'asd', 'as6', 'as7', 'as8']
+
+
+class SpectrumDataType(enum.IntEnum):
+
+ RAW_TYPE = 0
+ REF_TYPE = 1
+ RAD_TYPE = 2
+ NOUNITS_TYPE = 3
+ IRRAD_TYPE = 4
+ QI_TYPE = 5
+ TRANS_TYPE = 6
+ UNKNOWN_TYPE = 7
+ ABS_TYPE = 8
+
+
+
+class SpectrumDataFormat(enum.Enum):
+
+ FLOAT_FORMAT = 0
+ INTEGER_FORMAT = 1
+ DOUBLE_FORMAT = 2
+ UNKOWN_FORMAT = 3
+
+class InstrumentType(enum.Enum):
+
+ UNKOWN_INSTRUMENT = 0
+ PSII_INSTRUMENT = 1
+ LSVNIR_INSTRUMENT = 2
+ FSVNIR_INSTRUMENT = 3
+ FSFR_INSTRUMENT = 4
+ FSNIR_INSTRUMENT = 5
+ CHEM__INSTRUMENT = 6
+ FSFR_UNATTENDED_INSTRUMENT = 7
+
+class GPS_DATA(object):
+
+ def __init__(self, DATA):
+ ASD_GPS_DATA = struct.Struct("= 5d 2b cl 2b 5B 2c").unpack(DATA)
+
+
+ self.true_heading = self.speed = self.latitude = self.longitude = self.altitude = ASD_GPS_DATA[0:5]
+ self.flags = ASD_GPS_DATA[5:7]
+ self.hardware_mode = ASD_GPS_DATA[7]
+ self.timestamp = np.datetime64('1970-01-01') + np.timedelta64(ASD_GPS_DATA[8],'s')
+
+class SmartDetectorType(object):
+
+ def __init__(self, DATA):
+ """
+
+ :param DATA:
+ """
+ # 27 byte struct
+ # 1 i int 4 4
+ # 3 f float 12 16
+ # 1 h short 2 18
+ # 1 b byte 1 19
+ # 2 f float 8 27
+
+ if DATA is not None:
+ DETECTOR = struct.Struct('= 1i 3f 1h 1b 2f').unpack(DATA)
+ else:
+ DETECTOR = [None, None, None, None, None, None, None, None]
+ self.serial_number, self.Signal, self.dark, self.ref, self.Status, self.avg, self.humid, self.temp = DETECTOR
+
+
+
+
+class TM_STRUCT(object):
+
+ def __init__(self, DATA):
+ self.tm_sec, self.tm_min, self.tm_hour, self.tm_mday, \
+ self.tm_mon, self.tm_year, self.tm_wday, \
+ self.tm_yday, self.tm_isdst = struct.Struct("= 9h").unpack(DATA)
+
+ def date(self):
+ return datetime.date(self.year(), self.month(), self.day())
+
+ def datetime(self):
+ return datetime.datetime(self.year(), self.month(), self.day(), hour=self.tm_hour, minute=self.tm_min, second=self.tm_sec)
+
+ def time(self):
+ return datetime.time(hour=self.tm_hour, minute=self.tm_min, second=self.tm_sec)
+
+ def datetime64(self)->np.datetime64:
+ return np.datetime64('{:04}-{:02}-{:02}T{:02}:{:02}:{:02}'.format(self.year(), self.month(), self.day(), self.tm_hour, self.tm_min, self.tm_sec))
+
+ def doy(self)->int:
+ return self.tm_yday
+
+ def day(self)->int:
+ return self.tm_mday
+
+ def month(self)->int:
+ return self.tm_mon + 1
+
+ def year(self)->int:
+ return self.tm_year + 1900
+
+
+class ASDBinaryFile(object):
+ """
+ Wrapper class to access a ASD File Format binary file.
+ See ASD File Format, version 8, revision B, ASD Inc., a PANalytical company, 2555 55th Street, Suite 100 Boulder, CO 80301.
+ """
+
+
+ def __init__(self):
+ super(ASDBinaryFile, self).__init__()
+
+ # initialize all variables in the ASD Binary file header
+ self.co = None
+ self.comments = None
+ self.when = None
+ self.program_version = None
+ self.file_version = None
+ self.itime = None
+ self.dc_corr = None
+ self.dc_time = None
+ self.data_type = None
+ self.ref_time = None
+ self.ch1_wavel = None
+ self.wavel_step = None
+ self.data_format = None
+ self.old_dc_count = None
+ self.old_ref_count = None
+ self.old_sample_count = None
+ self.application = None
+ self.channels = None
+ self.app_data = None
+ self.gps_data = None
+ self.it = None
+ self.fo = None
+ self.dcc = None
+ self.calibration = None
+ self.instrument_num = None
+ self.ymin = None
+ self.ymax = None
+ self.xmin = None
+ self.ymax = None
+ self.ip_numbits = None
+ self.xmode = None
+ self.flags = None
+ self.dc_count = None
+ self.ref_count = None
+ self.sample_count = None
+ self.instrument = None
+ self.bulb = None
+ self.swir1_gain = None
+ self.swir2_gain = None
+ self.swir1_offset = None
+ self.swir2_offset = None
+ self.splice1_wavelength = None
+ self.splice2_wavelength = None
+ self.SmartDetectorType = None
+ self.spare = None
+
+
+ self.Spectrum = None
+ self.ReferenceFlag = None
+ self.ReferenceTime = None
+ self.SpectrumTime = None
+ self.SpectrumDescription = None
+ self.Reference = None
+
+
+ def xValues(self)->np.ndarray:
+ values = np.linspace(self.ch1_wavel, self.ch1_wavel + self.channels * self.wavel_step - 1, self.channels)
+ return values
+
+
+ def yValues(self)->np.ndarray:
+ return self.Spectrum
+
+
+ def readFromBinaryFile(self, path: str):
+ with open(path, 'rb') as f:
+
+ DATA = f.read()
+
+ def sub(start, len):
+ return DATA[start:start + len]
+
+
+ self.co = DATA[0:3].decode('utf-8')
+ self.comments = DATA[3:(3 + 157)].decode('utf-8')
+
+ self.when = TM_STRUCT(DATA[160:(160 + 18)])
+ self.program_version = DATA[178]
+ self.file_version = DATA[179]
+ self.itime = DATA[180]
+ self.dc_corr = DATA[181]
+ self.dc_time = np.datetime64('1970-01-01') + np.timedelta64(struct.unpack('l', DATA[182:182 + 4])[0], 's')
+ self.data_type = SpectrumDataType(DATA[186])
+ self.ref_time = np.datetime64('1970-01-01') + np.timedelta64(struct.unpack('l', DATA[182:182 + 4])[0], 's')
+ self.ch1_wavel = struct.unpack('f', sub(191, 4))[0]
+ self.wavel_step = struct.unpack('f', sub(195, 4))[0]
+ self.data_format = SpectrumDataFormat(DATA[199])
+ self.old_dc_count = DATA[200]
+ self.old_ref_count = DATA[201]
+ self.old_sample_count = DATA[202]
+ self.application = DATA[203]
+
+ self.channels = struct.unpack('H', sub(204, 2))[0]
+
+ self.app_data = sub(206, 128)
+ self.gps_data = GPS_DATA(sub(334, 56))
+
+ self.it = struct.unpack('L', sub(390, 4))[0]
+ self.fo = struct.unpack('h', sub(394, 2))[0]
+ self.dcc = struct.unpack('h', sub(396, 2))[0]
+
+ self.calibration = struct.unpack('H', sub(398, 2))[0]
+ self.instrument_num = struct.unpack('H', sub(400, 2))[0]
+
+ self.ymin, self.ymax, self.xmin, self.ymax = struct.unpack('4f', sub(402, 4 * 4))
+
+ self.ip_numbits = struct.unpack('H', sub(418, 2))[0]
+ self.xmode = struct.unpack('b', sub(420, 1))[0]
+ self.flags = struct.unpack('4b', sub(421, 4))
+
+ self.dc_count, self.ref_count, self.sample_count = struct.unpack('3H', sub(425, 2 * 3))
+
+ self.instrument = sub(431, 1)
+ self.bulb = struct.unpack('L', sub(432, 4))
+ self.swir1_gain, self.swir2_gain, self.swir1_offset, self.swir2_offset = struct.unpack('4H', sub(436, 2 * 4))
+
+ self.splice1_wavelength, self.splice2_wavelength = struct.unpack('2f', sub(444, 2 * 4))
+
+ self.SmartDetectorType = SmartDetectorType(sub(452, 27))
+ self.spare = sub(479, 5)
+
+ if self.data_format == SpectrumDataFormat.FLOAT_FORMAT:
+ size = 4 * self.channels
+ fmt = '{}f'.format(self.channels)
+
+ elif self.data_format == SpectrumDataFormat.DOUBLE_FORMAT:
+ size = 8 * self.channels
+ fmt = '{}d'.format(self.channels)
+ elif self.data_format == SpectrumDataFormat.INTEGER_FORMAT:
+ size = 4 * self.channels
+ fmt = '{}i'.format(self.channels)
+ else:
+ raise Exception()
+
+ self.Spectrum = np.array(struct.unpack(fmt, sub(484, size)))
+
+ return self
+
+
+class ASDSpectralLibraryIO(AbstractSpectralLibraryIO):
+
+
+ @staticmethod
+ def addImportActions(spectralLibrary: SpectralLibrary, menu: QMenu) -> list:
+
+ def read(speclib: SpectralLibrary):
+
+ pathes, filter = QFileDialog.getOpenFileNames(caption='ASD FilesCSV File',
+ filter='All type (*.*);;Text files (*.txt);; CSV (*.csv);;ASD (*.asd)')
+
+ if len(pathes) > 0:
+ sl = ASDSpectralLibraryIO.readFrom(pathes)
+ if isinstance(sl, SpectralLibrary):
+ speclib.startEditing()
+ speclib.beginEditCommand('Add ASD profiles')
+ speclib.addSpeclib(sl, True)
+ speclib.endEditCommand()
+ speclib.commitChanges()
+
+ a = menu.addAction('ASD')
+ a.setToolTip('Loads ASD FieldSpec files (binary or text)')
+ a.triggered.connect(lambda *args, sl=spectralLibrary: read(sl))
+
+
+ @staticmethod
+ def canRead(path, binary:bool=None)->bool:
+ """
+ Returns true if it can read the source defined by path
+ :param path: source uri
+ :return: True, if source is readable.
+ """
+ if not os.path.isfile(path):
+ return False
+
+
+ if isinstance(binary, bool):
+ if binary:
+ st = os.stat(path)
+
+ if st.st_size < 484 + 1 or st.st_size > 2 ** 20:
+ return False
+
+ with open(path, 'rb') as f:
+ DATA = f.read(3)
+ co = DATA[0:3].decode('utf-8')
+ if co not in ASD_VERSIONS:
+ return False
+ else:
+ return True
+
+ return False
+ else:
+ try:
+ with open(path, 'r', encoding='utf-8') as f:
+ lines = []
+ for line in f:
+ if len(lines) >= 2:
+ break
+ line = line.strip()
+ if len(line) > 0:
+ lines.append(line)
+
+ if len(lines) == 2:
+ return re.search(r'^wavelength[;]', lines[0], re.I) is not None \
+ and re.search(r'^\d+(\.\d+)?[;]', lines[1]) is not None
+
+ return False
+ except Exception as ex:
+ return False
+
+ else:
+ if ASDSpectralLibraryIO.canRead(path, binary=True):
+ return True
+ else:
+ return ASDSpectralLibraryIO.canRead(path, binary=False)
+
+
+
+ @staticmethod
+ def readFrom(pathes:typing.Union[str, list], asdFields:typing.Iterable[str] = None, progressDialog:QProgressDialog=None)->SpectralLibrary:
+ """
+ :param pathes: list of source paths
+ :param asdFields: list of header information to be extracted from ASD binary files
+ :return: SpectralLibrary
+ """
+ if asdFields is None:
+ #default fields to add as meta data
+ asdFields = ['when', 'ref_time', 'dc_time', 'dc_corr', 'it', 'sample_count', 'instrument_num', 'spec_type']
+
+ if not isinstance(pathes, list):
+ pathes = [pathes]
+
+ sl = SpectralLibrary()
+
+ profiles = []
+ asddFieldsInitialized = False
+
+ for filePath in pathes:
+ bn = os.path.basename(filePath)
+
+ if ASDSpectralLibraryIO.canRead(filePath, binary=True):
+ asd = ASDBinaryFile().readFromBinaryFile(filePath)
+ if isinstance(asd, ASDBinaryFile):
+
+ if not asddFieldsInitialized:
+ sl.startEditing()
+
+ asdFields = [n for n in asdFields if n not in sl.fieldNames() and n in asd.__dict__.keys()]
+ for n in asdFields:
+ v = asd.__dict__[n]
+ if isinstance(v, TM_STRUCT):
+ sl.addAttribute(createQgsField(n, '')) # TM struct will use a VARCHAR field to express the time stamp
+ else:
+ sl.addAttribute(createQgsField(n, v))
+
+ asddFieldsInitialized = True
+ sl.commitChanges()
+ sl.startEditing()
+
+ p = SpectralProfile(fields=sl.fields())
+ p.setName(bn)
+
+ for n in asdFields:
+ value = asd.__dict__[n]
+ if isinstance(value, np.datetime64):
+ value = str(value)
+ elif isinstance(value, TM_STRUCT):
+ value = str(value.datetime64())
+ p.setAttribute(n, value)
+
+ p.setValues(asd.xValues(), asd.yValues(), xUnit='nm')
+ profiles.append(p)
+ elif ASDSpectralLibraryIO.canRead(filePath, binary=False):
+
+
+ with open(filePath, 'r', encoding='utf-8') as f:
+ profiles = []
+ lines = f.readlines()
+ delimiter = ';'
+ if len(lines) >= 2:
+
+ hdrLine = lines[0].strip().split(delimiter)
+ if len(hdrLine) >= 2:
+ profileNames = hdrLine[1:]
+
+ xValues = []
+ DATA = dict()
+ for line in lines[1:]:
+ line = line.split(delimiter)
+ wl = float(line[0])
+ xValues.append(wl)
+ DATA[wl] = [float(v) for v in line[1:]]
+
+ for i, name in enumerate(profileNames):
+
+ yValues = [DATA[wl][i] for wl in xValues]
+ xUnit = 'nm'
+ profile = SpectralProfile(fields=sl.fields())
+ profile.setName(name)
+ profile.setValues(x=xValues, y=yValues, xUnit=xUnit)
+
+ profiles.append(profile)
+ if len(profiles) > 0:
+ sl.startEditing()
+ sl.addProfiles(profiles)
+ profiles.clear()
+ sl.commitChanges()
+ sl.startEditing()
+
+
+ else:
+ print('Unable to read {}'.format(filePath), file=sys.stderr)
+
+ sl.startEditing()
+ sl.addProfiles(profiles, addMissingFields=False)
+ sl.commitChanges()
+ return sl
+
+
+
diff --git a/eotimeseriesviewer/externals/qps/speclib/clipboard.py b/eotimeseriesviewer/externals/qps/speclib/clipboard.py
index 1afe90218f90ca2181a15649adfafbe148a1f3f5..3aee1c76d931a02056c3e6308957947ba9330537 100644
--- a/eotimeseriesviewer/externals/qps/speclib/clipboard.py
+++ b/eotimeseriesviewer/externals/qps/speclib/clipboard.py
@@ -56,7 +56,7 @@ class ClipboardIO(AbstractSpectralLibraryIO):
return False
@staticmethod
- def readFrom(path=None):
+ def readFrom(path=None, progressDialog:QProgressDialog=None):
clipboard = QApplication.clipboard()
mimeData = clipboard.mimeData()
assert isinstance(mimeData, QMimeData)
@@ -70,7 +70,7 @@ class ClipboardIO(AbstractSpectralLibraryIO):
return SpectralLibrary()
@staticmethod
- def write(speclib, path=None, mode=None, sep=None, newline=None):
+ def write(speclib, path=None, mode=None, sep=None, newline=None, progressDialog:QProgressDialog):
if mode is None:
mode = ClipboardIO.WritingModes.ALL
assert isinstance(speclib, SpectralLibrary)
diff --git a/eotimeseriesviewer/externals/qps/speclib/csvdata.py b/eotimeseriesviewer/externals/qps/speclib/csvdata.py
index 2699ec52b8ef2ba4758e5f84ab9a4dd8d52f7c2e..48890687d5524d51ec75f09d1fd1fc5b393dd875 100644
--- a/eotimeseriesviewer/externals/qps/speclib/csvdata.py
+++ b/eotimeseriesviewer/externals/qps/speclib/csvdata.py
@@ -44,6 +44,40 @@ class CSVSpectralLibraryIO(AbstractSpectralLibraryIO):
REGEX_HEADERLINE = re.compile('^'+'[\t;,]'.join(STD_NAMES)+'\\t.*')
REGEX_BANDVALUE_COLUMN = re.compile(r'^(?P<bandprefix>\D+)?(?P<band>\d+)[ _]*(?P<xvalue>-?\d+\.?\d*)?[ _]*(?P<xunit>\D+)?', re.IGNORECASE)
+ @staticmethod
+ def addImportActions(spectralLibrary:SpectralLibrary, menu:QMenu)->list:
+
+ def read(speclib:SpectralLibrary, dialect):
+
+ path, ext = QFileDialog.getOpenFileName(caption='Import CSV File', filter='All type (*.*);;Text files (*.txt);; CSV (*.csv)')
+ if isinstance(path, str) and os.path.isfile(path):
+
+ sl = CSVSpectralLibraryIO.readFrom(path, dialect)
+ if isinstance(sl, SpectralLibrary):
+ speclib.addSpeclib(sl, True)
+ m = menu.addMenu('CSV')
+
+ a = m.addAction('Excel (TAB)')
+ a.setToolTip('Imports Spectral Profiles from a Excel CSV sheet.')
+ a.triggered.connect(lambda *args, sl=spectralLibrary: read(sl, pycsv.excel_tab))
+
+ a = m.addAction('Excel (,)')
+ a.setToolTip('Imports Spectral Profiles from a Excel CSV sheet.')
+ a.triggered.connect(lambda *args, sl=spectralLibrary: read(sl, pycsv.excel))
+
+ @staticmethod
+ def addExportActions(spectralLibrary: SpectralLibrary, menu: QMenu) -> list:
+
+ def write(speclib: SpectralLibrary):
+ path, filter = QFileDialog.getSaveFileName(caption='Write to CSV File',
+ filter='CSV (*.csv);;Text files (*.txt)')
+ if isinstance(path, str) and len(path) > 0:
+ CSVSpectralLibraryIO.write(spectralLibrary, path)
+
+
+ m = menu.addAction('CSV Table')
+ m.triggered.connect(lambda *args, sl=spectralLibrary: write(sl))
+
@staticmethod
def isHeaderLine(line: str) -> str:
"""
@@ -85,7 +119,7 @@ class CSVSpectralLibraryIO(AbstractSpectralLibraryIO):
@staticmethod
- def write(speclib, path, dialect=pycsv.excel_tab)->list:
+ def write(speclib, path, progressDialog:QProgressDialog=None, dialect=pycsv.excel_tab)->list:
"""
Writes the speclib into a CSv file
:param speclib: SpectralLibrary
@@ -102,7 +136,7 @@ class CSVSpectralLibraryIO(AbstractSpectralLibraryIO):
return [path]
@staticmethod
- def readFrom(path=None, dialect=pycsv.excel_tab):
+ def readFrom(path=None, progressDialog:QProgressDialog=None, dialect=pycsv.excel_tab):
f = open(path, 'r', encoding='utf-8')
text = f.read()
f.close()
diff --git a/eotimeseriesviewer/externals/qps/speclib/ecosis.py b/eotimeseriesviewer/externals/qps/speclib/ecosis.py
new file mode 100644
index 0000000000000000000000000000000000000000..821fd7984054035595da0a769ec0d8f0495f2740
--- /dev/null
+++ b/eotimeseriesviewer/externals/qps/speclib/ecosis.py
@@ -0,0 +1,249 @@
+
+import os, sys, re, pathlib, json, io, re, linecache
+from qgis.PyQt.QtCore import *
+from qgis.PyQt.QtGui import *
+from qgis.PyQt.QtWidgets import *
+from qgis.core import *
+
+
+import csv as pycsv
+from .spectrallibraries import SpectralProfile, SpectralLibrary, AbstractSpectralLibraryIO, FIELD_FID, FIELD_VALUES, FIELD_NAME, findTypeFromString, createQgsField
+
+class EcoSISCSVDialect(pycsv.Dialect):
+ delimiter = ','
+ quotechar = '"'
+ doublequote = True
+ skipinitialspace = False
+ lineterminator = '\n'
+ escapechar = '\\'
+ quoting = pycsv.QUOTE_NONE
+
+
+def findDialect(file)->pycsv.Dialect:
+
+ if isinstance(file, str):
+ file = open(file, 'r', encoding='utf-8')
+
+ line = ''
+ while len(line) == 0:
+ line = file.readline()
+
+
+ delimiters = [',', ';', '\t']
+ counts = [len(line.split(delimiter)) for delimiter in delimiters]
+
+
+ dialect = EcoSISCSVDialect()
+ dialect.delimiter = delimiters[counts.index(max(counts))]
+ dialect.lineterminator = '\n\r' if line.endswith('\n\r') else line[-1]
+
+ file.seek(0)
+ s = ""
+ return dialect
+
+class EcoSISSpectralLibraryIO(AbstractSpectralLibraryIO):
+ """
+ I/O Interface for the EcoSIS spectral library format.
+ See https://ecosis.org for details.
+ """
+ @staticmethod
+ def canRead(path:str):
+ """
+ Returns true if it can read the source defined by path
+ :param path: source uri
+ :return: True, if source is readable.
+ """
+ if not isinstance(path, str) and os.path.isfile(path):
+ return False
+ try:
+ with open(path, 'r', encoding='utf-8') as f:
+ for line in f:
+ line = f.readline().strip()
+ if len(line) > 0:
+ # most-right header name must be a number
+ lastColumn = [c for c in re.split(r'[\t\n;,]', line) if c != ''][-1]
+ return re.search(r'^\d+(\.\d+)?$', lastColumn) is not None
+ except Exception as ex:
+ print(ex, file=sys.stderr)
+
+ return False
+
+ @staticmethod
+ def readFrom(path, progressDialog:QProgressDialog=None)->SpectralLibrary:
+ """
+ Returns the SpectralLibrary read from "path"
+ :param path: source of SpectralLibrary
+ :return: SpectralLibrary
+ """
+
+ # the EcoSIS CSV outputs are encoded as UTF-8 with BOM
+ with open(path, 'r', encoding='utf-8-sig') as f:
+
+ bn = os.path.basename(path)
+
+ dialect = findDialect(f)
+
+ reader = pycsv.DictReader(f, dialect=dialect)
+ fieldnames = reader.fieldnames
+
+ if fieldnames[0].startswith('\ufeff'):
+ s = ""
+ fieldnames = [n for n in fieldnames if len(n) > 0]
+
+
+ xUnit = yUnit = None
+ xValueNames = []
+ for fieldName in reversed(fieldnames):
+ if re.search(r'^\d+(\.\d+)?$', fieldName):
+ xValueNames.insert(0, fieldName)
+ else:
+ break
+ s = ""
+ xValues = [float(n) for n in xValueNames]
+ if len(xValues) == 0:
+ s = ""
+ if xValues[0] > 200:
+ xUnit = 'nm'
+
+
+ fieldnames = [n for n in fieldnames if n not in xValueNames]
+
+ speclib = SpectralLibrary()
+ speclib.startEditing()
+
+ profiles = []
+ LUT_FIELD_TYPES = dict()
+ missing_field_definitions = [n for n in fieldnames if n not in speclib.fieldNames()]
+ for i, row in enumerate(reader):
+ if len(missing_field_definitions) > 0:
+ for fieldName in missing_field_definitions[:]:
+ fieldValue = row[fieldName]
+ if fieldValue == 'NA':
+ continue
+
+ fieldType = findTypeFromString(fieldValue)
+ LUT_FIELD_TYPES[fieldName] = fieldType
+
+ qgsField = createQgsField(fieldName, fieldType(fieldValue))
+ speclib.addAttribute(qgsField)
+ assert speclib.commitChanges()
+ speclib.startEditing()
+ missing_field_definitions.remove(fieldName)
+
+ profile = SpectralProfile(fields=speclib.fields())
+ yValues = [float(row[n]) for n in xValueNames]
+ profile.setValues(x=xValues, y=yValues, xUnit=xUnit, yUnit=yUnit)
+
+ for fieldName, fieldType in LUT_FIELD_TYPES.items():
+ fieldValue = fieldType(row[fieldName])
+ profile.setAttribute(fieldName, fieldValue)
+
+ if FIELD_NAME not in fieldnames:
+ profile.setName('{}:{}'.format(bn, i+1))
+ else:
+ profile.setName(row[FIELD_NAME])
+ profiles.append(profile)
+
+ speclib.addProfiles(profiles)
+
+
+ s = ""
+ s = ""
+ assert speclib.commitChanges()
+ return speclib
+
+ @staticmethod
+ def write(speclib:SpectralLibrary, path:str, progressDialog:QProgressDialog, delimiter:str=';'):
+ """
+ Writes the SpectralLibrary to path and returns a list of written files that can be used to open the spectral library with readFrom
+ """
+ assert isinstance(speclib, SpectralLibrary)
+ basePath, ext = os.path.splitext(path)
+ s = ""
+
+ writtenFiles = []
+ fieldNames = [n for n in speclib.fields().names() if n not in [FIELD_VALUES, FIELD_FID]]
+ groups = speclib.groupBySpectralProperties()
+ for i, grp in enumerate(groups.keys()):
+ # in-memory text buffer
+ stream = io.StringIO()
+ xValues, xUnit, yUnit = grp
+ profiles = groups[grp]
+ if i == 0:
+ path = basePath + ext
+ else:
+ path = basePath + '{}{}'.format(i+1, ext)
+
+
+ headerNames = fieldNames + [str(v) for v in xValues]
+ W = pycsv.DictWriter(stream, fieldnames=headerNames, dialect=EcoSISCSVDialect())
+ W.writeheader()
+
+ for profile in profiles:
+ assert isinstance(profile, SpectralProfile)
+
+ rowDict = dict()
+ for n in fieldNames:
+ v = profile.attribute(n)
+ if v in [None, QVariant(None), '']:
+ v = 'NA'
+ rowDict[n] = v
+
+ yValues = profile.yValues()
+ for i, xValue in enumerate(xValues):
+ rowDict[str(xValue)] = yValues[i]
+ W.writerow(rowDict)
+
+ stream.write('\n')
+ lines = stream.getvalue().replace('\r', '')
+
+ with open(path, 'w', encoding='utf-8') as f:
+ f.write(lines)
+ writtenFiles.append(path)
+
+ return writtenFiles
+
+ @staticmethod
+ def score(uri:str)->int:
+ """
+ Returns a score value for the give uri. E.g. 0 for unlikely/unknown, 20 for yes, probalby thats the file format the reader can read.
+
+ :param uri: str
+ :return: int
+ """
+ return 0
+
+ @staticmethod
+ def addImportActions(spectralLibrary: SpectralLibrary, menu: QMenu) -> list:
+
+ def read(speclib: SpectralLibrary):
+
+ path, filter = QFileDialog.getOpenFileName(caption='EcoSIS CSV File',
+ filter='All type (*.*);;Text files (*.txt);; CSV (*.csv)')
+ if os.path.isfile(path):
+
+ sl = EcoSISSpectralLibraryIO.readFrom(path)
+ if isinstance(sl, SpectralLibrary):
+ speclib.startEditing()
+ speclib.beginEditCommand('Add EcoSIS profiles from {}'.format(path))
+ speclib.addSpeclib(sl, True)
+ speclib.endEditCommand()
+ speclib.commitChanges()
+
+ m = menu.addAction('EcoSIS')
+ m.setToolTip('Adds profiles from an EcoSIS csv text file.')
+ m.triggered.connect(lambda *args, sl=spectralLibrary: read(sl))
+
+
+ @staticmethod
+ def addExportActions(spectralLibrary:SpectralLibrary, menu:QMenu) -> list:
+
+ def write(speclib: SpectralLibrary):
+
+ path, filter = QFileDialog.getSaveFileName(caption='Write to EcoSIS CSV File',
+ filter='EcoSIS CSV (*.csv);;Text files (*.txt)')
+ if isinstance(path, str) and len(path) > 0:
+ sl = EcoSISSpectralLibraryIO.write(spectralLibrary, path)
+
+ m = menu.addAction('EcoSIS CSV')
+ m.triggered.connect(lambda *args, sl=spectralLibrary: write(sl))
\ No newline at end of file
diff --git a/eotimeseriesviewer/externals/qps/speclib/ecosys.py b/eotimeseriesviewer/externals/qps/speclib/ecosys.py
deleted file mode 100644
index 7db403bf1327ff201df5b3f1759ea936cc96e74f..0000000000000000000000000000000000000000
--- a/eotimeseriesviewer/externals/qps/speclib/ecosys.py
+++ /dev/null
@@ -1,45 +0,0 @@
-
-import os, sys, re, pathlib, json
-import csv as pycsv
-from .spectrallibraries import *
-
-
-class EcoSYSSpectralLibraryIO(object):
- """
- I/O Interface for the EcoSYS spectral library format.
- See https://ecosis.org for details.
- """
- @staticmethod
- def canRead(path):
- """
- Returns true if it can read the source defined by path
- :param path: source uri
- :return: True, if source is readable.
- """
- return False
-
- @staticmethod
- def readFrom(path):
- """
- Returns the SpectralLibrary read from "path"
- :param path: source of SpectralLibrary
- :return: SpectralLibrary
- """
- return None
-
- @staticmethod
- def write(speclib, path):
- """Writes the SpectralLibrary to path and returns a list of written files that can be used to open the spectral library with readFrom"""
- assert isinstance(speclib, SpectralLibrary)
- return []
-
- @staticmethod
- def score(uri:str)->int:
- """
- Returns a score value for the give uri. E.g. 0 for unlikely/unknown, 20 for yes, probalby thats the file format the reader can read.
-
- :param uri: str
- :return: int
- """
- return 0
-
diff --git a/eotimeseriesviewer/externals/qps/speclib/envi.py b/eotimeseriesviewer/externals/qps/speclib/envi.py
index 7778802a3e9c147590189a37217804a23eedc799..6db4c96fffaba78646c0050e970206731c300d37 100644
--- a/eotimeseriesviewer/externals/qps/speclib/envi.py
+++ b/eotimeseriesviewer/externals/qps/speclib/envi.py
@@ -56,6 +56,7 @@ LUT_GDT_NAME = {gdal.GDT_Byte:'Byte',
gdal.GDT_CFloat32:'Float32',
gdal.GDT_CFloat64:'Float64'}
+FILTER_SLI = 'ENVI Spectral Library (*.sli)'
CSV_PROFILE_NAME_COLUMN_NAMES = ['spectra names', 'name']
CSV_GEOMETRY_COLUMN = 'wkt'
@@ -200,12 +201,13 @@ def readCSVMetadata(pathESL):
for i, row in enumerate(reader):
METADATA_LINES.append(tuple(row.values()))
- #set emtpy value to None
+ # set an emtpy value to None
def stripped(value:str):
if value is None:
return None
value = value.strip()
return None if len(value) == 0 else value
+
METADATA_LINES = [tuple([stripped(v) for v in row]) for row in METADATA_LINES]
@@ -213,30 +215,40 @@ def readCSVMetadata(pathESL):
QGSFIELD_PYTHON_TYPES = []
QGSFIELDS = QgsFields()
for i, fieldName in enumerate(fieldNames):
- fieldValues = [row[i] for row in METADATA_LINES if row[i] is not None]
- fieldTypes = [findTypeFromString(v) for v in fieldValues]
- if len(fieldTypes) == 0:
- fieldTypes = [str]
+ refValue = None
+ for lineValues in METADATA_LINES:
+
+ if lineValues[i] not in ['', None, 'NA']:
+ refValue = lineValues[i]
+ break
+ if refValue is None:
+ refValue = ''
+ fieldType = findTypeFromString(refValue)
- if str in fieldTypes:
- t = str
+ if fieldType is str:
a, b = QVariant.String, 'varchar'
- elif float in fieldTypes:
- t = float
+ elif fieldType is float:
a, b = QVariant.Double, 'double'
- elif int in fieldTypes:
- t = int
+ elif fieldType is int:
a, b = QVariant.Int, 'int'
else:
raise NotImplementedError()
- QGSFIELD_PYTHON_TYPES.append(t)
+
+ QGSFIELD_PYTHON_TYPES.append(fieldType)
QGSFIELDS.append(QgsField(fieldName, a, b))
+
# convert metadata string values to basic python type
def typeOrNone(value:str, t:type):
return value if value is None else t(value)
- METADATA_LINES = [tuple(typeOrNone(v, QGSFIELD_PYTHON_TYPES[i]) for i, v in enumerate(line)) for line in METADATA_LINES]
+
+ for i in range(len(METADATA_LINES)):
+ line = METADATA_LINES[i]
+ lineTuple = tuple(typeOrNone(cellValue, cellType) for cellValue, cellType in zip(line, QGSFIELD_PYTHON_TYPES))
+ METADATA_LINES[i] = lineTuple
+
+ #METADATA_LINES = [tuple(typeOrNone(v, QGSFIELD_PYTHON_TYPES[i]) for i, v in enumerate(line)) for line in METADATA_LINES]
return (METADATA_LINES, QGSFIELDS)
@@ -262,7 +274,10 @@ def writeCSVMetadata(pathCSV:str, profiles:list):
for p in profiles:
assert isinstance(p, SpectralProfile)
d = {}
- d['spectra names'] = p.name().replace(',', '-')
+ spectrumName = p.name()
+ if spectrumName is None:
+ spectrumName = ''
+ d['spectra names'] = spectrumName.replace(',', '-')
d[CSV_GEOMETRY_COLUMN] = p.geometry().asWkt()
for name in fieldNames:
v = p.attribute(name)
@@ -282,6 +297,42 @@ class EnviSpectralLibraryIO(AbstractSpectralLibraryIO):
REQUIRED_TAGS = ['byte order', 'data type', 'header offset', 'lines', 'samples', 'bands']
SINGLE_VALUE_TAGS = REQUIRED_TAGS + ['description', 'wavelength', 'wavelength units']
+
+ @staticmethod
+ def addImportActions(spectralLibrary: SpectralLibrary, menu: QMenu) -> list:
+
+ def read(speclib: SpectralLibrary):
+
+ path, filter = QFileDialog.getOpenFileName(caption='ENVI Spectral Library',
+ filter='All types (*.*);;Spectral Library files (*.sli)')
+ if os.path.isfile(path):
+
+ sl = EnviSpectralLibraryIO.readFrom(path)
+ if isinstance(sl, SpectralLibrary):
+ speclib.startEditing()
+ speclib.beginEditCommand('Add ENVI Spectral Library from {}'.format(path))
+ speclib.addSpeclib(sl, True)
+ speclib.endEditCommand()
+ speclib.commitChanges()
+
+ m = menu.addAction('ENVI')
+ m.triggered.connect(lambda *args, sl=spectralLibrary: read(sl))
+
+
+
+ @staticmethod
+ def addExportActions(spectralLibrary:SpectralLibrary, menu:QMenu) -> list:
+
+ def write(speclib: SpectralLibrary):
+
+ path, filter = QFileDialog.getSaveFileName(caption='Write ENVI Spectral Library ',
+ filter=FILTER_SLI)
+ if isinstance(path, str) and len(path) > 0:
+ EnviSpectralLibraryIO.write(spectralLibrary, path)
+
+ m = menu.addAction('ENVI')
+ m.triggered.connect(lambda *args, sl=spectralLibrary: write(sl))
+
@staticmethod
def canRead(pathESL):
"""
@@ -306,7 +357,7 @@ class EnviSpectralLibraryIO(AbstractSpectralLibraryIO):
return 0
@staticmethod
- def readFrom(path):
+ def readFrom(path, progressDialog:QProgressDialog=None):
"""
Reads an ENVI Spectral Library (ESL).
:param path: path to ENVI Spectral Library
@@ -339,13 +390,10 @@ class EnviSpectralLibraryIO(AbstractSpectralLibraryIO):
spectraNames = md.get('spectra names', ['Spectrum {}'.format(i+1) for i in range(nSpectra)])
# thanks to Ann for https://bitbucket.org/jakimowb/qgispluginsupport/issues/3/speclib-envypy
- try:
- gbl = np.where(np.asarray(md.get('bbl'), dtype=int))[0]
- if xValues is not None:
- xValues = np.asarray(xValues, dtype=float)[gbl]
- except TypeError:
- gbl = range(nbands)
+ bbl = md.get('bbl', None)
+ if bbl:
+ bbl = np.asarray(bbl, dtype=np.byte).tolist()
speclibFields = createStandardFields()
@@ -356,6 +404,9 @@ class EnviSpectralLibraryIO(AbstractSpectralLibraryIO):
except Exception as ex:
print(str(ex), file=sys.stderr)
+ PROFILE2CSVLine = {}
+
+
if CSV_METADATA is not None:
CSV_DATA, CSV_FIELDS = CSV_METADATA
@@ -365,6 +416,7 @@ class EnviSpectralLibraryIO(AbstractSpectralLibraryIO):
speclibFields.append(csvField)
CSVLine2ESLProfile = {}
+
# look if we can match a CSV column with names to profile names
for profileNameColumnName in CSV_PROFILE_NAME_COLUMN_NAMES:
if profileNameColumnName in CSV_FIELDS.names():
@@ -372,67 +424,69 @@ class EnviSpectralLibraryIO(AbstractSpectralLibraryIO):
for r, row in enumerate(CSV_DATA):
nameCSV = row[c]
if nameCSV in spectraNames:
- CSVLine2ESLProfile[r] = spectraNames.index(nameCSV)
+ iProfile = spectraNames.index(nameCSV)
+ CSVLine2ESLProfile[r] = iProfile
+ PROFILE2CSVLine[iProfile] = r
break
- #backup: match csv line with profile index
- if len(CSVLine2ESLProfile) == 0:
+ # backup: match csv line with profile index
+ if len(PROFILE2CSVLine) == 0:
indices = range(min(nSpectra, len(CSV_DATA)))
- CSVLine2ESLProfile = dict(zip(indices, indices))
+ CSVLine2ESLProfile = PROFILE2CSVLine = dict(zip(indices, indices))
+
+ SLIB = SpectralLibrary()
+ assert SLIB.startEditing()
+ SLIB.addMissingFields(speclibFields)
+
+ if CSV_METADATA is not None:
+ sliceCSV = []
+ sliceAttr = []
+ for slibField in SLIB.fields():
+ fieldName = slibField.name()
+
+ iSLIB = SLIB.fields().lookupField(fieldName)
+ iCSV = CSV_FIELDS.lookupField(fieldName)
+
+ if iCSV >= 0:
+ sliceCSV.append(iCSV)
+ sliceAttr.append(iSLIB)
+
+ iCSVGeometry = CSV_FIELDS.lookupField(CSV_GEOMETRY_COLUMN)
profiles = []
+ import datetime
+ t0 = datetime.datetime.now()
for i in range(nSpectra):
- p = SpectralProfile(fields=speclibFields)
- p.setValues(x=xValues, y=data[i, gbl].tolist(), xUnit=xUnit, yUnit=yUnit)
- name = spectraNames[i]
- p.setName(name)
- profiles.append(p)
+ f = QgsFeature(SLIB.fields())
+ valueDict = {'x': xValues, 'y': data[i, :].tolist(), 'xUnit': xUnit, 'yUnit': yUnit, 'bbl': bbl}
+ if CSV_METADATA is not None:
+ j = PROFILE2CSVLine.get(i)
+ if j:
+ csvLine = CSV_DATA[j]
+ attr = f.attributes()
+ for iCSV, iAttr in zip(sliceCSV, sliceAttr):
+ attr[iAttr] = csvLine[iCSV]
+ f.setAttributes(attr)
- if CSV_METADATA is not None:
- #find which column index from CSV table matches which QgsFeature attribute index
- for fieldIndex, csvField in enumerate(CSV_FIELDS):
- assert isinstance(csvField, QgsField)
- fieldName = csvField.name()
- #is this a geometry field?
-
- if fieldName == CSV_GEOMETRY_COLUMN:
- # copy CSV values to profile geometry attribute
- for iCSV, iProfile in CSVLine2ESLProfile.items():
- value = CSV_DATA[iCSV][fieldIndex]
- if isinstance(value, str):
- g = QgsGeometry.fromWkt(value)
+ if iCSVGeometry > 0:
+ wkt = csvLine[iCSVGeometry]
+ if isinstance(wkt, str):
+ g = QgsGeometry.fromWkt(wkt)
if g.wkbType() == QgsWkbTypes.Point:
- profile = profiles[iProfile]
- assert isinstance(profile, SpectralProfile)
- profile.setGeometry(g)
- else:
- #set normal value fields
- if fieldName in CSV_PROFILE_NAME_COLUMN_NAMES:
- #map CSV field "spectrum names" or "name" to speclib "name" columns
- aSpeclib = speclibFields.lookupField(FIELD_NAME)
- else:
- aSpeclib = speclibFields.lookupField(fieldName)
-
- if aSpeclib < 0:
- s = ""
- aCSV = CSV_FIELDS.lookupField(fieldName)
-
- #copy CSV values to profile attribute
- for iCSV, iProfile in CSVLine2ESLProfile.items():
- profile = profiles[iProfile]
- assert isinstance(profile, SpectralProfile)
- value = CSV_DATA[iCSV][aCSV]
- if value not in EMPTY_VALUES:
- assert profile.setAttribute(aSpeclib, value)
- s = ""
+ f.setGeometry(g)
+ f.setAttribute(FIELD_VALUES, encodeProfileValueDict(valueDict))
+ f.setAttribute(FIELD_NAME, spectraNames[i])
+
+ profiles.append(f)
+
+ #print('Creation: {}'.format(datetime.datetime.now() - t0))
+ t0 = datetime.datetime.now()
+ SLIB.addFeatures(profiles)
+ #print('Adding: {}'.format(datetime.datetime.now() - t0))
- SLIB = SpectralLibrary()
- SLIB.startEditing()
- SLIB.addMissingFields(speclibFields)
- SLIB.addProfiles(profiles)
assert SLIB.commitChanges()
assert SLIB.featureCount() == nSpectra
@@ -441,7 +495,7 @@ class EnviSpectralLibraryIO(AbstractSpectralLibraryIO):
return SLIB
@staticmethod
- def write(speclib:SpectralLibrary, path:str):
+ def write(speclib:SpectralLibrary, path:str, progressDialog:QProgressDialog):
"""
Writes a SpectralLibrary as ENVI Spectral Library (ESL).
See http://www.harrisgeospatial.com/docs/ENVIHeaderFiles.html for ESL definition
@@ -461,7 +515,9 @@ class EnviSpectralLibraryIO(AbstractSpectralLibraryIO):
dn = os.path.dirname(path)
bn, ext = os.path.splitext(os.path.basename(path))
- assert ext in ['.sli', '.esl'], "Path needs extension .sli or .esl: {}".format(path)
+ if not re.search(r'\.(sli|esl)', ext, re.I):
+ ext = '.sli'
+
writtenFiles = []
diff --git a/eotimeseriesviewer/externals/qps/speclib/plotting.py b/eotimeseriesviewer/externals/qps/speclib/plotting.py
index 0aac0f1077f6393ffcf814282fcc1fa2c40240b0..a05e0da5c37b68f170633da7dbbe57572726a438 100644
--- a/eotimeseriesviewer/externals/qps/speclib/plotting.py
+++ b/eotimeseriesviewer/externals/qps/speclib/plotting.py
@@ -27,7 +27,7 @@
* *
***************************************************************************
"""
-import sys, re, os, collections
+import sys, re, os, collections, typing, random, copy
from qgis.PyQt.QtGui import *
from qgis.PyQt.QtCore import *
from qgis.PyQt.QtWidgets import *
@@ -37,11 +37,19 @@ from ..externals.pyqtgraph.functions import mkPen
from ..externals import pyqtgraph as pg
from ..externals.pyqtgraph.graphicsItems.PlotDataItem import PlotDataItem
from ..utils import METRIC_EXPONENTS, convertMetricUnit
-from .spectrallibraries import SpectralProfile, SpectralLibrary, MIMEDATA_SPECLIB_LINK, FIELD_VALUES
+from .spectrallibraries import SpectralProfile, SpectralLibrary, MIMEDATA_SPECLIB_LINK, FIELD_VALUES, X_UNITS, speclibSettings, SpectralLibrarySettingsKey, loadSpeclibUI
+from ..plotstyling.plotstyling import PlotStyleWidget, PlotStyle
BAND_INDEX = 'Band Index'
+def defaultCurvePlotStyle()->PlotStyle:
+ ps = PlotStyle()
+ ps.setLineColor('white')
+ ps.markerSymbol = None
+ ps.linePen.setStyle(Qt.SolidLine)
+ return ps
+
class SpectralXAxis(pg.AxisItem):
def __init__(self, *args, **kwds):
@@ -113,9 +121,216 @@ class SpectralLibraryPlotItem(pg.PlotItem):
# self.legend.addItem(item, name=name)
+class SpectralLibraryPlotColorScheme(object):
+
+ @staticmethod
+ def default():
+ """
+ Returns the default plotStyle scheme.
+ :return:
+ :rtype: SpectralLibraryPlotColorScheme
+ """
+ return SpectralLibraryPlotColorScheme.dark()
+
+ @staticmethod
+ def fromUserSettings():
+ """
+ Returns the SpectralLibraryPlotColorScheme last saved in then library settings
+ :return:
+ :rtype:
+ """
+ settings = speclibSettings()
+
+ scheme = SpectralLibraryPlotColorScheme.default()
+
+ if SpectralLibrarySettingsKey.DEFAULT_PROFILE_STYLE.name in settings.allKeys():
+ scheme.ps = PlotStyle.fromJSON(settings.value(SpectralLibrarySettingsKey.DEFAULT_PROFILE_STYLE.name))
+ if SpectralLibrarySettingsKey.CURRENT_PROFILE_STYLE.name in settings.allKeys():
+ scheme.cs = PlotStyle.fromJSON(settings.value(SpectralLibrarySettingsKey.CURRENT_PROFILE_STYLE.name))
+
+ scheme.bg = settings.value(SpectralLibrarySettingsKey.BACKGROUND_COLOR.name, scheme.bg)
+ scheme.fg = settings.value(SpectralLibrarySettingsKey.FOREGROUND_COLOR.name, scheme.fg)
+ scheme.ic = settings.value(SpectralLibrarySettingsKey.INFO_COLOR.name, scheme.ic)
+ scheme.useRendererColors = settings.value(SpectralLibrarySettingsKey.USE_VECTOR_RENDER_COLORS.name, scheme.useRendererColors) in ['True', 'true', True]
+
+ return scheme
+
+
+ @staticmethod
+ def dark():
+ ps = defaultCurvePlotStyle()
+ ps.setLineColor('white')
+
+ cs = defaultCurvePlotStyle()
+ cs.setLineColor('green')
+
+ return SpectralLibraryPlotColorScheme(
+ name='Dark', fg=QColor('white'), bg=QColor('black'),
+ ic=QColor('yellow'), ps=ps, cs=cs, userRendererColors=False)
+
+ @staticmethod
+ def bright():
+ ps = defaultCurvePlotStyle()
+ ps.setLineColor('black')
+
+ cs = defaultCurvePlotStyle()
+ cs.setLineColor('green')
+
+ return SpectralLibraryPlotColorScheme(
+ name='Bright', fg=QColor('black'), bg=QColor('white'),
+ ic=QColor('red'), ps=ps, cs=cs, userRendererColors=False)
+
+ def __init__(self, name:str='color_scheme',
+ fg:QColor=QColor('white'),
+ bg:QColor=QColor('black'),
+ ps:PlotStyle=PlotStyle(),
+ cs:PlotStyle=PlotStyle(),
+ ic:QColor=QColor('yellow'),
+ userRendererColors:bool=True):
+
+ self.name:str
+ self.name = name
+
+ self.fg : QColor
+ self.fg = fg
+
+ self.bg : QColor
+ self.bg = bg
+
+ self.ps:PlotStyle
+ self.ps = ps
+ self.cs: PlotStyle
+ self.cs = cs
+ self.ic:QColor
+ self.ic = ic
+ self.useRendererColors:bool
+ self.useRendererColors = userRendererColors
+
+ def clone(self):
+ return copy.deepcopy(self)
+
+ def __copy__(self):
+ return copy.copy(self)
+
+ def saveToUserSettings(self):
+ """
+ Saves this plotStyle scheme to the user Qt user settings
+ :return:
+ :rtype:
+ """
+ settings = speclibSettings()
+
+ settings.setValue(SpectralLibrarySettingsKey.DEFAULT_PROFILE_STYLE.name, self.ps.json())
+ settings.setValue(SpectralLibrarySettingsKey.CURRENT_PROFILE_STYLE.name, self.cs.json())
+ settings.setValue(SpectralLibrarySettingsKey.BACKGROUND_COLOR.name, self.bg)
+ settings.setValue(SpectralLibrarySettingsKey.FOREGROUND_COLOR.name, self.fg)
+ settings.setValue(SpectralLibrarySettingsKey.INFO_COLOR.name, self.ic)
+ settings.setValue(SpectralLibrarySettingsKey.USE_VECTOR_RENDER_COLORS.name, self.useRendererColors)
+
+
+ def __eq__(self, other):
+ if not isinstance(other, SpectralLibraryPlotColorScheme):
+ return False
+ else:
+
+ return self.bg == other.bg and \
+ self.fg == other.fg and \
+ self.ic == other.ic and \
+ self.ps == other.ps and \
+ self.cs == other.cs and \
+ self.useRendererColors == other.useRendererColors
+
+
+
+
+
+class SpectralLibraryPlotColorSchemeWidget(QWidget, loadSpeclibUI('spectrallibraryplotcolorschemewidget.ui')):
+
+ sigColorSchemeChanged = pyqtSignal(SpectralLibraryPlotColorScheme)
+
+ def __init__(self, *args, **kwds):
+ super(SpectralLibraryPlotColorSchemeWidget, self).__init__(*args, **kwds)
+ self.setupUi(self)
+
+ self.mBlocked = False
+
+ self.mLastColorScheme: SpectralLibraryPlotColorScheme
+ self.mLastColorScheme = None
+
+
+ self.btnColorBackground.colorChanged.connect(self.onColorSchemeChanged)
+ self.btnColorForeground.colorChanged.connect(self.onColorSchemeChanged)
+ self.btnColorInfo.colorChanged.connect(self.onColorSchemeChanged)
+ self.cbUseRendererColors.clicked.connect(self.onCbUseRendererColorsClicked)
+
+ self.wDefaultProfileStyle.setPreviewVisible(False)
+ self.wDefaultProfileStyle.cbIsVisible.setVisible(False)
+ self.wDefaultProfileStyle.sigPlotStyleChanged.connect(self.onColorSchemeChanged)
+ self.wDefaultProfileStyle.setMinimumSize(self.wDefaultProfileStyle.sizeHint())
+ self.btnReset.setDisabled(True)
+ self.btnReset.clicked.connect(lambda : self.setColorScheme(self.mLastColorScheme))
+ self.btnColorSchemeBright.clicked.connect(lambda : self.setColorScheme(SpectralLibraryPlotColorScheme.bright()))
+ self.btnColorSchemeDark.clicked.connect(lambda: self.setColorScheme(SpectralLibraryPlotColorScheme.dark()))
+
+
+
+ #l.setMargin(1)
+ #l.setSpacing(2)
+ #frame.setMinimumSize(l.sizeHint())
+
+ def onCbUseRendererColorsClicked(self, checked:bool):
+ self.onColorSchemeChanged()
+ w = self.wDefaultProfileStyle
+ assert isinstance(w, PlotStyleWidget)
+ w.btnLinePenColor.setDisabled(checked)
+
+
+ def setColorScheme(self, colorScheme:SpectralLibraryPlotColorScheme):
+ assert isinstance(colorScheme, SpectralLibraryPlotColorScheme)
+
+ if self.mLastColorScheme is None:
+ self.mLastColorScheme = colorScheme
+ self.btnReset.setEnabled(True)
+
+
+ changed = colorScheme != self.colorScheme()
+
+ self.mBlocked = True
+
+ self.btnColorBackground.setColor(colorScheme.bg)
+ self.btnColorForeground.setColor(colorScheme.fg)
+ self.btnColorInfo.setColor(colorScheme.ic)
+ self.wDefaultProfileStyle.setPlotStyle(colorScheme.ps)
+ ''
+ self.cbUseRendererColors.setChecked(colorScheme.useRendererColors)
+
+ self.mBlocked = False
+ if changed:
+ self.sigColorSchemeChanged.emit(self.colorScheme())
+
+ def onColorSchemeChanged(self, *args):
+ if not self.mBlocked:
+ self.sigColorSchemeChanged.emit(self.colorScheme())
+
+ self.btnReset.setEnabled(isinstance(self.mLastColorScheme, SpectralLibraryPlotColorScheme) and
+ self.colorScheme() != self.mLastColorScheme)
+
+ def colorScheme(self)->SpectralLibraryPlotColorScheme:
+ cs = SpectralLibraryPlotColorScheme()
+ cs.bg = self.btnColorBackground.color()
+ cs.fg = self.btnColorForeground.color()
+ cs.ic = self.btnColorInfo.color()
+ cs.ps = self.wDefaultProfileStyle.plotStyle()
+ cs.cs = self.mLastColorScheme.cs
+ cs.useRendererColors = self.cbUseRendererColors.isChecked()
+ return cs
+
+
+
+
class SpectralProfilePlotDataItem(PlotDataItem):
"""
- A pyqtgraph.PlotDataItem to plot SpectralProfiles
+ A pyqtgraph.PlotDataItem to plot a SpectralProfile
"""
def __init__(self, spectralProfile: SpectralProfile):
@@ -125,15 +340,17 @@ class SpectralProfilePlotDataItem(PlotDataItem):
self.mXValueConversionFunction = lambda v, *args: v
self.mYValueConversionFunction = lambda v, *args: v
- self.mDefaultLineWidth = self.pen().width()
- self.mDefaultLineColor = None
+ self.mDefaultStyle = PlotStyle()
+
+ self.mProfile:SpectralProfile
self.mProfile = None
self.mInitialDataX = None
self.mInitialDataY = None
self.mInitialUnitX = None
self.mInitialUnitY = None
+
self.initProfile(spectralProfile)
self.applyMapFunctions()
@@ -245,40 +462,60 @@ class SpectralProfilePlotDataItem(PlotDataItem):
"""
if b:
- self.setLineWidth(self.mDefaultLineWidth + 3)
+ self.setLineWidth(self.mDefaultStyle.lineWidth() + 3)
+ self.setZValue(999999)
# self.setColor(Qgis.DEFAULT_HIGHLIGHT_COLOR)
else:
- self.setLineWidth(self.mDefaultLineWidth)
- # self.setColor(self.mDefaultLineColor)
+ self.setLineWidth(self.mDefaultStyle.lineWidth())
+ self.setZValue(1)
+
+ def setPlotStyle(self, plotStyle:PlotStyle, updateItem=True):
+ """
+ Applies a PlotStyle to this SpectralProfilePlotDataItem
+ :param plotStyle:
+ :type plotStyle:
+ :param updateItem: set True (default) to apply changes immediately.
+ :type updateItem: bool
+ """
+ assert isinstance(plotStyle, PlotStyle)
+ plotStyle.apply(self, updateItem=updateItem)
+
+ def plotStyle(self)->PlotStyle:
+ """
+ Returns the SpectralProfilePlotDataItems' PlotStyle
+ :return: PlotStyle
+ :rtype: PlotStyle
+ """
+ return PlotStyle.fromPlotDataItem(self)
def setColor(self, color: QColor):
"""
- Sets the profile color
+ Sets the profile plotStyle
:param color: QColor
"""
if not isinstance(color, QColor):
color = QColor(color)
- self.setPen(color)
+ style = self.profileStyle()
+ style.linePen.setColor(color)
+ self.setProfileStyle(style)
- if not isinstance(self.mDefaultLineColor, QColor):
- self.mDefaultLineColor = color
-
- def pen(self):
+ def pen(self) -> QPen:
"""
Returns the QPen of the profile
:return: QPen
"""
return mkPen(self.opts['pen'])
- def color(self):
+ def color(self) -> QColor:
"""
- Returns the profile color
+ Returns the profile plotStyle
:return: QColor
"""
return self.pen().color()
- def setLineWidth(self, width):
+
+ def setLineWidth(self, width:int):
"""
Set the profile width in px
:param width: int
@@ -288,6 +525,14 @@ class SpectralProfilePlotDataItem(PlotDataItem):
pen.setWidth(width)
self.setPen(pen)
+ def lineWidth(self)->int:
+ """
+ Returns the line width
+ :return: line width in pixel
+ :rtype: int
+ """
+ return self.pen().width()
+
def mouseClickEvent(self, ev):
if ev.button() == Qt.RightButton:
if self.raiseContextMenu(ev):
@@ -334,6 +579,172 @@ class SpectralProfilePlotDataItem(PlotDataItem):
return self.menu
+class SpectralViewBox(pg.ViewBox):
+ """
+ Subclass of ViewBox
+ """
+ sigXUnitChanged = pyqtSignal(str)
+ sigColorSchemeChanged = pyqtSignal(SpectralLibraryPlotColorScheme)
+ sigMaxNumberOfProfilesChanged = pyqtSignal(int)
+
+ def __init__(self, parent=None):
+ """
+ Constructor of the CustomViewBox
+ """
+ super(SpectralViewBox, self).__init__(parent)
+ # self.menu = None # Override pyqtgraph ViewBoxMenu
+ # self.menu = self.getMenu() # Create the menu
+ # self.menu = None
+
+ xAction = [a for a in self.menu.actions() if a.text() == 'X Axis'][0]
+ yAction = [a for a in self.menu.actions() if a.text() == 'Y Axis'][0]
+
+
+ self.cbXAxisUnits = QComboBox(parent)
+
+
+ # profile settings
+ menuProfiles = self.menu.addMenu('Profiles')
+ l = QGridLayout()
+ self.sbMaxProfiles = QSpinBox(parent)
+ self.sbMaxProfiles.setToolTip('Maximum number of profiles to plot.')
+ self.sbMaxProfiles.setRange(0, 256)
+ self.sbMaxProfiles.setValue(64)
+ self.sbMaxProfiles.valueChanged[int].connect(self.sigMaxNumberOfProfilesChanged)
+ l.addWidget(QLabel('Max.'), 0, 0)
+ l.addWidget(self.sbMaxProfiles, 0, 1)
+ frame = QFrame()
+ frame.setLayout(l)
+ wa = QWidgetAction(menuProfiles)
+ wa.setDefaultWidget(frame)
+ menuProfiles.addAction(wa)
+
+ # color settings
+ menuColors = self.menu.addMenu('Colors')
+ wa = QWidgetAction(menuColors)
+ self.wColorScheme = SpectralLibraryPlotColorSchemeWidget(parent)
+ self.wColorScheme.sigColorSchemeChanged.connect(self.sigColorSchemeChanged.emit)
+ wa.setDefaultWidget(self.wColorScheme)
+ menuColors.addAction(wa)
+
+ menuXAxis = self.menu.addMenu('X Axis')
+
+ # define the widget to set X-Axis options
+ frame = QFrame()
+ l = QGridLayout()
+ frame.setLayout(l)
+ self.rbXManualRange = QRadioButton('Manual')
+ self.rbXAutoRange = QRadioButton('Auto')
+ self.rbXAutoRange.setChecked(True)
+
+ l.addWidget(self.rbXManualRange, 0, 0)
+ l.addWidget(self.rbXAutoRange, 1, 0)
+
+ self.mCBXAxisUnit = QComboBox()
+
+ # Order of X units:
+ # 1. long names
+ # 2. short si names
+ # 3. within these groups: by exponent
+ items = sorted(METRIC_EXPONENTS.items(), key=lambda item: item[1])
+ fullNames = []
+ siNames = []
+ for item in items:
+ if len(item[0]) > 5:
+ # make centimeters to Centimeters
+ item = (item[0].title(), item[1])
+ fullNames.append(item)
+ else:
+ siNames.append(item)
+
+ self.mCBXAxisUnit.addItem(BAND_INDEX, userData='')
+ for item in fullNames + siNames:
+ name, exponent = item
+ self.mCBXAxisUnit.addItem(name, userData=name)
+ self.mCBXAxisUnit.setCurrentIndex(0)
+
+ self.mCBXAxisUnit.currentIndexChanged.connect(
+ lambda: self.sigXUnitChanged.emit(self.mCBXAxisUnit.currentText()))
+
+ l.addWidget(QLabel('Unit'), 2, 0)
+ l.addWidget(self.mCBXAxisUnit, 2, 1)
+
+ self.mXAxisUnit = 'index'
+
+ l.setMargin(1)
+ l.setSpacing(1)
+ frame.setMinimumSize(l.sizeHint())
+ wa = QWidgetAction(menuXAxis)
+ wa.setDefaultWidget(frame)
+ menuXAxis.addAction(wa)
+
+ self.menu.insertMenu(xAction, menuXAxis)
+ self.menu.removeAction(xAction)
+
+ self.mActionShowCrosshair = self.menu.addAction('Show Crosshair')
+ self.mActionShowCrosshair.setCheckable(True)
+ self.mActionShowCrosshair.setChecked(True)
+ self.mActionShowCursorValues = self.menu.addAction('Show Mouse values')
+ self.mActionShowCursorValues.setCheckable(True)
+ self.mActionShowCursorValues.setChecked(True)
+
+ def raiseContextMenu(self, ev):
+ self.mLastColorScheme = self.colorScheme()
+ super(SpectralViewBox, self).raiseContextMenu(ev)
+
+ def setColorScheme(self, colorScheme:SpectralLibraryPlotColorScheme):
+ assert isinstance(colorScheme, SpectralLibraryPlotColorScheme)
+ self.wColorScheme.setColorScheme(colorScheme)
+
+ def colorScheme(self)->SpectralLibraryPlotColorScheme:
+ """
+ Returns the color scheme
+ """
+ return self.wColorScheme.colorScheme()
+
+ def setXAxisUnit(self, unit: str):
+ """
+ Sets the X axis unit.
+ :param unit: str, metric unit like `nm` or `Nanometers`.
+ """
+ i = self.mCBXAxisUnit.findText(unit)
+ if i == -1:
+ i = 0
+ if i != self.mCBXAxisUnit.currentIndex():
+ self.mCBXAxisUnit.setCurrentIndex(i)
+
+ def xAxisUnit(self) -> str:
+ """
+ Returns unit of X-Axis values
+ :return: str
+ """
+ return self.mCBXAxisUnit.currentText()
+
+ def addItems(self, pdis: list, ignoreBounds=False):
+ """
+ Add multiple QGraphicsItem to this view. The view will include this item when determining how to set its range
+ automatically unless *ignoreBounds* is True.
+ """
+ for i, item in enumerate(pdis):
+ if item.zValue() < self.zValue():
+ item.setZValue(self.zValue() + 1 + i)
+
+ scene = self.scene()
+ if scene is not None and scene is not item.scene():
+ for item in pdis:
+ scene.addItem(item) ## Necessary due to Qt bug: https://bugreports.qt-project.org/browse/QTBUG-18616
+ item.setParentItem(self.childGroup)
+ if not ignoreBounds:
+ self.addedItems.extend(pdis)
+ # self.updateAutoRange()
+
+ def updateCurrentPosition(self, x, y):
+ self.mCurrentPosition = (x, y)
+ pass
+
+
+
+
class SpectralLibraryPlotWidget(pg.PlotWidget):
"""
A widget to PlotWidget SpectralProfiles
@@ -342,14 +753,22 @@ class SpectralLibraryPlotWidget(pg.PlotWidget):
def __init__(self, parent=None):
super(SpectralLibraryPlotWidget, self).__init__(parent)
+ self.mMaxProfiles = 64
+
self.mViewBox = SpectralViewBox()
plotItem = SpectralLibraryPlotItem(
axisItems={'bottom': SpectralXAxis(orientation='bottom')}
, viewBox=self.mViewBox
)
+ self.mViewBox.sbMaxProfiles.setValue(self.mMaxProfiles)
+ self.mViewBox.sigColorSchemeChanged.connect(self.setColorScheme)
+ self.mViewBox.sigMaxNumberOfProfilesChanged.connect(self.setMaxProfiles)
+ self.mDualView = None
+
self.centralWidget.setParent(None)
self.centralWidget = None
self.setCentralWidget(plotItem)
+ self.plotItem:SpectralLibraryPlotItem
self.plotItem = plotItem
for m in ['addItem', 'removeItem', 'autoRange', 'clear', 'setXRange',
'setYRange', 'setRange', 'setAspectLocked', 'setMouseEnabled',
@@ -360,19 +779,20 @@ class SpectralLibraryPlotWidget(pg.PlotWidget):
self.plotItem.sigRangeChanged.connect(self.viewRangeChanged)
pi = self.getPlotItem()
- assert isinstance(pi, pg.PlotItem) and pi == plotItem and pi == self.plotItem
+ assert isinstance(pi, SpectralLibraryPlotItem) and pi == plotItem and pi == self.plotItem
#pi.disableAutoRange()
+ self.mSpeclib:SpectralLibrary
self.mSpeclib = None
self.mSpeclibSignalConnections = []
- self.mUpdatesBlocked = False
self.mXUnitInitialized = False
self.mXUnit = BAND_INDEX
self.mYUnit = None
+
# describe function to convert length units from unit a to unit b
self.mLUT_UnitConversions = dict()
returnNone = lambda v, *args: None
@@ -398,15 +818,11 @@ class SpectralLibraryPlotWidget(pg.PlotWidget):
self.mPlotDataItems = dict()
self.setAntialiasing(True)
self.setAcceptDrops(True)
- self.mMaxProfiles = 256
- self.mPlotOverlayItems = []
- self.mAddedFeatureList = []
+ self.mPlotOverlayItems = []
- self.mUpdateTimer = QTimer()
- #self.mUpdateTimer.timeout.connect(self._addedFeatureCheck)
- self.mUpdateTimer.setInterval(2000)
- self.mUpdateTimer.start(2000)
+ self.mLastFIDs = []
+ self.mNeedsPlotUpdate = False
self.mCrosshairLineV = pg.InfiniteLine(angle=90, movable=False)
self.mCrosshairLineH = pg.InfiniteLine(angle=0, movable=False)
@@ -424,9 +840,6 @@ class SpectralLibraryPlotWidget(pg.PlotWidget):
pi.addItem(self.mCrosshairLineV, ignoreBounds=True)
pi.addItem(self.mCrosshairLineH, ignoreBounds=True)
- self.setBackground(QColor('black'))
- self.mInfoColor = None
- self.setInfoColor(QColor('yellow'))
self.proxy2D = pg.SignalProxy(self.scene().sigMouseMoved, rateLimit=100, slot=self.onMouseMoved2D)
@@ -436,91 +849,149 @@ class SpectralLibraryPlotWidget(pg.PlotWidget):
self.setYLabel('Y (Spectral Value)')
self.mViewBox.sigXUnitChanged.connect(self.updateXUnit)
+ self.mSPECIFIC_PROFILE_STYLES = dict()
+ self.mDefaultColorScheme:SpectralLibraryPlotColorScheme
+ self.mDefaultColorScheme = SpectralLibraryPlotColorScheme.default()
+ self.mColorScheme:SpectralLibraryPlotColorScheme
+ self.mColorScheme = SpectralLibraryPlotColorScheme.fromUserSettings()
+ self.setColorScheme(self.mColorScheme)
- def setInfoColor(self, color: QColor):
- if isinstance(color, QColor):
- self.mInfoColor = color
- self.mInfoLabelCursor.setColor(self.mInfoColor)
- self.mCrosshairLineH.pen.setColor(self.mInfoColor)
- self.mCrosshairLineV.pen.setColor(self.mInfoColor)
+ self.mUpdateTimer = QTimer()
+ self.mUpdateTimeIsBlocked = False
+ self.mUpdateTimerInterval = 500
+ self.mUpdateTimer.timeout.connect(self.onPlotUpdateTimeOut)
- def infoColor(self) -> QColor:
- """
- Returns the color of overlotted information
- :return: QColor
- """
- return QColor(self.mInfoColor)
- def foregroundInfoColor(self) -> QColor:
- return self.plotItem.axes['bottom']['item'].pen().color()
+ def viewBox(self)->SpectralViewBox:
+ return self.mViewBox
- def setForegroundInfoColor(self, color: QColor):
- if isinstance(color, QColor):
- for axis in self.plotItem.axes.values():
+ def setColorScheme(self, colorScheme:SpectralLibraryPlotColorScheme):
+ """Sets and applies the SpectralProfilePlotColorScheme"""
+ assert isinstance(colorScheme, SpectralLibraryPlotColorScheme)
+ old = self.colorScheme()
+ self.mColorScheme = colorScheme
+
+ # set Background color
+ if old.bg != colorScheme.bg:
+ self.setBackground(colorScheme.bg)
+ # set Foreground color
+ if old.fg != colorScheme.fg:
+ for axis in self.plotItem.axes.values():
ai = axis['item']
if isinstance(ai, pg.AxisItem):
- ai.setPen(QColor(color))
+ ai.setPen(colorScheme.fg)
- def updatesBlocked(self) -> bool:
- """
- Returns whether speclib updates are shown in the plot widget or not
- :return: bool
- """
- return self.mUpdatesBlocked
+ # set info color
+ self.mInfoLabelCursor.setColor(colorScheme.ic)
+ self.mCrosshairLineH.pen.setColor(colorScheme.ic)
+ self.mCrosshairLineV.pen.setColor(colorScheme.ic)
+
+ # set Info Color
+ if old.ic != colorScheme.ic:
+ self.mInfoLabelCursor.setColor(colorScheme.ic)
+ self.mCrosshairLineH.pen.setColor(colorScheme.ic)
+ self.mCrosshairLineV.pen.setColor(colorScheme.ic)
- def blockUpdates(self, b: bool) -> bool:
+ # update profile colors
+ if old.ps != colorScheme.ps or old.cs != colorScheme.cs or old.useRendererColors != colorScheme.useRendererColors:
+ self.updateProfileStyles()
+
+ # update viewbox context menu and
+ self.viewBox().setColorScheme(self.mColorScheme)
+ self.mColorScheme.saveToUserSettings()
+
+
+
+
+ def colorScheme(self)->SpectralLibraryPlotColorScheme:
"""
- Disconnect the plot widget from spectral library signales.
- :param b:
+ Returns the used SpectralProfileColorScheme
:return:
+ :rtype:
"""
- b0 = self.updatesBlocked()
- self.mUpdatesBlocked = b
+ return self.mColorScheme.clone()
- if b == True:
- self.disconnectSpeclibSignals()
- self.blockSignals(True)
- #self.updatePlot()
- self.setViewportUpdateMode(QGraphicsView.NoViewportUpdate)
- else:
- self.setViewportUpdateMode(QGraphicsView.MinimalViewportUpdate)
- self.blockSignals(False)
- self.connectSpeclibSignals()
+ def onPlotUpdateTimeOut(self, *args):
+
+
+
+ try:
+
+ if not self.mUpdateTimeIsBlocked:
+ self.mUpdateTimeIsBlocked = True
+ self.updateSpectralProfilePlotItems()
+ self.mUpdateTimeIsBlocked = False
+ else:
+ s =""
+ except RuntimeError as ex:
+ print(ex, file=sys.stderr)
+ self.mUpdateTimeIsBlocked = False
+ finally:
+
+ # adapt changes to update interval
+ if self.mUpdateTimer.interval() != self.mUpdateTimerInterval:
+ self.mUpdateTimer.setInterval(self.mUpdateTimerInterval)
+ self.mUpdateTimer.start()
+
+ def leaveEvent(self, ev):
+ super(SpectralLibraryPlotWidget, self).leaveEvent(ev)
+
+ # disable mouse-position related plot items
+ self.mCrosshairLineH.setVisible(False)
+ self.mCrosshairLineV.setVisible(False)
+ self.mInfoLabelCursor.setVisible(False)
- return b0
+ def enterEvent(self, ev):
+ super(SpectralLibraryPlotWidget, self).enterEvent(ev)
+
+
+ def foregroundInfoColor(self) -> QColor:
+ return self.plotItem.axes['bottom']['item'].pen().color()
+
+ def hoverEvent(self, ev):
+ if ev.enter:
+ self.mouseHovering = True
+ if ev.exit:
+ self.mouseHovering = False
def onMouseMoved2D(self, evt):
pos = evt[0] ## using signal proxy turns original arguments into a tuple
plotItem = self.getPlotItem()
- if plotItem.sceneBoundingRect().contains(pos):
+ assert isinstance(plotItem, SpectralLibraryPlotItem)
+ if plotItem.sceneBoundingRect().contains(pos) and self.underMouse():
vb = plotItem.vb
assert isinstance(vb, SpectralViewBox)
mousePoint = vb.mapSceneToView(pos)
x = mousePoint.x()
- if x >= 0:
+ y = mousePoint.y()
+
+ # todo: add infos about plot data below mouse, e.g. profile band number
+ rect = QRectF(pos.x() - 2, pos.y() - 2, 5, 5)
+ itemsBelow = plotItem.scene().items(rect)
+ if SpectralProfilePlotDataItem in itemsBelow:
+ s = ""
- # todo: add infos about plot data below mouse, e.g. profile band number
- rect = QRectF(pos.x() - 2, pos.y() - 2, 5, 5)
- itemsBelow = plotItem.scene().items(rect)
- if SpectralProfilePlotDataItem in itemsBelow:
- s = ""
- y = mousePoint.y()
- vb.updateCurrentPosition(x, y)
- self.mInfoLabelCursor.setText('x:{:0.5f}\ny:{:0.5f}'.format(x, y))
+ vb.updateCurrentPosition(x, y)
+ self.mInfoLabelCursor.setText('x:{:0.5f}\ny:{:0.5f}'.format(x, y))
- s = self.size()
- pos = QPointF(s.width(), 0)
- self.mInfoLabelCursor.setVisible(vb.mActionShowCursorValues.isChecked())
- self.mInfoLabelCursor.setPos(pos)
+ s = self.size()
+ pos = QPointF(s.width(), 0)
+ self.mInfoLabelCursor.setVisible(vb.mActionShowCursorValues.isChecked())
+ self.mInfoLabelCursor.setPos(pos)
+
+ b = vb.mActionShowCrosshair.isChecked()
+ self.mCrosshairLineH.setVisible(b)
+ self.mCrosshairLineV.setVisible(b)
+ self.mCrosshairLineV.setPos(mousePoint.x())
+ self.mCrosshairLineH.setPos(mousePoint.y())
+ else:
+ self.mCrosshairLineH.setVisible(False)
+ self.mCrosshairLineV.setVisible(False)
+ self.mInfoLabelCursor.setVisible(False)
- b = vb.mActionShowCrosshair.isChecked()
- self.mCrosshairLineH.setVisible(b)
- self.mCrosshairLineV.setVisible(b)
- self.mCrosshairLineV.setPos(mousePoint.x())
- self.mCrosshairLineH.setPos(mousePoint.y())
def setPlotOverlayItems(self, items):
"""
@@ -558,20 +1029,82 @@ class SpectralLibraryPlotWidget(pg.PlotWidget):
self.setXUnit(xUnit)
self.mXUnitInitialized = True
- def _spectralProfilePDIs(self) -> list:
+ def spectralProfilePlotDataItems(self) -> typing.List[SpectralProfilePlotDataItem]:
+ """
+ Returns all SpectralProfilePlotDataItems
+ """
return [i for i in self.getPlotItem().items if isinstance(i, SpectralProfilePlotDataItem)]
- def _removeSpectralProfilePDIs(self, pdis: list):
+ def _removeSpectralProfilePDIs(self, fidsToRemove: typing.List[int]):
+ """
- pi = self.getPlotItem()
- assert isinstance(pi, pg.PlotItem)
+ :param fidsToRemove: feature ids to remove
+ :type fidsToRemove:
+ :return:
+ :rtype:
+ """
- for pdi in pdis:
+ def disconnect(sig, slot):
+ while True:
+ try:
+ r = sig.disconnect(slot)
+ s = ""
+ except:
+ break
+
+ plotItem = self.getPlotItem()
+ assert isinstance(plotItem, pg.PlotItem)
+ pdisToRemove = [pdi for pdi in self.spectralProfilePlotDataItems() if pdi.id() in fidsToRemove]
+ for pdi in pdisToRemove:
assert isinstance(pdi, SpectralProfilePlotDataItem)
- pi.removeItem(pdi)
- assert pdi not in pi.dataItems
+ pdi.setClickable(False)
+ disconnect(pdi, self.onProfileClicked)
+ plotItem.removeItem(pdi)
+ #QtGui.QGraphicsScene.items(self, *args)
+ assert pdi not in plotItem.dataItems
if pdi.id() in self.mPlotDataItems.keys():
- self.mPlotDataItems.pop(pdi.id())
+ self.mPlotDataItems.pop(pdi.id(), None)
+ self.mSPECIFIC_PROFILE_STYLES.pop(pdi.id(), None)
+ self.scene().update()
+ s = ""
+
+
+ def resetProfileStyles(self):
+ """
+ Resets the profile colors
+ """
+ self.mSPECIFIC_PROFILE_STYLES.clear()
+
+ def setProfileStyle(self, style:PlotStyle, fids:typing.List[int]):
+ """
+ Sets the specific profile style
+ :param style:
+ :type style:
+ :param fids:
+ :type fids:
+ :return:
+ :rtype:
+ """
+ if isinstance(fids, list):
+ if isinstance(style, PlotStyle):
+ for fid in fids:
+ self.mSPECIFIC_PROFILE_STYLES[fid] = style
+ elif style is None:
+ # delete existing
+ for fid in fids:
+ self.mSPECIFIC_PROFILE_STYLES.pop(fid, None)
+ self.updateProfileStyles(fids)
+
+ def setMaxProfiles(self, n:int):
+ """
+ Sets the maximum number of profiles.
+ :param n: maximum number of profiles visualized
+ :type n: int
+ """
+ assert n > 0
+
+ self.mMaxProfiles = n
+ self.mViewBox.sbMaxProfiles.setValue(self.mMaxProfiles)
def setSpeclib(self, speclib: SpectralLibrary):
"""
@@ -579,26 +1112,44 @@ class SpectralLibraryPlotWidget(pg.PlotWidget):
:param speclib: SpectralLibrary
"""
assert isinstance(speclib, SpectralLibrary)
-
- self._removeSpectralProfilePDIs(self._spectralProfilePDIs())
+ self.mUpdateTimer.stop()
+ # remove old spectra
+ if isinstance(self.speclib(), SpectralLibrary):
+ self._removeSpectralProfilePDIs(self.speclib().allFeatureIds())
self.mSpeclib = speclib
self.connectSpeclibSignals()
- self.onProfilesAdded(self.speclib().allFeatureIds())
+ self.mUpdateTimer.start(self.mUpdateTimerInterval)
+
+
+ def setDualView(self, dualView:QgsDualView):
+ assert isinstance(dualView, QgsDualView)
+ speclib = dualView.masterModel().layer()
+ assert isinstance(speclib, SpectralLibrary)
+ self.mDualView = dualView
+ if self.speclib() != speclib:
+ self.setSpeclib(speclib)
- self.updatePlot()
+
+ def dualView(self)->QgsDualView:
+ return self.mDualView
def connectSpeclibSignals(self):
+ """
+
+ """
if isinstance(self.mSpeclib, SpectralLibrary):
- self.mSpeclib.featureAdded.connect(self.onProfilesAdded)
- self.mSpeclib.featuresDeleted.connect(self.onProfilesRemoved)
+ #self.mSpeclib.featureAdded.connect(self.onProfilesAdded)
+ #self.mSpeclib.featuresDeleted.connect(self.onProfilesRemoved)
self.mSpeclib.selectionChanged.connect(self.onSelectionChanged)
self.mSpeclib.committedAttributeValuesChanges.connect(self.onCommittedAttributeValuesChanges)
self.mSpeclib.rendererChanged.connect(self.onRendererChanged)
def disconnectSpeclibSignals(self):
-
+ """
+ Savely disconnects all signals from the linked SpectralLibrary
+ """
if isinstance(self.mSpeclib, SpectralLibrary):
def disconnect(sig, slot):
while True:
@@ -613,21 +1164,12 @@ class SpectralLibraryPlotWidget(pg.PlotWidget):
disconnect(self.mSpeclib.committedAttributeValuesChanges, self.onCommittedAttributeValuesChanges)
disconnect(self.mSpeclib.rendererChanged, self.onRendererChanged)
-
- def _addedFeatureCheck(self):
- if len(self.mAddedFeatureList) > 0 and not self.mUpdatesBlocked:
- fids = self.mAddedFeatureList[:]
- self.mAddedFeatureList.clear()
- self.onProfilesAdded(fids)
-
- def _addAddedFeatureList(self, fid):
- self.mAddedFeatureList.append(fid)
-
def speclib(self) -> SpectralLibrary:
"""
Returns the SpectralLibrary this widget is linked to.
:return: SpectralLibrary
"""
+ return self.mSpeclib
def onCommittedAttributeValuesChanges(self, layerID, featureMap):
"""
@@ -655,42 +1197,39 @@ class SpectralLibraryPlotWidget(pg.PlotWidget):
@pyqtSlot()
def onRendererChanged(self):
+ """
+ Updates all SpectralProfilePlotDataItems
+ """
+ self.updateProfileStyles()
- profiles = self.mSpeclib.profiles(fids=self.mPlotDataItems.keys())
- self.updateProfileStyles(list(profiles))
-
-
- def onSelectionChanged(self, selected, deselected):
- for pdi in self.plotItem.items:
- if isinstance(pdi, SpectralProfilePlotDataItem):
- w = pdi.pen().width()
- if pdi.id() in selected:
- pdi.setSelected(True)
- elif pdi.id() in deselected:
- pdi.setSelected(False)
- s = ""
+ def onSelectionChanged(self, selected, deselected, clearAndSelect):
+ self.updateSpectralProfilePlotItems()
+ for pdi in self.allSpectralProfilePlotDataItems():
+ if pdi.id() in selected:
+ pdi.setSelected(True)
+ elif pdi.id() in deselected:
+ pdi.setSelected(False)
+ """
def syncLibrary(self):
s = ""
# see https://groups.google.com/forum/#!topic/pyqtgraph/kz4U6dswEKg
# speed problems in case of too many line items
- profiles = list(self.speclib().profiles())
+ #profiles = list(self.speclib().profiles())
self.disableAutoRange()
self.blockSignals(True)
- self.plotItem
self.setViewportUpdateMode(QGraphicsView.NoViewportUpdate)
- self.updateProfileStyles(profiles) #take too much time
- self.updatePlot() #take much more time
+
+ self.updateSpectralProfilePlotItems()
+ self.updateProfileStyles()
self.setViewportUpdateMode(QGraphicsView.FullViewportUpdate)
self.blockSignals(False)
self.enableAutoRange()
self.viewport().update()
+ """
-
- s = ""
-
def unitConversionFunction(self, unitSrc, unitDst):
"""
Returns a function to convert a numeric value from unitSrc to unitDst.
@@ -738,16 +1277,16 @@ class SpectralLibraryPlotWidget(pg.PlotWidget):
"""
return self.mXUnit
- def allPlotDataItems(self) -> list:
+ def allPlotDataItems(self) -> typing.List[PlotDataItem]:
"""
Returns all PlotDataItems (not only SpectralProfilePlotDataItems)
:return: [list-of-PlotDataItems]
"""
return list(self.mPlotDataItems.values()) + self.mPlotOverlayItems
- def allSpectralProfilePlotDataItems(self):
+ def allSpectralProfilePlotDataItems(self)->typing.List[SpectralProfilePlotDataItem]:
"""
- Returns alls SpectralProfilePlotDataItem, including those used as temporary overlays.
+ Returns all SpectralProfilePlotDataItem, including those used as temporary overlays.
:return: [list-of-SpectralProfilePlotDataItem]
"""
return [pdi for pdi in self.allPlotDataItems() if isinstance(pdi, SpectralProfilePlotDataItem)]
@@ -772,36 +1311,51 @@ class SpectralLibraryPlotWidget(pg.PlotWidget):
s = ""
- def updatePlot(self):
- i = 0
+ def updateSpectralProfilePlotItems(self):
+ """
+
+ """
pi = self.getPlotItem()
assert isinstance(pi, SpectralLibraryPlotItem)
- existing = list(self.mPlotDataItems.values())
+ toBeVisualized = self.profileIDsToVisualize()
+ visualized = self.plottedProfileIDs()
+ toBeRemoved = [fid for fid in visualized if fid not in toBeVisualized]
+ toBeAdded = [fid for fid in toBeVisualized if fid not in visualized]
- to_add = [i for i in existing if isinstance(i, SpectralProfilePlotDataItem) and i not in pi.dataItems]
- to_remove = [pdi for pdi in pi.dataItems if
- isinstance(pdi, SpectralProfilePlotDataItem) and pdi not in existing]
+ if len(toBeRemoved) > 0:
+ self._removeSpectralProfilePDIs(toBeRemoved)
- self._removeSpectralProfilePDIs(to_remove)
- pi.addItems(to_add)
+ if len(toBeAdded) > 0:
+ addedPDIs = []
+ addedProfiles = self.speclib().profiles(toBeAdded)
+
+ defaultPlotStyle = self.mColorScheme.ps
+ for profile in addedProfiles:
+ assert isinstance(profile, SpectralProfile)
+ pdi = SpectralProfilePlotDataItem(profile)
+ defaultPlotStyle.apply(pdi)
+ pdi.setClickable(True)
+ pdi.setVisible(True)
+ pdi.sigClicked.connect(self.onProfileClicked)
+ self.mPlotDataItems[profile.id()] = pdi
+ addedPDIs.append(pdi)
+ pi.addItems(addedPDIs)
+ self.updateProfileStyles(toBeAdded)
+ s = ""
+
+ if len(toBeAdded) > 0 or len(toBeRemoved) > 0:
+ pi.update()
- pi.update()
- s = ""
def resetSpectralProfiles(self):
for pdi in self.spectralProfilePlotDataItems():
assert isinstance(pdi, SpectralProfilePlotDataItem)
pdi.resetSpectralProfile()
- def spectralProfilePlotDataItems(self) -> list:
- """
- Returns all available SpectralProfilePlotDataItems
- """
- return [i for i in self.mPlotDataItems.values() if isinstance(i, SpectralProfilePlotDataItem)]
- def spectralProfilePlotDataItem(self, fid) -> SpectralProfilePlotDataItem:
+ def spectralProfilePlotDataItem(self, fid:typing.Union[int, QgsFeature, SpectralProfile]) -> SpectralProfilePlotDataItem:
"""
Returns the SpectralProfilePlotDataItem related to SpectralProfile fid
:param fid: int | QgsFeature | SpectralProfile
@@ -811,63 +1365,67 @@ class SpectralLibraryPlotWidget(pg.PlotWidget):
fid = fid.id()
return self.mPlotDataItems.get(fid)
- def updateProfileStyles(self, listOfProfiles: list):
+ def updateProfileStyles(self, fids: typing.List[SpectralProfile]=None):
"""
Updates the styles for a set of SpectralProfilePlotDataItems
:param listOfProfiles: [list-of-SpectralProfiles]
"""
+ if not isinstance(self.speclib(), SpectralLibrary):
+ return
+
+ cs = self.mColorScheme
+
xUnit = None
renderContext = QgsRenderContext()
- renderContext.setExtent(self.mSpeclib.extent())
+ renderContext.setExtent(self.speclib().extent())
renderer = self.speclib().renderer().clone()
- colors = []
- from .spectrallibraries import DEFAULT_PROFILE_COLOR
- if isinstance(renderer, QgsNullSymbolRenderer):
- for i in range(len(listOfProfiles)):
- colors.append(DEFAULT_PROFILE_COLOR)
- else:
- renderer.startRender(renderContext, self.mSpeclib.fields())
- for profile in listOfProfiles:
- symbol = renderer.symbolForFeature(profile, renderContext)
- if not isinstance(symbol, QgsSymbol):
- symbol = renderer.sourceSymbol()
- assert isinstance(symbol, QgsSymbol)
- color = QColor('white')
+ pdis = self.spectralProfilePlotDataItems()
- if isinstance(symbol, (QgsMarkerSymbol, QgsLineSymbol, QgsFillSymbol)):
- color = symbol.color()
- colors.append(color)
- renderer.stopRender(renderContext)
+ # update requested FIDs only
+ if isinstance(fids, list):
+ pdis = [pdi for pdi in pdis if pdi.id() in fids]
- s = ""
- for profile, color in zip(listOfProfiles, colors):
- assert isinstance(profile, SpectralProfile)
+ # update X Axis unit
+ if not self.mXUnitInitialized:
+ for pdi in pdis:
+ profile = pdi.spectralProfile()
+ if profile.xUnit() in X_UNITS:
+ self.setXUnit(profile.xUnit())
+ break
- if not self.mXUnitInitialized and isinstance(profile.xUnit(), str):
- self.setXUnit(profile.xUnit())
+ # update line colors
+ if not cs.useRendererColors or isinstance(renderer, QgsNullSymbolRenderer):
+ for pdi in pdis:
+ style = self.mSPECIFIC_PROFILE_STYLES.get(pdi.id(), cs.ps)
+ style.apply(pdi)
+ else:
+ renderer.startRender(renderContext, self.speclib().fields())
+ for pdi in pdis:
+ profile = pdi.spectralProfile()
- id = profile.id()
+ style = self.mSPECIFIC_PROFILE_STYLES.get(pdi.id(), None)
- pdi = self.mPlotDataItems.get(id)
- if not isinstance(pdi, PlotDataItem):
- pdi = SpectralProfilePlotDataItem(profile)
- pdi.setClickable(True)
- pdi.sigClicked.connect(self.onProfileClicked)
- self.mPlotDataItems[profile.id()] = pdi
- pdi.setColor(color)
+ if not isinstance(style, PlotStyle):
+ style = cs.ps.clone()
+ symbol = renderer.symbolForFeature(profile, renderContext)
+ if not isinstance(symbol, QgsSymbol):
+ symbol = renderer.sourceSymbol()
+ assert isinstance(symbol, QgsSymbol)
+ if isinstance(symbol, (QgsMarkerSymbol, QgsLineSymbol, QgsFillSymbol)):
+ style.setLineColor(symbol.color())
+ style.apply(pdi)
+ renderer.stopRender(renderContext)
if isinstance(xUnit, str):
self.setXUnit(xUnit)
self.mXUnitInitialized = True
def onProfileClicked(self, pdi):
- if self.mUpdatesBlocked:
- return
if isinstance(pdi, SpectralProfilePlotDataItem) and pdi in self.mPlotDataItems.values():
modifiers = QApplication.keyboardModifiers()
@@ -907,234 +1465,79 @@ class SpectralLibraryPlotWidget(pg.PlotWidget):
def xLabel(self) -> str:
return self.getPlotItem().getAxis('bottom').label
- def speclib(self) -> SpectralLibrary:
- """
- :return: SpectralLibrary
- """
- return self.mSpeclib
-
- def onProfilesAdded(self, fids):
- if not isinstance(fids, list):
- fids = [fids]
- if len(fids) == 0:
- return
- profiles = self.speclib().profiles(fids=fids)
- self.updateProfileStyles(list(profiles))
- self.updatePlot()
- s = ""
-
- def onProfilesRemoved(self, fids):
- if len(fids) == 0:
- return
-
- pi = self.getPlotItem()
- assert isinstance(pi, pg.PlotItem)
- to_remove = [pdi for pdi in self._spectralProfilePDIs() if pdi.id() in fids]
- self._removeSpectralProfilePDIs(to_remove)
-
- def dragEnterEvent(self, event):
- assert isinstance(event, QDragEnterEvent)
- if MIMEDATA_SPECLIB_LINK in event.mimeData().formats():
- event.accept()
-
- def dragMoveEvent(self, event):
- if MIMEDATA_SPECLIB_LINK in event.mimeData().formats():
- event.accept()
-
-
-class SpectralViewBox(pg.ViewBox):
- """
- Subclass of ViewBox
- """
- sigXUnitChanged = pyqtSignal(str)
-
- def __init__(self, parent=None):
- """
- Constructor of the CustomViewBox
- """
- super(SpectralViewBox, self).__init__(parent)
- # self.menu = None # Override pyqtgraph ViewBoxMenu
- # self.menu = self.getMenu() # Create the menu
- # self.menu = None
-
- xAction = [a for a in self.menu.actions() if a.text() == 'X Axis'][0]
- yAction = [a for a in self.menu.actions() if a.text() == 'Y Axis'][0]
-
- menuColors = self.menu.addMenu('Colors')
- frame = QFrame()
- l = QGridLayout()
- frame.setLayout(l)
-
- self.btnColorBackground = QgsColorButton(parent)
- self.btnColorForeground = QgsColorButton(parent)
- self.btnColorInfo = QgsColorButton(parent)
- self.btnColorSelected = QgsColorButton(parent)
- self.cbXAxisUnits = QComboBox(parent)
-
- def onBackgroundColorChanged(color: QColor):
- w = self._viewWidget()
- if isinstance(w, SpectralLibraryPlotWidget):
- w.setBackground(QColor(color))
-
- def onForegroundColorChanged(color: QColor):
- w = self._viewWidget()
- if isinstance(w, SpectralLibraryPlotWidget):
- w.setForegroundInfoColor(color)
- # w.setForegroundBrush(color)
-
- def onInfoColorChanged(color: QColor):
- w = self._viewWidget()
- if isinstance(w, SpectralLibraryPlotWidget):
- w.setInfoColor(color)
- s = ""
-
- self.btnColorBackground.colorChanged.connect(onBackgroundColorChanged)
- self.btnColorForeground.colorChanged.connect(onForegroundColorChanged)
- self.btnColorInfo.colorChanged.connect(onInfoColorChanged)
-
- l.addWidget(QLabel('Background'), 0, 0)
- l.addWidget(self.btnColorBackground, 0, 1)
-
- l.addWidget(QLabel('Foreground'), 1, 0)
- l.addWidget(self.btnColorForeground, 1, 1)
-
- l.addWidget(QLabel('Crosshair info'), 2, 0)
- l.addWidget(self.btnColorInfo, 2, 1)
-
- l.setMargin(1)
- l.setSpacing(1)
- frame.setMinimumSize(l.sizeHint())
- wa = QWidgetAction(menuColors)
- wa.setDefaultWidget(frame)
- menuColors.addAction(wa)
-
- menuXAxis = self.menu.addMenu('X Axis')
-
- # define the widget to set X-Axis options
- frame = QFrame()
- l = QGridLayout()
- frame.setLayout(l)
- self.rbXManualRange = QRadioButton('Manual')
-
- self.rbXAutoRange = QRadioButton('Auto')
- self.rbXAutoRange.setChecked(True)
-
- l.addWidget(self.rbXManualRange, 0, 0)
- l.addWidget(self.rbXAutoRange, 1, 0)
-
- self.mCBXAxisUnit = QComboBox()
-
- # Order of X units:
- # 1. long names
- # 2. short si names
- # 3. within these groups: by exponent
- items = sorted(METRIC_EXPONENTS.items(), key=lambda item: item[1])
- fullNames = []
- siNames = []
- for item in items:
- if len(item[0]) > 5:
- # make centimeters to Centimeters
- item = (item[0].title(), item[1])
- fullNames.append(item)
- else:
- siNames.append(item)
-
- self.mCBXAxisUnit.addItem(BAND_INDEX, userData='')
- for item in fullNames + siNames:
- name, exponent = item
- self.mCBXAxisUnit.addItem(name, userData=name)
- self.mCBXAxisUnit.setCurrentIndex(0)
-
- self.mCBXAxisUnit.currentIndexChanged.connect(
- lambda: self.sigXUnitChanged.emit(self.mCBXAxisUnit.currentText()))
-
- l.addWidget(QLabel('Unit'), 2, 0)
- l.addWidget(self.mCBXAxisUnit, 2, 1)
-
- self.mXAxisUnit = 'index'
-
- l.setMargin(1)
- l.setSpacing(1)
- frame.setMinimumSize(l.sizeHint())
- wa = QWidgetAction(menuXAxis)
- wa.setDefaultWidget(frame)
- menuXAxis.addAction(wa)
-
- self.menu.insertMenu(xAction, menuXAxis)
- self.menu.removeAction(xAction)
-
- self.mActionShowCrosshair = self.menu.addAction('Show Crosshair')
- self.mActionShowCrosshair.setCheckable(True)
- self.mActionShowCrosshair.setChecked(True)
- self.mActionShowCursorValues = self.menu.addAction('Show Mouse values')
- self.mActionShowCursorValues.setCheckable(True)
- self.mActionShowCursorValues.setChecked(True)
-
- def setXAxisUnit(self, unit: str):
+ def plottedProfileCount(self)->int:
"""
- Sets the X axis unit.
- :param unit: str, metric unit like `nm` or `Nanometers`.
+ Returns the number of plotted profiles
+ :return: int
+ :rtype: int
"""
- i = self.mCBXAxisUnit.findText(unit)
- if i == -1:
- i = 0
- if i != self.mCBXAxisUnit.currentIndex():
- self.mCBXAxisUnit.setCurrentIndex(i)
+ return len(self.allSpectralProfilePlotDataItems())
- def xAxisUnit(self) -> str:
+ def plottedProfileIDs(self)->typing.List[int]:
"""
- Returns unit of X-Axis values
- :return: str
+ Returns the feature IDs of all visualized SpectralProfiles.
"""
- return self.mCBXAxisUnit.currentText()
+ return [pdi.id() for pdi in self.allSpectralProfilePlotDataItems()]
- def addItems(self, pdis: list, ignoreBounds=False):
+ def profileIDsToVisualize(self)->typing.List[int]:
"""
- Add multiple QGraphicsItem to this view. The view will include this item when determining how to set its range
- automatically unless *ignoreBounds* is True.
+ Returns the list of profile/feature ids to be visualized.
+ The maximum number is determined by self.mMaxProfiles
+ Order of returned fids is equal to its importance. 1st postion = most important
"""
- for i, item in enumerate(pdis):
- if item.zValue() < self.zValue():
- item.setZValue(self.zValue() + 1 + i)
+ nMax = len(self.speclib())
- scene = self.scene()
- if scene is not None and scene is not item.scene():
- for item in pdis:
- scene.addItem(item) ## Necessary due to Qt bug: https://bugreports.qt-project.org/browse/QTBUG-18616
- item.setParentItem(self.childGroup)
- if not ignoreBounds:
- self.addedItems.extend(pdis)
- # self.updateAutoRange()
-
- def updateContextMenu(self):
+ allIDs = self.speclib().allFeatureIds()
+ if nMax <= self.mMaxProfiles:
+ return allIDs
- w = self._viewWidget()
- if isinstance(w, SpectralLibraryPlotWidget):
- # get background color
- bg = w.backgroundBrush().color()
- self.btnColorBackground.setColor(bg)
+ # Order:
+ # 1. visible in table
+ # 2. selected
+ # 3. others
- # get foreground color
- self.btnColorForeground.setColor(w.foregroundInfoColor())
- # get info color
- self.btnColorInfo.setColor(w.infoColor())
- def raiseContextMenu(self, ev):
+ vis = self.plottedProfileIDs()
+ dualView = self.dualView()
- pt = self.mapDeviceToView(ev.pos())
+ priority1 = []
+ if isinstance(dualView, QgsDualView):
+ tv = dualView.tableView()
+ assert isinstance(tv, QTableView)
+ rowHeight = tv.rowViewportPosition(1) - tv.rowViewportPosition(0)
+ for y in range(0, tv.viewport().height(), rowHeight):
+ idx = dualView.tableView().indexAt(QPoint(0, y))
+ if idx.isValid():
+ fid = tv.model().data(idx, role=Qt.UserRole)
+ priority1.append(fid)
+ priority2 = self.dualView().masterModel().layer().selectedFeatureIds()
+ priority3 = dualView.filteredFeatures()
+ else:
+ priority2 = self.speclib().selectedFeatureIds()
+ priority3 = self.speclib().allFeatureIds()
- xRange, yRange = self.viewRange()
+ #featurePool = priority3
+ featurePool = priority1+priority2
+ toVisualize = sorted(featurePool, key=lambda fid : (fid not in priority1, fid not in priority2, fid))
- menu = self.getMenu(ev)
+ if len(toVisualize) >= self.mMaxProfiles:
+ return sorted(toVisualize[0:self.mMaxProfiles])
+ else:
+ toVisualize = sorted(toVisualize)
+ nMissing = min(self.mMaxProfiles - len(toVisualize), len(priority3))
+ if nMissing > 0:
+ toVisualize += sorted(priority3[0:nMissing])
+ return toVisualize
- self.scene().addParentContextMenus(self, menu, ev)
- self.updateContextMenu()
- menu.exec_(ev.screenPos().toPoint())
- def updateCurrentPosition(self, x, y):
- self.mCurrentPosition = (x, y)
- pass
+ def dragEnterEvent(self, event):
+ assert isinstance(event, QDragEnterEvent)
+ if MIMEDATA_SPECLIB_LINK in event.mimeData().formats():
+ event.accept()
+ def dragMoveEvent(self, event):
+ if MIMEDATA_SPECLIB_LINK in event.mimeData().formats():
+ event.accept()
diff --git a/eotimeseriesviewer/externals/qps/speclib/specchio.py b/eotimeseriesviewer/externals/qps/speclib/specchio.py
new file mode 100644
index 0000000000000000000000000000000000000000..d2e82266fecafd2a480a71d30765cd17c2fa35bd
--- /dev/null
+++ b/eotimeseriesviewer/externals/qps/speclib/specchio.py
@@ -0,0 +1,227 @@
+
+import os, sys, re, pathlib, json, collections
+import csv as pycsv
+from .spectrallibraries import *
+
+
+class SPECCHIOSpectralLibraryIO(AbstractSpectralLibraryIO):
+ """
+ I/O Interface for the SPECCHIO spectral library .
+ See https://ecosis.org for details.
+ """
+ @staticmethod
+ def canRead(path)->bool:
+ """
+ Returns true if it can read the source defined by path
+ :param path: source uri
+ :return: True, if source is readable.
+ """
+
+ with open(path, 'r', encoding='utf-8') as f:
+ for line in f:
+ if re.search(r'^\d+(\.\d+)?.+', line):
+ return True
+
+ return False
+
+ @staticmethod
+ def readFrom(path, wlu='nm', delimiter=',', progressDialog:QProgressDialog=None)->SpectralLibrary:
+ """
+ Returns the SpectralLibrary read from "path"
+ :param path: source of SpectralLibrary
+ :return: SpectralLibrary
+ """
+
+ sl = SpectralLibrary()
+ sl.startEditing()
+ bn = os.path.basename(path)
+ delimiter = ','
+ with open(path, 'r', encoding='utf-8') as f:
+ lines = f.readlines()
+ DATA = collections.OrderedDict()
+ readMetaData = True
+ regNumber = re.compile(r'^\d+(\.\d+)?$')
+ nProfiles = 0
+ for i, line in enumerate(lines):
+
+ assert isinstance(line, str)
+ line = line.strip()
+ if len(line) == 0:
+ continue
+
+ values = line.split(delimiter)
+ if len(values) < 2:
+ continue
+
+ try:
+ mdKey = values.pop(0).strip()
+ assert isinstance(mdKey, str)
+ if len(values) == 0:
+ continue
+
+ t = findTypeFromString(values[0])
+ values = [t(v) for v in values if len(v) > 0]
+ if len(values) > 0:
+ DATA[mdKey] = values
+ else:
+ s = ""
+ except Exception as ex:
+ print(ex, file=sys.stderr)
+ print('Line {}:{}'.format(i+1, line), file=sys.stderr)
+
+ numericValueKeys = []
+ metadataKeys = []
+ for k in DATA.keys():
+ if regNumber.search(k):
+ numericValueKeys.append(k)
+ else:
+ metadataKeys.append(k)
+
+ numericValueKeys = sorted(numericValueKeys)
+ xValues = [float(v) for v in numericValueKeys]
+ nProfiles = len(DATA[numericValueKeys[0]])
+
+ sl.beginEditCommand('Set metadata columns')
+ for k in metadataKeys:
+ if k in sl.fieldNames():
+ continue
+
+ k2 = k.replace(' ', '_')
+ qgsField = createQgsField(k, DATA[k][0])
+ assert sl.addAttribute(qgsField)
+
+
+ sl.endEditCommand()
+ sl.commitChanges()
+ sl.startEditing()
+ profiles = []
+ for i in range(nProfiles):
+ profile = SpectralProfile(fields=sl.fields())
+ # add profile name
+ if FIELD_NAME in metadataKeys:
+ profile.setName(DATA[FIELD_NAME][i])
+ else:
+ profile.setName('{}:{}'.format(bn, i+1))
+
+ # add profile values
+ yValues = [float(DATA[k][i]) for k in numericValueKeys]
+ profile.setValues(x=xValues, y=yValues, xUnit=wlu)
+
+ # add profile metadata
+ for k in metadataKeys:
+ mdValues = DATA[k]
+ if len(mdValues) > i:
+ profile.setAttribute(k, mdValues[i])
+
+ profiles.append(profile)
+
+ sl.addProfiles(profiles, addMissingFields=True)
+ sl.commitChanges()
+ return sl
+
+ @staticmethod
+ def write(speclib:SpectralLibrary, path:str, progressDialog:QProgressDialog=None, delimiter:str=',')->list:
+ """
+ Writes the SpectralLibrary to path and returns a list of written files that can be used to open the spectral library with readFrom(...)
+ :param speclib: SpectralLibrary
+ :param path: str, path to library source
+ :return: [str-list-of-written-files]
+ """
+ """
+ Writes the SpectralLibrary to path and returns a list of written files that can be used to open the spectral library with readFrom
+ """
+ assert isinstance(speclib, SpectralLibrary)
+ basePath, ext = os.path.splitext(path)
+ s = ""
+
+ writtenFiles = []
+ fieldNames = [n for n in speclib.fields().names() if n not in [FIELD_VALUES, FIELD_FID]]
+ groups = speclib.groupBySpectralProperties()
+ for i, grp in enumerate(groups.keys()):
+ # in-memory text buffer
+ stream = io.StringIO()
+ xValues, xUnit, yUnit = grp
+ profiles = groups[grp]
+ if i == 0:
+ path = basePath + ext
+ else:
+ path = basePath + '{}{}'.format(i + 1, ext)
+
+ # write metadata
+ for fn in speclib.fields().names():
+ assert isinstance(fn, str)
+ if fn in [FIELD_FID, FIELD_VALUES]:
+ continue
+ line = [fn]
+ for p in profiles:
+ assert isinstance(p, SpectralProfile)
+ line.append(str(p.attribute(fn)))
+ stream.write(delimiter.join(line) + '\n')
+ #
+ line = ['wavelength unit']
+ for p in profiles:
+ line.append(str(p.xUnit()))
+ stream.write(delimiter.join(line) + '\n')
+
+ # write values
+ for i, xValue in enumerate(xValues):
+ line = [str(xValue)]
+ for p in profiles:
+ assert isinstance(p, SpectralProfile)
+ yValue = p.values()['y'][i]
+ line.append(str(yValue))
+ stream.write(delimiter.join(line) + '\n')
+
+ lines = stream.getvalue().replace('\r', '')
+
+ with open(path, 'w', encoding='utf-8') as f:
+ f.write(lines)
+ writtenFiles.append(path)
+
+ return writtenFiles
+
+ @staticmethod
+ def score(uri:str)->int:
+ """
+ Returns a score value for the give uri. E.g. 0 for unlikely/unknown, 20 for yes, probalby thats the file format the reader can read.
+
+ :param uri: str
+ :return: int
+ """
+ return 0
+
+
+ @staticmethod
+ def addExportActions(spectralLibrary:SpectralLibrary, menu:QMenu) -> list:
+
+ def write(speclib: SpectralLibrary):
+
+ path, filter = QFileDialog.getSaveFileName(caption='Write SPECCHIO CSV Spectral Library ',
+ filter='Textfile (*.csv)')
+ if isinstance(path, str) and len(path) > 0:
+ SPECCHIOSpectralLibraryIO.write(spectralLibrary, path)
+
+ m = menu.addAction('SPECCHIO')
+ m.setToolTip('Exports the profiles into the SPECCIO text file format.')
+ m.triggered.connect(lambda *args, sl=spectralLibrary: write(sl))
+
+ @staticmethod
+ def addImportActions(spectralLibrary: SpectralLibrary, menu: QMenu) -> list:
+
+ def read(speclib: SpectralLibrary):
+
+ path, filter = QFileDialog.getOpenFileName(caption='Read SPECCHIO CSV File',
+ filter='All type (*.*);;Text files (*.txt);; CSV (*.csv)')
+ if os.path.isfile(path):
+
+ sl = SPECCHIOSpectralLibraryIO.readFrom(path)
+ if isinstance(sl, SpectralLibrary):
+ speclib.startEditing()
+ speclib.beginEditCommand('Add profiles from {}'.format(path))
+ speclib.addSpeclib(sl, True)
+ speclib.endEditCommand()
+ speclib.commitChanges()
+
+ m = menu.addAction('SPECCHIO')
+ m.setToolTip('Adds profiles stored in an SPECCHIO csv text file.')
+ m.triggered.connect(lambda *args, sl=spectralLibrary: read(sl))
\ No newline at end of file
diff --git a/eotimeseriesviewer/externals/qps/speclib/speclibcsvexportdialog.ui b/eotimeseriesviewer/externals/qps/speclib/speclibcsvexportdialog.ui
new file mode 100644
index 0000000000000000000000000000000000000000..efb0b15ee880b3b62e3f1ecc90651c3d5208e05b
--- /dev/null
+++ b/eotimeseriesviewer/externals/qps/speclib/speclibcsvexportdialog.ui
@@ -0,0 +1,91 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>Dialog</class>
+ <widget class="QDialog" name="Dialog">
+ <property name="geometry">
+ <rect>
+ <x>0</x>
+ <y>0</y>
+ <width>400</width>
+ <height>300</height>
+ </rect>
+ </property>
+ <property name="windowTitle">
+ <string>Dialog</string>
+ </property>
+ <widget class="QDialogButtonBox" name="buttonBox">
+ <property name="geometry">
+ <rect>
+ <x>30</x>
+ <y>240</y>
+ <width>341</width>
+ <height>32</height>
+ </rect>
+ </property>
+ <property name="orientation">
+ <enum>Qt::Horizontal</enum>
+ </property>
+ <property name="standardButtons">
+ <set>QDialogButtonBox::Cancel|QDialogButtonBox::Ok</set>
+ </property>
+ </widget>
+ <widget class="QWidget" name="fileWidget" native="true">
+ <property name="geometry">
+ <rect>
+ <x>100</x>
+ <y>30</y>
+ <width>221</width>
+ <height>31</height>
+ </rect>
+ </property>
+ </widget>
+ <widget class="QLabel" name="label">
+ <property name="geometry">
+ <rect>
+ <x>20</x>
+ <y>40</y>
+ <width>47</width>
+ <height>13</height>
+ </rect>
+ </property>
+ <property name="text">
+ <string>File Name</string>
+ </property>
+ </widget>
+ </widget>
+ <resources/>
+ <connections>
+ <connection>
+ <sender>buttonBox</sender>
+ <signal>accepted()</signal>
+ <receiver>Dialog</receiver>
+ <slot>accept()</slot>
+ <hints>
+ <hint type="sourcelabel">
+ <x>248</x>
+ <y>254</y>
+ </hint>
+ <hint type="destinationlabel">
+ <x>157</x>
+ <y>274</y>
+ </hint>
+ </hints>
+ </connection>
+ <connection>
+ <sender>buttonBox</sender>
+ <signal>rejected()</signal>
+ <receiver>Dialog</receiver>
+ <slot>reject()</slot>
+ <hints>
+ <hint type="sourcelabel">
+ <x>316</x>
+ <y>260</y>
+ </hint>
+ <hint type="destinationlabel">
+ <x>286</x>
+ <y>274</y>
+ </hint>
+ </hints>
+ </connection>
+ </connections>
+</ui>
diff --git a/eotimeseriesviewer/externals/qps/speclib/spectrallibraries.py b/eotimeseriesviewer/externals/qps/speclib/spectrallibraries.py
index 70c112fa8ba95d83cb8ed9ed7d7ebbd008977ad9..08ec9c61a1968de6a12cca5129ea29a2789e410d 100644
--- a/eotimeseriesviewer/externals/qps/speclib/spectrallibraries.py
+++ b/eotimeseriesviewer/externals/qps/speclib/spectrallibraries.py
@@ -1,3 +1,4 @@
+
# -*- coding: utf-8 -*-
# noinspection PyPep8Naming
"""
@@ -30,15 +31,17 @@
"""
#see http://python-future.org/str_literals.html for str issue discussion
-import json, enum, tempfile, pickle, collections
+import json, enum, tempfile, pickle, collections, typing, inspect
from osgeo import ogr, osr
from qgis.utils import iface
from qgis.gui import Targets, QgsMapLayerAction
+from qgis.core import QgsField, QgsVectorLayer, QgsRasterLayer, QgsVectorFileWriter
from ..externals.pyqtgraph import PlotItem
from ..externals import pyqtgraph as pg
from ..models import Option, OptionListModel
from .. utils import *
-from ..speclib import speclibSettings
+from ..speclib import speclibSettings, SpectralLibrarySettingsKey
+from ..plotstyling.plotstyling import PlotStyleWidget, PlotStyle
# get to now how we can import this module
MODULE_IMPORT_PATH = None
@@ -60,15 +63,31 @@ SPECLIB_CRS = QgsCoordinateReferenceSystem('EPSG:{}'.format(SPECLIB_EPSG_CODE))
SPECLIB_CLIPBOARD = weakref.WeakValueDictionary()
-COLOR_CURRENT_SPECTRA = QColor('green')
-COLOR_SELECTED_SPECTRA = QColor('yellow')
-COLOR_BACKGROUND = QColor('black')
-CURRENT_PROFILE_COLOR = QColor('green')
-DEFAULT_PROFILE_COLOR = QColor('white')
+
+OGR_EXTENSION2DRIVER = dict()
+OGR_EXTENSION2DRIVER[''] = [] #list all drivers without specific extension
+
+for i in range(ogr.GetDriverCount()):
+ drv = ogr.GetDriver(i)
+ extensions = drv.GetMetadataItem(gdal.DMD_EXTENSIONS)
+ if isinstance(extensions, str):
+ extensions = extensions.split(',')
+ for ext in extensions:
+ if ext not in OGR_EXTENSION2DRIVER.keys():
+ OGR_EXTENSION2DRIVER[ext] = []
+ OGR_EXTENSION2DRIVER[ext].append(drv.GetName())
+ else:
+ OGR_EXTENSION2DRIVER[''].append(drv.GetName())
+OGR_EXTENSION2DRIVER[None] = OGR_EXTENSION2DRIVER['']
DEBUG = False
+class SerializationMode(enum.Enum):
+
+ JSON = 1
+ PICKLE = 2
+SERIALIZATION = SerializationMode.PICKLE
def log(msg:str):
if DEBUG:
@@ -97,7 +116,7 @@ PICKLE_PROTOCOL = pickle.HIGHEST_PROTOCOL
# DEFAULT_SPECTRUM_STYLE.linePen.setColor(Qt.white)
EMPTY_VALUES = [None, NULL, QVariant(), '', 'None']
-EMPTY_PROFILE_VALUES = {'x': None, 'y': None, 'xUnit': None, 'yUnit': None}
+EMPTY_PROFILE_VALUES = {'x': None, 'y': None, 'xUnit': None, 'yUnit': None, 'bbl': None}
FIELD_VALUES = 'values'
FIELD_NAME = 'name'
@@ -209,7 +228,7 @@ def findTypeFromString(value:str):
continue
return t
- #every values can be converted into a string
+ # every values can be converted into a string
return str
def setComboboxValue(cb: QComboBox, text: str):
@@ -272,27 +291,39 @@ def encodeProfileValueDict(d:dict)->str:
d2 = {}
for k in EMPTY_PROFILE_VALUES.keys():
v = d.get(k)
-
# save keys with information only
if v is not None:
d2[k] = v
- return json.dumps(d2, sort_keys=True, separators=(',', ':'))
+ if SERIALIZATION == SerializationMode.JSON:
+ return json.dumps(d2, sort_keys=True, separators=(',', ':'))
+ elif SERIALIZATION == SerializationMode.PICKLE:
+ return QByteArray(pickle.dumps(d2))
+ else:
+ raise NotImplementedError()
+
-def decodeProfileValueDict(jsonDump:str):
+def decodeProfileValueDict(dump):
"""
- Converts a json string into a SpectralProfile value dictionary
- :param jsonDump: str
+ Converts a json / pickle dump into a SpectralProfile value dictionary
+ :param dump: str
:return: dict
"""
d = EMPTY_PROFILE_VALUES.copy()
- if isinstance(jsonDump, str):
- d2 = json.loads(jsonDump)
+
+ if dump not in EMPTY_VALUES:
+ d2 = None
+ if SERIALIZATION == SerializationMode.JSON:
+ d2 = json.loads(dump)
+ elif SERIALIZATION == SerializationMode.PICKLE:
+ d2 = pickle.loads(dump)
+ else:
+ raise NotImplementedError()
d.update(d2)
return d
def qgsFieldAttributes2List(attributes)->list:
- """Returns a list of attibutes with None instead of NULL or QVariatn("""
+ """Returns a list of attributes with None instead of NULL or QVariant.NULL"""
r = QVariant(None)
return [None if v == r else v for v in attributes]
@@ -338,11 +369,10 @@ def ogrStandardFields()->list:
fields = [
ogr.FieldDefn(FIELD_FID, ogr.OFTInteger),
ogr.FieldDefn(FIELD_NAME, ogr.OFTString),
- #ogr.FieldDefn('x_unit', ogr.OFTString),
- #ogr.FieldDefn('y_unit', ogr.OFTString),
ogr.FieldDefn('source', ogr.OFTString),
- ogr.FieldDefn(FIELD_VALUES, ogr.OFTString),
- #ogr.FieldDefn(FIELD_STYLE, ogr.OFTString),
+ ogr.FieldDefn(FIELD_VALUES, ogr.OFTString) \
+ if SERIALIZATION == SerializationMode.JSON else \
+ ogr.FieldDefn(FIELD_VALUES, ogr.OFTBinary),
]
return fields
@@ -360,6 +390,8 @@ def createStandardFields():
a, b = QVariant.Int, 'int'
elif ogrType in [ogr.OFTReal]:
a, b = QVariant.Double, 'double'
+ elif ogrType in [ogr.OFTBinary]:
+ a, b = QVariant.ByteArray, 'Binary'
else:
raise NotImplementedError()
@@ -391,6 +423,29 @@ class SpectralProfile(QgsFeature):
crs = SPECLIB_CRS
+ @staticmethod
+ def profileName(basename:str, pxPosition:QPoint=None, geoPosition:QgsPointXY=None, index:int=None):
+ """
+ Unified method to generate the name of a single profile
+ :param basename: base name
+ :param pxPosition: optional, pixel position in source image
+ :param geoPosition: optional, pixel position in geo-coordinates
+ :param index: index, e.g. n'th-1 profile that was sampled from a data set
+ :return: name
+ """
+
+
+ name = basename
+
+ if isinstance(index, int):
+ name += str(index)
+
+ if isinstance(pxPosition, QPoint):
+ name += '({}:{})'.format(pxPosition.x(), pxPosition.y())
+ elif isinstance(geoPosition, QgsPoint):
+ name += '({}:{})'.format(geoPosition.x(), geoPosition.y())
+ return name.replace(' ', ':')
+
@staticmethod
def fromMapCanvas(mapCanvas, position)->list:
"""
@@ -434,7 +489,7 @@ class SpectralProfile(QgsFeature):
return None
profile = SpectralProfile()
- profile.setName('{} {}'.format(layer.name(), position))
+ profile.setName(SpectralProfile.profileName(layer.name(), geoPosition=position))
profile.setValues(x=wl, y=y, xUnit=wlu)
@@ -509,7 +564,7 @@ class SpectralProfile(QgsFeature):
wl, wlu = parseWavelength(ds)
profile = SpectralProfile(fields=fields)
- profile.setName('{} {},{}'.format(baseName, px.x(), px.y()))
+ profile.setName(SpectralProfile.profileName(baseName, pxPosition=px))
profile.setValues(x=wl, y=y, xUnit=wlu)
profile.setCoordinates(geoCoordinate)
profile.setSource('{}'.format(ds.GetDescription()))
@@ -553,16 +608,20 @@ class SpectralProfile(QgsFeature):
- def fieldNames(self):
+ def fieldNames(self)->typing.List[str]:
+ """
+ Returns all field names
+ :return:
+ """
return self.fields().names()
def setName(self, name:str):
if name != self.name():
- self.setAttribute('name', name)
+ self.setAttribute(FIELD_NAME, name)
#self.sigNameChanged.emit(name)
- def name(self):
- return self.metadata('name')
+ def name(self)->str:
+ return self.metadata(FIELD_NAME)
def setSource(self, uri: str):
self.setAttribute('source', uri)
@@ -580,28 +639,6 @@ class SpectralProfile(QgsFeature):
def geoCoordinate(self):
return self.geometry()
- #def style(self)->PlotStyle:
- # """
- # Returns this features's PlotStyle
- # :return: PlotStyle
- # """
- # styleJson = self.metadata(FIELD_STYLE)
- # try:
- # style = PlotStyle.fromJSON(styleJson)
- # except Exception as ex:
- # style = DEFAULT_SPECTRUM_STYLE
- # return style
-
- #def setStyle(self, style:PlotStyle):
- # """
- # Sets a Spectral Profiles's plot style
- # :param style: PLotStyle
- # """
- # if isinstance(style, PlotStyle):
- # self.setMetadata(FIELD_STYLE, style.json())
- # else:
- # self.setMetadata(FIELD_STYLE, None)
-
def updateMetadata(self, metaData):
if isinstance(metaData, dict):
for key, value in metaData.items():
@@ -657,10 +694,18 @@ class SpectralProfile(QgsFeature):
v = None
return default if v is None else v
+ def nb(self)->int:
+ """
+ Returns the number of profile bands / profile values
+ :return: int
+ :rtype:
+ """
+ return len(self.yValues())
+
def values(self)->dict:
"""
Returns a dictionary with 'x', 'y', 'xUnit' and 'yUnit' values.
- :return: {'x':list,'y':list,'xUnit':str,'yUnit':str}
+ :return: {'x':list,'y':list,'xUnit':str,'yUnit':str, 'bbl':list}
"""
if self.mValueCache is None:
jsonStr = self.attribute(self.fields().indexFromName(FIELD_VALUES))
@@ -671,7 +716,7 @@ class SpectralProfile(QgsFeature):
return self.mValueCache
- def setValues(self, x=None, y=None, xUnit=None, yUnit=None):
+ def setValues(self, x=None, y=None, xUnit=None, yUnit=None, bbl=None):
d = self.values().copy()
@@ -681,16 +726,22 @@ class SpectralProfile(QgsFeature):
if isinstance(y, np.ndarray):
y = y.tolist()
+ if isinstance(bbl, np.ndarray):
+ bbl = bbl.astype(bool).tolist()
+
if isinstance(x, list):
d['x'] = x
if isinstance(y, list):
d['y'] = y
- # ensure x/y are list or None
+ if isinstance(bbl, list):
+ d['bbl'] = bbl
+
+ # ensure x/y/bbl are list or None
assert d['x'] is None or isinstance(d['x'], list)
assert d['y'] is None or isinstance(d['y'], list)
-
+ assert d['bbl'] is None or isinstance(d['bbl'], list)
# ensure same length
if isinstance(d['x'], list):
@@ -699,6 +750,11 @@ class SpectralProfile(QgsFeature):
assert len(d['x']) == len(d['y']), \
'x and y need to have the same number of values ({} != {})'.format(len(d['x']), len(d['y']))
+ if isinstance(d['bbl'], list):
+ assert isinstance(d['y'], list), 'y values need to be specified'
+ assert len(d['bbl']) == len(d['y']), \
+ 'y and bbl need to have the same number of values ({} != {})'.format(len(d['y']), len(d['bbl']))
+
if isinstance(xUnit, str):
d['xUnit'] = xUnit
if isinstance(yUnit, str):
@@ -735,6 +791,16 @@ class SpectralProfile(QgsFeature):
else:
return y
+ def bbl(self)->list:
+ """
+ Returns the BadBandList.
+ :return:
+ :rtype:
+ """
+ bbl = self.values().get('bbl')
+ if not isinstance(bbl, list):
+ bbl = np.ones(self.nb(), dtype=np.byte).tolist()
+ return bbl
def setXUnit(self, unit : str):
d = self.values()
@@ -796,10 +862,10 @@ class SpectralProfile(QgsFeature):
pi = SpectralProfilePlotDataItem(self)
pi.setClickable(True)
pw = pg.plot( title=self.name())
- pw.plotItem().addItem(pi)
+ pw.getPlotItem().addItem(pi)
pi.setColor('green')
- pg.QAPP.exec_()
+ #pg.QAPP.exec_()
def __reduce_ex__(self, protocol):
@@ -849,6 +915,8 @@ class SpectralProfile(QgsFeature):
return False
if self.yValues() != other.yValues():
return False
+ if self.xUnit() != other.xUnit():
+ return False
else:
i2 = names2.index(n)
if self.attribute(i1) != other.attribute(i2):
@@ -969,7 +1037,9 @@ class SpectralLibrary(QgsVectorLayer):
def readFromVector(vector_qgs_layer:QgsVectorLayer=None,
raster_qgs_layer:QgsRasterLayer=None,
progressDialog:QProgressDialog=None,
- all_touched=False):
+ nameField=None,
+ all_touched=False,
+ returnProfileList=False):
"""
Reads SpectraProfiles from a raster source, based on the locations specified in a vector data set.
Opens a Select Polygon Layer dialog to select the correct polygon and returns a Spectral Library with
@@ -978,26 +1048,23 @@ class SpectralLibrary(QgsVectorLayer):
:param vector_qgs_layer: QgsVectorLayer | str
:param raster_qgs_layer: QgsRasterLayer | str
:param progressDialog: QProgressDialog (optional)
+ :param nameField: str | int | QgsField that is used to generate individual profile names.
:param all_touched: bool, False (default) = extract only pixel entirely covered with a geometry
True = extract all pixels touched by a geometry
- :return: Spectral Library
+ :param returnProfileList: bool, False (default) = return a SpectralLibrary
+ True = return a [list-of-SpectralProfiles] and skip the SpectralLibrary generations.
+ :return: Spectral Library | [list-of-profiles]
"""
- # for debugging only
- # layers = [l for l in canvas.layers()]
- # vector_qgs_layer = layers[0]
- # raster_qgs_layer = layers[1]
- # assert isinstance(vector_qgs_layer, QgsVectorLayer)
- # assert isinstance(raster_qgs_layer, QgsRasterLayer)
-
# the SpectralLibrary to be returned
spectral_library = SpectralLibrary()
- if isinstance(vector_qgs_layer, str):
- vector_qgs_layer = QgsVectorLayer(vector_qgs_layer)
-
- if isinstance(raster_qgs_layer, str):
- raster_qgs_layer = QgsRasterLayer(raster_qgs_layer)
+ # homogenize source file formats
+ try:
+ vector_qgs_layer = qgsVectorLayer(vector_qgs_layer)
+ raster_qgs_layer = qgsRasterLayer(raster_qgs_layer)
+ except Exception as ex:
+ print(ex, file=sys.stderr)
# get QgsLayers of vector and raster
from ..utils import SelectMapLayersDialog
@@ -1014,7 +1081,6 @@ class SpectralLibrary(QgsVectorLayer):
return
# get the shapefile fields and check the minimum requirements
- # standard_fields = qgsStandardFields()
# field in the vector source
vector_fields = vector_qgs_layer.fields()
@@ -1024,84 +1090,94 @@ class SpectralLibrary(QgsVectorLayer):
# fields we need to copy values from the vector source to each SpectralProfile
fields_to_copy = []
-
for field in vector_fields:
if speclib_fields.indexOf(field.name()) == -1:
speclib_fields.append(QgsField(field))
fields_to_copy.append(field.name())
+ options = QgsVectorFileWriter.SaveVectorOptions()
+ options.driverName = 'GPKG'
+ # set spatial filter in destination CRS
+ options.filterExtent = SpatialExtent.fromLayer(raster_qgs_layer)
+ #options.filterExtent = SpatialExtent.fromLayer(raster_qgs_layer).toCrs(vector_qgs_layer.crs())
+ options.destCRS = raster_qgs_layer.crs()
+ tmpPath = '/vsimem/tmp_transform{}.gpkg'.format(vector_qgs_layer.name())
+ ct = QgsCoordinateTransform()
+ ct.setSourceCrs(vector_qgs_layer.crs())
+ ct.setDestinationCrs(raster_qgs_layer.crs())
+ options.ct = ct
+ error = QgsVectorFileWriter.writeAsVectorFormat(layer=vector_qgs_layer,
+ fileName=tmpPath,
+ options=options)
+ vector_qgs_layer.disconnect()
+ del vector_qgs_layer
+
+ # make the internal FID a normal attribute which gdal can rasterize
+ tmp_qgs_layer = QgsVectorLayer(tmpPath)
+ if tmp_qgs_layer.featureCount() == 0:
+ info = 'No intersection between\nraster {} and vector {}'.format(raster_qgs_layer.source(), vector_qgs_layer.source())
+ print(info)
+ if isinstance(progressDialog, QProgressDialog):
+ progressDialog.setLabelText('No intersection between raster and vector source')
+ progressDialog.setValue(progressDialog.maximum())
+ return spectral_library
+ assert isinstance(tmp_qgs_layer, QgsVectorLayer)
+ assert tmp_qgs_layer.isValid()
+ assert tmp_qgs_layer.startEditing()
+ fidName = 'tmpFID'
+ i = 1
+ while fidName in tmp_qgs_layer.fields().names():
+ fidName = 'tmpFID{}'.format(i)
+ i += 1
+ tmp_qgs_layer.addAttribute(QgsField(fidName, QVariant.Int, 'int'))
+ assert tmp_qgs_layer.commitChanges()
+ assert fidName in tmp_qgs_layer.fields().names()
+
+ # let the tmpFID be fid + 1, so that there is not negative or zero tmpFID
+ # this will be the value to be burned into the gdal raster
+ assert tmp_qgs_layer.startEditing()
+
+ i = tmp_qgs_layer.fields().lookupField(fidName)
+ for fid in [fid for fid in tmp_qgs_layer.allFeatureIds() if fid >= 0]:
+ tmp_qgs_layer.changeAttributeValue(fid, i, fid+1)
+ assert tmp_qgs_layer.commitChanges()
# get ORG/GDAL dataset and OGR/GDAL layer of vector and raster
- drv = ogr.GetDriverByName('Memory')
- assert isinstance(drv, ogr.Driver)
- # load vector data into memory
- vector_dataset = drv.CopyDataSource(ogrDataSource(vector_qgs_layer), '')
- assert isinstance(vector_dataset, ogr.DataSource)
+ tmp_ogrDataSource = ogr.Open(tmpPath)
+ assert isinstance(tmp_ogrDataSource, ogr.DataSource)
+ assert tmp_ogrDataSource.GetLayerCount() == 1
+ tmp_ogrLayer = tmp_ogrDataSource.GetLayer(0)
+ assert isinstance(tmp_ogrLayer, ogr.Layer)
+
raster_dataset = gdal.Open(raster_qgs_layer.source())
- bn = os.path.basename(raster_dataset.GetDescription())
- assert isinstance(raster_dataset, gdal.Dataset)
+ badBandList = parseBadBandList(raster_dataset)
wl, wlu = parseWavelength(raster_dataset)
+ bn = os.path.basename(raster_dataset.GetDescription())
+ assert isinstance(raster_dataset, gdal.Dataset)
- iLayer = 0
- layerNames = [vector_dataset.GetLayer(i).GetName() for i in range(vector_dataset.GetLayerCount())]
- match = re.search('layername=([^|,;]+)', vector_qgs_layer.source())
- if match:
- layerName = match.group(1)
- if layerName in layerNames:
- iLayer = layerNames.index(layerName)
-
- vector_layer = vector_dataset.GetLayer(iLayer)
- assert isinstance(vector_layer, ogr.Layer)
- ldefn = vector_layer.GetLayerDefn()
- assert isinstance(ldefn, ogr.FeatureDefn)
- fieldNames = [ldefn.GetFieldDefn(i).GetName() for i in range(ldefn.GetFieldCount())]
-
- # make the internal FID a normal attribute which we can rasterize
- fidName = 'FID'
- iProfile = 0
- while fidName in fieldNames:
- fidName = 'tmpFID{}'.format(iProfile)
- vector_layer.CreateField(ogr.FieldDefn(fidName, ogr.OFTInteger64))
- # transform geometries to raster SRS
- srsVector = vector_layer.GetSpatialRef()
- srsRaster = osr.SpatialReference()
- srsRaster.ImportFromWkt(raster_dataset.GetProjection())
-
- trans = osr.CoordinateTransformation(srsVector, srsRaster)
- assert isinstance(trans, osr.CoordinateTransformation)
- for feature in vector_layer:
- assert isinstance(feature, ogr.Feature)
- feature.SetField(fidName, feature.GetFID()+1) # let the smalled fid be 1
-
- # assert geom.Transform(trans) == ogr.OGRERR_NONE
- # wow! gdal.Rasterize considers SRS differences
- # geom = feature.GetGeometryRef()
- # feature.SetGeometry(geom)
- vector_layer.SetFeature(feature)
-
- vector_layer.ResetReading()
-
- # vector to array to x and y values
- driver = gdal.GetDriverByName('MEM')
- mem = driver.Create('', raster_dataset.RasterXSize, raster_dataset.RasterYSize, 1, gdal.GDT_UInt32)
- assert isinstance(mem, gdal.Dataset)
- band = mem.GetRasterBand(1)
+ # create in-memory raster to burn the tempFID into
+ memDrv = gdal.GetDriverByName('MEM')
+ memRaster = memDrv.Create('', raster_dataset.RasterXSize, raster_dataset.RasterYSize, 1, gdal.GDT_UInt32)
+ assert isinstance(memRaster, gdal.Dataset)
+ band = memRaster.GetRasterBand(1)
assert isinstance(band, gdal.Band)
band.Fill(0)
- mem.SetGeoTransform(raster_dataset.GetGeoTransform())
- mem.SetProjection(raster_dataset.GetProjection())
- mem.FlushCache()
+ memRaster.SetGeoTransform(raster_dataset.GetGeoTransform())
+ memRaster.SetProjection(raster_dataset.GetProjection())
+ memRaster.FlushCache()
all_touched = 'TRUE' if all_touched else 'FALSE'
- gdal.RasterizeLayer(mem, [1], vector_layer,
+ gdal.RasterizeLayer(memRaster, [1], tmp_ogrLayer,
options=['ALL_TOUCHED={}'.format(all_touched),
'ATTRIBUTE={}'.format(fidName)])
- memory_array = mem.ReadAsArray()
- y, x = np.where(memory_array > 0)
+ # read the burned tmpFIDs
+ tmpFIDArray = memRaster.ReadAsArray()
+ y, x = np.where(tmpFIDArray > 0)
n_profiles = len(y)
- memory_array = memory_array - 1 # decrease FID by 1 (we already got the right positions
-
+ # decrease tmpFID array by 1 (we already got the right positions)
+ # it now contains the real FID values
+ tmpFIDArray = tmpFIDArray - 1
if n_profiles == 0:
# no profiles to extract. Return an empty speclib
@@ -1113,44 +1189,46 @@ class SpectralLibrary(QgsVectorLayer):
progressDialog.setRange(0, raster_dataset.RasterCount + n_profiles + 1)
progressDialog.setValue(0)
- progressDialog.setLabelText('Read profiles...')
-
- fids = memory_array[y, x]
- unique_fids = list(np.unique(fids))
- driver = None
+ progressDialog.setLabelText('Read {} profiles...'.format(n_profiles))
- percentage_to_extract = float(len(y)) / (mem.RasterXSize * mem.RasterYSize)
+ fids = tmpFIDArray[y, x]
+ unique_fids = np.unique(fids).tolist()
+ fids = fids.tolist()
- del vector_layer, memory_array, mem, driver
+ del tmp_ogrLayer, tmpFIDArray, memRaster, memDrv
# save all profiles in a spectral library
profiles = []
- # transform x/y pixel position into speclib crs
+ # transform x/y pixel position into the speclib crs
rasterCRS = raster_qgs_layer.crs()
rasterGT = raster_dataset.GetGeoTransform()
+
rasterSRS = osr.SpatialReference()
- speclibSRS = osr.SpatialReference()
rasterSRS.ImportFromWkt(rasterCRS.toWkt())
+ speclibSRS = osr.SpatialReference()
speclibSRS.ImportFromWkt(spectral_library.crs().toWkt())
- transCRS = QgsCoordinateTransform()
- transCRS.setSourceCrs(rasterCRS)
- transCRS.setDestinationCrs(spectral_library.crs())
+ # GDAL 3.0 considers authority specific axis order
+ # see https://github.com/OSGeo/gdal/issues/1974
+ # https://gdal.org/tutorials/osr_api_tut.html
+ rasterSRS.SetAxisMappingStrategy(osr.OAMS_TRADITIONAL_GIS_ORDER)
+ speclibSRS.SetAxisMappingStrategy(osr.OAMS_TRADITIONAL_GIS_ORDER)
# transform many coordinates fast!
transSRS = osr.CoordinateTransformation(rasterSRS, speclibSRS)
# geo-coordinate in raster CRS
- if True: # pixel center
- x2, y2 = x+0.5, y+0.5
+ # move to pixel center
+ if True:
+ x2, y2 = x + 0.5, y + 0.5
else:
x2, y2 = x, y
- # transSRS.TransformPoints(np.ones((n_points, 2)))
geo_coordinates = np.empty((n_profiles, 2), dtype=np.float)
geo_coordinates[:, 0] = rasterGT[0] + x2 * rasterGT[1] + y2 * rasterGT[2]
geo_coordinates[:, 1] = rasterGT[3] + x2 * rasterGT[4] + y2 * rasterGT[5]
+
geo_coordinates = transSRS.TransformPoints(geo_coordinates)
attr_idx_profile = []
@@ -1164,7 +1242,7 @@ class SpectralLibrary(QgsVectorLayer):
# store relevant features in memory for faster accesss
features = {}
featureAttributes = {}
- for f in vector_qgs_layer.getFeatures(unique_fids):
+ for f in tmp_qgs_layer.getFeatures(unique_fids):
assert isinstance(f, QgsFeature)
features[f.id()] = f
@@ -1178,8 +1256,6 @@ class SpectralLibrary(QgsVectorLayer):
profileData = None
- # should we consider a band-band-list?
-
for b in range(raster_dataset.RasterCount):
if isinstance(progressDialog, QProgressDialog):
if progressDialog.wasCanceled():
@@ -1199,14 +1275,34 @@ class SpectralLibrary(QgsVectorLayer):
del raster_dataset, bandData
-
-
- # 2. profiles with source vector metadata
-
- wasPointGeometry = vector_qgs_layer.wkbType() in [QgsWkbTypes.Point, QgsWkbTypes.PointGeometry]
+ # 2. write profiles + some meta data from the source vector file
+ wasPointGeometry = tmp_qgs_layer.wkbType() in [QgsWkbTypes.Point, QgsWkbTypes.PointGeometry]
if wasPointGeometry:
pass
+ # which field is to choose to describe the spectrum name?
+ nameFieldIndex = None
+ if isinstance(nameField, int):
+ nameFieldIndex = nameField
+ elif isinstance(nameField, QgsField):
+ nameFieldIndex = vector_fields.lookupField(nameField.name())
+ elif isinstance(nameField, str):
+ nameFieldIndex = vector_fields.lookupField(nameField)
+
+ if nameFieldIndex is None:
+ for i, field in enumerate(vector_fields):
+ assert isinstance(field, QgsField)
+ if field.type() == QVariant.String and re.search(field.name(), 'Name', re.I):
+ nameFieldIndex = vector_fields.lookupField(field.name())
+ break
+ if nameFieldIndex is None:
+ for i, field in enumerate(vector_fields):
+ assert isinstance(field, QgsField)
+ if re.search(field.name(), '^(fid|id)$', re.I):
+ nameFieldIndex = vector_fields.lookupField(field.name())
+ break
+
+ profileNameCounts = dict() # dictionary to store spectra names
for iProfile, fid, in enumerate(fids):
if isinstance(progressDialog, QProgressDialog):
@@ -1218,39 +1314,65 @@ class SpectralLibrary(QgsVectorLayer):
assert isinstance(feature, QgsFeature)
profile = SpectralProfile(fields=speclib_fields)
- # 2.1 set profile id + name
+ # 2.1 set profile id
profile.setId(iProfile)
- px_x, px_y = x[iProfile], y[iProfile]
- profile.setName('{} {},{}'.format(bn, px_x, px_y))
- # 2.2 set geometry
+ # 2.2. set profile name
+ if nameFieldIndex is None:
+ px_x, px_y = x[iProfile], y[iProfile]
+ profileName = '{} {},{}'.format(bn, px_x, px_y)
+ else:
+ profileName = str(feature.attribute(nameFieldIndex))
+
+ n = profileNameCounts.get(profileName)
+ # n = 1 -> Foobar
+ # n > 1 -> Foobar (n)
+ if n is None:
+ profileNameCounts[profileName] = 1
+ else:
+ profileNameCounts[profileName] = n + 1
+ profileName = profileName + ' ({})'.format(n + 1)
+ profile.setName(profileName)
+
+ # 2.3 set geometry
g = geo_coordinates[iProfile]
profile.setGeometry(QgsPoint(g[0], g[1]))
- # 2.3 copy vector feature attribute
+ # 2.4 copy vector feature attribute
for idx_p, idx_f in zip(attr_idx_profile, attr_idx_feature):
profile.setAttribute(idx_p, feature.attribute(idx_f))
- # 2.4 set the profile values
- profile.setValues(x=wl, y=profileData[:, iProfile], xUnit=wlu)
+ # 2.5 set the profile values
+ profile.setValues(x=wl, y=profileData[:, iProfile], xUnit=wlu, bbl=badBandList)
profiles.append(profile)
+ if returnProfileList:
+ return profiles
if isinstance(progressDialog, QProgressDialog):
progressDialog.setLabelText('Create speclib...')
- spectral_library.startEditing()
+ assert spectral_library.startEditing()
spectral_library.addMissingFields(vector_fields)
+ assert spectral_library.commitChanges()
+ assert spectral_library.startEditing()
# spectral_library.addProfiles(profiles)
if not spectral_library.addFeatures(profiles, QgsFeatureSink.FastInsert):
s = ""
- spectral_library.commitChanges()
+
+ if not spectral_library.commitChanges():
+ s = ""
if isinstance(progressDialog, QProgressDialog):
# print('{} {} {}'.format(progressDialog.minimum(), progressDialog.maximum(), progressDialog.value()))
progressDialog.setValue(progressDialog.value()+1)
+ tmp_qgs_layer.disconnect()
+ del tmp_qgs_layer
+ gdal.Unlink(tmpPath)
+
+
return spectral_library
@@ -1263,7 +1385,7 @@ class SpectralLibrary(QgsVectorLayer):
:param mode:
:return:
"""
-
+ warnings.warn(DeprecationWarning(r'Use readFromVector instead'))
assert mode in ['CENTROIDS', 'AVERAGES', 'PIXELS']
if isinstance(rasterSource, str):
@@ -1586,7 +1708,7 @@ class SpectralLibrary(QgsVectorLayer):
@staticmethod
- def readFrom(uri):
+ def readFrom(uri, progressDialog:QProgressDialog=None):
"""
Reads a Spectral Library from the source specified in "uri" (path, url, ...)
:param uri: path or uri of the source from which to read SpectralProfiles and return them in a SpectralLibrary
@@ -1603,12 +1725,13 @@ class SpectralLibrary(QgsVectorLayer):
readers = AbstractSpectralLibraryIO.__subclasses__()
for cls in sorted(readers, key=lambda r:r.score(uri)):
- if cls.canRead(uri):
- return cls.readFrom(uri)
+ try:
+ if cls.canRead(uri):
+ return cls.readFrom(uri, progressDialog=progressDialog)
+ except Exception as ex:
+ s = ""
return None
-
-
sigNameChanged = pyqtSignal(str)
__refs__ = []
@@ -1691,8 +1814,9 @@ class SpectralLibrary(QgsVectorLayer):
"""
Initializes the default QgsFeatureRenderer
"""
- self.renderer().symbol().setColor(DEFAULT_PROFILE_COLOR)
- s = ""
+ color = speclibSettings().value('DEFAULT_PROFILE_COLOR', QColor('green'))
+ self.renderer().symbol().setColor(color)
+
def initTableConfig(self):
"""
@@ -1816,7 +1940,7 @@ class SpectralLibrary(QgsVectorLayer):
# self.dataProvider().addAttributes(missingFields)
- def addSpeclib(self, speclib, addMissingFields=True):
+ def addSpeclib(self, speclib, addMissingFields=True, progressDialog:QProgressDialog=None):
"""
Adds another SpectraLibrary
:param speclib: SpectralLibrary
@@ -1824,69 +1948,85 @@ class SpectralLibrary(QgsVectorLayer):
"""
assert isinstance(speclib, SpectralLibrary)
- self.addProfiles(speclib.profiles(), addMissingFields=addMissingFields)
+ self.addProfiles(speclib, addMissingFields=addMissingFields, progressDialog=progressDialog)
s = ""
- def addProfiles(self, profiles, addMissingFields:bool=None):
-
- if addMissingFields is None:
- addMissingFields = isinstance(profiles, SpectralLibrary)
+ def addProfiles(self, profiles:typing.Union[typing.List[SpectralProfile], QgsVectorLayer],
+ addMissingFields:bool=None,
+ progressDialog:QProgressDialog=None):
if isinstance(profiles, SpectralProfile):
profiles = [profiles]
- elif isinstance(profiles, SpectralLibrary):
- profiles = profiles.profiles()
- profiles = list(profiles)
+ if addMissingFields is None:
+ addMissingFields = isinstance(profiles, SpectralLibrary)
if len(profiles) == 0:
return
assert self.isEditable(), 'SpectralLibrary "{}" is not editable. call startEditing() first'.format(self.name())
-
- profiles2 = []
- fieldLookup={}
- def createCopy(srcFeature:QgsFeature)->QgsFeature:
- p2 = QgsFeature(self.fields())
- srcAttributes = srcFeature.attributes()
- p2.setGeometry(srcFeature.geometry())
- for i1, i2 in fieldLookup.items():
- v = srcAttributes[i1]
- p2.setAttribute(i2, None if v == QVariant(None) else v)
- return p2
-
- pRef = profiles[0]
- if addMissingFields:
- self.addMissingFields(pRef.fields())
+ if isinstance(progressDialog, QProgressDialog):
+ progressDialog.setLabelText('Add {} profiles'.format(len(profiles)))
+ progressDialog.setValue(0)
+ progressDialog.setRange(0, len(profiles))
iSrcList = []
iDstList = []
- for i1, srcName in enumerate(pRef.fields().names()):
- if srcName == FIELD_FID:
- continue
- i2 = self.fields().lookupField(srcName)
- if i2 >= 0:
- iSrcList.append(i1)
- iDstList.append(i2)
- fieldLookup[i1] = i2
- elif addMissingFields:
- raise Exception('Missing field: "{}"'.format(srcName))
- # create new features + copy geometry
+ bufferLength = 500
+ profileBuffer = []
+
+ nAdded = 0
+
+ def flushBuffer():
+ nonlocal self, nAdded, profileBuffer, progressDialog
+ if not self.addFeatures(profileBuffer):
+ self.raiseError()
+ nAdded += len(profileBuffer)
+ #print('added {}'.format(len(profileBuffer)))
+ profileBuffer.clear()
+
+ if isinstance(progressDialog, QProgressDialog):
+ progressDialog.setValue(nAdded)
- for pSrc in profiles:
+ QApplication.processEvents()
+
+
+
+ for i, pSrc in enumerate(profiles):
+ #print(i)
+ if i == 0:
+ if addMissingFields:
+ self.addMissingFields(pSrc.fields())
+
+ for iSrc, srcName in enumerate(pSrc.fields().names()):
+ if srcName == FIELD_FID:
+ continue
+ iDst = self.fields().lookupField(srcName)
+ if iDst >= 0:
+ iSrcList.append(iSrc)
+ iDstList.append(iDst)
+ elif addMissingFields:
+ raise Exception('Missing field: "{}"'.format(srcName))
+
+ # create new feature + copy geometry
pDst = QgsFeature(self.fields())
pDst.setGeometry(pSrc.geometry())
- profiles2.append(pDst)
- for iSrc, iDst in zip(iSrcList,iDstList):
- for pSrc, pDst in zip(profiles, profiles2):
+ # copy attributes
+ for iSrc, iDst in zip(iSrcList, iDstList):
pDst.setAttribute(iDst, pSrc.attribute(iSrc))
- if not self.addFeatures(profiles2):
- self.raiseError()
- s = ""
+ profileBuffer.append(pDst)
+
+ if len(profileBuffer) >= bufferLength:
+ flushBuffer()
+
+
+ flushBuffer()
+
+ #s = ""
def speclibFromFeatureIDs(self, fids):
if isinstance(fids, int):
@@ -1937,13 +2077,13 @@ class SpectralLibrary(QgsVectorLayer):
for fid in fids:
assert isinstance(fid, int)
featureRequest.setFilterFids(fids)
- # features = [f for f in self.features() if f.id() in fids]
+ # features = [f for f in self.features() if f.id() in fidsToRemove]
return self.getFeatures(featureRequest)
- def profiles(self, fids=None):
+ def profiles(self, fids=None)->typing.Generator[SpectralProfile, None, None]:
"""
- Like features(fids=None), but converts each returned QgsFeature into a SpectralProfile
+ Like features(fidsToRemove=None), but converts each returned QgsFeature into a SpectralProfile
:param fids: optional, [int-list-of-feature-ids] to return
:return: generator of [List-of-SpectralProfiles]
"""
@@ -2118,9 +2258,9 @@ class SpectralLibrary(QgsVectorLayer):
self.commitChanges()
- def __len__(self):
+ def __len__(self)->int:
cnt = self.featureCount()
- #can be -1 if the number of features is unknown
+ # can be -1 if the number of features is unknown
return max(cnt, 0)
def __iter__(self):
@@ -2161,10 +2301,9 @@ class SpectralLibrary(QgsVectorLayer):
class AbstractSpectralLibraryIO(object):
"""
Abstract class interface to define I/O operations for spectral libraries
- Overwrite the canRead and read From routines.
"""
@staticmethod
- def canRead(path):
+ def canRead(path:str)->bool:
"""
Returns true if it can read the source defined by path
:param path: source uri
@@ -2173,18 +2312,24 @@ class AbstractSpectralLibraryIO(object):
return False
@staticmethod
- def readFrom(path):
+ def readFrom(path:str, progressDialog:QProgressDialog=None)->SpectralLibrary:
"""
Returns the SpectralLibrary read from "path"
- :param path: source of SpectralLibrary
+ :param path: source of Spectral Library
+ :param progressDialog: QProgressDialog, which well-behave implementations can use to show the import progress.
:return: SpectralLibrary
"""
return None
@staticmethod
- def write(speclib, path):
- """Writes the SpectralLibrary to path and returns a list of written files that can be used to open
- the spectral library with readFrom"""
+ def write(speclib:SpectralLibrary, path:str, progressDialog:QProgressDialog)->typing.List[str]:
+ """
+ Writes the SpectralLibrary.
+ :param speclib: SpectralLibrary to write
+ :param path: file path to write the SpectralLibrary to
+ :param progressDialog: QProgressDialog, which well-behave implementations can use to show the writting progress.
+ :return: a list of paths that can be used to re-open all written profiles
+ """
assert isinstance(speclib, SpectralLibrary)
return []
@@ -2199,6 +2344,31 @@ class AbstractSpectralLibraryIO(object):
"""
return 0
+ @staticmethod
+ def filterString()->str:
+ """
+ Returns a Qt file filter string
+ :return:
+ :rtype:
+ """
+
+ return None
+
+ @staticmethod
+ def addImportActions(spectralLibrary:SpectralLibrary, menu:QMenu):
+ """
+ Returns a list of QActions or QMenus that can be called to read/import SpectralProfiles from a certain file format into a SpectralLibrary
+ :param spectralLibrary: SpectralLibrary to import SpectralProfiles to
+ :return: [list-of-QAction-or-QMenus]
+ """
+
+ @staticmethod
+ def addExportActions(spectralLibrary:SpectralLibrary, menu:QMenu):
+ """
+ Returns a list of QActions or QMenus that can be called to write/export SpectralProfiles into certain file format
+ :param spectralLibrary: SpectralLibrary to export SpectralProfiles from
+ :return: [list-of-QAction-or-QMenus]
+ """
class AddAttributeDialog(QDialog):
@@ -2359,13 +2529,13 @@ class SpectralProfileMapTool(QgsMapToolEmitPoint):
self.marker = QgsVertexMarker(self.mCanvas)
self.rubberband = QgsRubberBand(self.mCanvas, QgsWkbTypes.PolygonGeometry)
- color = QColor('red')
+ plotStyle = QColor('red')
self.rubberband.setLineStyle(Qt.SolidLine)
- self.rubberband.setColor(color)
+ self.rubberband.setColor(plotStyle)
self.rubberband.setWidth(2)
- self.marker.setColor(color)
+ self.marker.setColor(plotStyle)
self.marker.setPenWidth(3)
self.marker.setIconSize(5)
self.marker.setIconType(QgsVertexMarker.ICON_CROSS) # or ICON_CROSS, ICON_X
@@ -2375,9 +2545,9 @@ class SpectralProfileMapTool(QgsMapToolEmitPoint):
self.marker.setCenter(geoPoint)
#self.marker.show()
- def setStyle(self, color=None, brushStyle=None, fillColor=None, lineStyle=None):
- if color:
- self.rubberband.setColor(color)
+ def setStyle(self, plotStyle=None, brushStyle=None, fillColor=None, lineStyle=None):
+ if plotStyle:
+ self.rubberband.setColor(plotStyle)
if brushStyle:
self.rubberband.setBrushStyle(brushStyle)
if fillColor:
@@ -2962,14 +3132,6 @@ def registerSpectralProfileEditorWidget():
reg.registerWidget(EDITOR_WIDGET_REGISTRY_KEY, SPECTRAL_PROFILE_EDITOR_WIDGET_FACTORY)
-def registerAbstractLibraryIOs():
- try:
- import asd
- except:
- s = ""
-
-
-
from ..utils import SelectMapLayersDialog
class SpectralProfileImportPointsDialog(SelectMapLayersDialog):
@@ -3076,15 +3238,32 @@ class SpectralLibraryWidget(QMainWindow, loadSpeclibUI('spectrallibrarywidget.ui
# set spacer into menu
# empty = QWidget(self.mToolbar)
#empty.setSizePolicy(QSizePolicy.Expanding, QSizePolicy.Preferred)
- from .plotting import SpectralLibraryPlotWidget
+ from ..speclib.plotting import SpectralLibraryPlotWidget
assert isinstance(self.mPlotWidget, SpectralLibraryPlotWidget)
- #self.mToolbar.insertWidget(self.actionReload, empty)
-
- self.mColorCurrentSpectra = COLOR_SELECTED_SPECTRA
- self.mColorSelectedSpectra = COLOR_SELECTED_SPECTRA
self.m_plot_max = 500
+ from .envi import EnviSpectralLibraryIO
+ from .csvdata import CSVSpectralLibraryIO
+ from .asd import ASDSpectralLibraryIO
+ from .ecosis import EcoSISSpectralLibraryIO
+ from .specchio import SPECCHIOSpectralLibraryIO
+ from .artmo import ARTMOSpectralLibraryIO
+ from .vectorsources import VectorSourceSpectralLibraryIO
+
+ self.mSpeclibIOInterfaces = [
+ EnviSpectralLibraryIO(),
+ CSVSpectralLibraryIO(),
+ ARTMOSpectralLibraryIO(),
+ ASDSpectralLibraryIO(),
+ EcoSISSpectralLibraryIO(),
+ SPECCHIOSpectralLibraryIO(),
+ VectorSourceSpectralLibraryIO(),
+ ]
+
+ self.mSpeclibIOInterfaces = sorted(self.mSpeclibIOInterfaces, key=lambda c: c.__class__.__name__)
+
+
self.mSelectionModel = None
if not isinstance(speclib, SpectralLibrary):
@@ -3093,19 +3272,12 @@ class SpectralLibraryWidget(QMainWindow, loadSpeclibUI('spectrallibrarywidget.ui
assert isinstance(speclib, SpectralLibrary)
self.mSpeclib = speclib
- MAP_LAYER_STORES[0].addMapLayer(speclib)
+ QPS_MAPLAYER_STORE.addMapLayer(speclib)
self.mSpeclib.editingStarted.connect(self.onIsEditableChanged)
self.mSpeclib.editingStopped.connect(self.onIsEditableChanged)
self.mSpeclib.selectionChanged.connect(self.onSelectionChanged)
-
-
- from .plotting import SpectralLibraryPlotWidget
- assert isinstance(self.mPlotWidget, SpectralLibraryPlotWidget)
- self.mPlotWidget.setSpeclib(self.mSpeclib)
-
-
- self.mPlotWidget.backgroundBrush().setColor(COLOR_BACKGROUND)
+ self.mSpeclib.nameChanged.connect(lambda *args, sl=self.mSpeclib: self.setWindowTitle(sl.name()))
if isinstance(mapCanvas, QgsMapCanvas):
self.mCanvas = mapCanvas
@@ -3121,12 +3293,14 @@ class SpectralLibraryWidget(QMainWindow, loadSpeclibUI('spectrallibrarywidget.ui
self.mDualView.init(self.mSpeclib, self.mCanvas)
self.mDualView.setView(QgsDualView.AttributeTable)
self.mDualView.setAttributeTableConfig(self.mSpeclib.attributeTableConfig())
+ self.mDualView.showContextMenuExternally.connect(self.onShowContextMenuExternally)
+ self.mDualView.tableView().willShowContextMenu.connect(self.onWillShowContextMenu)
+ from .plotting import SpectralLibraryPlotWidget
+ assert isinstance(self.mPlotWidget, SpectralLibraryPlotWidget)
+ self.mPlotWidget.setDualView(self.mDualView)
+ self.mPlotWidget.mUpdateTimer.timeout.connect(self.updateStatusBar)
- self.mTableView = self.mDualView.tableView()
- assert isinstance(self.mTableView, QgsAttributeTableView)
- self.mTableView.willShowContextMenu.connect(self.onWillShowContextMenu)
-
- # change selected row color: keep color also when attribtue table looses focus
+ # change selected row plotStyle: keep plotStyle also when the attribute table looses focus
pal = self.mDualView.tableView().palette()
cSelected = pal.color(QPalette.Active, QPalette.Highlight)
@@ -3160,6 +3334,29 @@ class SpectralLibraryWidget(QMainWindow, loadSpeclibUI('spectrallibrarywidget.ui
self.spectraLibrary = self.speclib
self.clearTable = self.clearSpectralLibrary
+ def applyAllPlotUpdates(self):
+ """
+ Forces the plot widget to update
+ :return:
+ :rtype:
+ """
+ self.plotWidget().onPlotUpdateTimeOut()
+
+ def updateStatusBar(self):
+
+ assert isinstance(self.mStatusBar, QStatusBar)
+ slib = self.speclib()
+ nFeatures = slib.featureCount()
+ nSelected = slib.selectedFeatureCount()
+ nVisible = self.plotWidget().plottedProfileCount()
+ msg = "{}/{}/{}".format(nFeatures, nSelected, nVisible)
+ self.mStatusBar.showMessage(msg)
+
+ def onShowContextMenuExternally(self, menu:QgsActionMenu, fid):
+ s = ""
+
+
+
def onImportFromVectorSource(self):
d = SpectralProfileImportPointsDialog()
@@ -3201,6 +3398,47 @@ class SpectralLibraryWidget(QMainWindow, loadSpeclibUI('spectrallibrarywidget.ui
menu.addAction(self.actionCopySelectedRows)
menu.addAction(self.actionPasteFeatures)
+ menu.addSeparator()
+
+ selectedFIDs = self.mDualView.tableView().selectedFeaturesIds()
+ n = len(selectedFIDs)
+ menuProfileStyle = menu.addMenu('Profile Style')
+ wa = QWidgetAction(menuProfileStyle)
+
+ btnResetProfileStyles = QPushButton('Reset')
+
+ plotStyle = self.plotWidget().colorScheme().ps
+ if n == 0:
+ btnResetProfileStyles.setText('Reset All')
+ btnResetProfileStyles.clicked.connect(self.plotWidget().resetProfileStyles)
+ btnResetProfileStyles.setToolTip('Resets all profile styles')
+ else:
+ from .plotting import SpectralProfilePlotDataItem
+ for fid in selectedFIDs:
+ spi = self.plotWidget().spectralProfilePlotDataItem(fid)
+ if isinstance(spi, SpectralProfilePlotDataItem):
+ plotStyle = PlotStyle.fromPlotDataItem(spi)
+
+ btnResetProfileStyles.setText('Reset Selected')
+ btnResetProfileStyles.clicked.connect(lambda *args, fids=selectedFIDs: self.plotWidget().setProfileStyle(None, fids))
+
+ psw = PlotStyleWidget(plotStyle=plotStyle)
+ psw.setPreviewVisible(False)
+ psw.cbIsVisible.setVisible(False)
+ psw.sigPlotStyleChanged.connect(lambda style, fids=selectedFIDs : self.plotWidget().setProfileStyle(style, fids))
+
+ frame = QFrame()
+ l = QVBoxLayout()
+ l.addWidget(btnResetProfileStyles)
+ l.addWidget(psw)
+
+ frame.setLayout(l)
+ wa.setDefaultWidget(frame)
+ menuProfileStyle.addAction(wa)
+
+ self.mDualView.tableView().currentIndex()
+
+
def clearSpectralLibrary(self):
"""
Removes all SpectralProfiles and additional fields
@@ -3267,7 +3505,7 @@ class SpectralLibraryWidget(QMainWindow, loadSpeclibUI('spectrallibrarywidget.ui
- def initActions(self):
+ def initActions(self):
self.actionSelectProfilesFromMap.triggered.connect(self.sigLoadFromMapRequest.emit)
@@ -3287,13 +3525,15 @@ class SpectralLibraryWidget(QMainWindow, loadSpeclibUI('spectrallibrarywidget.ui
if b else self.setCurrentProfilesMode(SpectralLibraryWidget.CurrentProfilesMode.normal)
)
- self.actionImportSpeclib.triggered.connect(lambda: self.importSpeclib())
+ self.actionImportSpeclib.triggered.connect(self.onImportSpeclib)
+ self.actionImportSpeclib.setMenu(self.importSpeclibMenu())
self.actionImportVectorSource.triggered.connect(self.onImportFromVectorSource)
self.actionAddProfiles.triggered.connect(self.addCurrentSpectraToSpeclib)
self.actionReloadProfiles.triggered.connect(self.onReloadProfiles)
+
m = QMenu()
- m.addAction(self.actionImportSpeclib)
+ #m.addAction(self.actionImportSpeclib)
m.addAction(self.actionImportVectorSource)
m.addAction(self.optionAddCurrentProfilesAutomatically)
m.addSeparator()
@@ -3301,9 +3541,10 @@ class SpectralLibraryWidget(QMainWindow, loadSpeclibUI('spectrallibrarywidget.ui
self.actionAddProfiles.setMenu(m)
- self.actionSaveSpeclib.triggered.connect(self.onExportSpectra)
-
- self.actionReload.triggered.connect(lambda : self.mPlotWidget.updatePlot())
+ self.actionExportSpeclib.triggered.connect(self.onExportSpectra)
+ self.actionExportSpeclib.setMenu(self.exportSpeclibMenu())
+ self.actionSaveSpeclib = self.actionExportSpeclib # backward compatibility
+ self.actionReload.triggered.connect(lambda : self.mPlotWidget.updateSpectralProfilePlotItems())
self.actionToggleEditing.toggled.connect(self.onToggleEditing)
self.actionSaveEdits.triggered.connect(self.onSaveEdits)
self.actionDeleteSelected.triggered.connect(lambda : deleteSelected(self.speclib()))
@@ -3335,6 +3576,27 @@ class SpectralLibraryWidget(QMainWindow, loadSpeclibUI('spectrallibrarywidget.ui
self.onIsEditableChanged()
+ def importSpeclibMenu(self)->QMenu:
+ """
+ :return: QMenu with QActions and submenus to import SpectralProfiles
+ """
+ m = QMenu()
+ for iface in self.mSpeclibIOInterfaces:
+ assert isinstance(iface, AbstractSpectralLibraryIO), iface
+ iface.addImportActions(self.speclib(), m)
+ return m
+
+ def exportSpeclibMenu(self)->QMenu:
+ """
+ :return: QMenu with QActions and submenus to export SpectralProfiles
+ """
+ m = QMenu()
+ for iface in self.mSpeclibIOInterfaces:
+ assert isinstance(iface, AbstractSpectralLibraryIO)
+ iface.addExportActions(self.speclib(), m)
+ return m
+
+
def showProperties(self, *args):
from ..layerproperties import showLayerPropertiesDialog
@@ -3343,16 +3605,13 @@ class SpectralLibraryWidget(QMainWindow, loadSpeclibUI('spectrallibrarywidget.ui
s = ""
- def importSpeclib(self, path=None):
+ def onImportSpeclib(self):
"""
Imports a SpectralLibrary
:param path: str
"""
- slib = None
- if path is None:
- slib = SpectralLibrary.readFromSourceDialog(self)
- else:
- slib = SpectralLibrary.readFrom(path)
+
+ slib = SpectralLibrary.readFromSourceDialog(self)
if isinstance(slib, SpectralLibrary) and len(slib) > 0:
self.addSpeclib(slib)
@@ -3387,6 +3646,11 @@ class SpectralLibraryWidget(QMainWindow, loadSpeclibUI('spectrallibrarywidget.ui
self.actionDeleteSelected.setEnabled(self.mSpeclib.isEditable() and hasSelected)
self.actionReloadProfiles.setEnabled(self.mSpeclib.isEditable() and hasSelected)
+ self.actionPanMapToSelectedRows.setEnabled(hasSelected)
+ self.actionRemoveSelection.setEnabled(hasSelected)
+ self.actionZoomMapToSelectedRows.setEnabled(hasSelected)
+
+
def onIsEditableChanged(self, *args):
speclib = self.speclib()
@@ -3432,7 +3696,7 @@ class SpectralLibraryWidget(QMainWindow, loadSpeclibUI('spectrallibrarywidget.ui
def onReloadProfiles(self):
cnt = self.speclib().selectedFeatureCount()
- if cnt > 0 and self.speclib().isEditable():
+ if cnt > 0 and self.speclib().isEditable():
# ask for profile source raster
from ..utils import SelectMapLayersDialog
@@ -3572,13 +3836,13 @@ class SpectralLibraryWidget(QMainWindow, loadSpeclibUI('spectrallibrarywidget.ui
if isinstance(iface, QgisInterface):
iface.copySelectionToClipboard(self.mSpeclib)
- def onAttributesChanged(self):
- self.btnRemoveAttribute.setEnabled(len(self.mSpeclib.metadataAttributes()) > 0)
+ #def onAttributesChanged(self):
+ # self.btnRemoveAttribute.setEnabled(len(self.mSpeclib.metadataAttributes()) > 0)
- def addAttribute(self, name):
- name = str(name)
- if len(name) > 0 and name not in self.mSpeclib.metadataAttributes():
- self.mModel.addAttribute(name)
+ #def addAttribute(self, name):
+ # name = str(name)
+ # if len(name) > 0 and name not in self.mSpeclib.metadataAttributes():
+ # self.mModel.addAttribute(name)
def plotWidget(self):
"""
@@ -3612,40 +3876,32 @@ class SpectralLibraryWidget(QMainWindow, loadSpeclibUI('spectrallibrarywidget.ui
progressDialog = QProgressDialog(self)
- progressDialog.setRange(0,1)
- info = 'Add {} profiles...'.format(len(speclib))
- progressDialog.setLabelText(info)
- progressDialog.setValue(0)
+ progressDialog.setWindowTitle('Add Profiles')
+ progressDialog.show()
+ info = 'Add {} profiles...'.format(len(speclib))
wasEditable = sl.isEditable()
- plotWasBlocked = self.mPlotWidget.blockUpdates(True)
+
try:
sl.startEditing()
sl.beginEditCommand(info)
- sl.addSpeclib(speclib)
+ sl.addSpeclib(speclib, progressDialog=progressDialog)
sl.endEditCommand()
if not wasEditable:
sl.commitChanges()
- except:
- s = ""
+ except Exception as ex:
+ print(ex, file=sys.stderr)
pass
- progressDialog.setValue(1)
- self.mPlotWidget.blockUpdates(plotWasBlocked)
- self.mPlotWidget.syncLibrary()
- s = ""
- #def onReset(*args):
- # self.mProgressBar.setValue(0)
- # self.mInfoLabel.setText('')
- # self.mPlotWidget.blockUpdates(False)
- # self.mPlotWidget.syncLibrary()
+ progressDialog.hide()
+ progressDialog.close()
+ QApplication.processEvents()
- #QTimer.singleShot(500, onReset)
def addCurrentSpectraToSpeclib(self, *args):
"""
- Adds all current spectral profiles to the "persistant" SpectralLibrary
+ Adds all current spectral profiles to the "persistent" SpectralLibrary
"""
profiles = self.currentSpectra()
@@ -3695,9 +3951,10 @@ class SpectralLibraryWidget(QMainWindow, loadSpeclibUI('spectrallibrarywidget.ui
newCurrent = collections.OrderedDict()
+ colorScheme = self.plotWidget().colorScheme()
for i, p in enumerate(profiles):
pdi = SpectralProfilePlotDataItem(p)
- pdi.setColor(CURRENT_PROFILE_COLOR)
+ pdi.setPlotStyle(colorScheme.cs)
newCurrent[p] = pdi
self.mCurrentProfiles.update(newCurrent)
@@ -3755,4 +4012,7 @@ class SpectralLibraryPanel(QgsDockWidget):
self.SLW.setCurrentProfilesMode(mode)
-registerAbstractLibraryIOs()
\ No newline at end of file
+class SpectralLibraryLayerStyleWidget(QgsMapLayerConfigWidget):
+
+ pass
+
diff --git a/eotimeseriesviewer/externals/qps/speclib/spectrallibraryplotcolorschemewidget.ui b/eotimeseriesviewer/externals/qps/speclib/spectrallibraryplotcolorschemewidget.ui
new file mode 100644
index 0000000000000000000000000000000000000000..511189320a5287f2337e7ad5957648cac11619f3
--- /dev/null
+++ b/eotimeseriesviewer/externals/qps/speclib/spectrallibraryplotcolorschemewidget.ui
@@ -0,0 +1,190 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>Form</class>
+ <widget class="QWidget" name="Form">
+ <property name="geometry">
+ <rect>
+ <x>0</x>
+ <y>0</y>
+ <width>262</width>
+ <height>247</height>
+ </rect>
+ </property>
+ <property name="windowTitle">
+ <string>Form</string>
+ </property>
+ <layout class="QGridLayout" name="gridLayout" rowstretch="0,1,1,1,0,0,0" columnstretch="0,2">
+ <property name="leftMargin">
+ <number>2</number>
+ </property>
+ <property name="topMargin">
+ <number>2</number>
+ </property>
+ <property name="rightMargin">
+ <number>2</number>
+ </property>
+ <property name="bottomMargin">
+ <number>2</number>
+ </property>
+ <property name="spacing">
+ <number>2</number>
+ </property>
+ <item row="3" column="1">
+ <widget class="QgsColorButton" name="btnColorInfo">
+ <property name="sizePolicy">
+ <sizepolicy hsizetype="Preferred" vsizetype="Fixed">
+ <horstretch>0</horstretch>
+ <verstretch>0</verstretch>
+ </sizepolicy>
+ </property>
+ <property name="text">
+ <string>...</string>
+ </property>
+ </widget>
+ </item>
+ <item row="2" column="1">
+ <widget class="QgsColorButton" name="btnColorForeground">
+ <property name="sizePolicy">
+ <sizepolicy hsizetype="Preferred" vsizetype="Fixed">
+ <horstretch>0</horstretch>
+ <verstretch>0</verstretch>
+ </sizepolicy>
+ </property>
+ <property name="text">
+ <string>...</string>
+ </property>
+ </widget>
+ </item>
+ <item row="3" column="0">
+ <widget class="QLabel" name="label_3">
+ <property name="text">
+ <string>Crosshair</string>
+ </property>
+ </widget>
+ </item>
+ <item row="1" column="1">
+ <widget class="QgsColorButton" name="btnColorBackground">
+ <property name="sizePolicy">
+ <sizepolicy hsizetype="Preferred" vsizetype="Fixed">
+ <horstretch>0</horstretch>
+ <verstretch>0</verstretch>
+ </sizepolicy>
+ </property>
+ <property name="text">
+ <string>...</string>
+ </property>
+ </widget>
+ </item>
+ <item row="2" column="0">
+ <widget class="QLabel" name="label_2">
+ <property name="text">
+ <string>Foreground</string>
+ </property>
+ </widget>
+ </item>
+ <item row="1" column="0">
+ <widget class="QLabel" name="label">
+ <property name="text">
+ <string>Background</string>
+ </property>
+ </widget>
+ </item>
+ <item row="0" column="0" colspan="2">
+ <layout class="QHBoxLayout" name="horizontalLayout_2">
+ <item>
+ <widget class="QToolButton" name="btnColorSchemeDark">
+ <property name="styleSheet">
+ <string notr="true">background-color:"black";
+color:"white"</string>
+ </property>
+ <property name="text">
+ <string>Dark</string>
+ </property>
+ <property name="autoRaise">
+ <bool>true</bool>
+ </property>
+ </widget>
+ </item>
+ <item>
+ <widget class="QToolButton" name="btnColorSchemeBright">
+ <property name="styleSheet">
+ <string notr="true">background-color:"white";
+color:"black"</string>
+ </property>
+ <property name="text">
+ <string>Bright</string>
+ </property>
+ <property name="autoRaise">
+ <bool>true</bool>
+ </property>
+ </widget>
+ </item>
+ <item>
+ <spacer name="horizontalSpacer">
+ <property name="orientation">
+ <enum>Qt::Horizontal</enum>
+ </property>
+ <property name="sizeHint" stdset="0">
+ <size>
+ <width>40</width>
+ <height>20</height>
+ </size>
+ </property>
+ </spacer>
+ </item>
+ <item>
+ <widget class="QToolButton" name="btnReset">
+ <property name="text">
+ <string>Reset</string>
+ </property>
+ <property name="autoRaise">
+ <bool>true</bool>
+ </property>
+ </widget>
+ </item>
+ </layout>
+ </item>
+ <item row="4" column="0" colspan="2">
+ <widget class="QCheckBox" name="cbUseRendererColors">
+ <property name="text">
+ <string>Vector point colors as line colors</string>
+ </property>
+ </widget>
+ </item>
+ <item row="5" column="0" colspan="2">
+ <widget class="PlotStyleWidget" name="wDefaultProfileStyle" native="true">
+ <property name="sizePolicy">
+ <sizepolicy hsizetype="Preferred" vsizetype="Preferred">
+ <horstretch>1</horstretch>
+ <verstretch>1</verstretch>
+ </sizepolicy>
+ </property>
+ <property name="minimumSize">
+ <size>
+ <width>50</width>
+ <height>50</height>
+ </size>
+ </property>
+ </widget>
+ </item>
+ </layout>
+ </widget>
+ <customwidgets>
+ <customwidget>
+ <class>QgsColorButton</class>
+ <extends>QToolButton</extends>
+ <header>qgscolorbutton.h</header>
+ </customwidget>
+ <customwidget>
+ <class>PlotStyleWidget</class>
+ <extends>QWidget</extends>
+ <header>qps.plotstyling.plotstyling</header>
+ <container>1</container>
+ </customwidget>
+ </customwidgets>
+ <resources>
+ <include location="../../../../QGIS/images/images.qrc"/>
+ <include location="../qpsresources.qrc"/>
+ </resources>
+ <connections/>
+</ui>
diff --git a/eotimeseriesviewer/externals/qps/speclib/spectrallibrarywidget.ui b/eotimeseriesviewer/externals/qps/speclib/spectrallibrarywidget.ui
index 60b7126473bd8023cb63c62248b34c7abd4f7e40..918178cfa6ea29f754aa52d468c009377effaca3 100644
--- a/eotimeseriesviewer/externals/qps/speclib/spectrallibrarywidget.ui
+++ b/eotimeseriesviewer/externals/qps/speclib/spectrallibrarywidget.ui
@@ -60,23 +60,6 @@
<property name="acceptDrops">
<bool>true</bool>
</property>
- <layout class="QVBoxLayout" name="verticalLayout_2">
- <property name="spacing">
- <number>2</number>
- </property>
- <property name="leftMargin">
- <number>0</number>
- </property>
- <property name="topMargin">
- <number>0</number>
- </property>
- <property name="rightMargin">
- <number>0</number>
- </property>
- <property name="bottomMargin">
- <number>0</number>
- </property>
- </layout>
</widget>
</widget>
</item>
@@ -94,7 +77,8 @@
</attribute>
<addaction name="actionSelectProfilesFromMap"/>
<addaction name="actionAddProfiles"/>
- <addaction name="actionSaveSpeclib"/>
+ <addaction name="actionImportSpeclib"/>
+ <addaction name="actionExportSpeclib"/>
</widget>
<widget class="QToolBar" name="toolBarFeatureSelections">
<property name="windowTitle">
@@ -135,7 +119,7 @@
</widget>
<widget class="QStatusBar" name="mStatusBar">
<property name="sizeGripEnabled">
- <bool>false</bool>
+ <bool>true</bool>
</property>
</widget>
<action name="actionImportSpeclib">
@@ -150,7 +134,7 @@
<string>Import Spectral Library</string>
</property>
</action>
- <action name="actionSaveSpeclib">
+ <action name="actionExportSpeclib">
<property name="icon">
<iconset resource="../qpsresources.qrc">
<normaloff>:/qps/ui/icons/speclib_save.svg</normaloff>:/qps/ui/icons/speclib_save.svg</iconset>
diff --git a/eotimeseriesviewer/externals/qps/speclib/vectorsources.py b/eotimeseriesviewer/externals/qps/speclib/vectorsources.py
new file mode 100644
index 0000000000000000000000000000000000000000..6840921f1946a6de7c47caa5a96b0ad542dc9f55
--- /dev/null
+++ b/eotimeseriesviewer/externals/qps/speclib/vectorsources.py
@@ -0,0 +1,168 @@
+
+import os, sys, re, pathlib, json, io, re, linecache
+from qgis.PyQt.QtCore import *
+from qgis.PyQt.QtGui import *
+from qgis.PyQt.QtWidgets import *
+from qgis.core import *
+
+
+from .spectrallibraries import SpectralProfile, SpectralLibrary, AbstractSpectralLibraryIO, FIELD_FID, FIELD_VALUES, FIELD_NAME, findTypeFromString, createQgsField, OGR_EXTENSION2DRIVER
+
+class VectorSourceSpectralLibraryIO(AbstractSpectralLibraryIO):
+ """
+ I/O Interface for the EcoSIS spectral library format.
+ See https://ecosis.org for details.
+ """
+ @staticmethod
+ def canRead(path:str):
+ """
+ Returns true if it can read the source defined by path
+ :param path: source uri
+ :return: True, if source is readable.
+ """
+ try:
+
+ lyr = QgsVectorLayer(path)
+ assert isinstance(lyr, QgsVectorLayer)
+ assert lyr.isValid()
+ fieldNames = lyr.fields().names()
+ for fn in [FIELD_NAME, FIELD_VALUES]:
+ assert fn in fieldNames
+ typeName = lyr.fields().at(lyr.fields().lookupField(FIELD_NAME)).typeName()
+ assert re.search('(string|varchar|char|json)', typeName, re.I)
+ return True
+ except:
+ return False
+ return False
+
+
+ @staticmethod
+ def readFrom(path, progressDialog:QProgressDialog=None, addAttributes:bool = True)->SpectralLibrary:
+ """
+ Returns the SpectralLibrary read from "path"
+ :param path: source of SpectralLibrary
+ :return: SpectralLibrary
+ """
+
+ lyr = QgsVectorLayer(path)
+ assert isinstance(lyr, QgsVectorLayer)
+
+
+ speclib = SpectralLibrary()
+ assert isinstance(speclib, SpectralLibrary)
+
+ speclib.setName(lyr.name())
+
+
+ assert speclib.startEditing()
+
+ if addAttributes:
+ speclib.addMissingFields(lyr.fields())
+ assert speclib.commitChanges()
+ assert speclib.startEditing()
+
+
+ profiles = []
+ for feature in lyr.getFeatures():
+ profile = SpectralProfile(fields=speclib.fields())
+ for name in speclib.fieldNames():
+ profile.setAttribute(name, feature.attribute(name))
+ profiles.append(profile)
+
+ speclib.addProfiles(profiles, addMissingFields=False)
+
+ assert speclib.commitChanges()
+ return speclib
+
+ @staticmethod
+ def write(speclib:SpectralLibrary, path:str, progressDialog:QProgressDialog=None, options:QgsVectorFileWriter.SaveVectorOptions=None):
+ """
+ Writes the SpectralLibrary to path and returns a list of written files that can be used to open the spectral library with readFrom
+ """
+ assert isinstance(speclib, SpectralLibrary)
+ basePath, ext = os.path.splitext(path)
+
+
+
+ if not isinstance(options, QgsVectorFileWriter.SaveVectorOptions):
+ driverName = OGR_EXTENSION2DRIVER.get(ext, 'GPKG')
+ options = QgsVectorFileWriter.SaveVectorOptions()
+ options.fileEncoding = 'utf-8'
+ options.driverName = driverName
+
+ if driverName == 'GPKG' and not ext == '.gpkg':
+ path += '.gpkg'
+
+ if options.layerName in [None, '']:
+ options.layerName = speclib.name()
+
+ errors = QgsVectorFileWriter.writeAsVectorFormat(layer=speclib,
+ fileName=path,
+ options=options)
+ writtenFiles = []
+ if os.path.exists(path):
+ writtenFiles.append(path)
+ return writtenFiles
+
+ @staticmethod
+ def score(uri:str)->int:
+ """
+ Returns a score value for the give uri. E.g. 0 for unlikely/unknown, 20 for yes, probably thats the file format the reader can read.
+
+ :param uri: str
+ :return: int
+ """
+ return 0
+
+ @staticmethod
+ def addImportActions(spectralLibrary: SpectralLibrary, menu: QMenu) -> list:
+
+ def read(speclib: SpectralLibrary):
+
+ path, filter = QFileDialog.getOpenFileName(caption='Vector File',
+ filter='All type (*.*)')
+ if os.path.isfile(path) and VectorSourceSpectralLibraryIO.canRead(path):
+ sl = VectorSourceSpectralLibraryIO.readFrom(path)
+ if isinstance(sl, SpectralLibrary):
+ speclib.startEditing()
+ speclib.beginEditCommand('Add Spectral Library profiles from {}'.format(path))
+ speclib.addSpeclib(sl, True)
+ speclib.endEditCommand()
+ speclib.commitChanges()
+
+ m = menu.addAction('Vector Layer')
+ m.setToolTip('Adds profiles from another vector source\'s "{}" and "{}" attributes.'.format(FIELD_VALUES, FIELD_NAME))
+ m.triggered.connect(lambda *args, sl=spectralLibrary: read(sl))
+
+
+ @staticmethod
+ def addExportActions(spectralLibrary:SpectralLibrary, menu:QMenu) -> list:
+
+ def write(speclib: SpectralLibrary):
+ # https://gdal.org/drivers/vector/index.html
+ LUT_Files = {'Geopackage (*.gpkg)': 'GPKG',
+ 'ESRI Shapefile (*.shp)' : 'ESRI Shapefile',
+ 'Keyhole Markup Language (*.kml)': 'KML',
+ 'Comma Separated Value (*.csv)': 'CSV'}
+
+ path, filter = QFileDialog.getSaveFileName(caption='Write to Vector Layer',
+ filter=';;'.join(LUT_Files.keys()))
+ if isinstance(path, str) and len(path) > 0:
+ options = QgsVectorFileWriter.SaveVectorOptions()
+ options.fileEncoding = 'UTF-8'
+
+ ogrType = LUT_Files.get(filter)
+ if isinstance(ogrType, str):
+ options.driverName = ogrType
+ if ogrType == 'GPKG':
+ pass
+ elif ogrType == 'ESRI Shapefile':
+ pass
+ elif ogrType == 'KML':
+ pass
+ elif ogrType == 'CSV':
+ pass
+ sl = VectorSourceSpectralLibraryIO.write(spectralLibrary, path, options=options)
+
+ m = menu.addAction('Vector Source')
+ m.triggered.connect(lambda *args, sl=spectralLibrary: write(sl))
\ No newline at end of file
diff --git a/eotimeseriesviewer/externals/qps/testing.py b/eotimeseriesviewer/externals/qps/testing.py
index 19f0dc7dee6034eceba926b188228ffa17c25eda..c8c0ce6967530597cd6c947eb3fe4f0a14e40a28 100644
--- a/eotimeseriesviewer/externals/qps/testing.py
+++ b/eotimeseriesviewer/externals/qps/testing.py
@@ -1,4 +1,4 @@
-import os, sys, re, io, importlib, uuid, warnings, pathlib, time, site
+import os, sys, re, io, importlib, uuid, warnings, pathlib, time, site, mock, inspect, types
import sip
from qgis.core import *
from qgis.gui import *
@@ -163,6 +163,7 @@ def initQgisApplication(*args, qgisResourceDir: str = None,
loadPythonRunner = False
if isinstance(QgsApplication.instance(), QgsApplication):
+ print('Found existing QgsApplication.instance()')
return QgsApplication.instance()
else:
@@ -209,12 +210,14 @@ def initQgisApplication(*args, qgisResourceDir: str = None,
if isinstance(resourceDir, str) and os.path.exists(resourceDir):
qgisResourceDir = resourceDir
+ # try to find a directory "qgisresources" that contains python modules mit a qInitResources method
if isinstance(qgisResourceDir, str) and os.path.isdir(qgisResourceDir):
modules = [m for m in os.listdir(qgisResourceDir) if re.search(r'[^_].*\.py', m)]
modules = [m[0:-3] for m in modules]
for m in modules:
mod = importlib.import_module('qgisresources.{}'.format(m))
if "qInitResources" in dir(mod):
+ print('Loads Qt resources from {}'.format(m))
mod.qInitResources()
# initiate a PythonRunner instance if None exists
@@ -255,7 +258,7 @@ def initQgisApplication(*args, qgisResourceDir: str = None,
providers = QgsProviderRegistry.instance().providerList()
potentialProviders = ['DB2', 'WFS', 'arcgisfeatureserver', 'arcgismapserver', 'delimitedtext', 'gdal',
- 'geonode', 'gpx', 'mdal', 'memory', 'mesh_memory', 'mssql', 'ogr', 'oracle', 'ows',
+ 'geonode', 'gpx', 'mdal', 'memory', 'mesh_memory', 'mssql', 'ogr', 'ows',
'postgres', 'spatialite', 'virtual', 'wcs', 'wms']
missing = [p for p in potentialProviders if p not in providers]
@@ -267,16 +270,19 @@ def initQgisApplication(*args, qgisResourceDir: str = None,
class QgisMockup(QgisInterface):
"""
- A "fake" QGIS Desktop instance that should provide all the inferfaces a plugin developer might need (and nothing more)
+ A "fake" QGIS Desktop instance that should provide all the interfaces a plugin developer might need (and nothing more)
"""
-
- def pluginManagerInterface(self) -> QgsPluginManagerInterface:
- return self.mPluginManager
-
def __init__(self, *args):
- # QgisInterface.__init__(self)
super(QgisMockup, self).__init__()
+ #mock.MagicMock.__init__(self, spec=QgisInterface, name='QgisMockup')
+
+
+ #super(QgisMockup, self).__init__(spec=QgisInterface, name='QgisMockup')
+ #mock.MagicMock.__init__(self, spec=QgisInterface)
+ #QgisInterface.__init__(self)
+
+
self.mCanvas = QgsMapCanvas()
self.mCanvas.blockSignals(False)
self.mCanvas.setCanvasColor(Qt.black)
@@ -313,8 +319,30 @@ class QgisMockup(QgisInterface):
self.mClipBoard = QgsClipboardMockup()
+ # mock other functions
+ excluded = QObject.__dict__.keys()
+
+ self._mock = mock.Mock(spec=QgisInterface)
+ for n in self._mock._mock_methods:
+ assert isinstance(n, str)
+ if not n.startswith('_') and n not in excluded:
+ try:
+ inspect.getfullargspec(getattr(self, n))
+ except:
+ setattr(self, n, getattr(self._mock, n))
+
+
+
+ def pluginManagerInterface(self) -> QgsPluginManagerInterface:
+ return self.mPluginManager
+
def activeLayer(self):
- return None
+ return self.mapCanvas().currentLayer()
+
+ def setActiveLayer(self, mapLayer:QgsMapLayer):
+ if mapLayer in self.mapCanvas().layers():
+ self.mapCanvas().setCurrentLayer(mapLayer)
+
def cutSelectionToClipboard(self, mapLayer: QgsMapLayer):
if isinstance(mapLayer, QgsVectorLayer):
@@ -543,11 +571,22 @@ class TestObjects():
Create an in-memory ogr.DataSource
:return: ogr.DataSource
"""
+ ogr.UseExceptions()
assert wkb in [ogr.wkbPoint, ogr.wkbPolygon, ogr.wkbLineString]
+ # find the QGIS world_map.shp
pkgPath = QgsApplication.instance().pkgDataPath()
- pathSrc = os.path.join(pkgPath, *['resources', 'data', 'world_map.shp'])
- assert os.path.isfile(pathSrc), 'Unable to find QGIS "world_map.shp"'
+ pathSrc = None
+ potentialPathes = [
+ os.path.join(os.path.dirname(__file__), 'testpolygons.geojson'),
+ os.path.join(pkgPath, *['resources', 'data', 'world_map.shp']),
+ ]
+ for p in potentialPathes:
+ if os.path.isfile(p):
+ pathSrc = p
+ break
+
+ assert os.path.isfile(pathSrc), 'Unable to find QGIS "world_map.shp". QGIS Pkg path = {}'.format(pkgPath)
dsSrc = ogr.Open(pathSrc)
assert isinstance(dsSrc, ogr.DataSource)
@@ -560,19 +599,19 @@ class TestObjects():
srs = lyrSrc.GetSpatialRef()
assert isinstance(srs, osr.SpatialReference)
- drv = dsSrc.GetDriver()
+ drv = ogr.GetDriverByName('ESRI Shapefile')
assert isinstance(drv, ogr.Driver)
# set temp path
if wkb == ogr.wkbPolygon:
lname = 'polygons'
- pathDst = '/vsimem/tmp' + str(uuid.uuid4()) + '.world_map.polygons.shp'
+ pathDst = '/vsimem/tmp' + str(uuid.uuid4()) + '.test.polygons.shp'
elif wkb == ogr.wkbPoint:
lname = 'points'
- pathDst = '/vsimem/tmp' + str(uuid.uuid4()) + '.world_map.centroids.shp'
+ pathDst = '/vsimem/tmp' + str(uuid.uuid4()) + '.test.centroids.shp'
elif wkb == ogr.wkbLineString:
lname = 'lines'
- pathDst = '/vsimem/tmp' + str(uuid.uuid4()) + '.world_map.line.shp'
+ pathDst = '/vsimem/tmp' + str(uuid.uuid4()) + '.test.line.shp'
else:
raise NotImplementedError()
@@ -612,7 +651,7 @@ class TestObjects():
for i in range(ldef.GetFieldCount()):
fDst.SetField(i, fSrc.GetField(i))
- lyrDst.CreateFeature(fDst)
+ assert lyrDst.CreateFeature(fDst) == ogr.OGRERR_NONE
assert isinstance(dsDst, ogr.DataSource)
dsDst.FlushCache()
diff --git a/eotimeseriesviewer/externals/qps/testpolygons.geojson b/eotimeseriesviewer/externals/qps/testpolygons.geojson
new file mode 100644
index 0000000000000000000000000000000000000000..730b78f3025804487da43d503ccb21c127dee3d0
--- /dev/null
+++ b/eotimeseriesviewer/externals/qps/testpolygons.geojson
@@ -0,0 +1,158 @@
+{
+"type": "FeatureCollection",
+"name": "testpolygons",
+"crs": { "type": "name", "properties": { "name": "urn:ogc:def:crs:OGC:1.3:CRS84" } },
+"features": [
+{ "type": "Feature", "properties": { "fid": 1, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.297082085241408, 52.501857636615817 ], [ 13.297091916472423, 52.501855399052978 ], [ 13.297111122367605, 52.501862812730671 ], [ 13.297123131476843, 52.501854659724032 ], [ 13.297125401290463, 52.501846365631216 ], [ 13.297114173278231, 52.5018343095376 ], [ 13.297108374751774, 52.501833036535857 ], [ 13.297091162945314, 52.501824462922258 ], [ 13.297095243067778, 52.501819763501132 ], [ 13.297089629821974, 52.501813735014331 ], [ 13.297060362969674, 52.501814503275988 ], [ 13.297044410083084, 52.501823789944318 ], [ 13.297036159427256, 52.501835565657998 ], [ 13.297031757660644, 52.501848586312406 ], [ 13.297050870199671, 52.501858376832537 ], [ 13.297058387126265, 52.50186562226132 ], [ 13.297073833116501, 52.501869412310882 ], [ 13.297082085241408, 52.501857636615817 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 2, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298304702572262, 52.501824082425173 ], [ 13.298300435722354, 52.501822824320577 ], [ 13.29825068351229, 52.501822331659241 ], [ 13.298246260722161, 52.501823241788593 ], [ 13.298235832622826, 52.501840933950739 ], [ 13.298229437127349, 52.501855115506416 ], [ 13.298227029792844, 52.501866975354623 ], [ 13.298242293678461, 52.501875520781752 ], [ 13.298277036215257, 52.501884347291082 ], [ 13.298290811110379, 52.501880976817539 ], [ 13.298302820043775, 52.501872822790673 ], [ 13.2983165015893, 52.501871830945682 ], [ 13.298330506067664, 52.501862516082035 ], [ 13.298317282167101, 52.501851620933977 ], [ 13.298305961987545, 52.501841942704885 ], [ 13.298304702572262, 52.501824082425173 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 3, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.30011789363734, 52.50296980947023 ], [ 13.300084958990217, 52.502964578098634 ], [ 13.300072812496468, 52.502976298040394 ], [ 13.300056905682681, 52.502984396237082 ], [ 13.300036966322143, 52.50299600419978 ], [ 13.300034284195048, 52.503014996454972 ], [ 13.300035681956849, 52.503029290085308 ], [ 13.300052663936688, 52.503043808544668 ], [ 13.300069509850308, 52.50306189185936 ], [ 13.300096460828359, 52.50307060586924 ], [ 13.30011548431251, 52.503082773679566 ], [ 13.300140626181049, 52.503087893074024 ], [ 13.300181535806409, 52.503088480864932 ], [ 13.300201245858641, 52.503082816369421 ], [ 13.300224989912431, 52.503073642117229 ], [ 13.300229253296955, 52.50306418707504 ], [ 13.300225815517718, 52.503052243211627 ], [ 13.300234250508318, 52.503035711781585 ], [ 13.300248253454688, 52.503026397569819 ], [ 13.300250568580179, 52.503016915434721 ], [ 13.300233540676105, 52.503003585881267 ], [ 13.300210392892453, 52.502997306518672 ], [ 13.300204961040695, 52.502986523541374 ], [ 13.300199113699573, 52.502982156116161 ], [ 13.300193594321467, 52.502978033468104 ], [ 13.300176367183729, 52.502977200623455 ], [ 13.300158573834583, 52.502976340759389 ], [ 13.30011789363734, 52.50296980947023 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 4, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299496909753373, 52.502948989912838 ], [ 13.299477750305265, 52.502940388658601 ], [ 13.299461569568436, 52.502955619162442 ], [ 13.299435923101921, 52.502963576379294 ], [ 13.29942544783469, 52.502982457501119 ], [ 13.29944034521821, 52.503000513797666 ], [ 13.299424392425534, 52.50300979988711 ], [ 13.299437525163722, 52.503023072669706 ], [ 13.299464752798588, 52.503024653578208 ], [ 13.299486089904134, 52.503027339348705 ], [ 13.299507748229658, 52.503021702972347 ], [ 13.299518085773174, 52.503006389374463 ], [ 13.299518957607523, 52.502983801598894 ], [ 13.299515841242265, 52.502963535573194 ], [ 13.299496909753373, 52.502948989912838 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 5, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.300367728312782, 52.503571915856064 ], [ 13.300336400444165, 52.503564208085116 ], [ 13.300337501155242, 52.503565390058228 ], [ 13.300367728312782, 52.503571915856064 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 6, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.300203039686897, 52.503531395592923 ], [ 13.300139368274001, 52.503515728892388 ], [ 13.300139487031698, 52.50351582051082 ], [ 13.300143339562354, 52.503523468940621 ], [ 13.300192831547587, 52.503534154884534 ], [ 13.300199237270173, 52.503533331614861 ], [ 13.300203039686897, 52.503531395592923 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 7, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.297801449808738, 52.502914829827432 ], [ 13.297799960907115, 52.502902913929717 ], [ 13.297784099678516, 52.502909822042447 ], [ 13.297772595611489, 52.502904899268792 ], [ 13.297753298754193, 52.502899863469182 ], [ 13.29774122380152, 52.502909220414637 ], [ 13.297735213697502, 52.502913876802737 ], [ 13.297722784590649, 52.502921112119047 ], [ 13.297721256199086, 52.502922001836495 ], [ 13.297713286114993, 52.502929260850792 ], [ 13.297878326254931, 52.502974029025758 ], [ 13.29787178375668, 52.502961041497464 ], [ 13.297868302310833, 52.502956918389067 ], [ 13.297860599721353, 52.502947796574958 ], [ 13.297853036548389, 52.502941740072316 ], [ 13.297848740251519, 52.50293899168458 ], [ 13.297835917505157, 52.502930788831748 ], [ 13.297820654811188, 52.502922243372403 ], [ 13.297801449808738, 52.502914829827432 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 8, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299268435465493, 52.502919537657483 ], [ 13.299259291015593, 52.502903943115442 ], [ 13.299241988052058, 52.502897747585216 ], [ 13.299228121151176, 52.502903495023133 ], [ 13.29922761633488, 52.502916571776225 ], [ 13.299210129821578, 52.502915130852429 ], [ 13.299196815071014, 52.502906613576044 ], [ 13.299184437403193, 52.502924277790669 ], [ 13.299197386457887, 52.502942306108856 ], [ 13.299187370061349, 52.502949298434892 ], [ 13.299214368160538, 52.502956823787535 ], [ 13.299228004164208, 52.502957019818787 ], [ 13.299229355767178, 52.502972502333954 ], [ 13.299251105887386, 52.502964488249724 ], [ 13.299255415329212, 52.502953845265317 ], [ 13.299271458452752, 52.502942181422618 ], [ 13.299272055045272, 52.502926726914389 ], [ 13.299268435465493, 52.502919537657483 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 9, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.300322648459646, 52.503478334186376 ], [ 13.300340364568573, 52.503473830557795 ], [ 13.300363696014211, 52.50347535618198 ], [ 13.300420365382793, 52.503486183804988 ], [ 13.300461966681835, 52.503416945815175 ], [ 13.30043635043085, 52.503410978997806 ], [ 13.300414554469276, 52.503420181278763 ], [ 13.300333558684903, 52.503397606912046 ], [ 13.300340137171508, 52.503378670628877 ], [ 13.300407862218799, 52.503391538050352 ], [ 13.300437658314099, 52.503326546058133 ], [ 13.300333147868345, 52.50330720159554 ], [ 13.300354004541257, 52.503271817820327 ], [ 13.300285762863499, 52.503256153871064 ], [ 13.300281302407939, 52.503260176292422 ], [ 13.300279808096045, 52.503269502084805 ], [ 13.300277536846481, 52.503272118264007 ], [ 13.300277236330677, 52.503279907526682 ], [ 13.300267034854, 52.503284214307293 ], [ 13.300263488433291, 52.503288299311713 ], [ 13.300241921841749, 52.503291557171316 ], [ 13.300207086020672, 52.503285109882789 ], [ 13.300205159301134, 52.503273488035965 ], [ 13.300199678661006, 52.503269276932187 ], [ 13.3001939257241, 52.503266815201663 ], [ 13.300174821722688, 52.503258641042365 ], [ 13.30016917792415, 52.503257207674814 ], [ 13.300167346822031, 52.503255442465743 ], [ 13.30016516248722, 52.503254507464703 ], [ 13.300143871099179, 52.503250632937601 ], [ 13.30012978277972, 52.503251656015436 ], [ 13.300114434843467, 52.503267186291801 ], [ 13.300095503026551, 52.503252640725172 ], [ 13.300105930935546, 52.503238914425197 ], [ 13.300103511759183, 52.503235779496215 ], [ 13.300109314838263, 52.503234459349834 ], [ 13.300145010137447, 52.503187468973394 ], [ 13.300163347203778, 52.503191423333313 ], [ 13.30016325756813, 52.503191378887628 ], [ 13.300154351627119, 52.503186815563041 ], [ 13.300140989301433, 52.50317948634919 ], [ 13.300127949519938, 52.503163835908154 ], [ 13.300115047328957, 52.503144619730527 ], [ 13.300111838935299, 52.503126731474445 ], [ 13.300124168947953, 52.503110256017521 ], [ 13.300147821290274, 52.503103459537016 ], [ 13.300161137758318, 52.503111976729315 ], [ 13.300179083051395, 52.50310152963231 ], [ 13.300218411425007, 52.503092578394885 ], [ 13.300232048950374, 52.503092774331911 ], [ 13.300259230792907, 52.503095543936155 ], [ 13.30026475289937, 52.503103950032425 ], [ 13.300285311892228, 52.503126844809913 ], [ 13.300284990820517, 52.503135166956156 ], [ 13.300284394613405, 52.503150620573351 ], [ 13.300283752503598, 52.503167263967114 ], [ 13.300277219859513, 52.503185012268524 ], [ 13.300280474191734, 52.503201711642468 ], [ 13.300268748790081, 52.503214126380456 ], [ 13.300276801218585, 52.503215874873916 ], [ 13.300280398871129, 52.503216648555579 ], [ 13.300339077537721, 52.503100033116141 ], [ 13.30033715362787, 52.503096663443678 ], [ 13.300306535448623, 52.503081950017233 ], [ 13.300299201213145, 52.503069950176389 ], [ 13.300332640456993, 52.503062104728905 ], [ 13.300346826853746, 52.503048034993071 ], [ 13.300362871233821, 52.503036370122892 ], [ 13.30036527659278, 52.503024510208043 ], [ 13.30036550588332, 52.503018566716079 ], [ 13.300378620013797, 52.503021444387876 ], [ 13.300378701424503, 52.503021281917427 ], [ 13.300394959839803, 52.50301426587577 ], [ 13.300007723172229, 52.502929202793943 ], [ 13.299721672529332, 52.50286636149842 ], [ 13.299353627343386, 52.502785507525125 ], [ 13.298995256896209, 52.502706773163759 ], [ 13.298636050152107, 52.502627865637535 ], [ 13.298281359511597, 52.502549939075223 ], [ 13.297917229390796, 52.502469936229744 ], [ 13.297556234233978, 52.502390624734332 ], [ 13.297198311381784, 52.502311985733733 ], [ 13.29726565624031, 52.502197306427327 ], [ 13.297361150311481, 52.502217791626904 ], [ 13.297365297588037, 52.502212536606969 ], [ 13.297406112584852, 52.502221232278146 ], [ 13.297409050398517, 52.502216315902892 ], [ 13.297452427392662, 52.502225054722608 ], [ 13.29744947160925, 52.502230474348302 ], [ 13.297491050530574, 52.502239342825483 ], [ 13.29749700132929, 52.502247124041808 ], [ 13.297522071869377, 52.502252162949915 ], [ 13.297543847949536, 52.50224667878112 ], [ 13.297586017619645, 52.502178336482629 ], [ 13.297588541630287, 52.502110575452292 ], [ 13.297574745438462, 52.502098441088485 ], [ 13.297544780729794, 52.502097971229006 ], [ 13.297536502057918, 52.50210437342384 ], [ 13.297488206643054, 52.502103386210848 ], [ 13.297488437512495, 52.502109955817005 ], [ 13.297445561759574, 52.502109180548665 ], [ 13.297445080209915, 52.502102502137618 ], [ 13.297399377388366, 52.502101566584599 ], [ 13.297399797387142, 52.502094701542944 ], [ 13.297299400581686, 52.502093955254715 ], [ 13.297297556271626, 52.502135120161604 ], [ 13.297310054005161, 52.502130908723984 ], [ 13.29733542324743, 52.502130084304738 ], [ 13.297356623420709, 52.502136337105405 ], [ 13.297378143736704, 52.502134267745994 ], [ 13.297383481432673, 52.502147428579512 ], [ 13.297378851486792, 52.502166393650157 ], [ 13.297376443904822, 52.502178253478384 ], [ 13.297370048082296, 52.502192434984096 ], [ 13.297352332198168, 52.502196938170542 ], [ 13.297321254756232, 52.502194111827414 ], [ 13.297307710894422, 52.502191537825688 ], [ 13.297294257454693, 52.502186586048467 ], [ 13.297271018635486, 52.502182683869833 ], [ 13.297271615913159, 52.502167229375644 ], [ 13.297276017677797, 52.502154207814023 ], [ 13.297286354309653, 52.502138894392708 ], [ 13.297292247885519, 52.502136908539029 ], [ 13.297130109722676, 52.502135325632523 ], [ 13.297130540579346, 52.502111026782714 ], [ 13.2970583252705, 52.502110799214691 ], [ 13.29705964697945, 52.502085828956687 ], [ 13.297020521011607, 52.502085585842558 ], [ 13.297021713456596, 52.502069754193023 ], [ 13.297022122726352, 52.502064273645054 ], [ 13.296920850309574, 52.502062473248102 ], [ 13.296920435570081, 52.502066722819748 ], [ 13.296875115688696, 52.502065868102655 ], [ 13.296875530168196, 52.502061663483488 ], [ 13.296764317734166, 52.502059691983135 ], [ 13.296764625581462, 52.502063772132992 ], [ 13.296725871979923, 52.502063044260993 ], [ 13.29672569681709, 52.50205900018787 ], [ 13.296645568568685, 52.502057581295041 ], [ 13.296636626085288, 52.502073794974706 ], [ 13.296655310029513, 52.50207817027232 ], [ 13.296642672724557, 52.502100052764298 ], [ 13.296646289015678, 52.50210083581716 ], [ 13.296630853793987, 52.50212671957501 ], [ 13.296627590109047, 52.502126152892124 ], [ 13.296596601692183, 52.502179788875125 ], [ 13.296450508254486, 52.502147685197535 ], [ 13.296548084496953, 52.501982874106361 ], [ 13.297027663568374, 52.501990299060303 ], [ 13.297303850998823, 52.50199458186831 ], [ 13.297687707321044, 52.502000532022635 ], [ 13.298071771403178, 52.502006483919175 ], [ 13.298454087749036, 52.502012408531783 ], [ 13.298833060263393, 52.502018279329903 ], [ 13.299219197970963, 52.502024260013208 ], [ 13.299601174587623, 52.502030175132532 ], [ 13.299921958137718, 52.502035141343576 ], [ 13.300360432799872, 52.502041920730491 ], [ 13.30035928141019, 52.502025821610133 ], [ 13.300358886746581, 52.50202608387827 ], [ 13.30033931478216, 52.502028181770292 ], [ 13.300319834545235, 52.502027901902551 ], [ 13.300280874072286, 52.502027342157412 ], [ 13.300267603769877, 52.502017636101414 ], [ 13.300252845439804, 52.501996013292519 ], [ 13.300241477455238, 52.501987524102042 ], [ 13.300233181750293, 52.502000488923585 ], [ 13.300217825729995, 52.501994320607693 ], [ 13.300194816079488, 52.50198447461085 ], [ 13.300197589834895, 52.501963103692646 ], [ 13.300223281448226, 52.501953957425087 ], [ 13.300215672247225, 52.501949089949434 ], [ 13.300201715474644, 52.501957216182198 ], [ 13.30019211224012, 52.501953509592312 ], [ 13.300184825557508, 52.501940320886966 ], [ 13.300181708948406, 52.501920054873402 ], [ 13.300159913679398, 52.501929257115449 ], [ 13.300144603528683, 52.501921900810721 ], [ 13.300135185256917, 52.501913438724657 ], [ 13.30012214433477, 52.501897789160388 ], [ 13.300120792442199, 52.50188230665033 ], [ 13.300134979990105, 52.501868236955737 ], [ 13.300165965697593, 52.501873439417281 ], [ 13.300183222492386, 52.50188082458795 ], [ 13.300180723945084, 52.501895062236748 ], [ 13.300192044553944, 52.501904740289923 ], [ 13.300217185762557, 52.501909859663478 ], [ 13.300215881176046, 52.501893188297153 ], [ 13.300220005368727, 52.501887299866127 ], [ 13.30024936393, 52.501884153964859 ], [ 13.300260777755881, 52.501891454276262 ], [ 13.300289997283796, 52.501891874079952 ], [ 13.300274688596344, 52.501884517813068 ], [ 13.300284704611116, 52.50187752449164 ], [ 13.300306087080786, 52.501879021232178 ], [ 13.300310258597285, 52.501871943940735 ], [ 13.300319676894309, 52.501880406013115 ], [ 13.300346720440219, 52.501886741327802 ], [ 13.300349385745676, 52.501887695823669 ], [ 13.30034618559675, 52.501843049844503 ], [ 13.298300435722354, 52.501822824320577 ], [ 13.298304702572262, 52.501824082425173 ], [ 13.298305961987545, 52.501841942704885 ], [ 13.298317282167101, 52.501851620933977 ], [ 13.298330506067664, 52.501862516082035 ], [ 13.2983165015893, 52.501871830945682 ], [ 13.298302820043775, 52.501872822790673 ], [ 13.298290811110379, 52.501880976817539 ], [ 13.298277036215257, 52.501884347291082 ], [ 13.298242293678461, 52.501875520781752 ], [ 13.298227029792844, 52.501866975354623 ], [ 13.298229437127349, 52.501855115506416 ], [ 13.298235832622826, 52.501840933950739 ], [ 13.298246260722161, 52.501823241788593 ], [ 13.29825068351229, 52.501822331659241 ], [ 13.29743704397443, 52.501814276504007 ], [ 13.297438465929279, 52.501815187098003 ], [ 13.297441627210452, 52.501834264296839 ], [ 13.297452671546331, 52.501851075866341 ], [ 13.297465298027753, 52.501877425605784 ], [ 13.297464838648498, 52.50188931347266 ], [ 13.297470223721561, 52.501901286345998 ], [ 13.297483308129738, 52.501915748195472 ], [ 13.297476682710419, 52.501935873192295 ], [ 13.297459104765515, 52.501936809766306 ], [ 13.297441343051405, 52.501942501843779 ], [ 13.297431234725661, 52.501951871774878 ], [ 13.297411754551828, 52.501951591428686 ], [ 13.2973902343267, 52.501953660794996 ], [ 13.29735131992318, 52.501951911209474 ], [ 13.297344032622705, 52.50193872231516 ], [ 13.297328768892342, 52.501930176773548 ], [ 13.297315179165347, 52.501928791649689 ], [ 13.29730761623993, 52.501922735113325 ], [ 13.297310023824863, 52.501910875286072 ], [ 13.297316189931204, 52.501902637266433 ], [ 13.297334456969747, 52.501883869363787 ], [ 13.297371424623281, 52.501885590938095 ], [ 13.297358292844068, 52.501872317931841 ], [ 13.297340806811899, 52.501870876735502 ], [ 13.297330928206764, 52.501874302275731 ], [ 13.297315344390455, 52.50187407799028 ], [ 13.297306018533847, 52.501863238829309 ], [ 13.297296874992764, 52.501847644140661 ], [ 13.297297472254149, 52.501832189645391 ], [ 13.297325020646893, 52.501825449803107 ], [ 13.297346494867586, 52.501824569324597 ], [ 13.297357998606712, 52.501829492137723 ], [ 13.297366342536304, 52.501815338669033 ], [ 13.297369737639228, 52.50181360996762 ], [ 13.296853966483106, 52.501808501196777 ], [ 13.296865421073189, 52.50181526565067 ], [ 13.296867001606602, 52.501824803807402 ], [ 13.296866450151898, 52.501839069423049 ], [ 13.296848595014461, 52.501847139142519 ], [ 13.296828701301019, 52.50185755768765 ], [ 13.296805232936981, 52.501859598901277 ], [ 13.296785660890892, 52.501861696204664 ], [ 13.296754170114626, 52.501869568701196 ], [ 13.29674688447929, 52.501856379792791 ], [ 13.296729534886559, 52.501851371856795 ], [ 13.296720393025458, 52.501835777146511 ], [ 13.296705129453141, 52.501827231525581 ], [ 13.296707537194175, 52.501815371711743 ], [ 13.296723719919243, 52.501800141607475 ], [ 13.296735821003768, 52.501789610888267 ], [ 13.296765409564136, 52.501780520573874 ], [ 13.296788500233259, 52.501784399141805 ], [ 13.29670838482547, 52.501708954895442 ], [ 13.296528153917547, 52.501982543971565 ], [ 13.296426686459958, 52.502160196013769 ], [ 13.296370418791428, 52.502280410217644 ], [ 13.296371716986899, 52.502280748999169 ], [ 13.296382992349171, 52.502291616307012 ], [ 13.296396949888431, 52.502283491430717 ], [ 13.296412671753464, 52.502280149210819 ], [ 13.29641189032492, 52.50230035830247 ], [ 13.296413240922607, 52.50231584084289 ], [ 13.296399053521485, 52.50232991010003 ], [ 13.296393071067362, 52.502333392566115 ], [ 13.296373268934198, 52.502341434178135 ], [ 13.296357455135016, 52.502347153245452 ], [ 13.296350030154077, 52.502337530920038 ], [ 13.296345918565404, 52.502332753121813 ], [ 13.296330914055686, 52.502364828100518 ], [ 13.296246096747051, 52.502468990892758 ], [ 13.29627726769368, 52.502469440687726 ], [ 13.296281945594428, 52.502449286810908 ], [ 13.296286163749599, 52.502441021690871 ], [ 13.296286899300439, 52.502422000578129 ], [ 13.296296960531159, 52.502413819603071 ], [ 13.296322837126963, 52.502399917790775 ], [ 13.296325612754558, 52.502378547879644 ], [ 13.296362672720043, 52.502377892020668 ], [ 13.296390024235373, 52.502377589966251 ], [ 13.296390089097013, 52.502377589102025 ], [ 13.296448577182723, 52.502390208011022 ], [ 13.296762254293377, 52.502457863404167 ], [ 13.296752854843126, 52.502455140409594 ], [ 13.296747286020024, 52.502447923908349 ], [ 13.296724093111415, 52.502442831847077 ], [ 13.296716807394267, 52.502429642937336 ], [ 13.296705485951637, 52.502419964536507 ], [ 13.296721621469368, 52.502405923290695 ], [ 13.29672987382636, 52.502394146724271 ], [ 13.296738264029637, 52.502378804427778 ], [ 13.296744568159877, 52.502367000710677 ], [ 13.296767852953256, 52.502369715015583 ], [ 13.296777592393003, 52.502369855232295 ], [ 13.2967857987329, 52.502359268436301 ], [ 13.296792332649147, 52.502341520336259 ], [ 13.296821506463319, 52.502343129874937 ], [ 13.296856342497064, 52.502349578171987 ], [ 13.296871696686933, 52.502355746899681 ], [ 13.296883155989237, 52.502361859555229 ], [ 13.296908343048923, 52.502365789855801 ], [ 13.296903711401274, 52.502384754884076 ], [ 13.296903068032483, 52.502401398250825 ], [ 13.29690251657798, 52.502415663865371 ], [ 13.296902286790662, 52.502421608245832 ], [ 13.296909298325783, 52.502441929523776 ], [ 13.296916492188481, 52.502457496174351 ], [ 13.296894879778979, 52.502461943200309 ], [ 13.296879203842076, 52.502464096607852 ], [ 13.296855827074006, 52.502463760076473 ], [ 13.296834260614959, 52.502467018215249 ], [ 13.296827003258372, 52.502471846316567 ], [ 13.297103425457369, 52.502531466684623 ], [ 13.297065618216461, 52.502598871784777 ], [ 13.297024663192014, 52.50259947089809 ], [ 13.297017427805418, 52.502595459165505 ], [ 13.297020179261439, 52.502613357121326 ], [ 13.29703349497084, 52.502621874660001 ], [ 13.297038878573398, 52.50263384663149 ], [ 13.297054280313837, 52.502638826481359 ], [ 13.297070094164976, 52.502633106422685 ], [ 13.297091706607153, 52.502628660264008 ], [ 13.297109055108514, 52.502633667229382 ], [ 13.297100758360768, 52.50264663182103 ], [ 13.297096494349875, 52.502656086745723 ], [ 13.297101237663517, 52.502667204323807 ], [ 13.297108378641774, 52.502662528280389 ], [ 13.297116998492616, 52.502641242474802 ], [ 13.297115601687999, 52.502626948817223 ], [ 13.29710042967212, 52.502616025493069 ], [ 13.297087115458654, 52.50260750708442 ], [ 13.29713047361164, 52.502537300192003 ], [ 13.297452877950789, 52.502606828147584 ], [ 13.29749072899123, 52.502614987514761 ], [ 13.297534396914777, 52.502624405728263 ], [ 13.297540663963588, 52.502625758279294 ], [ 13.297530466273709, 52.502609069496849 ], [ 13.297533379188515, 52.502584132025262 ], [ 13.29754357804921, 52.502572384313353 ], [ 13.297547979742147, 52.502559363640749 ], [ 13.297562166855061, 52.502545294243902 ], [ 13.297576217612994, 52.502534791495862 ], [ 13.297580619292305, 52.502521770821836 ], [ 13.297575371900814, 52.50250623222297 ], [ 13.297540305966423, 52.502505727619592 ], [ 13.297530244942802, 52.502513908702042 ], [ 13.29750909197748, 52.502506467075925 ], [ 13.297507465342498, 52.502498117803839 ], [ 13.297494057728619, 52.502491977172191 ], [ 13.297482324127744, 52.502492997854759 ], [ 13.297462797771733, 52.502493906391422 ], [ 13.297449160451311, 52.502493710136825 ], [ 13.297429771924511, 52.502491052038778 ], [ 13.297428283135236, 52.502479136136536 ], [ 13.297431150119603, 52.502455388442414 ], [ 13.297453038095219, 52.502443808958034 ], [ 13.297459250194317, 52.50243438205564 ], [ 13.297434108986876, 52.502429262995221 ], [ 13.297430809842519, 52.502413752426932 ], [ 13.297442728667397, 52.502407976264749 ], [ 13.297472315996885, 52.502398886654142 ], [ 13.297477701165809, 52.502410858628103 ], [ 13.297469403096848, 52.502423823226167 ], [ 13.297500526652248, 52.502425460655338 ], [ 13.297502796392118, 52.50241716745429 ], [ 13.297529977667631, 52.502419936782296 ], [ 13.297529518262108, 52.502431825547099 ], [ 13.297541435606648, 52.502426049353737 ], [ 13.297555486330758, 52.502415546607665 ], [ 13.297574874832488, 52.502418204684929 ], [ 13.297594217432541, 52.502422050736939 ], [ 13.297611383596299, 52.502431814054468 ], [ 13.297614956962708, 52.502440191337875 ], [ 13.297620709645754, 52.502442653192034 ], [ 13.297641954475084, 52.502447717045122 ], [ 13.297657126569801, 52.502458640300787 ], [ 13.297646696606288, 52.502476332384653 ], [ 13.297621233854642, 52.502479533702164 ], [ 13.297611171344693, 52.50248771566914 ], [ 13.297608719339649, 52.502500764399571 ], [ 13.297609885136051, 52.502521002414291 ], [ 13.297629550788217, 52.502516527245085 ], [ 13.297662713007501, 52.502515814891382 ], [ 13.297668236052916, 52.502524220227365 ], [ 13.29766773074595, 52.502537297869345 ], [ 13.297678914621445, 52.502550542809573 ], [ 13.297690097031062, 52.502563787727567 ], [ 13.297691539957128, 52.502576892503527 ], [ 13.297668117182326, 52.502577745008672 ], [ 13.297665985275966, 52.50258247158326 ], [ 13.297675220934007, 52.502595689389487 ], [ 13.297688259674455, 52.502611340093523 ], [ 13.29767425632765, 52.502620653999401 ], [ 13.297668136156132, 52.502627702261286 ], [ 13.297652919536443, 52.502617967904563 ], [ 13.297635339849634, 52.502618904481174 ], [ 13.297628945515497, 52.502633086021213 ], [ 13.297624681653623, 52.502642540067299 ], [ 13.297624878654307, 52.502643923952427 ], [ 13.297627116871205, 52.502644415610355 ], [ 13.297789327581443, 52.502679405720343 ], [ 13.297760957743066, 52.50272306705935 ], [ 13.297727261738949, 52.502788002289805 ], [ 13.297699391244198, 52.502803064355696 ], [ 13.297664004981042, 52.502810881943645 ], [ 13.297686446190351, 52.502764815587639 ], [ 13.297435262157903, 52.502707675438984 ], [ 13.297416121908769, 52.502749031104102 ], [ 13.297381383808954, 52.502739428468139 ], [ 13.297379277940205, 52.50275293533236 ], [ 13.297357206041729, 52.502769269407644 ], [ 13.297346959631616, 52.502782206855997 ], [ 13.297319226853169, 52.502793702202382 ], [ 13.297317632137176, 52.502794630521407 ], [ 13.297317273075342, 52.502795190901104 ], [ 13.297506779447504, 52.50284430291876 ], [ 13.297573156820615, 52.502862683075833 ], [ 13.297581823333013, 52.502858144043977 ], [ 13.29758966209217, 52.502857067305015 ], [ 13.297606826984353, 52.502866829704168 ], [ 13.297624085199516, 52.502874215267802 ], [ 13.297626606606833, 52.502877482991551 ], [ 13.29774122380152, 52.502909220414637 ], [ 13.297753298754193, 52.502899863469182 ], [ 13.297772595611489, 52.502904899268792 ], [ 13.297784099678516, 52.502909822042447 ], [ 13.297799960907115, 52.502902913929717 ], [ 13.297801449808738, 52.502914829827432 ], [ 13.297820654811188, 52.502922243372403 ], [ 13.297835917505157, 52.502930788831748 ], [ 13.297848740251519, 52.50293899168458 ], [ 13.297973486531472, 52.502973533314787 ], [ 13.29813001468858, 52.503011185312445 ], [ 13.298166510853891, 52.502945457665874 ], [ 13.297906428081555, 52.502888300214003 ], [ 13.297978823667604, 52.502765702692116 ], [ 13.297902582082855, 52.502891630072611 ], [ 13.297889128362755, 52.502886678361236 ], [ 13.297863803151897, 52.502886313997699 ], [ 13.297840609879618, 52.502881222152617 ], [ 13.297817600312227, 52.502871375695442 ], [ 13.29781638700865, 52.502852326538395 ], [ 13.297820698256846, 52.50284168363013 ], [ 13.297884525303438, 52.502854496422941 ], [ 13.297941898875646, 52.502731617159448 ], [ 13.297883686928461, 52.502724832870193 ], [ 13.297897934417945, 52.502702830456123 ], [ 13.29800261507798, 52.502725409179668 ], [ 13.298003145486831, 52.502725523805736 ], [ 13.298536596754278, 52.502840570064784 ], [ 13.298541566464644, 52.502841638663519 ], [ 13.298536713731806, 52.502838838241473 ], [ 13.298517554522157, 52.502830236833546 ], [ 13.29850641627316, 52.502815802194867 ], [ 13.298494958063317, 52.502809690613923 ], [ 13.298487808028758, 52.502792935156812 ], [ 13.298500002276301, 52.502780026524796 ], [ 13.29850621269442, 52.502770600443867 ], [ 13.298525924285167, 52.50276493624898 ], [ 13.29853027832249, 52.50275310439379 ], [ 13.29854632303401, 52.502741440671194 ], [ 13.29855438984479, 52.502734419461518 ], [ 13.298555170337792, 52.502714209450275 ], [ 13.298549694485303, 52.502704615298491 ], [ 13.29856369767648, 52.502695301287744 ], [ 13.298560489942259, 52.502677412993961 ], [ 13.298565029085797, 52.50266082565004 ], [ 13.29860041651194, 52.502653008709807 ], [ 13.298608529209483, 52.502644798619038 ], [ 13.298616092437362, 52.502650855074101 ], [ 13.298653059320422, 52.502652576232393 ], [ 13.298672357683481, 52.502657611007898 ], [ 13.298691562724558, 52.50266502441211 ], [ 13.298712853697046, 52.502668899197516 ], [ 13.298716520582341, 52.502674898716116 ], [ 13.298739576126678, 52.502683557021086 ], [ 13.298768659941288, 52.502687542958917 ], [ 13.298766160885835, 52.502701780571677 ], [ 13.298777160032488, 52.502719780898438 ], [ 13.298768863756171, 52.502732745610956 ], [ 13.298756990921284, 52.502737333029977 ], [ 13.298756531876212, 52.502749220903091 ], [ 13.298757929216638, 52.502763514545549 ], [ 13.298736500468779, 52.502763206399365 ], [ 13.298697446086004, 52.502765023860618 ], [ 13.298695132113977, 52.502774505984128 ], [ 13.29870264799367, 52.502781751289774 ], [ 13.298718463160109, 52.502776031030699 ], [ 13.298735765966162, 52.502782227535192 ], [ 13.298741335158155, 52.502789443945581 ], [ 13.298719309614688, 52.502804590300485 ], [ 13.298693525342214, 52.502816114886208 ], [ 13.298675440616309, 52.502830128366512 ], [ 13.298669184314983, 52.502840743333543 ], [ 13.298657036010253, 52.502852463106059 ], [ 13.298619885312034, 52.502855497455961 ], [ 13.298602312060508, 52.502854739425842 ], [ 13.298620965754722, 52.502858766913484 ], [ 13.298954472906155, 52.502932094552094 ], [ 13.298953278307765, 52.502934337766369 ], [ 13.299002678304745, 52.502945168549985 ], [ 13.298991494257868, 52.502964008873661 ], [ 13.298942092735471, 52.502953178962741 ], [ 13.298869460791005, 52.503076273569462 ], [ 13.29891915505412, 52.503087194933741 ], [ 13.298907970899567, 52.503106036147095 ], [ 13.298858276618182, 52.503095114778006 ], [ 13.298831580669235, 52.503140243524669 ], [ 13.298219224799769, 52.503005634365771 ], [ 13.298205318352515, 52.503029298803341 ], [ 13.298467881686213, 52.503092455136489 ], [ 13.298555194399452, 52.503114329513018 ], [ 13.298555898179233, 52.50311361764021 ], [ 13.298585119964198, 52.503114037892821 ], [ 13.298593280102297, 52.503104639847251 ], [ 13.298600750142084, 52.503113073137683 ], [ 13.298618008622697, 52.50312045855825 ], [ 13.298642873423383, 52.503132710611993 ], [ 13.298654700466047, 52.50312931208272 ], [ 13.298662952414579, 52.503117536278204 ], [ 13.298682387205814, 52.503119005299766 ], [ 13.298699690140277, 52.503125201810342 ], [ 13.298712639087279, 52.503143229281221 ], [ 13.298707567524724, 52.503152504513039 ], [ 13.298800314841808, 52.503175739904002 ], [ 13.298995012436151, 52.503221108291932 ], [ 13.299016515337867, 52.503218967351096 ], [ 13.29903817381628, 52.503213331062177 ], [ 13.299071108517758, 52.503218562725465 ], [ 13.299101957341021, 52.503227332103421 ], [ 13.299103307433196, 52.503242814597883 ], [ 13.299102826353641, 52.503246230635348 ], [ 13.299499353695619, 52.50333862767426 ], [ 13.299501176513742, 52.503337743964238 ], [ 13.29952686907636, 52.503328597857958 ], [ 13.299548527545854, 52.503322961475597 ], [ 13.299573898916673, 52.503322136603131 ], [ 13.299595557377151, 52.503316500212094 ], [ 13.299636283662359, 52.503321843703588 ], [ 13.299657437383985, 52.503329284954788 ], [ 13.29966481736979, 52.503340095956148 ], [ 13.29967387028247, 52.503358068222965 ], [ 13.299677260576896, 52.503371200957218 ], [ 13.299676920902051, 52.503380002066315 ], [ 13.299859355484537, 52.503422511594799 ], [ 13.299877937928366, 52.503424041898079 ], [ 13.299901315242494, 52.503424377836737 ], [ 13.299930399621582, 52.503428364392079 ], [ 13.299957168794208, 52.503441833068436 ], [ 13.299956367295161, 52.503445115930262 ], [ 13.299973275832574, 52.503449055186131 ], [ 13.299990377528767, 52.503439932088803 ], [ 13.300000439822934, 52.503431749918811 ], [ 13.30000410691094, 52.503437750297408 ], [ 13.300032732596231, 52.503453624707213 ], [ 13.300061540325522, 52.50346474357773 ], [ 13.300063305064013, 52.503469527082878 ], [ 13.300098234226903, 52.503473596680003 ], [ 13.300105843674238, 52.503478464164118 ], [ 13.300107235655732, 52.503480268919759 ], [ 13.300280085848797, 52.503520543330744 ], [ 13.30031063797842, 52.503486488394401 ], [ 13.300322648459646, 52.503478334186376 ] ], [ [ 13.300156715960265, 52.503434319084967 ], [ 13.300179796292106, 52.50339183006767 ], [ 13.299111531443387, 52.503142151251218 ], [ 13.29909461467466, 52.503176402819733 ], [ 13.299083156289239, 52.50317029129463 ], [ 13.299073783861967, 52.503160640247962 ], [ 13.299074426428586, 52.50314399686458 ], [ 13.299090974530799, 52.50311925629611 ], [ 13.299105438172401, 52.503098054368735 ], [ 13.299117263698482, 52.503094655771626 ], [ 13.299130945642576, 52.503093662937069 ], [ 13.299142589045539, 52.503095019867921 ], [ 13.299121869153087, 52.503126837689699 ], [ 13.300186006476713, 52.503382402998561 ], [ 13.300212753861276, 52.50334591434715 ], [ 13.300231821891762, 52.503356893240415 ], [ 13.300231179757319, 52.503373536633177 ], [ 13.300226871979623, 52.503384179675159 ], [ 13.300208420539608, 52.503407704414208 ], [ 13.300201933697501, 52.503424263832258 ], [ 13.300180093283187, 52.503434654968579 ], [ 13.300156715960265, 52.503434319084967 ] ], [ [ 13.29951180906164, 52.503124116381855 ], [ 13.299519820819727, 52.503108899726733 ], [ 13.299504141945443, 52.503109408947999 ], [ 13.299502245116942, 52.503102819898395 ], [ 13.299497110426005, 52.503095297775516 ], [ 13.299484208565829, 52.503076080632759 ], [ 13.299479487396781, 52.503059677540435 ], [ 13.299142777300958, 52.502989160056572 ], [ 13.29912178210331, 52.503028110244763 ], [ 13.299065699911921, 52.503016599011282 ], [ 13.299045326682823, 52.502988948539205 ], [ 13.29907367540309, 52.502956415018822 ], [ 13.299493752797648, 52.503047003577677 ], [ 13.299506612074726, 52.503049764393992 ], [ 13.299512583369259, 52.503047941388687 ], [ 13.299513042215331, 52.503036053511522 ], [ 13.299525601862806, 52.503013633730447 ], [ 13.299545357815676, 52.503006781365578 ], [ 13.299587666441802, 52.503021663017236 ], [ 13.29960655063358, 52.503037397519861 ], [ 13.299629560694587, 52.503047243633013 ], [ 13.299634854757624, 52.50306159326842 ], [ 13.299634304174287, 52.503075858901568 ], [ 13.299632691299175, 52.503076953327984 ], [ 13.299630412629483, 52.503078501232537 ], [ 13.299627593700899, 52.503085037787713 ], [ 13.299976412266465, 52.503162578278406 ], [ 13.299982876392415, 52.503160545643048 ], [ 13.299983881729995, 52.503159387635506 ], [ 13.299985584455635, 52.50315672822672 ], [ 13.299987374289158, 52.503153453272652 ], [ 13.299987646316145, 52.503153505734069 ], [ 13.299992179241157, 52.503146421958903 ], [ 13.299990643864623, 52.503135694961983 ], [ 13.299975425079468, 52.50312596087776 ], [ 13.299971163141629, 52.50313541503273 ], [ 13.299949732726891, 52.503135107083565 ], [ 13.29995789258003, 52.503125708941468 ], [ 13.299960207773591, 52.503116226812779 ], [ 13.299946571715479, 52.503116030865527 ], [ 13.299927273037127, 52.503110995396646 ], [ 13.299892345685143, 52.503106924873926 ], [ 13.299891085601857, 52.50308906460905 ], [ 13.299893584319117, 52.503074826970497 ], [ 13.299915196705781, 52.503070380295739 ], [ 13.299917557817199, 52.503059708391447 ], [ 13.299914395351815, 52.503040632151354 ], [ 13.299901080460591, 52.50303211405425 ], [ 13.299862163514391, 52.503030365264848 ], [ 13.299844631054045, 52.503030113312121 ], [ 13.299831453783279, 52.503018029472599 ], [ 13.299816556232546, 52.502999973223965 ], [ 13.299803195457761, 52.502992644892508 ], [ 13.299785569779104, 52.50299477066546 ], [ 13.299776472483673, 52.502977987305322 ], [ 13.299787175530154, 52.502953161741111 ], [ 13.299795610630143, 52.502936631241944 ], [ 13.299809431623823, 52.50293207171616 ], [ 13.299838789472155, 52.502928925003665 ], [ 13.29985863856886, 52.502919694851194 ], [ 13.299876943091334, 52.502911965610238 ], [ 13.299880434428911, 52.502910491772205 ], [ 13.299897966841987, 52.502910743719255 ], [ 13.299919395674497, 52.502911051655715 ], [ 13.29994630212685, 52.502920954597954 ], [ 13.299963559325091, 52.502928338903956 ], [ 13.299970862773989, 52.50293242785748 ], [ 13.299978823880972, 52.502936885010158 ], [ 13.299988058871033, 52.502950101721758 ], [ 13.30000531608772, 52.502957486021771 ], [ 13.300007126675625, 52.502961080650053 ], [ 13.300004673876989, 52.50297412941373 ], [ 13.29999447557233, 52.502985877341779 ], [ 13.300003756417139, 52.50299790607292 ], [ 13.300005291792827, 52.503008633069925 ], [ 13.30000659779561, 52.503025304456301 ], [ 13.299988790119356, 52.503032184893591 ], [ 13.29995956836739, 52.503031764988037 ], [ 13.29994203590557, 52.503031513049699 ], [ 13.299941714770139, 52.503039835194592 ], [ 13.299966810752096, 52.503046142604887 ], [ 13.299989958490738, 52.503052422913669 ], [ 13.3000247940954, 52.503058870264475 ], [ 13.300034076436019, 52.503070899014489 ], [ 13.300057224232184, 52.50307717841163 ], [ 13.300064787734168, 52.503083234775993 ], [ 13.300045169412302, 52.503086521492833 ], [ 13.30005241036107, 52.503100899083471 ], [ 13.300065635063111, 52.503111794042162 ], [ 13.300082800610122, 52.503121556087144 ], [ 13.300090180632571, 52.50313236796157 ], [ 13.300109661355418, 52.503132647871226 ], [ 13.300109202668688, 52.503144535751865 ], [ 13.300079843256224, 52.503147681610514 ], [ 13.300071866882824, 52.503152325148214 ], [ 13.300061806139315, 52.50316050734645 ], [ 13.3000545753459, 52.503167937182532 ], [ 13.300045856405251, 52.503176894820477 ], [ 13.300045231297029, 52.503180226971807 ], [ 13.30003642296581, 52.503191348407874 ], [ 13.300035196334608, 52.503193430229757 ], [ 13.300034543982052, 52.503193420856043 ], [ 13.300021028402577, 52.503201289965531 ], [ 13.300007620220097, 52.503195149614669 ], [ 13.29998832297265, 52.503190114176618 ], [ 13.299986874620533, 52.503189847005387 ], [ 13.299974123022666, 52.503211213003077 ], [ 13.29965847415373, 52.503141051789363 ], [ 13.299669797251454, 52.503160558217076 ], [ 13.299670965478288, 52.503180796238652 ], [ 13.299651255350412, 52.503186459746146 ], [ 13.299629596961168, 52.50319209614814 ], [ 13.299603766841997, 52.503204808910588 ], [ 13.299586463746348, 52.503198612531037 ], [ 13.299566981527066, 52.50319833251384 ], [ 13.299553161897341, 52.503202892031361 ], [ 13.299541105464129, 52.503212235038596 ], [ 13.299517865931598, 52.503208332397101 ], [ 13.299518233037215, 52.503198821376706 ], [ 13.299505422880801, 52.503177227379787 ], [ 13.299498318292734, 52.503159283103471 ], [ 13.299502948914778, 52.503140317967201 ], [ 13.299516787852165, 52.503124378558105 ], [ 13.29951180906164, 52.503124116381855 ] ], [ [ 13.300052663936688, 52.503043808544668 ], [ 13.300035681956849, 52.503029290085308 ], [ 13.300034284195048, 52.503014996454972 ], [ 13.300036966322143, 52.50299600419978 ], [ 13.300056905682681, 52.502984396237082 ], [ 13.300072812496468, 52.502976298040394 ], [ 13.300084958990217, 52.502964578098634 ], [ 13.30011789363734, 52.50296980947023 ], [ 13.300158573834583, 52.502976340759389 ], [ 13.300176367183729, 52.502977200623455 ], [ 13.300193594321467, 52.502978033468104 ], [ 13.300199113699573, 52.502982156116161 ], [ 13.300204961040695, 52.502986523541374 ], [ 13.300210392892453, 52.502997306518672 ], [ 13.300233540676105, 52.503003585881267 ], [ 13.300250568580179, 52.503016915434721 ], [ 13.300248253454688, 52.503026397569819 ], [ 13.300234250508318, 52.503035711781585 ], [ 13.300225815517718, 52.503052243211627 ], [ 13.300229253296955, 52.50306418707504 ], [ 13.300224989912431, 52.503073642117229 ], [ 13.300201245858641, 52.503082816369421 ], [ 13.300181535806409, 52.503088480864932 ], [ 13.300140626181049, 52.503087893074024 ], [ 13.30011548431251, 52.503082773679566 ], [ 13.300096460828359, 52.50307060586924 ], [ 13.300069509850308, 52.50306189185936 ], [ 13.300052663936688, 52.503043808544668 ] ], [ [ 13.299719267813908, 52.502945049481511 ], [ 13.299712919980811, 52.502958042260985 ], [ 13.299693437866603, 52.502957762265503 ], [ 13.299679710092541, 52.502959944043326 ], [ 13.299669418465179, 52.502974069676917 ], [ 13.299640611155093, 52.502962950713588 ], [ 13.299621358464519, 52.502956726317841 ], [ 13.299596400241334, 52.502946852202122 ], [ 13.299589297123688, 52.502928907951748 ], [ 13.299585905413995, 52.502915775193344 ], [ 13.299579167886478, 52.502888320798611 ], [ 13.299595258293859, 52.502875467155832 ], [ 13.29962053616379, 52.502877020005322 ], [ 13.299657275335838, 52.502884685261265 ], [ 13.299705977595167, 52.502885385215833 ], [ 13.299739003899345, 52.502888238936571 ], [ 13.299740491852997, 52.502900154793195 ], [ 13.299739895425326, 52.502915609305248 ], [ 13.299745005983057, 52.502934714447207 ], [ 13.299719267813908, 52.502945049481511 ] ], [ [ 13.299049861597364, 52.502875953754227 ], [ 13.299037667482422, 52.502888862443882 ], [ 13.299027927916546, 52.502888722412258 ], [ 13.299006359927798, 52.502891980925163 ], [ 13.298990224949579, 52.502906022486172 ], [ 13.298968612519747, 52.502910469890537 ], [ 13.298953349644387, 52.502901923676902 ], [ 13.298930202136694, 52.502895643167051 ], [ 13.29892681062627, 52.50288251039138 ], [ 13.298925275517163, 52.502871783382425 ], [ 13.298933665054188, 52.50285644092574 ], [ 13.29895332925482, 52.502851965515667 ], [ 13.298984589375092, 52.502850036802947 ], [ 13.299007782803056, 52.502855127526132 ], [ 13.299034413642454, 52.502872163039051 ], [ 13.299049861597364, 52.502875953754227 ] ], [ [ 13.299169475091261, 52.502857452198192 ], [ 13.299146327540324, 52.502851172629128 ], [ 13.299132919587462, 52.502845032180709 ], [ 13.299117886159372, 52.502830542499815 ], [ 13.299100307886439, 52.502831479314835 ], [ 13.29908708350812, 52.502820584250422 ], [ 13.299101363489877, 52.502804136932589 ], [ 13.299098017833563, 52.502789815283869 ], [ 13.299088965268298, 52.502771842974326 ], [ 13.299102694483809, 52.502769661285917 ], [ 13.299108996569188, 52.502757857417471 ], [ 13.299136453515647, 52.50275349401312 ], [ 13.299154741953638, 52.502754617398828 ], [ 13.299161732769834, 52.502755046981086 ], [ 13.299162747269374, 52.502756361695241 ], [ 13.299171014845861, 52.502767074898252 ], [ 13.299188501299097, 52.502768515827348 ], [ 13.299207935956117, 52.502769984761528 ], [ 13.299229135236109, 52.502776237209652 ], [ 13.299232572724639, 52.502788181100115 ], [ 13.299263191809526, 52.502802894821606 ], [ 13.299256750602149, 52.502818265309735 ], [ 13.299254297590524, 52.502831314056351 ], [ 13.29924015681434, 52.502844194781837 ], [ 13.299214556235331, 52.502850963972236 ], [ 13.299198650819426, 52.502859061175279 ], [ 13.299182881580505, 52.502863592621352 ], [ 13.299169475091261, 52.502857452198192 ] ], [ [ 13.298980949426086, 52.502792889375698 ], [ 13.298966898880828, 52.502803393190895 ], [ 13.298955211130368, 52.502803225141818 ], [ 13.298918242634498, 52.502801504055689 ], [ 13.298893284694156, 52.502791628894805 ], [ 13.298875752337569, 52.502791376799301 ], [ 13.298862483594556, 52.502781670608726 ], [ 13.298859183922842, 52.502766160076675 ], [ 13.298845867812849, 52.502757642740363 ], [ 13.298846372739526, 52.502744565989509 ], [ 13.298856389176906, 52.502737572793571 ], [ 13.298876191011281, 52.502729531662752 ], [ 13.298890195649594, 52.502720216735433 ], [ 13.298919553382172, 52.502717071148943 ], [ 13.298941073915556, 52.502715001507212 ], [ 13.298966307237571, 52.502717743393987 ], [ 13.298979669261241, 52.502725071839563 ], [ 13.299000684915589, 52.502736078938888 ], [ 13.299013678269585, 52.502752918378135 ], [ 13.298997726916978, 52.502762205330257 ], [ 13.298980148669163, 52.502763142127648 ], [ 13.298993096156037, 52.502781169547738 ], [ 13.298980949426086, 52.502792889375698 ] ], [ [ 13.298870432945471, 52.502828174169906 ], [ 13.29887604803552, 52.502834202595515 ], [ 13.298893580409114, 52.502834454691111 ], [ 13.298899103729237, 52.502842859971544 ], [ 13.29889655880153, 52.50285828646421 ], [ 13.298896053887674, 52.502871363215164 ], [ 13.298876389672767, 52.502875838615566 ], [ 13.298856817264907, 52.502877936258265 ], [ 13.298825739238067, 52.50287511030573 ], [ 13.298810522309665, 52.502865375196777 ], [ 13.298799246199735, 52.502854508114972 ], [ 13.298797894750708, 52.502839025595897 ], [ 13.29882553536749, 52.502829907654352 ], [ 13.298845245472522, 52.502824243385007 ], [ 13.298866582440935, 52.502826929266192 ], [ 13.298870432945471, 52.502828174169906 ] ], [ [ 13.299056551419921, 52.50290459703249 ], [ 13.299075003219404, 52.502881073373231 ], [ 13.299094667417265, 52.502876597939697 ], [ 13.299121894947627, 52.502878178926231 ], [ 13.299148847129009, 52.502886892272194 ], [ 13.299158035961048, 52.502901297923941 ], [ 13.299153680568999, 52.502913130680724 ], [ 13.29915526163246, 52.502922668809695 ], [ 13.299141166695584, 52.502934360645305 ], [ 13.299115657846386, 52.50293875205891 ], [ 13.299100073639234, 52.502938528005338 ], [ 13.299076880191203, 52.502933436401236 ], [ 13.299065328632901, 52.502929701709611 ], [ 13.299054052443458, 52.50291883465156 ], [ 13.299056551419921, 52.50290459703249 ] ], [ [ 13.299184437403193, 52.502924277790669 ], [ 13.299196815071014, 52.502906613576044 ], [ 13.299210129821578, 52.502915130852429 ], [ 13.29922761633488, 52.502916571776225 ], [ 13.299228121151176, 52.502903495023133 ], [ 13.299241988052058, 52.502897747585216 ], [ 13.299259291015593, 52.502903943115442 ], [ 13.299268435465493, 52.502919537657483 ], [ 13.299272055045272, 52.502926726914389 ], [ 13.299271458452752, 52.502942181422618 ], [ 13.299255415329212, 52.502953845265317 ], [ 13.299251105887386, 52.502964488249724 ], [ 13.299229355767178, 52.502972502333954 ], [ 13.299228004164208, 52.502957019818787 ], [ 13.299214368160538, 52.502956823787535 ], [ 13.299187370061349, 52.502949298434892 ], [ 13.299197386457887, 52.502942306108856 ], [ 13.299184437403193, 52.502924277790669 ] ], [ [ 13.299461569568436, 52.502955619162442 ], [ 13.299477750305265, 52.502940388658601 ], [ 13.299496909753373, 52.502948989912838 ], [ 13.299515841242265, 52.502963535573194 ], [ 13.299518957607523, 52.502983801598894 ], [ 13.299518085773174, 52.503006389374463 ], [ 13.299507748229658, 52.503021702972347 ], [ 13.299486089904134, 52.503027339348705 ], [ 13.299464752798588, 52.503024653578208 ], [ 13.299437525163722, 52.503023072669706 ], [ 13.299424392425534, 52.50300979988711 ], [ 13.29944034521821, 52.503000513797666 ], [ 13.29942544783469, 52.502982457501119 ], [ 13.299435923101921, 52.502963576379294 ], [ 13.299461569568436, 52.502955619162442 ] ], [ [ 13.299664558548953, 52.502998978310721 ], [ 13.299684407713391, 52.502989748188213 ], [ 13.299699579031504, 52.503000671165658 ], [ 13.299707509533036, 52.502997216530773 ], [ 13.299705974230243, 52.502986489530521 ], [ 13.299706111878548, 52.502982922897388 ], [ 13.299729351310177, 52.502986825501203 ], [ 13.299762192694306, 52.502994434705855 ], [ 13.29976971029496, 52.503001679067822 ], [ 13.299769343280909, 52.503011189191142 ], [ 13.299790588638697, 52.503016252662334 ], [ 13.299798197973749, 52.503021120165627 ], [ 13.299807663799474, 52.503028392523191 ], [ 13.299795882750821, 52.503030602291027 ], [ 13.29979143578954, 52.503044811929264 ], [ 13.299789212290431, 52.503051917197588 ], [ 13.299798632240764, 52.503060378433673 ], [ 13.299778968029331, 52.503064853984029 ], [ 13.299765146990577, 52.503069413505784 ], [ 13.299733931153472, 52.503070153524817 ], [ 13.299723686837202, 52.503083091204893 ], [ 13.299706246122959, 52.503080461476053 ], [ 13.299677253761764, 52.503074097112084 ], [ 13.299672097334886, 52.503056180845455 ], [ 13.299657017773278, 52.503042880109142 ], [ 13.299645649639281, 52.503034390861529 ], [ 13.299655620134105, 52.503028586475374 ], [ 13.299658118923475, 52.503014348842306 ], [ 13.299664558548953, 52.502998978310721 ] ], [ [ 13.298492031981219, 52.502683564762407 ], [ 13.298478350151978, 52.502684557524098 ], [ 13.298455340540912, 52.502674711190259 ], [ 13.298453254595145, 52.502678249801271 ], [ 13.29845238225889, 52.502700836666961 ], [ 13.298457490761644, 52.50271994183904 ], [ 13.298456893887924, 52.502735396341322 ], [ 13.298462049784797, 52.502753312657298 ], [ 13.298449857006371, 52.502766221306658 ], [ 13.298441696902231, 52.502775619343097 ], [ 13.298435301330192, 52.502789800907202 ], [ 13.298407706542852, 52.50279773077883 ], [ 13.298382473212584, 52.502794988772841 ], [ 13.298368975020599, 52.502791226013869 ], [ 13.298359325844688, 52.502788708152373 ], [ 13.298326301185668, 52.502785854068961 ], [ 13.298310991052105, 52.502778497527999 ], [ 13.298309411683405, 52.502768958511645 ], [ 13.298295820157588, 52.502767574375653 ], [ 13.2982863102258, 52.502761489898809 ], [ 13.298282735234023, 52.502753112613654 ], [ 13.298271275633946, 52.502747000091574 ], [ 13.298271918494045, 52.502730356713933 ], [ 13.298274371789873, 52.502717307989911 ], [ 13.298297978311169, 52.502711699857727 ], [ 13.298296672961984, 52.502695028457183 ], [ 13.298281548020027, 52.502682916426245 ], [ 13.298287759943038, 52.502673490378115 ], [ 13.298311228679504, 52.502671448873713 ], [ 13.298320922274122, 52.502672777840814 ], [ 13.298338454578481, 52.502673030018116 ], [ 13.298338638255034, 52.502668274510434 ], [ 13.298356217948964, 52.502667337829337 ], [ 13.298342947885903, 52.502657631560382 ], [ 13.298339602486694, 52.502643309892107 ], [ 13.298342285351888, 52.502624316781564 ], [ 13.298350445448319, 52.502614918751661 ], [ 13.298358605541239, 52.502605520721183 ], [ 13.298374556969124, 52.502596233855684 ], [ 13.29838448157599, 52.502591619352465 ], [ 13.298407858430439, 52.50259195558241 ], [ 13.298411295682529, 52.502603899495092 ], [ 13.29841899515414, 52.50260638931038 ], [ 13.298430638405138, 52.502607746310126 ], [ 13.2984385215439, 52.502605480616147 ], [ 13.298447987054994, 52.502612753080392 ], [ 13.298453556144011, 52.502619970402556 ], [ 13.298465381589759, 52.502616571869702 ], [ 13.298475443937958, 52.502608390727744 ], [ 13.298490477078749, 52.502622880488403 ], [ 13.298519882193995, 52.502618545246236 ], [ 13.298519560829495, 52.502626866486942 ], [ 13.29852879678889, 52.50264008333005 ], [ 13.298516510760733, 52.502655369719825 ], [ 13.298500283886767, 52.502671788968044 ], [ 13.298492031981219, 52.502683564762407 ] ], [ [ 13.298238625072498, 52.502633531577445 ], [ 13.298213024502438, 52.502640299652413 ], [ 13.29819368178538, 52.502636452801852 ], [ 13.29817619394781, 52.502635011705188 ], [ 13.298175642900773, 52.502649277328601 ], [ 13.298188775119879, 52.502662551145086 ], [ 13.298194296811372, 52.50267095643612 ], [ 13.298194067196174, 52.502676900820376 ], [ 13.298172362989643, 52.502683724934748 ], [ 13.298162210192903, 52.502694283825008 ], [ 13.298159802754654, 52.5027061445683 ], [ 13.298153361178599, 52.502721514993425 ], [ 13.298147149220021, 52.502730941034159 ], [ 13.298125399054568, 52.502738954016358 ], [ 13.298107683023996, 52.502743457314367 ], [ 13.298080639323356, 52.502737120588336 ], [ 13.298057400141689, 52.502733218561488 ], [ 13.298032442436748, 52.502723343220886 ], [ 13.298021489488129, 52.502704154849347 ], [ 13.29801443150636, 52.502685021611576 ], [ 13.298017022658907, 52.502668406263204 ], [ 13.298035060124555, 52.502655581739965 ], [ 13.298043220291984, 52.50264618373194 ], [ 13.298047621880295, 52.502633162141073 ], [ 13.298057728763219, 52.502623792137442 ], [ 13.298069280154211, 52.502627526926226 ], [ 13.298094375625517, 52.502633834729842 ], [ 13.298117844314154, 52.502631794162369 ], [ 13.298124008901832, 52.502623556079946 ], [ 13.298126186686108, 52.50261764061996 ], [ 13.298114728615445, 52.502611528104232 ], [ 13.298101229030335, 52.502607765294094 ], [ 13.298082391488245, 52.502590841679371 ], [ 13.29806912298144, 52.502581135401527 ], [ 13.298081223966278, 52.50257060454512 ], [ 13.298095182793755, 52.502562478589482 ], [ 13.298095733865109, 52.502548212966481 ], [ 13.298109828950752, 52.50253652125604 ], [ 13.298132838411563, 52.502546367656038 ], [ 13.298140401556761, 52.502552424140909 ], [ 13.298148607606297, 52.502541837248238 ], [ 13.29818353437334, 52.502545907382384 ], [ 13.298218324818336, 52.50255354505672 ], [ 13.29823934019854, 52.502564552289243 ], [ 13.298244771482755, 52.502575336251617 ], [ 13.29825609183351, 52.502585014486904 ], [ 13.298273302691753, 52.502593587913218 ], [ 13.298261109903704, 52.502606496543379 ], [ 13.29825693798743, 52.50261357375831 ], [ 13.29825629512438, 52.502630217136137 ], [ 13.298238625072498, 52.502633531577445 ] ], [ [ 13.297838839746154, 52.502548085730083 ], [ 13.297832949239323, 52.502549190516312 ], [ 13.297809664280978, 52.502546476419695 ], [ 13.297784293332745, 52.502547300917421 ], [ 13.297773156832843, 52.502532867131464 ], [ 13.297763645551553, 52.502526782592241 ], [ 13.297746572624582, 52.502514642462927 ], [ 13.297750790512707, 52.502506377288505 ], [ 13.29775528400673, 52.502490978854262 ], [ 13.297767522843284, 52.502476881400398 ], [ 13.297785468468257, 52.502466433769392 ], [ 13.297799243547976, 52.502463064253881 ], [ 13.297822574394385, 52.502464589475537 ], [ 13.297830044179795, 52.502473022813348 ], [ 13.297833159739037, 52.502493288878206 ], [ 13.297860432912675, 52.502493681276135 ], [ 13.297869668646145, 52.502506898169074 ], [ 13.297861416604929, 52.502518673918615 ], [ 13.297835953808571, 52.502521876180879 ], [ 13.297843562875373, 52.502526742909119 ], [ 13.297846999934668, 52.50253868773558 ], [ 13.297838839746154, 52.502548085730083 ] ], [ [ 13.29820522492278, 52.502741291845787 ], [ 13.298188059944266, 52.502731529532568 ], [ 13.298164591170616, 52.502733571012158 ], [ 13.298155125716029, 52.502726297626992 ], [ 13.298165509613982, 52.502709794374567 ], [ 13.298194775575803, 52.5027090258233 ], [ 13.298193378419533, 52.502694732175641 ], [ 13.298203303067487, 52.50269011768804 ], [ 13.298218933101975, 52.502689152982107 ], [ 13.298246436010587, 52.502683600907794 ], [ 13.298258354769468, 52.502677825562046 ], [ 13.298270042482443, 52.502677993679669 ], [ 13.29827733017868, 52.502691182518689 ], [ 13.298269261894413, 52.502698202789418 ], [ 13.298268527191855, 52.502717223920826 ], [ 13.298267792488472, 52.502736245052198 ], [ 13.298242008175212, 52.502747768640354 ], [ 13.298226607731799, 52.50274278896493 ], [ 13.29820522492278, 52.502741291845787 ] ], [ [ 13.297397554371791, 52.502416841549241 ], [ 13.29738336724906, 52.502430910926549 ], [ 13.297379838399621, 52.502421344738906 ], [ 13.297366248519729, 52.502419959619772 ], [ 13.297367691345606, 52.502433064399135 ], [ 13.297373258761944, 52.502440281749479 ], [ 13.297352013968132, 52.502435217848415 ], [ 13.297336567790603, 52.502431426935026 ], [ 13.297324786783966, 52.502433636457276 ], [ 13.297310599632665, 52.502447705825581 ], [ 13.297295015613726, 52.502447481535775 ], [ 13.297275717504688, 52.502442446537515 ], [ 13.297273403245821, 52.502451928631274 ], [ 13.297286763431346, 52.502459257244126 ], [ 13.297291964768487, 52.502475984731362 ], [ 13.297272484364425, 52.502475704360279 ], [ 13.29725712856853, 52.502469536561279 ], [ 13.297249060164679, 52.50247655676165 ], [ 13.297258433519339, 52.502486207970513 ], [ 13.297264002431444, 52.502493424448403 ], [ 13.297277362593077, 52.502500753961023 ], [ 13.297272914878979, 52.50251496349933 ], [ 13.297251394372077, 52.502517032837844 ], [ 13.297241333292734, 52.502525213895254 ], [ 13.297219720881325, 52.502529660980514 ], [ 13.297211928121422, 52.502529548819162 ], [ 13.297202738531375, 52.502515143000302 ], [ 13.29718747613901, 52.502506596562291 ], [ 13.297185849565073, 52.502498247286368 ], [ 13.297178516277567, 52.502486247258936 ], [ 13.29720026799273, 52.502478233573484 ], [ 13.297216173630719, 52.502470136640547 ], [ 13.297218489410222, 52.502460653670603 ], [ 13.297218811018459, 52.502452332435283 ], [ 13.297219178575498, 52.502442822323616 ], [ 13.297209621441683, 52.502437926616849 ], [ 13.297223580384983, 52.502429800764887 ], [ 13.29721796553839, 52.502423773161397 ], [ 13.297202840987568, 52.502411660995321 ], [ 13.297195921254881, 52.502388961082374 ], [ 13.297202271213912, 52.502375968463561 ], [ 13.297214326397503, 52.502366626573057 ], [ 13.297243823355805, 52.502359913894907 ], [ 13.297261217682829, 52.502363732859727 ], [ 13.297286404744449, 52.502367663978703 ], [ 13.297303890971428, 52.502369105184577 ], [ 13.297305563510077, 52.502376265582896 ], [ 13.297322775537406, 52.502384840065368 ], [ 13.297336641079138, 52.502379091931211 ], [ 13.297366092083006, 52.502373568098847 ], [ 13.29738112477739, 52.502388057997202 ], [ 13.297398289407582, 52.502397821324031 ], [ 13.297397554371791, 52.502416841549241 ] ], [ [ 13.29702373446213, 52.502370665292268 ], [ 13.297017158181044, 52.502374493495566 ], [ 13.296989885093074, 52.502374100903907 ], [ 13.296989106316445, 52.502366118082698 ], [ 13.296983376619639, 52.502362910257617 ], [ 13.296969877209799, 52.502359147319709 ], [ 13.296932864693867, 52.502358614514172 ], [ 13.296930353261697, 52.502353032579819 ], [ 13.296920582118799, 52.502351692491288 ], [ 13.29692090378202, 52.502343371257055 ], [ 13.296921205069781, 52.502342628424358 ], [ 13.29691416554553, 52.502338124987702 ], [ 13.296904838254889, 52.502327284876152 ], [ 13.296889300239483, 52.502325871657149 ], [ 13.296880082457061, 52.502326758563107 ], [ 13.296872615780574, 52.502331971175153 ], [ 13.296871517729235, 52.502332286244375 ], [ 13.296877105617781, 52.50233878101978 ], [ 13.296855677097369, 52.502338472534767 ], [ 13.296846211944663, 52.502331199046964 ], [ 13.296846519309497, 52.502323248045037 ], [ 13.296829542677829, 52.502320021259372 ], [ 13.296830765848464, 52.50232740806814 ], [ 13.296803538752252, 52.50232582655773 ], [ 13.296790178688344, 52.50231849789116 ], [ 13.296789781685574, 52.502314437137755 ], [ 13.296774045748039, 52.502310330882679 ], [ 13.296770472552049, 52.502301953575156 ], [ 13.29675312278224, 52.502296945641469 ], [ 13.296739624885278, 52.502293182698772 ], [ 13.296733044047656, 52.502288972674684 ], [ 13.296722661794847, 52.50229071135464 ], [ 13.296720144567574, 52.502292902237471 ], [ 13.296720138557404, 52.502293057698935 ], [ 13.296728253491516, 52.502306901419153 ], [ 13.296699033742472, 52.502306480733722 ], [ 13.296669858485105, 52.502304871143906 ], [ 13.296648843660524, 52.502293862737879 ], [ 13.296631539837893, 52.502287666809146 ], [ 13.296624254173185, 52.502274477893828 ], [ 13.296640251804163, 52.502264002387811 ], [ 13.296638717270627, 52.502253275353063 ], [ 13.296620566680181, 52.502246268810964 ], [ 13.296618664152252, 52.502246241418199 ], [ 13.296593728279506, 52.502257385746788 ], [ 13.296585567879056, 52.502266783653411 ], [ 13.296530977354649, 52.50226718716312 ], [ 13.296511725416769, 52.502260962266924 ], [ 13.296498595261953, 52.502247689188557 ], [ 13.296486717045074, 52.502238999874677 ], [ 13.296464792380318, 52.502242836317635 ], [ 13.296460896027281, 52.502242780212377 ], [ 13.29646082436104, 52.502242271176783 ], [ 13.296453928014927, 52.502243478296599 ], [ 13.296446411125562, 52.502236232830164 ], [ 13.296462638594463, 52.502219813867697 ], [ 13.296476689505969, 52.502209311251022 ], [ 13.296488744795319, 52.502199969435154 ], [ 13.296517837536932, 52.502196852099225 ], [ 13.296523217047437, 52.502193720593773 ], [ 13.29652469540609, 52.502193629490314 ], [ 13.296530022728591, 52.502191047495515 ], [ 13.296537681111355, 52.50218438288654 ], [ 13.296538089720084, 52.502184027323189 ], [ 13.2965556232863, 52.502184279784188 ], [ 13.296590687474431, 52.502184784655995 ], [ 13.296617684685742, 52.502192309695829 ], [ 13.296643009481434, 52.502192674322693 ], [ 13.296656737157898, 52.502190492896219 ], [ 13.296677845334646, 52.502199123569852 ], [ 13.29670122196015, 52.502199460135202 ], [ 13.296712958276327, 52.502203588838363 ], [ 13.296713850637717, 52.50220360168597 ], [ 13.296714895920221, 52.502204270396589 ], [ 13.296722374674236, 52.502206901005152 ], [ 13.296749417848702, 52.502213238037776 ], [ 13.296768714288561, 52.502218273998174 ], [ 13.29678801076763, 52.502223309056824 ], [ 13.296799422591622, 52.502230610575054 ], [ 13.296799269600273, 52.50223456810356 ], [ 13.296810104583514, 52.50223472408981 ], [ 13.296824212375206, 52.502234067631527 ], [ 13.296834488293616, 52.502231115396143 ], [ 13.296851790650875, 52.502237311274072 ], [ 13.296871226459858, 52.502238780610803 ], [ 13.296884632436539, 52.502244921290703 ], [ 13.296917336398103, 52.502256097028123 ], [ 13.296920817705143, 52.502266852083757 ], [ 13.29693436303892, 52.502269426150939 ], [ 13.296963752109788, 52.502269849215772 ], [ 13.296966657330074, 52.502269093516212 ], [ 13.296988177727759, 52.502267024228495 ], [ 13.297025098260026, 52.502269934768485 ], [ 13.297040406492984, 52.502277292350527 ], [ 13.297043154596798, 52.502278924252316 ], [ 13.297058579556618, 52.502283109613472 ], [ 13.297071847749937, 52.502292816002495 ], [ 13.29708511742165, 52.502302522411298 ], [ 13.297086376680065, 52.502303944964972 ], [ 13.297092587003331, 52.502310956693087 ], [ 13.297092295382486, 52.502318501519113 ], [ 13.297093344332088, 52.502319685475683 ], [ 13.297092198615463, 52.502321005078613 ], [ 13.297092081564166, 52.502324033432998 ], [ 13.297089581990994, 52.502338271006813 ], [ 13.297073538520102, 52.502349934551738 ], [ 13.297053506769371, 52.502363919760953 ], [ 13.297041633860033, 52.502368507007432 ], [ 13.29702373446213, 52.502370665292268 ] ], [ [ 13.296668288314232, 52.502194227820112 ], [ 13.296657104832757, 52.502180982786918 ], [ 13.296644112549105, 52.502164143096373 ], [ 13.296660156063577, 52.502152479609713 ], [ 13.296670402488605, 52.502139543118567 ], [ 13.296688348196017, 52.502129096553119 ], [ 13.296676752564348, 52.50212655052848 ], [ 13.296673132000134, 52.502119361174216 ], [ 13.296677763681558, 52.502100397053354 ], [ 13.296685646816425, 52.502098131476004 ], [ 13.296699421896284, 52.50209476118949 ], [ 13.296715005785675, 52.502094985556681 ], [ 13.296742278696991, 52.502095378210221 ], [ 13.296781560879815, 52.502087616988277 ], [ 13.296791623414414, 52.502079435990439 ], [ 13.296824648908279, 52.502082290518445 ], [ 13.296843991258493, 52.502086137590162 ], [ 13.296870896538771, 52.50209604032441 ], [ 13.296874333337533, 52.502107984278858 ], [ 13.296887693317915, 52.502115313834359 ], [ 13.296900915466439, 52.502126209118238 ], [ 13.296902679810339, 52.502130992668214 ], [ 13.296910288706151, 52.502135859455329 ], [ 13.296907972879112, 52.502145342419325 ], [ 13.296892159218679, 52.502151061559438 ], [ 13.296874397346251, 52.502156753550267 ], [ 13.296864105018484, 52.502170878935623 ], [ 13.296850329926887, 52.502174249241179 ], [ 13.296842676579855, 52.502170570448932 ], [ 13.296817351794271, 52.502170205864907 ], [ 13.296801398761433, 52.502179491599783 ], [ 13.296795142072089, 52.502190107364427 ], [ 13.296771581642652, 52.502194525423285 ], [ 13.296749831465084, 52.502202539052043 ], [ 13.296724644548046, 52.502198607819906 ], [ 13.29670530068702, 52.502194760707241 ], [ 13.296668288314232, 52.502194227820112 ] ], [ [ 13.296484198341407, 52.502295452715288 ], [ 13.296497697689107, 52.502299215708177 ], [ 13.296517315910311, 52.502295929578473 ], [ 13.296536658325913, 52.502299776700845 ], [ 13.296547749866546, 52.502315399496908 ], [ 13.296549284379724, 52.502326126532573 ], [ 13.296546738664336, 52.502341552969284 ], [ 13.296546279029613, 52.502353440829552 ], [ 13.296543871212537, 52.502365300638431 ], [ 13.29651655216921, 52.502366096813631 ], [ 13.296506857227127, 52.502364767678408 ], [ 13.29649345123325, 52.502358627854562 ], [ 13.296481900049308, 52.502354892913438 ], [ 13.296466178162516, 52.502358235142303 ], [ 13.296444657732573, 52.502360303435808 ], [ 13.296450824029769, 52.502352066362427 ], [ 13.296431757384662, 52.50234108686962 ], [ 13.2964303148398, 52.502327982081049 ], [ 13.296442645990115, 52.502311507015463 ], [ 13.29645057661677, 52.502308052599638 ], [ 13.29646625251763, 52.502305899248533 ], [ 13.296484198341407, 52.502295452715288 ] ], [ [ 13.296630780347382, 52.502335625804328 ], [ 13.296644969149547, 52.502321556540011 ], [ 13.296685832026172, 52.502323334409361 ], [ 13.296706709020999, 52.502337908538294 ], [ 13.296720024552176, 52.50234642701006 ], [ 13.296717524857515, 52.502360664574859 ], [ 13.29671488730852, 52.502378467868937 ], [ 13.296706818801374, 52.502385488930472 ], [ 13.296693091066276, 52.502387670362168 ], [ 13.296692539544077, 52.502401935975186 ], [ 13.296696020806802, 52.502412691036788 ], [ 13.29666870320855, 52.502413487268122 ], [ 13.296653439448813, 52.502404941639696 ], [ 13.296642073569288, 52.502396451231483 ], [ 13.296634326799937, 52.502395150156339 ], [ 13.296620461163347, 52.502400898207362 ], [ 13.296608955922698, 52.502395974402575 ], [ 13.29659949223686, 52.502388701815136 ], [ 13.296609599402437, 52.502379331038327 ], [ 13.29661409328037, 52.502363932650397 ], [ 13.296608708352437, 52.502351960639061 ], [ 13.29662285120213, 52.502339080253485 ], [ 13.296630780347382, 52.502335625804328 ] ], [ [ 13.29712523041583, 52.502503321551586 ], [ 13.297111271431081, 52.502511447391512 ], [ 13.297101531958322, 52.502511307202042 ], [ 13.297084044209742, 52.502509865944639 ], [ 13.297078614656403, 52.502499082851159 ], [ 13.297078982279052, 52.502489571841643 ], [ 13.297085468672897, 52.502473012579976 ], [ 13.297078228795064, 52.502458634815369 ], [ 13.297088243936388, 52.502451642648069 ], [ 13.297109580610556, 52.502454328843868 ], [ 13.297121040006422, 52.502460440578112 ], [ 13.297130503759714, 52.502467714023226 ], [ 13.297130090231789, 52.5024784130106 ], [ 13.297129446946316, 52.502495056379061 ], [ 13.29712523041583, 52.502503321551586 ] ], [ [ 13.297320680737133, 52.50248948203361 ], [ 13.297335051647813, 52.502470658057455 ], [ 13.297364456768303, 52.502466323102489 ], [ 13.297384304690743, 52.50245709334596 ], [ 13.297393724050281, 52.502465554769323 ], [ 13.297404906352554, 52.502478799713565 ], [ 13.297408159548175, 52.50249549915879 ], [ 13.297429404377551, 52.502500563049978 ], [ 13.297440771944228, 52.502509052506539 ], [ 13.297432565697243, 52.502519640247357 ], [ 13.297426169840648, 52.502533821755058 ], [ 13.297423762249062, 52.502545681583449 ], [ 13.297411844891373, 52.502551456865824 ], [ 13.297403546775744, 52.502564421458587 ], [ 13.29740113914149, 52.502576282185032 ], [ 13.297389221772516, 52.502582057465006 ], [ 13.297371642095342, 52.502582994002537 ], [ 13.297348540897717, 52.50257552520852 ], [ 13.297342971996331, 52.502568307835858 ], [ 13.297329290180079, 52.502569300464756 ], [ 13.297305913350771, 52.502568964021819 ], [ 13.297292553129157, 52.502561635410942 ], [ 13.297275570742917, 52.502547117440962 ], [ 13.297275984271277, 52.502536417554239 ], [ 13.297284374313477, 52.502521075218048 ], [ 13.297300371845646, 52.502510600521212 ], [ 13.297310342524842, 52.502504796333881 ], [ 13.297320680737133, 52.50248948203361 ] ], [ [ 13.300022057336459, 52.502016486187635 ], [ 13.299989354216819, 52.502005311324083 ], [ 13.29998990466396, 52.50199104568572 ], [ 13.299996206396584, 52.501979241765547 ], [ 13.299992770231205, 52.501967297915634 ], [ 13.299989561962132, 52.501949409654017 ], [ 13.300003656355129, 52.501937717710902 ], [ 13.300025405822614, 52.501929703477423 ], [ 13.300046880051317, 52.501928822508695 ], [ 13.30006636171424, 52.501929102442169 ], [ 13.300074428098773, 52.501922082023235 ], [ 13.30009567300519, 52.501927144537774 ], [ 13.300102915226448, 52.50194152304632 ], [ 13.300084970394327, 52.501951970137618 ], [ 13.300084557591344, 52.501962669142316 ], [ 13.300092075038636, 52.501969914382585 ], [ 13.300077703993988, 52.501988738685348 ], [ 13.300077520509589, 52.501993494197905 ], [ 13.300071171452677, 52.502006486979511 ], [ 13.300065053187238, 52.50201353628988 ], [ 13.300049376117906, 52.502015689200526 ], [ 13.3000277642294, 52.502020136803658 ], [ 13.300022057336459, 52.502016486187635 ] ], [ [ 13.299941915778302, 52.501921367426519 ], [ 13.299924337883267, 52.501922304367376 ], [ 13.299909165436194, 52.501911380499699 ], [ 13.299897294413253, 52.501915968057837 ], [ 13.299892847605252, 52.50193017770367 ], [ 13.299876941141015, 52.501938275880491 ], [ 13.299861311439292, 52.501939239909518 ], [ 13.299857782087045, 52.501929673790826 ], [ 13.299854527998271, 52.50191297440395 ], [ 13.299853223549016, 52.501896303034798 ], [ 13.299857531263008, 52.50188566000336 ], [ 13.299861932200798, 52.501872639236822 ], [ 13.299881595869262, 52.501868163667226 ], [ 13.299905293452241, 52.501860178350476 ], [ 13.299936233250882, 52.50186656975 ], [ 13.29994950340002, 52.501876276741022 ], [ 13.299948907067675, 52.501891731257473 ], [ 13.299954383129339, 52.501901325347475 ], [ 13.299942145151483, 52.501915423036209 ], [ 13.299941915778302, 52.501921367426519 ] ], [ [ 13.299554896756224, 52.501899152687734 ], [ 13.29954433006716, 52.501920410682963 ], [ 13.299530648496251, 52.501921403568701 ], [ 13.29951320825251, 52.501918773814943 ], [ 13.299474338159628, 52.501915836926955 ], [ 13.29944901348583, 52.501915472907321 ], [ 13.299437325967924, 52.501915304907818 ], [ 13.299423872366971, 52.501910353371258 ], [ 13.299429946303666, 52.501904492993603 ], [ 13.299430405153098, 52.501892605114634 ], [ 13.299408976821262, 52.501892297093761 ], [ 13.299407349845625, 52.501883947844156 ], [ 13.299423346679529, 52.501873471954312 ], [ 13.299431322850999, 52.501868829356653 ], [ 13.29944138488244, 52.501860647229933 ], [ 13.299449405465026, 52.501854815732074 ], [ 13.29948048281736, 52.501857641515471 ], [ 13.299501865246764, 52.501859138401059 ], [ 13.299523385335178, 52.501857068649272 ], [ 13.299552698071713, 52.501855110900372 ], [ 13.29956800662638, 52.501862467259564 ], [ 13.299563377651662, 52.501881432424859 ], [ 13.299554896756224, 52.501899152687734 ] ], [ [ 13.299248849793878, 52.501849553655511 ], [ 13.299266152315395, 52.501855750080949 ], [ 13.299271492017967, 52.501868910855514 ], [ 13.299261200523388, 52.501883036457116 ], [ 13.299258977036578, 52.501890140817984 ], [ 13.299237135700027, 52.501900531766239 ], [ 13.299246647054282, 52.501906616188208 ], [ 13.299252260609082, 52.501912644575164 ], [ 13.29924414820311, 52.501920853814568 ], [ 13.299238028345972, 52.501927903060071 ], [ 13.299225972236448, 52.501937245140923 ], [ 13.299200555764267, 52.501939258823285 ], [ 13.299183436765469, 52.501928307776382 ], [ 13.299183987506643, 52.501914041245158 ], [ 13.299176379866642, 52.501909174623442 ], [ 13.29915912176042, 52.501901789286116 ], [ 13.299143905054001, 52.501892055119306 ], [ 13.299134623164338, 52.501880027199981 ], [ 13.299141293750282, 52.501858712327419 ], [ 13.299162997401433, 52.501851888029606 ], [ 13.299186511557664, 52.501848657469687 ], [ 13.299195885244476, 52.501858307629853 ], [ 13.299218848673345, 52.501869343595004 ], [ 13.299225060312919, 52.501859916595087 ], [ 13.299248849793878, 52.501849553655511 ] ], [ [ 13.29897423185882, 52.501849174063871 ], [ 13.298987410022535, 52.501861258017406 ], [ 13.298994742232596, 52.501873257916017 ], [ 13.298996185529157, 52.501886362680622 ], [ 13.298986124882433, 52.501894544789835 ], [ 13.298981861385734, 52.501903998889105 ], [ 13.298967765262814, 52.50191569068717 ], [ 13.298953624703586, 52.501928571382102 ], [ 13.298938362132311, 52.501920026066685 ], [ 13.298940815180478, 52.501906977325035 ], [ 13.298927591148999, 52.501896081345272 ], [ 13.298900547808843, 52.501889745707842 ], [ 13.298912603973422, 52.50188040366055 ], [ 13.298909212574186, 52.501867269984295 ], [ 13.29893132934612, 52.501849746730947 ], [ 13.298945333689025, 52.501840431793298 ], [ 13.298962911568863, 52.501839494997832 ], [ 13.298974461361928, 52.501843229676467 ], [ 13.29897423185882, 52.501849174063871 ] ], [ [ 13.298709869131303, 52.501881056124844 ], [ 13.29868992992699, 52.501892663863828 ], [ 13.298676294256449, 52.501892467773374 ], [ 13.298653422737935, 52.501879054848068 ], [ 13.298642192823619, 52.501866998874753 ], [ 13.298642927342366, 52.501847977736901 ], [ 13.298658648852939, 52.501844636114157 ], [ 13.298681841715108, 52.501849726897255 ], [ 13.298705126363856, 52.501852440819825 ], [ 13.298706844986157, 52.501858413221996 ], [ 13.298714316314486, 52.501866846526561 ], [ 13.298713994960716, 52.501875168667802 ], [ 13.298709869131303, 52.501881056124844 ] ], [ [ 13.298185616236259, 52.501879463645899 ], [ 13.298177502166938, 52.501887672789415 ], [ 13.298165906509112, 52.501885126910445 ], [ 13.298158710784818, 52.501869561208892 ], [ 13.298145212894259, 52.501865798426394 ], [ 13.298144937390786, 52.501872930789617 ], [ 13.298129122478487, 52.501878650974966 ], [ 13.298115578663928, 52.501876077066051 ], [ 13.298106388908243, 52.501861671314465 ], [ 13.298090988787996, 52.501856691623424 ], [ 13.298101187328278, 52.50184494385941 ], [ 13.298109393251526, 52.501834356967215 ], [ 13.298138797874058, 52.50183002181506 ], [ 13.298168248378614, 52.501824498677166 ], [ 13.298167835112215, 52.501835197671511 ], [ 13.298188758297401, 52.501848582665261 ], [ 13.298186259108586, 52.501862820266574 ], [ 13.298185616236259, 52.501879463645899 ] ], [ [ 13.29792263056447, 52.501875680329022 ], [ 13.297912660143782, 52.501881483671838 ], [ 13.297920039429773, 52.501892295677514 ], [ 13.297931267678686, 52.501904351696545 ], [ 13.297931681003549, 52.501893652703657 ], [ 13.297972545018277, 52.501895430146909 ], [ 13.297985905155251, 52.501902758681055 ], [ 13.29799239259048, 52.501886199385623 ], [ 13.298031169187839, 52.501891515390739 ], [ 13.298081772546443, 52.501893432908076 ], [ 13.298081221483587, 52.501907698532577 ], [ 13.298090549014018, 52.501918537655214 ], [ 13.298080394905794, 52.501929096519916 ], [ 13.298066254050438, 52.501941978005142 ], [ 13.298063846666837, 52.501953837849442 ], [ 13.298049796212265, 52.501964340658944 ], [ 13.298047480674594, 52.501973822749036 ], [ 13.298031896817264, 52.501973598557676 ], [ 13.298012508481307, 52.501970940556546 ], [ 13.297995068278993, 52.501968311478201 ], [ 13.297983700776189, 52.501959821175866 ], [ 13.297974191025183, 52.501953737573558 ], [ 13.297954893085709, 52.501948701788251 ], [ 13.297941073688365, 52.501953261120242 ], [ 13.297934769938937, 52.501965064905178 ], [ 13.297911393422755, 52.501964728584547 ], [ 13.297880178314081, 52.501965469019538 ], [ 13.297862967810984, 52.501956894639278 ], [ 13.297849378057574, 52.501955509576611 ], [ 13.297823869654941, 52.501959900716081 ], [ 13.297813991031642, 52.501963327195341 ], [ 13.297796688677302, 52.501957130559028 ], [ 13.297806979183864, 52.501943005067893 ], [ 13.297799463557993, 52.501935760605427 ], [ 13.297785458979865, 52.501945074506345 ], [ 13.297762358042245, 52.501937605794602 ], [ 13.297753261730232, 52.501920822284369 ], [ 13.297761925612873, 52.50189834662882 ], [ 13.297781131641836, 52.501905760198788 ], [ 13.297794583614685, 52.501910711000768 ], [ 13.297796991068026, 52.501898851162487 ], [ 13.297789657709242, 52.501886851171214 ], [ 13.297782188028448, 52.501878417830959 ], [ 13.297802127496622, 52.5018668093483 ], [ 13.297796880099497, 52.501851270757584 ], [ 13.297807126120954, 52.501838334163949 ], [ 13.297805820975979, 52.50182166275745 ], [ 13.297827341083977, 52.501819594213352 ], [ 13.297868249482956, 52.501820182794063 ], [ 13.297879616962559, 52.501828672208624 ], [ 13.297898913368373, 52.501833707984602 ], [ 13.297923732791116, 52.501847149082209 ], [ 13.297929026161501, 52.501861498790824 ], [ 13.29792263056447, 52.501875680329022 ] ], [ [ 13.297618550865932, 52.501896283596118 ], [ 13.297631910908644, 52.501903613068336 ], [ 13.297639427973909, 52.501910857562379 ], [ 13.297670457830343, 52.50191487267606 ], [ 13.297654276859074, 52.501930102933159 ], [ 13.297655857567063, 52.501939641080675 ], [ 13.297655214492652, 52.50195628445519 ], [ 13.297635412756124, 52.501964326282348 ], [ 13.297615932574718, 52.501964045969714 ], [ 13.297602662919704, 52.501954338721205 ], [ 13.297585406502828, 52.501946954076246 ], [ 13.297595834888115, 52.501929261974183 ], [ 13.297596477984326, 52.501912618600073 ], [ 13.297618550865932, 52.501896283596118 ] ], [ [ 13.297094452627164, 52.501941077780998 ], [ 13.297086246441166, 52.501951664600405 ], [ 13.297070662599449, 52.501951440282525 ], [ 13.297053406309372, 52.501944054662097 ], [ 13.297033926142847, 52.501943774253753 ], [ 13.297032529382161, 52.501929480594008 ], [ 13.297025288134405, 52.501915102804624 ], [ 13.297014335819483, 52.501895914342747 ], [ 13.297024580642043, 52.501882976899218 ], [ 13.297057514100711, 52.501888209113766 ], [ 13.297069339453236, 52.501884810719304 ], [ 13.29710050856225, 52.501885259374163 ], [ 13.297117810788356, 52.501891456111316 ], [ 13.297141095355704, 52.501894170341082 ], [ 13.297130942500116, 52.501904729143646 ], [ 13.297124592591222, 52.50191772176003 ], [ 13.297123995267372, 52.501933176253679 ], [ 13.29711996108797, 52.501936686799361 ], [ 13.297102429087634, 52.501936434443998 ], [ 13.297094452627164, 52.501941077780998 ] ], [ [ 13.296842834044, 52.501945781548741 ], [ 13.296807722609651, 52.501946465608164 ], [ 13.296760969624875, 52.501945792517169 ], [ 13.296737776977642, 52.501940700460402 ], [ 13.296728541700608, 52.501927483481751 ], [ 13.296729185124304, 52.501910840115194 ], [ 13.296735443226074, 52.501900225273154 ], [ 13.296747362000032, 52.501894449180149 ], [ 13.296755612743976, 52.501882673487458 ], [ 13.296787241408481, 52.501871234362277 ], [ 13.296788775967006, 52.501881961395966 ], [ 13.296806261983646, 52.501883402673748 ], [ 13.296814146545566, 52.501881137108562 ], [ 13.296837660844275, 52.501877907915741 ], [ 13.2968449020247, 52.501892285716117 ], [ 13.296838827783635, 52.501898145059528 ], [ 13.296836374114447, 52.501911193752292 ], [ 13.296839948730794, 52.501919571978021 ], [ 13.296845240282687, 52.501933921710844 ], [ 13.296842834044, 52.501945781548741 ] ], [ [ 13.298254965088338, 52.501900681542686 ], [ 13.298264981388835, 52.501893689293645 ], [ 13.298280106060181, 52.501905801325961 ], [ 13.298307332957902, 52.501907382494878 ], [ 13.29832472720287, 52.501911201302867 ], [ 13.298348103695673, 52.501911537541623 ], [ 13.298344528792104, 52.501903159359003 ], [ 13.298360114099571, 52.501903383530177 ], [ 13.298381404675032, 52.501907258372349 ], [ 13.298380807792133, 52.501922712876116 ], [ 13.298370516000753, 52.501936838397576 ], [ 13.298389950261225, 52.501938307463021 ], [ 13.298401639251397, 52.501938475587181 ], [ 13.298407162334, 52.501946881788641 ], [ 13.298416442564875, 52.5019589097422 ], [ 13.298412270771824, 52.501965986065528 ], [ 13.298384677972352, 52.501973915958381 ], [ 13.298380643923362, 52.501977425649159 ], [ 13.298362972670796, 52.501980740090538 ], [ 13.298345670195955, 52.501974544432429 ], [ 13.298324241836303, 52.501974236214821 ], [ 13.298314501003611, 52.501974096104995 ], [ 13.298295112649365, 52.501971438150015 ], [ 13.298265891626414, 52.501971017832119 ], [ 13.298242744705865, 52.501964737191827 ], [ 13.298219781441967, 52.501953701937673 ], [ 13.298220470224219, 52.501935869681255 ], [ 13.298217126386856, 52.501921548029785 ], [ 13.29823915165246, 52.501906401763939 ], [ 13.298254965088338, 52.501900681542686 ] ], [ [ 13.298720502304306, 52.501908566598431 ], [ 13.298742114229691, 52.501904120133304 ], [ 13.298762007553945, 52.501893700364221 ], [ 13.298787194488989, 52.501897631162848 ], [ 13.298780936879472, 52.501908246117601 ], [ 13.298801952063675, 52.501919254148547 ], [ 13.29881109615444, 52.501934848725327 ], [ 13.298814349848483, 52.501951548137541 ], [ 13.298802293643483, 52.501960890174381 ], [ 13.298788428421895, 52.501966638483438 ], [ 13.298793859805407, 52.501977421523556 ], [ 13.298793676217249, 52.501982176134334 ], [ 13.298779855421378, 52.501986735543788 ], [ 13.298764271553559, 52.501986511448827 ], [ 13.2987352800153, 52.501980147758786 ], [ 13.298721736132686, 52.501977573918673 ], [ 13.29871621298601, 52.501969167731424 ], [ 13.298697100023245, 52.501959377476979 ], [ 13.298699644961639, 52.501943950986444 ], [ 13.298700287641337, 52.501927307602891 ], [ 13.298702785195868, 52.501913069968325 ], [ 13.298720502304306, 52.501908566598431 ] ], [ [ 13.29939302036232, 52.502002688407444 ], [ 13.299366161956128, 52.501991596487123 ], [ 13.299354931817245, 52.501979540579839 ], [ 13.299343519593521, 52.501972240203379 ], [ 13.299318378455185, 52.501967120644792 ], [ 13.299291426797938, 52.501958407340609 ], [ 13.299278156771148, 52.501948700276884 ], [ 13.299272725271978, 52.501937917257983 ], [ 13.29929048822639, 52.50193222492468 ], [ 13.299319571564794, 52.501936211622386 ], [ 13.299331121414088, 52.501939946266617 ], [ 13.29934517155875, 52.501929443302252 ], [ 13.299347393595962, 52.501922338019902 ], [ 13.299347806577304, 52.501911639019191 ], [ 13.29937132075281, 52.501908408422715 ], [ 13.299402352248213, 52.501912423104585 ], [ 13.299417386936783, 52.50192691277082 ], [ 13.29943264960473, 52.501935458025258 ], [ 13.299418737110441, 52.501942395265566 ], [ 13.299424076868693, 52.501955556033536 ], [ 13.299449401565232, 52.501955920058698 ], [ 13.299492487726219, 52.5019505916935 ], [ 13.299516185422595, 52.501942606455749 ], [ 13.299533581262777, 52.501946425108152 ], [ 13.299569997015759, 52.501962411610592 ], [ 13.299588880755737, 52.501978146114858 ], [ 13.299603961412009, 52.501991446880083 ], [ 13.299595893467732, 52.501998467244952 ], [ 13.299576229712899, 52.502002942766239 ], [ 13.299558789434084, 52.50200031301889 ], [ 13.299563097229672, 52.501989669999013 ], [ 13.299531837707855, 52.501991599768957 ], [ 13.29951402890806, 52.501998480117656 ], [ 13.299490835902786, 52.501993388597732 ], [ 13.299457719982632, 52.501992912589756 ], [ 13.299446306265713, 52.501985612201935 ], [ 13.299422883831545, 52.501986465057527 ], [ 13.299410645660597, 52.502000562689418 ], [ 13.29939302036232, 52.502002688407444 ] ], [ [ 13.299727948707384, 52.502011070132866 ], [ 13.299726367547949, 52.502001532009345 ], [ 13.2997460312875, 52.501997056462955 ], [ 13.299744450124582, 52.501987518339632 ], [ 13.299734892803125, 52.501982622834959 ], [ 13.299723526395441, 52.501974133616748 ], [ 13.299710210352041, 52.501965616377205 ], [ 13.299712892579173, 52.501946623228179 ], [ 13.299732556295373, 52.501942147683785 ], [ 13.299759829154851, 52.501942539641121 ], [ 13.29975824799063, 52.50193300151787 ], [ 13.299737003156233, 52.501927938044439 ], [ 13.299733427951645, 52.501919560800218 ], [ 13.299757033864106, 52.501913952370955 ], [ 13.299786025477626, 52.501920316710184 ], [ 13.299787331374489, 52.501936988100958 ], [ 13.299798653379156, 52.501946666212262 ], [ 13.299804221171362, 52.501953882553003 ], [ 13.299795879466343, 52.501968036220902 ], [ 13.299809331654984, 52.501972987694408 ], [ 13.299821020662961, 52.501973155678449 ], [ 13.299824595853703, 52.5019815338188 ], [ 13.299814809168321, 52.501982581811838 ], [ 13.299802936643898, 52.501987169339024 ], [ 13.2997947784469, 52.501996567494849 ], [ 13.299792646762659, 52.502001295009002 ], [ 13.299782630642145, 52.502008288287705 ], [ 13.299763104539993, 52.502009197206313 ], [ 13.299727948707384, 52.502011070132866 ] ], [ [ 13.299113236066315, 52.501979634567732 ], [ 13.299075856677808, 52.501988612556801 ], [ 13.29905080732545, 52.501981116085126 ], [ 13.29902199934593, 52.501969996954998 ], [ 13.299012855173162, 52.501954402393906 ], [ 13.299011733168213, 52.501932975487122 ], [ 13.299023927019746, 52.501920066795975 ], [ 13.299028649501684, 52.501898723920071 ], [ 13.299048818079529, 52.501881172634292 ], [ 13.299053402849294, 52.501863396389723 ], [ 13.299077008814946, 52.501857788096565 ], [ 13.299100293494021, 52.5018605019416 ], [ 13.29911379146702, 52.501864264615833 ], [ 13.299105679044576, 52.501872473845701 ], [ 13.299089772459135, 52.501880571915663 ], [ 13.299091169886598, 52.501894865556906 ], [ 13.299104761136181, 52.50189625049827 ], [ 13.299114546380034, 52.501895201644189 ], [ 13.299133751202419, 52.501902614076691 ], [ 13.299135010955514, 52.5019204743502 ], [ 13.299126852629726, 52.501929872458916 ], [ 13.299140304729887, 52.501934824007847 ], [ 13.299149448944117, 52.501950418559474 ], [ 13.299133221097142, 52.501966837879394 ], [ 13.299113236066315, 52.501979634567732 ] ], [ [ 13.297060362969674, 52.501814503275988 ], [ 13.297089629821974, 52.501813735014331 ], [ 13.297095243067778, 52.501819763501132 ], [ 13.297091162945314, 52.501824462922258 ], [ 13.297108374751774, 52.501833036535857 ], [ 13.297114173278231, 52.5018343095376 ], [ 13.297125401290463, 52.501846365631216 ], [ 13.297123131476843, 52.501854659724032 ], [ 13.297111122367605, 52.501862812730671 ], [ 13.297091916472423, 52.501855399052978 ], [ 13.297082085241408, 52.501857636615817 ], [ 13.297073833116501, 52.501869412310882 ], [ 13.297058387126265, 52.50186562226132 ], [ 13.297050870199671, 52.501858376832537 ], [ 13.297031757660644, 52.501848586312406 ], [ 13.297036159427256, 52.501835565657998 ], [ 13.297044410083084, 52.501823789944318 ], [ 13.297060362969674, 52.501814503275988 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 10, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299679710092541, 52.502959944043326 ], [ 13.299693437866603, 52.502957762265503 ], [ 13.299712919980811, 52.502958042260985 ], [ 13.299719267813908, 52.502945049481511 ], [ 13.299745005983057, 52.502934714447207 ], [ 13.299739895425326, 52.502915609305248 ], [ 13.299740491852997, 52.502900154793195 ], [ 13.299739003899345, 52.502888238936571 ], [ 13.299705977595167, 52.502885385215833 ], [ 13.299657275335838, 52.502884685261265 ], [ 13.29962053616379, 52.502877020005322 ], [ 13.299595258293859, 52.502875467155832 ], [ 13.299579167886478, 52.502888320798611 ], [ 13.299585905413995, 52.502915775193344 ], [ 13.299589297123688, 52.502928907951748 ], [ 13.299596400241334, 52.502946852202122 ], [ 13.299621358464519, 52.502956726317841 ], [ 13.299640611155093, 52.502962950713588 ], [ 13.299669418465179, 52.502974069676917 ], [ 13.299679710092541, 52.502959944043326 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 11, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299948533740141, 52.503468775222601 ], [ 13.299945995587674, 52.503468150724771 ], [ 13.299946372526126, 52.503469035481565 ], [ 13.299948533740141, 52.503468775222601 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 12, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299121894947627, 52.502878178926231 ], [ 13.299094667417265, 52.502876597939697 ], [ 13.299075003219404, 52.502881073373231 ], [ 13.299056551419921, 52.50290459703249 ], [ 13.299054052443458, 52.50291883465156 ], [ 13.299065328632901, 52.502929701709611 ], [ 13.299076880191203, 52.502933436401236 ], [ 13.299100073639234, 52.502938528005338 ], [ 13.299115657846386, 52.50293875205891 ], [ 13.299141166695584, 52.502934360645305 ], [ 13.29915526163246, 52.502922668809695 ], [ 13.299153680568999, 52.502913130680724 ], [ 13.299158035961048, 52.502901297923941 ], [ 13.299148847129009, 52.502886892272194 ], [ 13.299121894947627, 52.502878178926231 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 13, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299706503814821, 52.503421578199841 ], [ 13.299730110505051, 52.503415970682795 ], [ 13.299734157172278, 52.503416028839943 ], [ 13.299665630157659, 52.503399168198001 ], [ 13.299664379742834, 52.503401941997474 ], [ 13.299646709481246, 52.503405256646943 ], [ 13.299634836587613, 52.503409843254204 ], [ 13.299625051017921, 52.503410892148324 ], [ 13.299621709720128, 52.503410844125398 ], [ 13.29966722838723, 52.503420672067406 ], [ 13.299677281808929, 52.503421158222423 ], [ 13.299706503814821, 52.503421578199841 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 14, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.29954772268942, 52.503394317636868 ], [ 13.299544986625637, 52.503394278310893 ], [ 13.299550521735823, 52.503395473677209 ], [ 13.29954772268942, 52.503394317636868 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 15, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.297606826984353, 52.502866829704168 ], [ 13.29758966209217, 52.502857067305015 ], [ 13.297581823333013, 52.502858144043977 ], [ 13.297573156820615, 52.502862683075833 ], [ 13.297561929328152, 52.502868562708301 ], [ 13.297548603914818, 52.50287825049918 ], [ 13.297545885784542, 52.502880226315675 ], [ 13.297540167313857, 52.502882292026548 ], [ 13.2976336986512, 52.50290766604445 ], [ 13.2976365268715, 52.502905319573905 ], [ 13.297636092661557, 52.502899779234276 ], [ 13.297635221733998, 52.502888649067266 ], [ 13.297626606606833, 52.502877482991551 ], [ 13.297624085199516, 52.502874215267802 ], [ 13.297606826984353, 52.502866829704168 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 16, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299006359927798, 52.502891980925163 ], [ 13.299027927916546, 52.502888722412258 ], [ 13.299037667482422, 52.502888862443882 ], [ 13.299049861597364, 52.502875953754227 ], [ 13.299034413642454, 52.502872163039051 ], [ 13.299007782803056, 52.502855127526132 ], [ 13.298984589375092, 52.502850036802947 ], [ 13.29895332925482, 52.502851965515667 ], [ 13.298933665054188, 52.50285644092574 ], [ 13.298925275517163, 52.502871783382425 ], [ 13.29892681062627, 52.50288251039138 ], [ 13.298930202136694, 52.502895643167051 ], [ 13.298953349644387, 52.502901923676902 ], [ 13.298968612519747, 52.502910469890537 ], [ 13.298990224949579, 52.502906022486172 ], [ 13.299006359927798, 52.502891980925163 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 17, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299424465821042, 52.503355673026583 ], [ 13.29944037141216, 52.503347574896345 ], [ 13.299457676017402, 52.503353771318658 ], [ 13.299468492888259, 52.503350662989995 ], [ 13.299100851847712, 52.503260202462137 ], [ 13.299100626324533, 52.503261807747364 ], [ 13.299073077290807, 52.503268547996228 ], [ 13.299041907171517, 52.503268099852711 ], [ 13.299026001537365, 52.503276197929083 ], [ 13.299027039127512, 52.503282448251831 ], [ 13.299264931597611, 52.503333809469083 ], [ 13.299298802070426, 52.503328887259791 ], [ 13.299339759267463, 52.50332828648731 ], [ 13.299376405506132, 52.503338329566375 ], [ 13.299389903953347, 52.503342092212222 ], [ 13.29940113444075, 52.503354148116593 ], [ 13.299424465821042, 52.503355673026583 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 18, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298866582440935, 52.502826929266192 ], [ 13.298845245472522, 52.502824243385007 ], [ 13.29882553536749, 52.502829907654352 ], [ 13.298797894750708, 52.502839025595897 ], [ 13.298799246199735, 52.502854508114972 ], [ 13.298810522309665, 52.502865375196777 ], [ 13.298825739238067, 52.50287511030573 ], [ 13.298856817264907, 52.502877936258265 ], [ 13.298876389672767, 52.502875838615566 ], [ 13.298896053887674, 52.502871363215164 ], [ 13.29889655880153, 52.50285828646421 ], [ 13.298899103729237, 52.502842859971544 ], [ 13.298893580409114, 52.502834454691111 ], [ 13.29887604803552, 52.502834202595515 ], [ 13.298870432945471, 52.502828174169906 ], [ 13.298866582440935, 52.502826929266192 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 19, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298982982937124, 52.503231200598101 ], [ 13.298816268159539, 52.50319017901429 ], [ 13.298835204652773, 52.503199707759919 ], [ 13.298862111065317, 52.503209610049119 ], [ 13.298875427313149, 52.503218127384152 ], [ 13.298859290699195, 52.503232168904006 ], [ 13.298838535479518, 52.503234521071398 ], [ 13.298933767094201, 52.503260353674129 ], [ 13.298933087886564, 52.503259398931938 ], [ 13.298948857293023, 52.50325486752088 ], [ 13.298978262789003, 52.503250532168437 ], [ 13.29898057820018, 52.503241050060957 ], [ 13.298982982937124, 52.503231200598101 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 20, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.29924015681434, 52.502844194781837 ], [ 13.299254297590524, 52.502831314056351 ], [ 13.299256750602149, 52.502818265309735 ], [ 13.299263191809526, 52.502802894821606 ], [ 13.299232572724639, 52.502788181100115 ], [ 13.299229135236109, 52.502776237209652 ], [ 13.299207935956117, 52.502769984761528 ], [ 13.299188501299097, 52.502768515827348 ], [ 13.299171014845861, 52.502767074898252 ], [ 13.299162747269374, 52.502756361695241 ], [ 13.299161732769834, 52.502755046981086 ], [ 13.299154741953638, 52.502754617398828 ], [ 13.299136453515647, 52.50275349401312 ], [ 13.299108996569188, 52.502757857417471 ], [ 13.299102694483809, 52.502769661285917 ], [ 13.299088965268298, 52.502771842974326 ], [ 13.299098017833563, 52.502789815283869 ], [ 13.299101363489877, 52.502804136932589 ], [ 13.29908708350812, 52.502820584250422 ], [ 13.299100307886439, 52.502831479314835 ], [ 13.299117886159372, 52.502830542499815 ], [ 13.299132919587462, 52.502845032180709 ], [ 13.299146327540324, 52.502851172629128 ], [ 13.299169475091261, 52.502857452198192 ], [ 13.299182881580505, 52.502863592621352 ], [ 13.299198650819426, 52.502859061175279 ], [ 13.299214556235331, 52.502850963972236 ], [ 13.29924015681434, 52.502844194781837 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 21, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298805550824005, 52.503187542431604 ], [ 13.298703719631215, 52.503162485169149 ], [ 13.298701520759456, 52.503178753715567 ], [ 13.298685661041739, 52.50318566197037 ], [ 13.298710710975698, 52.503193159421762 ], [ 13.298726157541129, 52.503196950158568 ], [ 13.298737569973829, 52.503204250594933 ], [ 13.298747545756076, 52.503209836426983 ], [ 13.298756310536515, 52.503212213863243 ], [ 13.298772452852546, 52.503209510356562 ], [ 13.298790582141669, 52.503194307965046 ], [ 13.298805550824005, 52.503187542431604 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 22, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298735765966162, 52.502782227535192 ], [ 13.298718463160109, 52.502776031030699 ], [ 13.29870264799367, 52.502781751289774 ], [ 13.298695132113977, 52.502774505984128 ], [ 13.298697446086004, 52.502765023860618 ], [ 13.298736500468779, 52.502763206399365 ], [ 13.298757929216638, 52.502763514545549 ], [ 13.298756531876212, 52.502749220903091 ], [ 13.298756990921284, 52.502737333029977 ], [ 13.298768863756171, 52.502732745610956 ], [ 13.298777160032488, 52.502719780898438 ], [ 13.298766160885835, 52.502701780571677 ], [ 13.298768659941288, 52.502687542958917 ], [ 13.298739576126678, 52.502683557021086 ], [ 13.298716520582341, 52.502674898716116 ], [ 13.298712853697046, 52.502668899197516 ], [ 13.298691562724558, 52.50266502441211 ], [ 13.298672357683481, 52.502657611007898 ], [ 13.298653059320422, 52.502652576232393 ], [ 13.298616092437362, 52.502650855074101 ], [ 13.298608529209483, 52.502644798619038 ], [ 13.29860041651194, 52.502653008709807 ], [ 13.298565029085797, 52.50266082565004 ], [ 13.298560489942259, 52.502677412993961 ], [ 13.29856369767648, 52.502695301287744 ], [ 13.298549694485303, 52.502704615298491 ], [ 13.298555170337792, 52.502714209450275 ], [ 13.29855438984479, 52.502734419461518 ], [ 13.29854632303401, 52.502741440671194 ], [ 13.29853027832249, 52.50275310439379 ], [ 13.298525924285167, 52.50276493624898 ], [ 13.29850621269442, 52.502770600443867 ], [ 13.298500002276301, 52.502780026524796 ], [ 13.298487808028758, 52.502792935156812 ], [ 13.298494958063317, 52.502809690613923 ], [ 13.29850641627316, 52.502815802194867 ], [ 13.298517554522157, 52.502830236833546 ], [ 13.298536713731806, 52.502838838241473 ], [ 13.298541580297877, 52.5028416429085 ], [ 13.298555781087154, 52.502849818299019 ], [ 13.298579020376495, 52.502853720228778 ], [ 13.298602232993046, 52.502854726600184 ], [ 13.298602293038611, 52.502854736005332 ], [ 13.298619885312034, 52.502855497455961 ], [ 13.298657036010253, 52.502852463106059 ], [ 13.298669184314983, 52.502840743333543 ], [ 13.298675440616309, 52.502830128366512 ], [ 13.298693525342214, 52.502816114886208 ], [ 13.298719309614688, 52.502804590300485 ], [ 13.298741335158155, 52.502789443945581 ], [ 13.298735765966162, 52.502782227535192 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 23, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298543208334486, 52.503122990099726 ], [ 13.298352279492166, 52.503076009097732 ], [ 13.298356437445189, 52.503079822733866 ], [ 13.298367254310698, 52.503102578625601 ], [ 13.298367097776246, 52.503106631410681 ], [ 13.298409364283774, 52.503118094420884 ], [ 13.298411784872556, 52.503110355434103 ], [ 13.298448707687029, 52.503113265557424 ], [ 13.298483634900933, 52.503117336505277 ], [ 13.298493238240018, 52.503121043234074 ], [ 13.298516431750972, 52.503126134054092 ], [ 13.298530067802094, 52.503126330166161 ], [ 13.298543208334486, 52.503122990099726 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 24, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298305716377858, 52.503064552598779 ], [ 13.297868302310833, 52.502956918389067 ], [ 13.29787178375668, 52.502961041497464 ], [ 13.297878326254931, 52.502974029025758 ], [ 13.298261009893841, 52.503077848620315 ], [ 13.298265106787129, 52.503072562274873 ], [ 13.298286719364947, 52.503068115000403 ], [ 13.298305716377858, 52.503064552598779 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 25, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.29641806455512, 52.502530941505476 ], [ 13.296407208783656, 52.50253673197399 ], [ 13.296415229888289, 52.502530900686899 ], [ 13.29641806455512, 52.502530941505476 ], [ 13.296431091224317, 52.502523991859334 ], [ 13.296434925227574, 52.502519221482558 ], [ 13.296443376460884, 52.502508705670436 ], [ 13.296443744186005, 52.502499195562699 ], [ 13.296434954387628, 52.502491870626507 ], [ 13.296424861361659, 52.502483460565379 ], [ 13.296429539196655, 52.502463306682195 ], [ 13.296439692350782, 52.502452747943337 ], [ 13.296451657283665, 52.502445783006415 ], [ 13.296475953347896, 52.502422343898253 ], [ 13.296478453124465, 52.502408106339345 ], [ 13.296463189403999, 52.502399560686733 ], [ 13.296448632062459, 52.502390236674046 ], [ 13.296448577182723, 52.502390208011022 ], [ 13.296390089097013, 52.502377589102025 ], [ 13.296390024235373, 52.502377589966251 ], [ 13.296362672720043, 52.502377892020668 ], [ 13.296325612754558, 52.502378547879644 ], [ 13.296322837126963, 52.502399917790775 ], [ 13.296296960531159, 52.502413819603071 ], [ 13.296286899300439, 52.502422000578129 ], [ 13.296286163749599, 52.502441021690871 ], [ 13.296281945594428, 52.502449286810908 ], [ 13.29627726769368, 52.502469440687726 ], [ 13.296246096747051, 52.502468990892758 ], [ 13.296204592643997, 52.502519947005418 ], [ 13.297290312081708, 52.502814508015561 ], [ 13.29729905713223, 52.502811254079923 ], [ 13.297309257616185, 52.502799505512215 ], [ 13.297317632137176, 52.502794630521407 ], [ 13.297319226853169, 52.502793702202382 ], [ 13.297346959631616, 52.502782206855997 ], [ 13.297357206041729, 52.502769269407644 ], [ 13.297379277940205, 52.50275293533236 ], [ 13.297381383808954, 52.502739428468139 ], [ 13.297381869336592, 52.50273632000021 ], [ 13.297380426498584, 52.502723215221543 ], [ 13.297375225100716, 52.502706487738372 ], [ 13.297395027220379, 52.502698445958991 ], [ 13.297397296995294, 52.50269015276065 ], [ 13.29737025343308, 52.502683815873304 ], [ 13.297333332529329, 52.502680905438112 ], [ 13.297332827120126, 52.502693983077442 ], [ 13.297318272346542, 52.502717562557166 ], [ 13.297317721020153, 52.502731828173971 ], [ 13.297311554829239, 52.502740065292976 ], [ 13.297282011677259, 52.502747966861818 ], [ 13.297280385112204, 52.50273961668865 ], [ 13.29729439005218, 52.502730302851788 ], [ 13.29729290129295, 52.502718386948544 ], [ 13.297275597246974, 52.502712190213686 ], [ 13.297276194534453, 52.502696735720846 ], [ 13.297268816714922, 52.502685924596371 ], [ 13.297245439824485, 52.502685588140984 ], [ 13.297241175875255, 52.502695042172491 ], [ 13.297231021347184, 52.502705601858302 ], [ 13.297209914291987, 52.502696971302335 ], [ 13.297192519838701, 52.502693152329122 ], [ 13.297173269057932, 52.502686928458495 ], [ 13.297145903871719, 52.502688913653529 ], [ 13.297128186326798, 52.502693415884401 ], [ 13.297104993209173, 52.502688324795152 ], [ 13.297103643832308, 52.502672842282607 ], [ 13.297101237663517, 52.502667204323807 ], [ 13.297096494349875, 52.502656086745723 ], [ 13.297100758360768, 52.50264663182103 ], [ 13.297109055108514, 52.502633667229382 ], [ 13.297091706607153, 52.502628660264008 ], [ 13.297070094164976, 52.502633106422685 ], [ 13.297054280313837, 52.502638826481359 ], [ 13.297038878573398, 52.50263384663149 ], [ 13.29703349497084, 52.502621874660001 ], [ 13.297020179261439, 52.502613357121326 ], [ 13.297017427805418, 52.502595459165505 ], [ 13.297017064069466, 52.502593091038541 ], [ 13.297013791420929, 52.502593441341382 ], [ 13.29699749170601, 52.502595188374045 ], [ 13.296981723814982, 52.502599719546986 ], [ 13.296967141480804, 52.502603425307335 ], [ 13.296964006289922, 52.502604221753501 ], [ 13.296934464641776, 52.502612123257116 ], [ 13.296910812083926, 52.502618919093763 ], [ 13.296904553918163, 52.502629533943285 ], [ 13.296890778685341, 52.50263290425211 ], [ 13.296861512758728, 52.502633672481068 ], [ 13.296842352498066, 52.502625070783893 ], [ 13.296828946412919, 52.502618930098635 ], [ 13.296810109359505, 52.502602006285493 ], [ 13.296786962288779, 52.502595726258555 ], [ 13.2967601486831, 52.502583444852988 ], [ 13.296701659909763, 52.502583792321104 ], [ 13.296645258659787, 52.502580602102199 ], [ 13.296617985449533, 52.502580209423762 ], [ 13.29660512949131, 52.502559803080274 ], [ 13.296591907289001, 52.502548907763639 ], [ 13.296571930328899, 52.502540358100568 ], [ 13.296568898212847, 52.502539060168267 ], [ 13.296541854831579, 52.50253272399182 ], [ 13.296532386961943, 52.50253664809884 ], [ 13.296527989174175, 52.502538471132794 ], [ 13.296498767802065, 52.502538050375428 ], [ 13.296487308473958, 52.502531938581505 ], [ 13.29641806455512, 52.502530941505476 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 26, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298453254595145, 52.502678249801271 ], [ 13.298455340540912, 52.502674711190259 ], [ 13.298478350151978, 52.502684557524098 ], [ 13.298492031981219, 52.502683564762407 ], [ 13.298500283886767, 52.502671788968044 ], [ 13.298516510760733, 52.502655369719825 ], [ 13.29852879678889, 52.50264008333005 ], [ 13.298519560829495, 52.502626866486942 ], [ 13.298519882193995, 52.502618545246236 ], [ 13.298490477078749, 52.502622880488403 ], [ 13.298475443937958, 52.502608390727744 ], [ 13.298465381589759, 52.502616571869702 ], [ 13.298453556144011, 52.502619970402556 ], [ 13.298447987054994, 52.502612753080392 ], [ 13.2984385215439, 52.502605480616147 ], [ 13.298430638405138, 52.502607746310126 ], [ 13.29841899515414, 52.50260638931038 ], [ 13.298411295682529, 52.502603899495092 ], [ 13.298407858430439, 52.50259195558241 ], [ 13.29838448157599, 52.502591619352465 ], [ 13.298374556969124, 52.502596233855684 ], [ 13.298358605541239, 52.502605520721183 ], [ 13.298350445448319, 52.502614918751661 ], [ 13.298342285351888, 52.502624316781564 ], [ 13.298339602486694, 52.502643309892107 ], [ 13.298342947885903, 52.502657631560382 ], [ 13.298356217948964, 52.502667337829337 ], [ 13.298338638255034, 52.502668274510434 ], [ 13.298338454578481, 52.502673030018116 ], [ 13.298320922274122, 52.502672777840814 ], [ 13.298311228679504, 52.502671448873713 ], [ 13.298287759943038, 52.502673490378115 ], [ 13.298281548020027, 52.502682916426245 ], [ 13.298296672961984, 52.502695028457183 ], [ 13.298297978311169, 52.502711699857727 ], [ 13.298274371789873, 52.502717307989911 ], [ 13.298271918494045, 52.502730356713933 ], [ 13.298271275633946, 52.502747000091574 ], [ 13.298282735234023, 52.502753112613654 ], [ 13.2982863102258, 52.502761489898809 ], [ 13.298295820157588, 52.502767574375653 ], [ 13.298309411683405, 52.502768958511645 ], [ 13.298310991052105, 52.502778497527999 ], [ 13.298326301185668, 52.502785854068961 ], [ 13.298359325844688, 52.502788708152373 ], [ 13.298368975020599, 52.502791226013869 ], [ 13.298382473212584, 52.502794988772841 ], [ 13.298407706542852, 52.50279773077883 ], [ 13.298435301330192, 52.502789800907202 ], [ 13.298441696902231, 52.502775619343097 ], [ 13.298449857006371, 52.502766221306658 ], [ 13.298462049784797, 52.502753312657298 ], [ 13.298456893887924, 52.502735396341322 ], [ 13.298457490761644, 52.50271994183904 ], [ 13.29845238225889, 52.502700836666961 ], [ 13.298453254595145, 52.502678249801271 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 27, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.297722784590649, 52.502921112119047 ], [ 13.297636092661557, 52.502899779234276 ], [ 13.2976365268715, 52.502905319573905 ], [ 13.2976336986512, 52.50290766604445 ], [ 13.297713286114993, 52.502929260850792 ], [ 13.297721256199086, 52.502922001836495 ], [ 13.297722784590649, 52.502921112119047 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 28, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298966307237571, 52.502717743393987 ], [ 13.298941073915556, 52.502715001507212 ], [ 13.298919553382172, 52.502717071148943 ], [ 13.298890195649594, 52.502720216735433 ], [ 13.298876191011281, 52.502729531662752 ], [ 13.298856389176906, 52.502737572793571 ], [ 13.298846372739526, 52.502744565989509 ], [ 13.298845867812849, 52.502757642740363 ], [ 13.298859183922842, 52.502766160076675 ], [ 13.298862483594556, 52.502781670608726 ], [ 13.298875752337569, 52.502791376799301 ], [ 13.298893284694156, 52.502791628894805 ], [ 13.298918242634498, 52.502801504055689 ], [ 13.298955211130368, 52.502803225141818 ], [ 13.298966898880828, 52.502803393190895 ], [ 13.298980949426086, 52.502792889375698 ], [ 13.298993096156037, 52.502781169547738 ], [ 13.298980148669163, 52.502763142127648 ], [ 13.298997726916978, 52.502762205330257 ], [ 13.299013678269585, 52.502752918378135 ], [ 13.299000684915589, 52.502736078938888 ], [ 13.298979669261241, 52.502725071839563 ], [ 13.298966307237571, 52.502717743393987 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 29, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.297548603914818, 52.50287825049918 ], [ 13.297297833003908, 52.502816546672591 ], [ 13.297540167313857, 52.502882292026548 ], [ 13.297545885784542, 52.502880226315675 ], [ 13.297548603914818, 52.50287825049918 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 30, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.30016446593517, 52.502815455785885 ], [ 13.300180143284706, 52.502813302862606 ], [ 13.300199623867421, 52.502813582756282 ], [ 13.300207598692861, 52.502808939187929 ], [ 13.300212228969947, 52.50278997401994 ], [ 13.300222245168968, 52.502782981605279 ], [ 13.300238104538687, 52.502776072242128 ], [ 13.300247891426162, 52.502775023317028 ], [ 13.300263429717418, 52.502776436097065 ], [ 13.300265377921354, 52.502776464087304 ], [ 13.300267509594461, 52.502771736565137 ], [ 13.300263934223807, 52.502763359336598 ], [ 13.300254515718022, 52.502754898158152 ], [ 13.300252750985535, 52.502750114655363 ], [ 13.300235675806762, 52.502737974858029 ], [ 13.300232147820177, 52.502728407873057 ], [ 13.300234462932007, 52.502718925737703 ], [ 13.300232881640843, 52.502709387620882 ], [ 13.300221467645493, 52.502702086407425 ], [ 13.300202308159569, 52.502693485269859 ], [ 13.300179114707595, 52.502688393881662 ], [ 13.300161674120387, 52.502685764220907 ], [ 13.300152045035867, 52.50268562586902 ], [ 13.300151933121144, 52.502685624261005 ], [ 13.300133302199928, 52.502684479924397 ], [ 13.300126653866984, 52.502684071504667 ], [ 13.300099518123742, 52.50268011389263 ], [ 13.300074147164889, 52.502680937982475 ], [ 13.300054666642072, 52.502680658068641 ], [ 13.300054345531976, 52.502688980214529 ], [ 13.300077676586064, 52.50269050499309 ], [ 13.300083200115933, 52.50269891022014 ], [ 13.300077309642589, 52.502700015118442 ], [ 13.300055880910945, 52.502699707211434 ], [ 13.300042061488105, 52.502704266788179 ], [ 13.300035941680727, 52.50271131517556 ], [ 13.300030097078164, 52.50271123119348 ], [ 13.300014788153272, 52.502703874891949 ], [ 13.300008622467436, 52.502712112155848 ], [ 13.300008347222454, 52.502719245423549 ], [ 13.300008117886222, 52.502725188914674 ], [ 13.300003854488882, 52.502734643949267 ], [ 13.299993746517575, 52.502744014101154 ], [ 13.299993333680648, 52.502754713103897 ], [ 13.300006879351292, 52.502757286821911 ], [ 13.300000713621609, 52.502765524983879 ], [ 13.299998844644751, 52.502766613037792 ], [ 13.299984762504124, 52.502774811172159 ], [ 13.299984579004494, 52.502779566683813 ], [ 13.299994135087086, 52.502784461249632 ], [ 13.299998337144759, 52.502785225642718 ], [ 13.300015426236984, 52.502788335801988 ], [ 13.300034908279548, 52.502788615743825 ], [ 13.300054388849883, 52.502788895661311 ], [ 13.300063853162118, 52.502796168876074 ], [ 13.300079255344446, 52.502801147436728 ], [ 13.300081111804598, 52.502803553185927 ], [ 13.300086725586009, 52.502809581534379 ], [ 13.300108109972342, 52.502811078335355 ], [ 13.300121791808467, 52.502810085385242 ], [ 13.300133481040399, 52.502810253340279 ], [ 13.300144985351981, 52.502815175886425 ], [ 13.30016446593517, 52.502815455785885 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 31, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.300319902220508, 52.502856274775873 ], [ 13.300310242501725, 52.502782648141384 ], [ 13.300300800541386, 52.502782891020075 ], [ 13.300296242168931, 52.502754050061959 ], [ 13.300306436555863, 52.502753628279173 ], [ 13.30029719387074, 52.502683247166615 ], [ 13.300182492944035, 52.502688934239146 ], [ 13.300153509085854, 52.502683156339522 ], [ 13.300152045035867, 52.50268562586902 ], [ 13.300161674120387, 52.502685764220907 ], [ 13.300179114707595, 52.502688393881662 ], [ 13.300202308159569, 52.502693485269859 ], [ 13.300221467645493, 52.502702086407425 ], [ 13.300232881640843, 52.502709387620882 ], [ 13.300234462932007, 52.502718925737703 ], [ 13.300232147820177, 52.502728407873057 ], [ 13.300235675806762, 52.502737974858029 ], [ 13.300252750985535, 52.502750114655363 ], [ 13.300254515718022, 52.502754898158152 ], [ 13.300263934223807, 52.502763359336598 ], [ 13.300267509594461, 52.502771736565137 ], [ 13.300265377921354, 52.502776464087304 ], [ 13.300263429717418, 52.502776436097065 ], [ 13.300247891426162, 52.502775023317028 ], [ 13.300238104538687, 52.502776072242128 ], [ 13.300222245168968, 52.502782981605279 ], [ 13.300212228969947, 52.50278997401994 ], [ 13.300207598692861, 52.502808939187929 ], [ 13.300199623867421, 52.502813582756282 ], [ 13.300180143284706, 52.502813302862606 ], [ 13.30016446593517, 52.502815455785885 ], [ 13.300144985351981, 52.502815175886425 ], [ 13.300133481040399, 52.502810253340279 ], [ 13.300121791808467, 52.502810085385242 ], [ 13.300108109972342, 52.502811078335355 ], [ 13.300086725586009, 52.502809581534379 ], [ 13.300081111804598, 52.502803553185927 ], [ 13.300079255344446, 52.502801147436728 ], [ 13.300063853162118, 52.502796168876074 ], [ 13.300054388849883, 52.502788895661311 ], [ 13.300034908279548, 52.502788615743825 ], [ 13.300015426236984, 52.502788335801988 ], [ 13.299998337144759, 52.502785225642718 ], [ 13.299997583948898, 52.502786569795084 ], [ 13.299995526471429, 52.502789831912317 ], [ 13.29999307076281, 52.502792990302929 ], [ 13.299990419914508, 52.502796089244853 ], [ 13.299987392525736, 52.502799056899008 ], [ 13.300074383756726, 52.502816704161191 ], [ 13.300170417830532, 52.502838077770726 ], [ 13.300170482073479, 52.50283721463849 ], [ 13.300170680146676, 52.502836357924707 ], [ 13.300170942770112, 52.502835508432256 ], [ 13.30017133435541, 52.502834676976939 ], [ 13.300171790282914, 52.502833858134601 ], [ 13.300172368831214, 52.502833068926833 ], [ 13.300173007096006, 52.502832297660383 ], [ 13.300173763182526, 52.502831565849874 ], [ 13.300174571449332, 52.502830856367957 ], [ 13.30017548688318, 52.50283019518011 ], [ 13.300176451309479, 52.502829562568941 ], [ 13.300177510775585, 52.502828987068767 ], [ 13.300178610294706, 52.502828442714211 ], [ 13.300179789815912, 52.502827963346661 ], [ 13.300181004833773, 52.502827518655771 ], [ 13.300182281974882, 52.5028271440897 ], [ 13.300183588583709, 52.502826807710107 ], [ 13.300184939436985, 52.502826546593219 ], [ 13.30018630938067, 52.502826325311965 ], [ 13.300187705759283, 52.50282618263401 ], [ 13.300189112392957, 52.502826079664757 ], [ 13.300190529124659, 52.502826058660503 ], [ 13.300191945838096, 52.502826076318243 ], [ 13.300193353471535, 52.502826176564618 ], [ 13.300194750744081, 52.50282631622342 ], [ 13.300196122877123, 52.502826534643653 ], [ 13.300197475813855, 52.502826792349424 ], [ 13.300198781591913, 52.502827126701973 ], [ 13.300200062352779, 52.502827498458196 ], [ 13.300201279999438, 52.502827940338108 ], [ 13.300202460952338, 52.502828416756579 ], [ 13.300203565676648, 52.502828959513813 ], [ 13.300204626517743, 52.502829532210733 ], [ 13.30020559520935, 52.502830163824676 ], [ 13.300206514266163, 52.50283082169917 ], [ 13.300207326759832, 52.502831530191585 ], [ 13.300208086881565, 52.502832259510463 ], [ 13.300208730478943, 52.502833030312914 ], [ 13.30020931300767, 52.502833818220424 ], [ 13.300209773572421, 52.502834635844799 ], [ 13.300210171769319, 52.502835466059885 ], [ 13.300210439548213, 52.502836315980097 ], [ 13.300210640818889, 52.50283717123861 ], [ 13.300210710649717, 52.50283803449895 ], [ 13.300210714111003, 52.502838899503061 ], [ 13.300210585110555, 52.502839760805792 ], [ 13.300210391455829, 52.502840617583111 ], [ 13.300210067262595, 52.502841458998034 ], [ 13.300209675712663, 52.502842289554934 ], [ 13.300209161368461, 52.502843094970373 ], [ 13.300208584258558, 52.50284388509813 ], [ 13.300207890660714, 52.502844639385579 ], [ 13.300207136047108, 52.502845371217475 ], [ 13.300206275600203, 52.502846058370984 ], [ 13.300297356020181, 52.502866331210456 ], [ 13.300319902220508, 52.502856274775873 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 32, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298267792488472, 52.502736245052198 ], [ 13.298268527191855, 52.502717223920826 ], [ 13.298269261894413, 52.502698202789418 ], [ 13.29827733017868, 52.502691182518689 ], [ 13.298270042482443, 52.502677993679669 ], [ 13.298258354769468, 52.502677825562046 ], [ 13.298246436010587, 52.502683600907794 ], [ 13.298218933101975, 52.502689152982107 ], [ 13.298203303067487, 52.50269011768804 ], [ 13.298193378419533, 52.502694732175641 ], [ 13.298194775575803, 52.5027090258233 ], [ 13.298165509613982, 52.502709794374567 ], [ 13.298155125716029, 52.502726297626992 ], [ 13.298164591170616, 52.502733571012158 ], [ 13.298188059944266, 52.502731529532568 ], [ 13.29820522492278, 52.502741291845787 ], [ 13.298226607731799, 52.50274278896493 ], [ 13.298242008175212, 52.502747768640354 ], [ 13.298267792488472, 52.502736245052198 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 33, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299979356583378, 52.502761029088489 ], [ 13.299980893422964, 52.502760988233788 ], [ 13.299982428441009, 52.502761032769399 ], [ 13.299983961759951, 52.502761121337521 ], [ 13.299985472641453, 52.502761294999715 ], [ 13.299986968605531, 52.502761511605271 ], [ 13.299988427475867, 52.502761811296125 ], [ 13.299989859717565, 52.502762151963857 ], [ 13.299991235860903, 52.502762571847249 ], [ 13.299992578082163, 52.502763030804488 ], [ 13.299993845339134, 52.502763561513326 ], [ 13.299995071380552, 52.502764129392965 ], [ 13.299996205029618, 52.50276476247997 ], [ 13.299997291780931, 52.50276542726138 ], [ 13.29999827316421, 52.502766149870673 ], [ 13.299998844644751, 52.502766613037792 ], [ 13.300000713621609, 52.502765524983879 ], [ 13.300006879351292, 52.502757286821911 ], [ 13.299993333680648, 52.502754713103897 ], [ 13.299993746517575, 52.502744014101154 ], [ 13.300003854488882, 52.502734643949267 ], [ 13.300008117886222, 52.502725188914674 ], [ 13.300008347222454, 52.502719245423549 ], [ 13.300008622467436, 52.502712112155848 ], [ 13.300014788153272, 52.502703874891949 ], [ 13.300030097078164, 52.50271123119348 ], [ 13.300035941680727, 52.50271131517556 ], [ 13.300042061488105, 52.502704266788179 ], [ 13.300055880910945, 52.502699707211434 ], [ 13.300077309642589, 52.502700015118442 ], [ 13.300083200115933, 52.50269891022014 ], [ 13.300077676586064, 52.50269050499309 ], [ 13.300054345531976, 52.502688980214529 ], [ 13.300054666642072, 52.502680658068641 ], [ 13.300074147164889, 52.502680937982475 ], [ 13.300099518123742, 52.50268011389263 ], [ 13.300126653866984, 52.502684071504667 ], [ 13.300133302199928, 52.502684479924397 ], [ 13.299982172303707, 52.502650943405826 ], [ 13.299982951506466, 52.502647054215501 ], [ 13.299954872948385, 52.502640650000608 ], [ 13.299925986861277, 52.502645665599836 ], [ 13.299919535973459, 52.502659613574302 ], [ 13.299925902765363, 52.50266281242817 ], [ 13.299878609300068, 52.50274737128197 ], [ 13.299892746476285, 52.502767261593405 ], [ 13.299954508397844, 52.502781217841765 ], [ 13.29995434051345, 52.502779879335449 ], [ 13.299954379065607, 52.502778536602619 ], [ 13.299954520627976, 52.502777197148284 ], [ 13.299954869440576, 52.502775870562417 ], [ 13.299955317971483, 52.502774556198915 ], [ 13.299955967134151, 52.502773273490341 ], [ 13.299956714230413, 52.502772011070547 ], [ 13.299957652498906, 52.502770796353964 ], [ 13.299958683971223, 52.502769609950285 ], [ 13.299959892703802, 52.502768488133185 ], [ 13.29996118552741, 52.502767401691003 ], [ 13.299962641768703, 52.502766394921501 ], [ 13.299964172953532, 52.502765431487589 ], [ 13.29996584648935, 52.502764559112165 ], [ 13.299967584452762, 52.502763735315952 ], [ 13.299969440720641, 52.50276301482041 ], [ 13.299971350865441, 52.502762349046307 ], [ 13.299973353934391, 52.502761795199305 ], [ 13.299974813705735, 52.502761498786029 ], [ 13.299976312991358, 52.502761285659638 ], [ 13.299977825407545, 52.502761114081466 ], [ 13.299979356583378, 52.502761029088489 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 34, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298175642900773, 52.502649277328601 ], [ 13.29817619394781, 52.502635011705188 ], [ 13.29819368178538, 52.502636452801852 ], [ 13.298213024502438, 52.502640299652413 ], [ 13.298238625072498, 52.502633531577445 ], [ 13.29825629512438, 52.502630217136137 ], [ 13.29825693798743, 52.50261357375831 ], [ 13.298261109903704, 52.502606496543379 ], [ 13.298273302691753, 52.502593587913218 ], [ 13.29825609183351, 52.502585014486904 ], [ 13.298244771482755, 52.502575336251617 ], [ 13.29823934019854, 52.502564552289243 ], [ 13.298218324818336, 52.50255354505672 ], [ 13.29818353437334, 52.502545907382384 ], [ 13.298148607606297, 52.502541837248238 ], [ 13.298140401556761, 52.502552424140909 ], [ 13.298132838411563, 52.502546367656038 ], [ 13.298109828950752, 52.50253652125604 ], [ 13.298095733865109, 52.502548212966481 ], [ 13.298095182793755, 52.502562478589482 ], [ 13.298081223966278, 52.50257060454512 ], [ 13.29806912298144, 52.502581135401527 ], [ 13.298082391488245, 52.502590841679371 ], [ 13.298101229030335, 52.502607765294094 ], [ 13.298114728615445, 52.502611528104232 ], [ 13.298126186686108, 52.50261764061996 ], [ 13.298124008901832, 52.502623556079946 ], [ 13.298117844314154, 52.502631794162369 ], [ 13.298094375625517, 52.502633834729842 ], [ 13.298069280154211, 52.502627526926226 ], [ 13.298057728763219, 52.502623792137442 ], [ 13.298047621880295, 52.502633162141073 ], [ 13.298043220291984, 52.50264618373194 ], [ 13.298035060124555, 52.502655581739965 ], [ 13.298017022658907, 52.502668406263204 ], [ 13.29801443150636, 52.502685021611576 ], [ 13.298021489488129, 52.502704154849347 ], [ 13.298032442436748, 52.502723343220886 ], [ 13.298057400141689, 52.502733218561488 ], [ 13.298080639323356, 52.502737120588336 ], [ 13.298107683023996, 52.502743457314367 ], [ 13.298125399054568, 52.502738954016358 ], [ 13.298147149220021, 52.502730941034159 ], [ 13.298153361178599, 52.502721514993425 ], [ 13.298159802754654, 52.5027061445683 ], [ 13.298162210192903, 52.502694283825008 ], [ 13.298172362989643, 52.502683724934748 ], [ 13.298194067196174, 52.502676900820376 ], [ 13.298194296811372, 52.50267095643612 ], [ 13.298188775119879, 52.502662551145086 ], [ 13.298175642900773, 52.502649277328601 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 35, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299717913720253, 52.502722208042428 ], [ 13.299713911293674, 52.502722150520157 ], [ 13.299711687799565, 52.502729255787415 ], [ 13.299713799654173, 52.502731991594054 ], [ 13.299717913720253, 52.502722208042428 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 36, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299711687799565, 52.502729255787415 ], [ 13.299713911293674, 52.502722150520157 ], [ 13.299717913720253, 52.502722208042428 ], [ 13.299735340032401, 52.502722458489181 ], [ 13.299753057331547, 52.502717955865684 ], [ 13.299759221627809, 52.502709717695723 ], [ 13.299759772163435, 52.502695452060792 ], [ 13.299764402619866, 52.50267648691149 ], [ 13.299757114478663, 52.5026632981603 ], [ 13.299757573252405, 52.502651410280841 ], [ 13.299753956186878, 52.502645490633938 ], [ 13.299750240708807, 52.502639410428152 ], [ 13.299738918540282, 52.502629732311902 ], [ 13.299715358156648, 52.502634150957213 ], [ 13.299685907259091, 52.502639675375178 ], [ 13.29968673311321, 52.502618276473946 ], [ 13.299704955044273, 52.502600697100419 ], [ 13.299721364973031, 52.50257952217158 ], [ 13.299701930380818, 52.502578053322267 ], [ 13.299674657128904, 52.50257766134829 ], [ 13.29964729211026, 52.502579647123554 ], [ 13.299627536365914, 52.502586499507629 ], [ 13.299615296616347, 52.502600597137302 ], [ 13.299622538820543, 52.50261497477468 ], [ 13.29962787868215, 52.502628136431866 ], [ 13.299645043944706, 52.502637898538673 ], [ 13.2996427287109, 52.502647380661593 ], [ 13.299609428757471, 52.502651660202851 ], [ 13.299582293117973, 52.502647701574091 ], [ 13.299560818531136, 52.502648582455336 ], [ 13.299556463308109, 52.502660414329952 ], [ 13.29955781501987, 52.502675896843009 ], [ 13.299532214586526, 52.502682666103581 ], [ 13.299522198302453, 52.502689658459197 ], [ 13.299506476517109, 52.50269300109283 ], [ 13.299507247772688, 52.502700007340707 ], [ 13.299507919987304, 52.502706105850933 ], [ 13.29953519331638, 52.502706497864018 ], [ 13.299552725645166, 52.502706749861524 ], [ 13.299576194346475, 52.502704708105881 ], [ 13.299583803604497, 52.502709575622561 ], [ 13.299599204193809, 52.502714555122537 ], [ 13.299628288111435, 52.502718540849827 ], [ 13.299643734593033, 52.502722331466373 ], [ 13.299649303892698, 52.502729548733889 ], [ 13.299662893945614, 52.502730933592105 ], [ 13.299684047425096, 52.502738373938278 ], [ 13.299697317776252, 52.502748080957986 ], [ 13.299708959668969, 52.502749436912765 ], [ 13.299720970021445, 52.502741283662722 ], [ 13.299713799654173, 52.502731991594054 ], [ 13.299711687799565, 52.502729255787415 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 37, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.29955781501987, 52.502675896843009 ], [ 13.299556463308109, 52.502660414329952 ], [ 13.299560818531136, 52.502648582455336 ], [ 13.299582293117973, 52.502647701574091 ], [ 13.299609428757471, 52.502651660202851 ], [ 13.2996427287109, 52.502647380661593 ], [ 13.299645043944706, 52.502637898538673 ], [ 13.29962787868215, 52.502628136431866 ], [ 13.299622538820543, 52.50261497477468 ], [ 13.299615296616347, 52.502600597137302 ], [ 13.299627536365914, 52.502586499507629 ], [ 13.29964729211026, 52.502579647123554 ], [ 13.299674657128904, 52.50257766134829 ], [ 13.299701930380818, 52.502578053322267 ], [ 13.299721364973031, 52.50257952217158 ], [ 13.299704955044273, 52.502600697100419 ], [ 13.29968673311321, 52.502618276473946 ], [ 13.299685907259091, 52.502639675375178 ], [ 13.299715358156648, 52.502634150957213 ], [ 13.299738918540282, 52.502629732311902 ], [ 13.299750240708807, 52.502639410428152 ], [ 13.299753956186878, 52.502645490633938 ], [ 13.299761922549099, 52.502631445763832 ], [ 13.299753680175495, 52.502628933848193 ], [ 13.299789981703459, 52.5025672237851 ], [ 13.299789767357865, 52.502542769106761 ], [ 13.299789067228504, 52.502542432664086 ], [ 13.299771902004988, 52.502532669679397 ], [ 13.299756593185339, 52.502525313345103 ], [ 13.299761130390033, 52.502508725929793 ], [ 13.299763445625091, 52.502499242905472 ], [ 13.299779673405132, 52.502482824398847 ], [ 13.299787602333796, 52.502479369736271 ], [ 13.299809307702725, 52.502472544444871 ], [ 13.299831011557748, 52.502465720026905 ], [ 13.299834493593465, 52.502476475002602 ], [ 13.299855648419284, 52.502483916237395 ], [ 13.299880973425072, 52.50248428017273 ], [ 13.299894425814486, 52.502489230738945 ], [ 13.299896602657816, 52.502495131483386 ], [ 13.29989896790835, 52.502452316958461 ], [ 13.299801833893422, 52.502452255365696 ], [ 13.299793625156669, 52.502445169207782 ], [ 13.299722817416562, 52.502443769465799 ], [ 13.299711899431456, 52.502454505406185 ], [ 13.299638445578008, 52.502454249029149 ], [ 13.299638023474424, 52.502463620795687 ], [ 13.299626732438457, 52.502472989198104 ], [ 13.299622745847337, 52.502516194910903 ], [ 13.299607769232988, 52.502516189151301 ], [ 13.299526032178607, 52.502497146099273 ], [ 13.299548212438179, 52.50246003808882 ], [ 13.299520991805196, 52.502468400678609 ], [ 13.299520487083727, 52.502481477434699 ], [ 13.299493077703643, 52.502484652073605 ], [ 13.299468427875357, 52.502487752183548 ], [ 13.299476858323732, 52.502489551122324 ], [ 13.299473756229903, 52.502494835624042 ], [ 13.299521155857564, 52.502505301169485 ], [ 13.299513491573483, 52.502518122166499 ], [ 13.299602023360501, 52.502538361612707 ], [ 13.299615098852225, 52.502538532460576 ], [ 13.29957582186408, 52.502602354898457 ], [ 13.299563826997158, 52.502603274028054 ], [ 13.299524474453666, 52.502673440460633 ], [ 13.299516606600454, 52.502671837528311 ], [ 13.299507161849705, 52.5026864680393 ], [ 13.299496648323831, 52.502690348580416 ], [ 13.299507247772688, 52.502700007340707 ], [ 13.299506476517109, 52.50269300109283 ], [ 13.299522198302453, 52.502689658459197 ], [ 13.299532214586526, 52.502682666103581 ], [ 13.29955781501987, 52.502675896843009 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 38, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299262133709355, 52.50264843667582 ], [ 13.299272561597121, 52.502630744423669 ], [ 13.299239904114621, 52.502618380474281 ], [ 13.299254549619715, 52.502592422993771 ], [ 13.299341799506376, 52.502604382182007 ], [ 13.299323074085162, 52.502635039172553 ], [ 13.29934826149527, 52.502638969855262 ], [ 13.299356742622679, 52.502621249611217 ], [ 13.299372326719741, 52.502621473630043 ], [ 13.299371663784822, 52.502622807387482 ], [ 13.299377090915275, 52.502624011100764 ], [ 13.299399402449604, 52.502586293602569 ], [ 13.299167729049344, 52.502534537409318 ], [ 13.299158376164879, 52.502551098727977 ], [ 13.299182619515214, 52.502549178779475 ], [ 13.299195797941632, 52.50256126271065 ], [ 13.299199556675889, 52.502564884459915 ], [ 13.299202992633932, 52.502576829228886 ], [ 13.299218394640272, 52.502581807900349 ], [ 13.299227675189185, 52.502593836690657 ], [ 13.299211861660487, 52.502599556141668 ], [ 13.299207414558008, 52.502613765757708 ], [ 13.299203013348279, 52.502626786496052 ], [ 13.299183349273095, 52.502631261948821 ], [ 13.299156305480642, 52.502624925467856 ], [ 13.299141318015636, 52.502609246912563 ], [ 13.2991418144912, 52.502596386727348 ], [ 13.299127156301221, 52.502622098551868 ], [ 13.299212461714554, 52.502640460394353 ], [ 13.299214766048292, 52.502635613991252 ], [ 13.299260803231933, 52.502645231063958 ], [ 13.299258246460017, 52.502650319298994 ], [ 13.299341994028293, 52.50266835295097 ], [ 13.299345245075003, 52.502662951010763 ], [ 13.299262133709355, 52.50264843667582 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 39, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.297628945515497, 52.502633086021213 ], [ 13.297635339849634, 52.502618904481174 ], [ 13.297652919536443, 52.502617967904563 ], [ 13.297668136156132, 52.502627702261286 ], [ 13.29767425632765, 52.502620653999401 ], [ 13.297688259674455, 52.502611340093523 ], [ 13.297675220934007, 52.502595689389487 ], [ 13.297665985275966, 52.50258247158326 ], [ 13.297668117182326, 52.502577745008672 ], [ 13.297691539957128, 52.502576892503527 ], [ 13.297690097031062, 52.502563787727567 ], [ 13.297678914621445, 52.502550542809573 ], [ 13.29766773074595, 52.502537297869345 ], [ 13.297668236052916, 52.502524220227365 ], [ 13.297662713007501, 52.502515814891382 ], [ 13.297629550788217, 52.502516527245085 ], [ 13.297609885136051, 52.502521002414291 ], [ 13.297608719339649, 52.502500764399571 ], [ 13.297611171344693, 52.50248771566914 ], [ 13.297621233854642, 52.502479533702164 ], [ 13.297646696606288, 52.502476332384653 ], [ 13.297657126569801, 52.502458640300787 ], [ 13.297641954475084, 52.502447717045122 ], [ 13.297620709645754, 52.502442653192034 ], [ 13.297614956962708, 52.502440191337875 ], [ 13.297611383596299, 52.502431814054468 ], [ 13.297594217432541, 52.502422050736939 ], [ 13.297574874832488, 52.502418204684929 ], [ 13.297555486330758, 52.502415546607665 ], [ 13.297541435606648, 52.502426049353737 ], [ 13.297529518262108, 52.502431825547099 ], [ 13.297529977667631, 52.502419936782296 ], [ 13.297502796392118, 52.50241716745429 ], [ 13.297500526652248, 52.502425460655338 ], [ 13.297469403096848, 52.502423823226167 ], [ 13.297477701165809, 52.502410858628103 ], [ 13.297472315996885, 52.502398886654142 ], [ 13.297442728667397, 52.502407976264749 ], [ 13.297430809842519, 52.502413752426932 ], [ 13.297434108986876, 52.502429262995221 ], [ 13.297459250194317, 52.50243438205564 ], [ 13.297453038095219, 52.502443808958034 ], [ 13.297431150119603, 52.502455388442414 ], [ 13.297428283135236, 52.502479136136536 ], [ 13.297429771924511, 52.502491052038778 ], [ 13.297449160451311, 52.502493710136825 ], [ 13.297462797771733, 52.502493906391422 ], [ 13.297482324127744, 52.502492997854759 ], [ 13.297494057728619, 52.502491977172191 ], [ 13.297507465342498, 52.502498117803839 ], [ 13.29750909197748, 52.502506467075925 ], [ 13.297530244942802, 52.502513908702042 ], [ 13.297540305966423, 52.502505727619592 ], [ 13.297575371900814, 52.50250623222297 ], [ 13.297580619292305, 52.502521770821836 ], [ 13.297576217612994, 52.502534791495862 ], [ 13.297562166855061, 52.502545294243902 ], [ 13.297547979742147, 52.502559363640749 ], [ 13.29754357804921, 52.502572384313353 ], [ 13.297533379188515, 52.502584132025262 ], [ 13.297530466273709, 52.502609069496849 ], [ 13.297540663963588, 52.502625758279294 ], [ 13.297534396914777, 52.502624405728263 ], [ 13.297534423504379, 52.502624442075756 ], [ 13.297536190053227, 52.502626730585376 ], [ 13.297527616313475, 52.502646828445492 ], [ 13.297532863703724, 52.502662367046092 ], [ 13.297558096901176, 52.502665109232325 ], [ 13.297592931828655, 52.502671557294029 ], [ 13.297627906019326, 52.502674439635889 ], [ 13.297626738739613, 52.502654201600549 ], [ 13.297627116871205, 52.502644415610355 ], [ 13.297624878654307, 52.502643923952427 ], [ 13.297624681653623, 52.502642540067299 ], [ 13.297628945515497, 52.502633086021213 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 40, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.296909800981512, 52.502545481383301 ], [ 13.296882895420117, 52.502535578656207 ], [ 13.296826815969256, 52.502524065493283 ], [ 13.29678015278582, 52.502521015530107 ], [ 13.29670617198094, 52.50251876088938 ], [ 13.296634140846029, 52.502516534273532 ], [ 13.296552275369573, 52.502516545088575 ], [ 13.296492298183951, 52.502504975644214 ], [ 13.296434954387628, 52.502491870626507 ], [ 13.296443744186005, 52.502499195562699 ], [ 13.296443376460884, 52.502508705670436 ], [ 13.296434925227574, 52.502519221482558 ], [ 13.296447193515419, 52.502522168334004 ], [ 13.296509117428855, 52.502533765832077 ], [ 13.296532386961943, 52.50253664809884 ], [ 13.296541854831579, 52.50253272399182 ], [ 13.296568898212847, 52.502539060168267 ], [ 13.296571930328899, 52.502540358100568 ], [ 13.296602440807321, 52.502539866809933 ], [ 13.296612135790875, 52.502541195937631 ], [ 13.296609773945661, 52.502551866871684 ], [ 13.296712976185397, 52.502554542284905 ], [ 13.296713527704016, 52.502540276672164 ], [ 13.296738852700894, 52.502540641280163 ], [ 13.29678560631619, 52.502541314385184 ], [ 13.296826147719853, 52.502551413441203 ], [ 13.296872395839952, 52.502565163249706 ], [ 13.296908811080176, 52.502581151464454 ], [ 13.296941469338977, 52.502593516072849 ], [ 13.296967141480804, 52.502603425307335 ], [ 13.296981723814982, 52.502599719546986 ], [ 13.29699749170601, 52.502595188374045 ], [ 13.297013791420929, 52.502593441341382 ], [ 13.296996039155202, 52.502583595772137 ], [ 13.296978874509275, 52.502573833286014 ], [ 13.296950250505629, 52.50255795814919 ], [ 13.296909800981512, 52.502545481383301 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 41, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.297396451398445, 52.502661593488149 ], [ 13.297420563345387, 52.502642908790406 ], [ 13.297432022798844, 52.502649021393736 ], [ 13.297442039435969, 52.502642028319158 ], [ 13.297446347807439, 52.502631385382379 ], [ 13.297421344355772, 52.502622698790731 ], [ 13.297421665927589, 52.502614377554686 ], [ 13.297400742620155, 52.502600992425812 ], [ 13.297388687410397, 52.502610334334747 ], [ 13.297374958164408, 52.502612515823984 ], [ 13.297370603832492, 52.502624347634438 ], [ 13.297371631685923, 52.502648152279214 ], [ 13.297396451398445, 52.502661593488149 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 42, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.297455932254017, 52.502585134044864 ], [ 13.297430699109114, 52.502582391837265 ], [ 13.297433952321285, 52.502599091281652 ], [ 13.297452877950789, 52.502606828147584 ], [ 13.29745300408392, 52.502606881212664 ], [ 13.297455059409549, 52.502607720899199 ], [ 13.297460260827034, 52.502624448379265 ], [ 13.297489620062223, 52.5026213031691 ], [ 13.29749072346233, 52.502615016207066 ], [ 13.29749072899123, 52.502614987514761 ], [ 13.2974921180866, 52.502607064666734 ], [ 13.297478987533161, 52.502593791694501 ], [ 13.297455932254017, 52.502585134044864 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 43, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299195797941632, 52.50256126271065 ], [ 13.299182619515214, 52.502549178779475 ], [ 13.299158376164879, 52.502551098727977 ], [ 13.299157202722286, 52.502551191550666 ], [ 13.299157120468733, 52.502553322184426 ], [ 13.299156376613047, 52.502572590446263 ], [ 13.299148088644467, 52.502585381773869 ], [ 13.299141868749285, 52.502594981281923 ], [ 13.2991418144912, 52.502596386727348 ], [ 13.299141318015636, 52.502609246912563 ], [ 13.299156305480642, 52.502624925467856 ], [ 13.299183349273095, 52.502631261948821 ], [ 13.299203013348279, 52.502626786496052 ], [ 13.299207414558008, 52.502613765757708 ], [ 13.299211861660487, 52.502599556141668 ], [ 13.299227675189185, 52.502593836690657 ], [ 13.299218394640272, 52.502581807900349 ], [ 13.299202992633932, 52.502576829228886 ], [ 13.299199556675889, 52.502564884459915 ], [ 13.299195797941632, 52.50256126271065 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 44, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.29740113914149, 52.502576282185032 ], [ 13.297403546775744, 52.502564421458587 ], [ 13.297411844891373, 52.502551456865824 ], [ 13.297423762249062, 52.502545681583449 ], [ 13.297426169840648, 52.502533821755058 ], [ 13.297432565697243, 52.502519640247357 ], [ 13.297440771944228, 52.502509052506539 ], [ 13.297429404377551, 52.502500563049978 ], [ 13.297408159548175, 52.50249549915879 ], [ 13.297404906352554, 52.502478799713565 ], [ 13.297393724050281, 52.502465554769323 ], [ 13.297384304690743, 52.50245709334596 ], [ 13.297364456768303, 52.502466323102489 ], [ 13.297335051647813, 52.502470658057455 ], [ 13.297320680737133, 52.50248948203361 ], [ 13.297310342524842, 52.502504796333881 ], [ 13.297300371845646, 52.502510600521212 ], [ 13.297284374313477, 52.502521075218048 ], [ 13.297275984271277, 52.502536417554239 ], [ 13.297275570742917, 52.502547117440962 ], [ 13.297292553129157, 52.502561635410942 ], [ 13.297305913350771, 52.502568964021819 ], [ 13.297329290180079, 52.502569300464756 ], [ 13.297342971996331, 52.502568307835858 ], [ 13.297348540897717, 52.50257552520852 ], [ 13.297371642095342, 52.502582994002537 ], [ 13.297389221772516, 52.502582057465006 ], [ 13.29740113914149, 52.502576282185032 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 45, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.300257317658589, 52.502480171525924 ], [ 13.300257502201546, 52.502475388156014 ], [ 13.300257720477349, 52.502469730425958 ], [ 13.300257868028423, 52.502465905886702 ], [ 13.300258464264777, 52.50245045136932 ], [ 13.300248952618563, 52.50244436792569 ], [ 13.300231282819354, 52.50244768176799 ], [ 13.300219274079318, 52.502455835991483 ], [ 13.300201373458133, 52.502465094198747 ], [ 13.300193536301403, 52.502466171133115 ], [ 13.300176140197612, 52.50246235257584 ], [ 13.300168532353254, 52.502457486016688 ], [ 13.300164223182545, 52.502468129037446 ], [ 13.300162045644241, 52.502474045436131 ], [ 13.300156246942539, 52.502472772582458 ], [ 13.300136995862408, 52.50246654829251 ], [ 13.300129386583821, 52.502461680811038 ], [ 13.300125031497963, 52.502473513607015 ], [ 13.300116781535035, 52.502485289540239 ], [ 13.300122442659729, 52.502490128131448 ], [ 13.300122213306111, 52.502496072521758 ], [ 13.300108392481745, 52.502500632085848 ], [ 13.30010027865063, 52.502508841362463 ], [ 13.300099774100316, 52.502521918122348 ], [ 13.300099269549612, 52.502534994882183 ], [ 13.300106649481172, 52.502545806755847 ], [ 13.300113937708867, 52.502558995486503 ], [ 13.300125120857867, 52.502572240180534 ], [ 13.300133422851488, 52.502575574723529 ], [ 13.300140477099182, 52.502578407610862 ], [ 13.300167289354667, 52.502583186858288 ], [ 13.300169513602363, 52.502583582960362 ], [ 13.300169686407989, 52.502583724806996 ], [ 13.300182738181283, 52.502594477905816 ], [ 13.300217804234364, 52.502594981726801 ], [ 13.30025296051601, 52.502593108658608 ], [ 13.300257773061409, 52.502590307807637 ], [ 13.300260936768042, 52.502588465107323 ], [ 13.300282457180968, 52.502586395220447 ], [ 13.300286787840667, 52.502585582594534 ], [ 13.30029423661445, 52.502584185381643 ], [ 13.300288852129658, 52.502572213550742 ], [ 13.300287270831243, 52.502562675434369 ], [ 13.300275948597616, 52.502552996469902 ], [ 13.300278309556527, 52.502542325455124 ], [ 13.300280762247295, 52.502529276683994 ], [ 13.300275468033242, 52.502514927074969 ], [ 13.300271283779505, 52.502512250516929 ], [ 13.300268451140653, 52.502510438551397 ], [ 13.300260780010751, 52.50250553152776 ], [ 13.300258348543313, 52.502503976180485 ], [ 13.3002549108311, 52.50249203141852 ], [ 13.300257317658589, 52.502480171525924 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 46, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.297838839746154, 52.502548085730083 ], [ 13.297846999934668, 52.50253868773558 ], [ 13.297843562875373, 52.502526742909119 ], [ 13.297835953808571, 52.502521876180879 ], [ 13.297861416604929, 52.502518673918615 ], [ 13.297869668646145, 52.502506898169074 ], [ 13.297860432912675, 52.502493681276135 ], [ 13.297833159739037, 52.502493288878206 ], [ 13.297830044179795, 52.502473022813348 ], [ 13.297822574394385, 52.502464589475537 ], [ 13.297799243547976, 52.502463064253881 ], [ 13.297785468468257, 52.502466433769392 ], [ 13.297767522843284, 52.502476881400398 ], [ 13.29775528400673, 52.502490978854262 ], [ 13.297750790512707, 52.502506377288505 ], [ 13.297746572624582, 52.502514642462927 ], [ 13.297763645551553, 52.502526782592241 ], [ 13.297773156832843, 52.502532867131464 ], [ 13.297784293332745, 52.502547300917421 ], [ 13.297809664280978, 52.502546476419695 ], [ 13.297832949239323, 52.502549190516312 ], [ 13.297838839746154, 52.502548085730083 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 47, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.297249060164679, 52.50247655676165 ], [ 13.29725712856853, 52.502469536561279 ], [ 13.297272484364425, 52.502475704360279 ], [ 13.297291964768487, 52.502475984731362 ], [ 13.297286763431346, 52.502459257244126 ], [ 13.297273403245821, 52.502451928631274 ], [ 13.297275717504688, 52.502442446537515 ], [ 13.297295015613726, 52.502447481535775 ], [ 13.297310599632665, 52.502447705825581 ], [ 13.297324786783966, 52.502433636457276 ], [ 13.297336567790603, 52.502431426935026 ], [ 13.297352013968132, 52.502435217848415 ], [ 13.297373258761944, 52.502440281749479 ], [ 13.297367691345606, 52.502433064399135 ], [ 13.297366248519729, 52.502419959619772 ], [ 13.297379838399621, 52.502421344738906 ], [ 13.29738336724906, 52.502430910926549 ], [ 13.297397554371791, 52.502416841549241 ], [ 13.297398289407582, 52.502397821324031 ], [ 13.29738112477739, 52.502388057997202 ], [ 13.297366092083006, 52.502373568098847 ], [ 13.297336641079138, 52.502379091931211 ], [ 13.297322775537406, 52.502384840065368 ], [ 13.297305563510077, 52.502376265582896 ], [ 13.297303890971428, 52.502369105184577 ], [ 13.297286404744449, 52.502367663978703 ], [ 13.297261217682829, 52.502363732859727 ], [ 13.297243823355805, 52.502359913894907 ], [ 13.297214326397503, 52.502366626573057 ], [ 13.297202271213912, 52.502375968463561 ], [ 13.297195921254881, 52.502388961082374 ], [ 13.297202840987568, 52.502411660995321 ], [ 13.29721796553839, 52.502423773161397 ], [ 13.297223580384983, 52.502429800764887 ], [ 13.297209621441683, 52.502437926616849 ], [ 13.297219178575498, 52.502442822323616 ], [ 13.297218811018459, 52.502452332435283 ], [ 13.297218489410222, 52.502460653670603 ], [ 13.297216173630719, 52.502470136640547 ], [ 13.29720026799273, 52.502478233573484 ], [ 13.297178516277567, 52.502486247258936 ], [ 13.297185849565073, 52.502498247286368 ], [ 13.29718747613901, 52.502506596562291 ], [ 13.297202738531375, 52.502515143000302 ], [ 13.297211928121422, 52.502529548819162 ], [ 13.297219720881325, 52.502529660980514 ], [ 13.297241333292734, 52.502525213895254 ], [ 13.297251394372077, 52.502517032837844 ], [ 13.297272914878979, 52.50251496349933 ], [ 13.297277362593077, 52.502500753961023 ], [ 13.297264002431444, 52.502493424448403 ], [ 13.297258433519339, 52.502486207970513 ], [ 13.297249060164679, 52.50247655676165 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 48, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299858876655284, 52.502551761753722 ], [ 13.299884339331825, 52.502548559054986 ], [ 13.299884591292471, 52.502542029662024 ], [ 13.29988502745533, 52.502530726784983 ], [ 13.299891101383952, 52.502524867283071 ], [ 13.299895253850815, 52.502519508851961 ], [ 13.299899307010294, 52.502514280265295 ], [ 13.299899719901145, 52.502503580363999 ], [ 13.299896602657816, 52.502495131483386 ], [ 13.299894425814486, 52.502489230738945 ], [ 13.299880973425072, 52.50248428017273 ], [ 13.299855648419284, 52.502483916237395 ], [ 13.299834493593465, 52.502476475002602 ], [ 13.299831011557748, 52.502465720026905 ], [ 13.299809307702725, 52.502472544444871 ], [ 13.299787602333796, 52.502479369736271 ], [ 13.299779673405132, 52.502482824398847 ], [ 13.299763445625091, 52.502499242905472 ], [ 13.299761130390033, 52.502508725929793 ], [ 13.299756593185339, 52.502525313345103 ], [ 13.299771902004988, 52.502532669679397 ], [ 13.299789067228504, 52.502542432664086 ], [ 13.299789767357865, 52.502542769106761 ], [ 13.299804377532126, 52.502549789015426 ], [ 13.299833597489586, 52.502550208935439 ], [ 13.299858876655284, 52.502551761753722 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 49, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.297109580610556, 52.502454328843868 ], [ 13.297088243936388, 52.502451642648069 ], [ 13.297078228795064, 52.502458634815369 ], [ 13.297085468672897, 52.502473012579976 ], [ 13.297078982279052, 52.502489571841643 ], [ 13.297078614656403, 52.502499082851159 ], [ 13.297084044209742, 52.502509865944639 ], [ 13.297101531958322, 52.502511307202042 ], [ 13.297111271431081, 52.502511447391512 ], [ 13.29712523041583, 52.502503321551586 ], [ 13.297129446946316, 52.502495056379061 ], [ 13.297130090231789, 52.5024784130106 ], [ 13.297130503759714, 52.502467714023226 ], [ 13.297121040006422, 52.502460440578112 ], [ 13.297109580610556, 52.502454328843868 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 50, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.296834260614959, 52.502467018215249 ], [ 13.296855827074006, 52.502463760076473 ], [ 13.296879203842076, 52.502464096607852 ], [ 13.296894879778979, 52.502461943200309 ], [ 13.296916492188481, 52.502457496174351 ], [ 13.296909298325783, 52.502441929523776 ], [ 13.296902286790662, 52.502421608245832 ], [ 13.29690251657798, 52.502415663865371 ], [ 13.296903068032483, 52.502401398250825 ], [ 13.296903711401274, 52.502384754884076 ], [ 13.296908343048923, 52.502365789855801 ], [ 13.296883155989237, 52.502361859555229 ], [ 13.296871696686933, 52.502355746899681 ], [ 13.296856342497064, 52.502349578171987 ], [ 13.296821506463319, 52.502343129874937 ], [ 13.296792332649147, 52.502341520336259 ], [ 13.2967857987329, 52.502359268436301 ], [ 13.296777592393003, 52.502369855232295 ], [ 13.296767852953256, 52.502369715015583 ], [ 13.296744568159877, 52.502367000710677 ], [ 13.296738264029637, 52.502378804427778 ], [ 13.29672987382636, 52.502394146724271 ], [ 13.296721621469368, 52.502405923290695 ], [ 13.296705485951637, 52.502419964536507 ], [ 13.296716807394267, 52.502429642937336 ], [ 13.296724093111415, 52.502442831847077 ], [ 13.296747286020024, 52.502447923908349 ], [ 13.296752854843126, 52.502455140409594 ], [ 13.296762254293377, 52.502457863404167 ], [ 13.296762376910815, 52.502457893042269 ], [ 13.296762481579695, 52.502457929614913 ], [ 13.296762802831406, 52.502458004371384 ], [ 13.296770204674823, 52.502460148343694 ], [ 13.296775634113031, 52.502470932349347 ], [ 13.296791173648039, 52.502472345604843 ], [ 13.296820255663915, 52.50247633199789 ], [ 13.296827003258372, 52.502471846316567 ], [ 13.296834260614959, 52.502467018215249 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 51, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298643199292213, 52.502334455716792 ], [ 13.298637584296415, 52.502328427280439 ], [ 13.29861837941006, 52.502321013868404 ], [ 13.298600755420221, 52.50232313948807 ], [ 13.298596721320932, 52.502326650084534 ], [ 13.298581045510371, 52.50232880371879 ], [ 13.298571855510598, 52.502314398002348 ], [ 13.298568464147998, 52.502301265216467 ], [ 13.298542955647271, 52.502305655610982 ], [ 13.298532711166482, 52.502318593188079 ], [ 13.298527988429807, 52.50233993514167 ], [ 13.298519598854647, 52.502355277570537 ], [ 13.298507406205699, 52.502368186227699 ], [ 13.298481805796019, 52.502374955261431 ], [ 13.298471790660392, 52.502383670261842 ], [ 13.298461636763959, 52.50239250644529 ], [ 13.298451023475501, 52.502414954111373 ], [ 13.29845001258321, 52.502422435546123 ], [ 13.298448294756117, 52.502435136102562 ], [ 13.298461701050512, 52.502441275707348 ], [ 13.298496537377892, 52.502447724422652 ], [ 13.29850219831814, 52.502452563089847 ], [ 13.298503687362714, 52.502464479879713 ], [ 13.298511544937067, 52.502474663945264 ], [ 13.29851296772593, 52.502476507825804 ], [ 13.298520778152376, 52.502476620155548 ], [ 13.29852660504859, 52.502476703957768 ], [ 13.298529615325606, 52.502478492445732 ], [ 13.298553281387093, 52.502492550699507 ], [ 13.298576428663598, 52.502498830382585 ], [ 13.298587582392548, 52.502499967235288 ], [ 13.298588884141404, 52.502500100144658 ], [ 13.298590018608943, 52.502500215363227 ], [ 13.298617337708949, 52.502499418709661 ], [ 13.29862712457032, 52.502498369918364 ], [ 13.298635374931623, 52.502486594092453 ], [ 13.298647431317994, 52.502477252074954 ], [ 13.29864807402978, 52.502460608693319 ], [ 13.298656462108763, 52.502445266234261 ], [ 13.298666845751283, 52.502428762934947 ], [ 13.298667304815238, 52.502416875061755 ], [ 13.298668131157312, 52.502395476171024 ], [ 13.29866478567012, 52.502381154510594 ], [ 13.298669003373377, 52.502372889301668 ], [ 13.2986810582485, 52.502363547259066 ], [ 13.298681333704783, 52.502356413995855 ], [ 13.298676144955845, 52.502353426225326 ], [ 13.298662266493727, 52.502345434857844 ], [ 13.298643199292213, 52.502334455716792 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 52, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298961029808625, 52.502381846649897 ], [ 13.298931900308762, 52.502379048739435 ], [ 13.298920073489578, 52.502382447298722 ], [ 13.298906024570361, 52.50239295023092 ], [ 13.298903571481604, 52.50240599897046 ], [ 13.29888938483928, 52.502420068532551 ], [ 13.298881178989904, 52.502430655478506 ], [ 13.298880628175134, 52.502444921107625 ], [ 13.298885967829577, 52.502458081897963 ], [ 13.29891301147987, 52.502464418439686 ], [ 13.298930314192544, 52.502470614915275 ], [ 13.298945668755429, 52.502476782477892 ], [ 13.298959030668717, 52.502484111824081 ], [ 13.298980551086332, 52.502482042174101 ], [ 13.298996318735481, 52.502477510732575 ], [ 13.299004478665486, 52.50246811265589 ], [ 13.299014401740566, 52.502463497179129 ], [ 13.299016808899694, 52.50245163731455 ], [ 13.299021164245284, 52.502439805460483 ], [ 13.29902950776329, 52.502425651872322 ], [ 13.299020363496918, 52.502410057312147 ], [ 13.299012755825519, 52.502405189781115 ], [ 13.29899943979296, 52.502396672462254 ], [ 13.298988027557103, 52.502389371152987 ], [ 13.298961029808625, 52.502381846649897 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 53, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299542676105153, 52.502411618164743 ], [ 13.29951558647163, 52.502406471542727 ], [ 13.299518222926887, 52.50238866727809 ], [ 13.299508894980425, 52.502377827366374 ], [ 13.299481575967333, 52.502378624226672 ], [ 13.299470040082339, 52.502362385721042 ], [ 13.299472353898951, 52.502352902681473 ], [ 13.299453148823815, 52.502345490302346 ], [ 13.299427915681822, 52.502342748520789 ], [ 13.299404538947192, 52.502342412493427 ], [ 13.299379030467076, 52.502346803967356 ], [ 13.299376669302276, 52.502357474962736 ], [ 13.29937996912914, 52.502372985482694 ], [ 13.299368327381218, 52.50237162859775 ], [ 13.299348892893645, 52.502370159691239 ], [ 13.299349259989937, 52.502360649568992 ], [ 13.299357601914933, 52.502346495935342 ], [ 13.299341834383764, 52.502351026527208 ], [ 13.299321986877521, 52.502360257514873 ], [ 13.29929453022911, 52.502364620066125 ], [ 13.299280892935734, 52.502364424022964 ], [ 13.299270786336646, 52.50237379503286 ], [ 13.299272275621883, 52.502385710916293 ], [ 13.299287584311221, 52.502393067312354 ], [ 13.299273673120931, 52.502400004554858 ], [ 13.299282907789321, 52.502413221319927 ], [ 13.299304015159041, 52.502421850610133 ], [ 13.299325397855121, 52.502423347529735 ], [ 13.299340983354485, 52.50242357157326 ], [ 13.29934705733973, 52.502417712099664 ], [ 13.299370663567949, 52.50241210375065 ], [ 13.299378592515206, 52.50240864911563 ], [ 13.299408354276711, 52.502407320946006 ], [ 13.299407616141439, 52.502426329445413 ], [ 13.299381832303927, 52.502437853286622 ], [ 13.299373444477855, 52.502453195799298 ], [ 13.299398356482614, 52.502464258837669 ], [ 13.299411579326495, 52.502475154745106 ], [ 13.299430427191718, 52.502479646146057 ], [ 13.299432824419259, 52.502480217379826 ], [ 13.299450127212932, 52.502486413780012 ], [ 13.299467615037615, 52.502487854688205 ], [ 13.299468427875357, 52.502487752183548 ], [ 13.299493077703643, 52.502484652073605 ], [ 13.299520487083727, 52.502481477434699 ], [ 13.299520991805196, 52.502468400678609 ], [ 13.299548212438179, 52.50246003808882 ], [ 13.299550580231122, 52.502459310566223 ], [ 13.29955683773742, 52.502448695570827 ], [ 13.299570979764871, 52.502435814825937 ], [ 13.299583218008962, 52.502421717179089 ], [ 13.299573923651074, 52.502415770772679 ], [ 13.299568001065287, 52.502411982166713 ], [ 13.299542676105153, 52.502411618164743 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 54, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.300280736274599, 52.503542829294574 ], [ 13.300269919786373, 52.503520073591297 ], [ 13.300249934366484, 52.503532870465222 ], [ 13.300222614646167, 52.503533667490508 ], [ 13.300215142751489, 52.503525234278662 ], [ 13.300203039686897, 52.503531395592923 ], [ 13.300199237270173, 52.503533331614861 ], [ 13.300192831547587, 52.503534154884534 ], [ 13.300337501155242, 52.503565390058228 ], [ 13.300336400444165, 52.503564208085116 ], [ 13.300327078271255, 52.503554200012353 ], [ 13.30029998787713, 52.503549052665562 ], [ 13.300280736274599, 52.503542829294574 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 55, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.300098234226903, 52.503473596680003 ], [ 13.300063305064013, 52.503469527082878 ], [ 13.300061540325522, 52.50346474357773 ], [ 13.300032732596231, 52.503453624707213 ], [ 13.30000410691094, 52.503437750297408 ], [ 13.300000439822934, 52.503431749918811 ], [ 13.299990377528767, 52.503439932088803 ], [ 13.299973275832574, 52.503449055186131 ], [ 13.2999664955985, 52.503452672924581 ], [ 13.29996399688056, 52.503466910563809 ], [ 13.299948533740141, 52.503468775222601 ], [ 13.299946372526126, 52.503469035481565 ], [ 13.299945995587674, 52.503468150724771 ], [ 13.299942797163183, 52.503460658244364 ], [ 13.299954853546613, 52.503451316095045 ], [ 13.299956367295161, 52.503445115930262 ], [ 13.299957168794208, 52.503441833068436 ], [ 13.299930399621582, 52.503428364392079 ], [ 13.299901315242494, 52.503424377836737 ], [ 13.299877937928366, 52.503424041898079 ], [ 13.299859355484537, 52.503422511594799 ], [ 13.299842964419302, 52.503421161135229 ], [ 13.299833131533669, 52.503423398004529 ], [ 13.299819403620535, 52.503425579797209 ], [ 13.299795978953128, 52.503426432698838 ], [ 13.299771021898861, 52.503416558639323 ], [ 13.299734157172278, 52.503416028839943 ], [ 13.299730110505051, 52.503415970682795 ], [ 13.299706503814821, 52.503421578199841 ], [ 13.299677281808929, 52.503421158222423 ], [ 13.29966722838723, 52.503420672067406 ], [ 13.300143339562354, 52.503523468940621 ], [ 13.300139487031698, 52.50351582051082 ], [ 13.300139368274001, 52.503515728892388 ], [ 13.300120556574043, 52.503501274968976 ], [ 13.300111411670272, 52.5034856813893 ], [ 13.300107235655732, 52.503480268919759 ], [ 13.300105843674238, 52.503478464164118 ], [ 13.300098234226903, 52.503473596680003 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 56, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299677260576896, 52.503371200957218 ], [ 13.29967387028247, 52.503358068222965 ], [ 13.29966481736979, 52.503340095956148 ], [ 13.299657437383985, 52.503329284954788 ], [ 13.299636283662359, 52.503321843703588 ], [ 13.299595557377151, 52.503316500212094 ], [ 13.299573898916673, 52.503322136603131 ], [ 13.299548527545854, 52.503322961475597 ], [ 13.29952686907636, 52.503328597857958 ], [ 13.299501176513742, 52.503337743964238 ], [ 13.299499353695619, 52.50333862767426 ], [ 13.299489257699749, 52.503343520333075 ], [ 13.2994695015862, 52.503350372686832 ], [ 13.299468492888259, 52.503350662989995 ], [ 13.299457676017402, 52.503353771318658 ], [ 13.29944037141216, 52.503347574896345 ], [ 13.299424465821042, 52.503355673026583 ], [ 13.29940113444075, 52.503354148116593 ], [ 13.299389903953347, 52.503342092212222 ], [ 13.299376405506132, 52.503338329566375 ], [ 13.299339759267463, 52.50332828648731 ], [ 13.299298802070426, 52.503328887259791 ], [ 13.299264931597611, 52.503333809469083 ], [ 13.29952077121073, 52.503389049826573 ], [ 13.299544986625637, 52.503394278310893 ], [ 13.29954772268942, 52.503394317636868 ], [ 13.299550521735823, 52.503395473677209 ], [ 13.299621709720128, 52.503410844125398 ], [ 13.299625051017921, 52.503410892148324 ], [ 13.299634836587613, 52.503409843254204 ], [ 13.299646709481246, 52.503405256646943 ], [ 13.299664379742834, 52.503401941997474 ], [ 13.299665630157659, 52.503399168198001 ], [ 13.299668643280588, 52.503392486977305 ], [ 13.299676618232681, 52.503387844345184 ], [ 13.299676920902051, 52.503380002066315 ], [ 13.299677260576896, 52.503371200957218 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 57, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.300547665914642, 52.503274277988858 ], [ 13.300477198925744, 52.503259082994781 ], [ 13.300477071587624, 52.5032592519985 ], [ 13.300461302366775, 52.503263782715976 ], [ 13.300458666231757, 52.503281587001865 ], [ 13.300458482779911, 52.503286342514329 ], [ 13.300465817093684, 52.503298342345545 ], [ 13.30047718545447, 52.503306831515872 ], [ 13.300478104171676, 52.503306925634433 ], [ 13.300480640359947, 52.503312566288137 ], [ 13.300480273495197, 52.50332207641447 ], [ 13.300471885874504, 52.503337419004616 ], [ 13.300473650652902, 52.503342202504086 ], [ 13.300475322268543, 52.503349362839934 ], [ 13.300487195094849, 52.50334477524877 ], [ 13.300500968778616, 52.503341405398601 ], [ 13.300508004635279, 52.503340288160523 ], [ 13.300547665914642, 52.503274277988858 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 58, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299026001537365, 52.503276197929083 ], [ 13.299041907171517, 52.503268099852711 ], [ 13.299073077290807, 52.503268547996228 ], [ 13.299100626324533, 52.503261807747364 ], [ 13.299100851847712, 52.503260202462137 ], [ 13.299102826353641, 52.503246230635348 ], [ 13.299103307433196, 52.503242814597883 ], [ 13.299101957341021, 52.503227332103421 ], [ 13.299071108517758, 52.503218562725465 ], [ 13.29903817381628, 52.503213331062177 ], [ 13.299016515337867, 52.503218967351096 ], [ 13.298995012436151, 52.503221108291932 ], [ 13.298985207581447, 52.503222084926001 ], [ 13.298982982937124, 52.503231200598101 ], [ 13.29898057820018, 52.503241050060957 ], [ 13.298978262789003, 52.503250532168437 ], [ 13.298948857293023, 52.50325486752088 ], [ 13.298933087886564, 52.503259398931938 ], [ 13.298933767094201, 52.503260353674129 ], [ 13.298969007064139, 52.503269913613153 ], [ 13.299027039127512, 52.503282448251831 ], [ 13.299026001537365, 52.503276197929083 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 59, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.300285762863499, 52.503256153871064 ], [ 13.300296053110262, 52.503246872628971 ], [ 13.300315488019011, 52.503248341383184 ], [ 13.300333022043082, 52.503248593288063 ], [ 13.30032777359725, 52.50323305480417 ], [ 13.300296832818974, 52.503226662601236 ], [ 13.30027956057099, 52.503222871915398 ], [ 13.300274834670743, 52.50321941523142 ], [ 13.300276801218585, 52.503215874873916 ], [ 13.300268748790081, 52.503214126380456 ], [ 13.300280474191734, 52.503201711642468 ], [ 13.300277219859513, 52.503185012268524 ], [ 13.300283752503598, 52.503167263967114 ], [ 13.300284394613405, 52.503150620573351 ], [ 13.300284990820517, 52.503135166956156 ], [ 13.300285311892228, 52.503126844809913 ], [ 13.30026475289937, 52.503103950032425 ], [ 13.300259230792907, 52.503095543936155 ], [ 13.300232048950374, 52.503092774331911 ], [ 13.300218411425007, 52.503092578394885 ], [ 13.300179083051395, 52.50310152963231 ], [ 13.300161137758318, 52.503111976729315 ], [ 13.300147821290274, 52.503103459537016 ], [ 13.300124168947953, 52.503110256017521 ], [ 13.300111838935299, 52.503126731474445 ], [ 13.300115047328957, 52.503144619730527 ], [ 13.300127949519938, 52.503163835908154 ], [ 13.300140989301433, 52.50317948634919 ], [ 13.300154351627119, 52.503186815563041 ], [ 13.30016325756813, 52.503191378887628 ], [ 13.300163347203778, 52.503191423333313 ], [ 13.300163909254149, 52.50319171103547 ], [ 13.30016935501326, 52.503196367603856 ], [ 13.30016912888459, 52.503202228421699 ], [ 13.300160878792486, 52.503214004355527 ], [ 13.300141122804687, 52.503220857721601 ], [ 13.300136950873778, 52.503225077594159 ], [ 13.300122087892941, 52.503231552599452 ], [ 13.300109314838263, 52.503234459349834 ], [ 13.300103511759183, 52.503235779496215 ], [ 13.300105930935546, 52.503238914425197 ], [ 13.300116505680506, 52.503252618817818 ], [ 13.30012978277972, 52.503251656015436 ], [ 13.300143871099179, 52.503250632937601 ], [ 13.30016516248722, 52.503254507464703 ], [ 13.300167346822031, 52.503255442465743 ], [ 13.30016917792415, 52.503257207674814 ], [ 13.300174821722688, 52.503258641042365 ], [ 13.3001939257241, 52.503266815201663 ], [ 13.300199678661006, 52.503269276932187 ], [ 13.300205159301134, 52.503273488035965 ], [ 13.300207086020672, 52.503285109882789 ], [ 13.300241921841749, 52.503291557171316 ], [ 13.300263488433291, 52.503288299311713 ], [ 13.300267034854, 52.503284214307293 ], [ 13.300277236330677, 52.503279907526682 ], [ 13.300277536846481, 52.503272118264007 ], [ 13.300279808096045, 52.503269502084805 ], [ 13.300281302407939, 52.503260176292422 ], [ 13.300285762863499, 52.503256153871064 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 60, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298816268159539, 52.50319017901429 ], [ 13.298808437446938, 52.503186238854525 ], [ 13.298805550824005, 52.503187542431604 ], [ 13.298790582141669, 52.503194307965046 ], [ 13.298772452852546, 52.503209510356562 ], [ 13.298756310536515, 52.503212213863243 ], [ 13.298838535479518, 52.503234521071398 ], [ 13.298859290699195, 52.503232168904006 ], [ 13.298875427313149, 52.503218127384152 ], [ 13.298862111065317, 52.503209610049119 ], [ 13.298835204652773, 52.503199707759919 ], [ 13.298816268159539, 52.50319017901429 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 61, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298712639087279, 52.503143229281221 ], [ 13.298699690140277, 52.503125201810342 ], [ 13.298682387205814, 52.503119005299766 ], [ 13.298662952414579, 52.503117536278204 ], [ 13.298654700466047, 52.50312931208272 ], [ 13.298642873423383, 52.503132710611993 ], [ 13.298618008622697, 52.50312045855825 ], [ 13.298600750142084, 52.503113073137683 ], [ 13.298593280102297, 52.503104639847251 ], [ 13.298585119964198, 52.503114037892821 ], [ 13.298555898179233, 52.50311361764021 ], [ 13.298555194399452, 52.503114329513018 ], [ 13.298547783911051, 52.503121827704732 ], [ 13.298543208334486, 52.503122990099726 ], [ 13.298530067802094, 52.503126330166161 ], [ 13.298516431750972, 52.503126134054092 ], [ 13.298493238240018, 52.503121043234074 ], [ 13.298483634900933, 52.503117336505277 ], [ 13.298448707687029, 52.503113265557424 ], [ 13.298411784872556, 52.503110355434103 ], [ 13.298409364283774, 52.503118094420884 ], [ 13.298747545756076, 52.503209836426983 ], [ 13.298737569973829, 52.503204250594933 ], [ 13.298726157541129, 52.503196950158568 ], [ 13.298710710975698, 52.503193159421762 ], [ 13.298685661041739, 52.50318566197037 ], [ 13.298701520759456, 52.503178753715567 ], [ 13.298703719631215, 52.503162485169149 ], [ 13.298704249416751, 52.503158571720391 ], [ 13.298707567524724, 52.503152504513039 ], [ 13.298712639087279, 52.503143229281221 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 62, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299553161897341, 52.503202892031361 ], [ 13.299566981527066, 52.50319833251384 ], [ 13.299586463746348, 52.503198612531037 ], [ 13.299603766841997, 52.503204808910588 ], [ 13.299629596961168, 52.50319209614814 ], [ 13.299651255350412, 52.503186459746146 ], [ 13.299670965478288, 52.503180796238652 ], [ 13.299669797251454, 52.503160558217076 ], [ 13.29965847415373, 52.503141051789363 ], [ 13.29965517646488, 52.503135369602546 ], [ 13.299636429868995, 52.503116068474512 ], [ 13.299621486481279, 52.503099201079621 ], [ 13.299627593700899, 52.503085037787713 ], [ 13.299630412629483, 52.503078501232537 ], [ 13.299632691299175, 52.503076953327984 ], [ 13.299634304174287, 52.503075858901568 ], [ 13.299634854757624, 52.50306159326842 ], [ 13.299629560694587, 52.503047243633013 ], [ 13.29960655063358, 52.503037397519861 ], [ 13.299587666441802, 52.503021663017236 ], [ 13.299545357815676, 52.503006781365578 ], [ 13.299525601862806, 52.503013633730447 ], [ 13.299513042215331, 52.503036053511522 ], [ 13.299512583369259, 52.503047941388687 ], [ 13.299506612074726, 52.503049764393992 ], [ 13.299493752797648, 52.503047003577677 ], [ 13.299482875557441, 52.503054388159434 ], [ 13.299483741214509, 52.50305673472046 ], [ 13.299479052217434, 52.503058164358379 ], [ 13.299479487396781, 52.503059677540435 ], [ 13.299484208565829, 52.503076080632759 ], [ 13.299497110426005, 52.503095297775516 ], [ 13.299502245116942, 52.503102819898395 ], [ 13.299504141945443, 52.503109408947999 ], [ 13.299519820819727, 52.503108899726733 ], [ 13.299529513159113, 52.503108584982641 ], [ 13.299523347324786, 52.503116822219489 ], [ 13.299516787852165, 52.503124378558105 ], [ 13.299502948914778, 52.503140317967201 ], [ 13.299498318292734, 52.503159283103471 ], [ 13.299505422880801, 52.503177227379787 ], [ 13.299518233037215, 52.503198821376706 ], [ 13.299517865931598, 52.503208332397101 ], [ 13.299541105464129, 52.503212235038596 ], [ 13.299553161897341, 52.503202892031361 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 63, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.300021028402577, 52.503201289965531 ], [ 13.300034543982052, 52.503193420856043 ], [ 13.300035196334608, 52.503193430229757 ], [ 13.30003642296581, 52.503191348407874 ], [ 13.300045231297029, 52.503180226971807 ], [ 13.300045856405251, 52.503176894820477 ], [ 13.3000545753459, 52.503167937182532 ], [ 13.300061806139315, 52.50316050734645 ], [ 13.300071866882824, 52.503152325148214 ], [ 13.300079843256224, 52.503147681610514 ], [ 13.300109202668688, 52.503144535751865 ], [ 13.300109661355418, 52.503132647871226 ], [ 13.300090180632571, 52.50313236796157 ], [ 13.300082800610122, 52.503121556087144 ], [ 13.300065635063111, 52.503111794042162 ], [ 13.30005241036107, 52.503100899083471 ], [ 13.300045169412302, 52.503086521492833 ], [ 13.300064787734168, 52.503083234775993 ], [ 13.300057224232184, 52.50307717841163 ], [ 13.300034076436019, 52.503070899014489 ], [ 13.3000247940954, 52.503058870264475 ], [ 13.299989958490738, 52.503052422913669 ], [ 13.299966810752096, 52.503046142604887 ], [ 13.299941714770139, 52.503039835194592 ], [ 13.29994203590557, 52.503031513049699 ], [ 13.29995956836739, 52.503031764988037 ], [ 13.299988790119356, 52.503032184893591 ], [ 13.30000659779561, 52.503025304456301 ], [ 13.300005291792827, 52.503008633069925 ], [ 13.300003756417139, 52.50299790607292 ], [ 13.29999447557233, 52.502985877341779 ], [ 13.300004673876989, 52.50297412941373 ], [ 13.300007126675625, 52.502961080650053 ], [ 13.30000531608772, 52.502957486021771 ], [ 13.299988058871033, 52.502950101721758 ], [ 13.299978823880972, 52.502936885010158 ], [ 13.299970862773989, 52.50293242785748 ], [ 13.299963559325091, 52.502928338903956 ], [ 13.29994630212685, 52.502920954597954 ], [ 13.299919395674497, 52.502911051655715 ], [ 13.299897966841987, 52.502910743719255 ], [ 13.299880434428911, 52.502910491772205 ], [ 13.299876943091334, 52.502911965610238 ], [ 13.29985863856886, 52.502919694851194 ], [ 13.299838789472155, 52.502928925003665 ], [ 13.299809431623823, 52.50293207171616 ], [ 13.299795610630143, 52.502936631241944 ], [ 13.299787175530154, 52.502953161741111 ], [ 13.299776472483673, 52.502977987305322 ], [ 13.299785569779104, 52.50299477066546 ], [ 13.299803195457761, 52.502992644892508 ], [ 13.299816556232546, 52.502999973223965 ], [ 13.299831453783279, 52.503018029472599 ], [ 13.299844631054045, 52.503030113312121 ], [ 13.299862163514391, 52.503030365264848 ], [ 13.299901080460591, 52.50303211405425 ], [ 13.299914395351815, 52.503040632151354 ], [ 13.299917557817199, 52.503059708391447 ], [ 13.299915196705781, 52.503070380295739 ], [ 13.299893584319117, 52.503074826970497 ], [ 13.299891085601857, 52.50308906460905 ], [ 13.299892345685143, 52.503106924873926 ], [ 13.299927273037127, 52.503110995396646 ], [ 13.299946571715479, 52.503116030865527 ], [ 13.299960207773591, 52.503116226812779 ], [ 13.29995789258003, 52.503125708941468 ], [ 13.299949732726891, 52.503135107083565 ], [ 13.299971163141629, 52.50313541503273 ], [ 13.299975425079468, 52.50312596087776 ], [ 13.299990643864623, 52.503135694961983 ], [ 13.299992179241157, 52.503146421958903 ], [ 13.299987646316145, 52.503153505734069 ], [ 13.299987374289158, 52.503153453272652 ], [ 13.299985584455635, 52.50315672822672 ], [ 13.299983881729995, 52.503159387635506 ], [ 13.299982876392415, 52.503160545643048 ], [ 13.299976412266465, 52.503162578278406 ], [ 13.299961920916269, 52.503167135384018 ], [ 13.299953485797667, 52.503183666793198 ], [ 13.299986874620533, 52.503189847005387 ], [ 13.29998832297265, 52.503190114176618 ], [ 13.300007620220097, 52.503195149614669 ], [ 13.300021028402577, 52.503201289965531 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 64, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298343260571837, 52.503067738732021 ], [ 13.298310280153203, 52.503063695744487 ], [ 13.298305716377858, 52.503064552598779 ], [ 13.298286719364947, 52.503068115000403 ], [ 13.298265106787129, 52.503072562274873 ], [ 13.298261009893841, 52.503077848620315 ], [ 13.298367097776246, 52.503106631410681 ], [ 13.298367254310698, 52.503102578625601 ], [ 13.298356437445189, 52.503079822733866 ], [ 13.298352279492166, 52.503076009097732 ], [ 13.298343260571837, 52.503067738732021 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 65, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.300378620013797, 52.503021444387876 ], [ 13.30036550588332, 52.503018566716079 ], [ 13.30036527659278, 52.503024510208043 ], [ 13.300362871233821, 52.503036370122892 ], [ 13.300346826853746, 52.503048034993071 ], [ 13.300332640456993, 52.503062104728905 ], [ 13.300299201213145, 52.503069950176389 ], [ 13.300306535448623, 52.503081950017233 ], [ 13.30033715362787, 52.503096663443678 ], [ 13.300339077537721, 52.503100033116141 ], [ 13.300378620013797, 52.503021444387876 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 66, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.29976971029496, 52.503001679067822 ], [ 13.299762192694306, 52.502994434705855 ], [ 13.299729351310177, 52.502986825501203 ], [ 13.299706111878548, 52.502982922897388 ], [ 13.299705974230243, 52.502986489530521 ], [ 13.299707509533036, 52.502997216530773 ], [ 13.299699579031504, 52.503000671165658 ], [ 13.299684407713391, 52.502989748188213 ], [ 13.299664558548953, 52.502998978310721 ], [ 13.299658118923475, 52.503014348842306 ], [ 13.299655620134105, 52.503028586475374 ], [ 13.299645649639281, 52.503034390861529 ], [ 13.299657017773278, 52.503042880109142 ], [ 13.299672097334886, 52.503056180845455 ], [ 13.299677253761764, 52.503074097112084 ], [ 13.299706246122959, 52.503080461476053 ], [ 13.299723686837202, 52.503083091204893 ], [ 13.299733931153472, 52.503070153524817 ], [ 13.299765146990577, 52.503069413505784 ], [ 13.299778968029331, 52.503064853984029 ], [ 13.299798632240764, 52.503060378433673 ], [ 13.299789212290431, 52.503051917197588 ], [ 13.29979143578954, 52.503044811929264 ], [ 13.299795882750821, 52.503030602291027 ], [ 13.299807663799474, 52.503028392523191 ], [ 13.299798197973749, 52.503021120165627 ], [ 13.299790588638697, 52.503016252662334 ], [ 13.299769343280909, 52.503011189191142 ], [ 13.29976971029496, 52.503001679067822 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 67, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298691109622755, 52.502166819313963 ], [ 13.298673852937405, 52.502159434825792 ], [ 13.29866184402719, 52.502167587991174 ], [ 13.298665189498784, 52.502181909652066 ], [ 13.29866078817531, 52.502194930370166 ], [ 13.298656432758943, 52.502206762210832 ], [ 13.298675775330333, 52.502210608984754 ], [ 13.298691634695082, 52.5022037007272 ], [ 13.2987016510318, 52.50219670754295 ], [ 13.298707908702882, 52.502186092593398 ], [ 13.298706419575968, 52.502174176703825 ], [ 13.298691109622755, 52.502166819313963 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 68, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299507060257131, 52.50216070819063 ], [ 13.299477884977868, 52.502159099293202 ], [ 13.299417037052709, 52.502170120026484 ], [ 13.299455171716261, 52.502192078058727 ], [ 13.299499150918182, 52.502214120985599 ], [ 13.299501190870556, 52.502211771232737 ], [ 13.299502246201675, 52.502184428841922 ], [ 13.299506739049651, 52.502169030334869 ], [ 13.299507060257131, 52.50216070819063 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 69, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299976412266458, 52.503162578278406 ], [ 13.299627593700892, 52.503085037787727 ], [ 13.299621486481277, 52.503099201079621 ], [ 13.299636429868992, 52.503116068474512 ], [ 13.299655176464876, 52.503135369602568 ], [ 13.299658474153729, 52.503141051789363 ], [ 13.299974123022658, 52.503211213003077 ], [ 13.299986874620526, 52.503189847005395 ], [ 13.299953485797666, 52.503183666793177 ], [ 13.299961920916266, 52.503167135384018 ], [ 13.299976412266458, 52.503162578278406 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 70, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298831580669232, 52.503140243524662 ], [ 13.298858276618178, 52.503095114778006 ], [ 13.298907970899561, 52.503106036147095 ], [ 13.298919155054117, 52.503087194933741 ], [ 13.298869460790998, 52.503076273569448 ], [ 13.298942092735466, 52.50295317896272 ], [ 13.298991494257859, 52.502964008873654 ], [ 13.299002678304745, 52.502945168549971 ], [ 13.29895327830776, 52.502934337766376 ], [ 13.298954472906154, 52.502932094552094 ], [ 13.298620965754719, 52.502858766913484 ], [ 13.298602293038607, 52.502854736005332 ], [ 13.298602232993044, 52.502854726600169 ], [ 13.298579020376488, 52.502853720228785 ], [ 13.298555781087151, 52.502849818299012 ], [ 13.29854158029787, 52.5028416429085 ], [ 13.298536596754273, 52.502840570064798 ], [ 13.298003145486824, 52.502725523805729 ], [ 13.298002615077976, 52.502725409179668 ], [ 13.297979253797143, 52.502764980591948 ], [ 13.297978823667597, 52.502765702692116 ], [ 13.297906428081548, 52.502888300213996 ], [ 13.298166510853884, 52.502945457665867 ], [ 13.298130014688574, 52.503011185312438 ], [ 13.298128027863145, 52.503014750519036 ], [ 13.298201578125822, 52.503035650341154 ], [ 13.298205318352514, 52.503029298803334 ], [ 13.298219224799764, 52.503005634365771 ], [ 13.298831580669232, 52.503140243524662 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 71, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.300502805748911, 52.502967713976041 ], [ 13.300360869224312, 52.502047985278281 ], [ 13.300360432799868, 52.502041920730491 ], [ 13.299921958137714, 52.502035141343576 ], [ 13.29960117458762, 52.502030175132525 ], [ 13.29921919797096, 52.502024260013194 ], [ 13.298833060263386, 52.502018279329903 ], [ 13.298454087749029, 52.502012408531776 ], [ 13.298071771403173, 52.502006483919182 ], [ 13.297687707321041, 52.502000532022613 ], [ 13.297303850998821, 52.50199458186831 ], [ 13.297027663568368, 52.501990299060296 ], [ 13.296548084496949, 52.501982874106361 ], [ 13.296450508254479, 52.502147685197535 ], [ 13.296596601692176, 52.502179788875111 ], [ 13.296627590109038, 52.502126152892117 ], [ 13.296630853793983, 52.502126719575003 ], [ 13.296646289015674, 52.50210083581716 ], [ 13.296642672724555, 52.502100052764312 ], [ 13.296655310029509, 52.502078170272313 ], [ 13.296636626085288, 52.502073794974692 ], [ 13.29664556856868, 52.502057581295048 ], [ 13.296725696817084, 52.502059000187863 ], [ 13.29672587197992, 52.502063044260993 ], [ 13.296764625581456, 52.502063772132999 ], [ 13.29676431773416, 52.502059691983128 ], [ 13.296875530168194, 52.502061663483481 ], [ 13.296875115688689, 52.502065868102662 ], [ 13.296920435570076, 52.502066722819748 ], [ 13.296920850309567, 52.502062473248088 ], [ 13.297022122726345, 52.502064273645047 ], [ 13.297021713456592, 52.502069754193016 ], [ 13.297020521011602, 52.502085585842558 ], [ 13.297059646979445, 52.50208582895668 ], [ 13.297058325270497, 52.502110799214705 ], [ 13.297130540579341, 52.502111026782707 ], [ 13.297130109722673, 52.502135325632516 ], [ 13.297292247885512, 52.502136908539022 ], [ 13.297297556271621, 52.50213512016159 ], [ 13.297299400581682, 52.502093955254715 ], [ 13.297399797387135, 52.502094701542966 ], [ 13.297399377388357, 52.502101566584578 ], [ 13.297445080209908, 52.50210250213761 ], [ 13.297445561759565, 52.502109180548665 ], [ 13.29748843751249, 52.502109955816998 ], [ 13.297488206643045, 52.502103386210848 ], [ 13.297536502057916, 52.502104373423833 ], [ 13.29754478072979, 52.50209797122902 ], [ 13.29757474543846, 52.502098441088499 ], [ 13.297588541630287, 52.502110575452285 ], [ 13.29758601761964, 52.502178336482629 ], [ 13.297543847949534, 52.502246678781113 ], [ 13.297522071869373, 52.502252162949922 ], [ 13.297497001329285, 52.502247124041794 ], [ 13.297491050530567, 52.502239342825483 ], [ 13.297449471609243, 52.502230474348288 ], [ 13.297452427392656, 52.502225054722594 ], [ 13.297409050398512, 52.502216315902885 ], [ 13.297406112584849, 52.502221232278139 ], [ 13.297365297588033, 52.502212536606983 ], [ 13.297361150311479, 52.502217791626904 ], [ 13.297265656240302, 52.502197306427327 ], [ 13.297198311381775, 52.502311985733719 ], [ 13.297556234233976, 52.502390624734346 ], [ 13.297917229390791, 52.50246993622973 ], [ 13.298281359511591, 52.502549939075223 ], [ 13.298636050152101, 52.502627865637535 ], [ 13.298995256896204, 52.502706773163744 ], [ 13.299353627343379, 52.502785507525125 ], [ 13.29972167252933, 52.50286636149842 ], [ 13.300007723172223, 52.50292920279395 ], [ 13.300394959839801, 52.503014265875777 ], [ 13.300502805748911, 52.502967713976041 ] ], [ [ 13.300210714110994, 52.502838899503075 ], [ 13.300210710649715, 52.502838034498943 ], [ 13.300210640818882, 52.502837171238596 ], [ 13.300210439548204, 52.502836315980097 ], [ 13.300210171769315, 52.502835466059892 ], [ 13.300209773572416, 52.502834635844799 ], [ 13.300209313007667, 52.502833818220417 ], [ 13.300208730478939, 52.502833030312921 ], [ 13.300208086881561, 52.502832259510456 ], [ 13.300207326759825, 52.502831530191592 ], [ 13.300206514266158, 52.502830821699156 ], [ 13.300205595209343, 52.502830163824676 ], [ 13.30020462651774, 52.502829532210718 ], [ 13.300203565676645, 52.502828959513813 ], [ 13.300202460952333, 52.502828416756579 ], [ 13.300201279999435, 52.502827940338115 ], [ 13.300200062352777, 52.502827498458196 ], [ 13.300198781591908, 52.50282712670198 ], [ 13.300197475813851, 52.502826792349417 ], [ 13.300196122877118, 52.50282653464366 ], [ 13.300194750744074, 52.502826316223427 ], [ 13.300193353471533, 52.502826176564611 ], [ 13.30019194583809, 52.502826076318243 ], [ 13.300190529124656, 52.502826058660524 ], [ 13.300189112392955, 52.502826079664757 ], [ 13.30018770575928, 52.502826182634017 ], [ 13.300186309380667, 52.502826325311965 ], [ 13.300184939436981, 52.502826546593205 ], [ 13.300183588583705, 52.5028268077101 ], [ 13.30018228197488, 52.502827144089693 ], [ 13.300181004833767, 52.502827518655764 ], [ 13.300179789815909, 52.502827963346682 ], [ 13.300178610294703, 52.502828442714204 ], [ 13.30017751077558, 52.502828987068767 ], [ 13.300176451309474, 52.502829562568934 ], [ 13.300175486883175, 52.502830195180103 ], [ 13.300174571449329, 52.50283085636795 ], [ 13.300173763182524, 52.502831565849867 ], [ 13.300173007096001, 52.502832297660383 ], [ 13.300172368831207, 52.502833068926819 ], [ 13.300171790282912, 52.502833858134593 ], [ 13.300171334355403, 52.502834676976924 ], [ 13.300170942770105, 52.50283550843227 ], [ 13.300170680146671, 52.502836357924721 ], [ 13.300170482073474, 52.502837214638497 ], [ 13.300170417830527, 52.502838077770733 ], [ 13.300074383756723, 52.502816704161191 ], [ 13.299987392525734, 52.502799056898994 ], [ 13.299990419914502, 52.502796089244839 ], [ 13.299993070762806, 52.502792990302943 ], [ 13.299995526471422, 52.502789831912303 ], [ 13.299997583948892, 52.502786569795099 ], [ 13.29999833714475, 52.502785225642711 ], [ 13.299994135087083, 52.502784461249625 ], [ 13.299984579004491, 52.502779566683813 ], [ 13.299984762504122, 52.502774811172159 ], [ 13.299998844644747, 52.502766613037778 ], [ 13.299998273164201, 52.502766149870688 ], [ 13.299997291780922, 52.502765427261373 ], [ 13.299996205029613, 52.502764762479956 ], [ 13.29999507138055, 52.502764129392972 ], [ 13.299993845339133, 52.502763561513312 ], [ 13.299992578082156, 52.502763030804473 ], [ 13.299991235860901, 52.502762571847235 ], [ 13.299989859717558, 52.50276215196385 ], [ 13.299988427475858, 52.502761811296139 ], [ 13.299986968605522, 52.502761511605286 ], [ 13.299985472641451, 52.502761294999694 ], [ 13.299983961759946, 52.502761121337521 ], [ 13.299982428441002, 52.502761032769399 ], [ 13.29998089342296, 52.502760988233788 ], [ 13.299979356583375, 52.502761029088475 ], [ 13.299977825407542, 52.502761114081466 ], [ 13.299976312991355, 52.502761285659631 ], [ 13.299974813705731, 52.502761498786008 ], [ 13.299973353934387, 52.502761795199305 ], [ 13.299971350865439, 52.5027623490463 ], [ 13.299969440720641, 52.502763014820403 ], [ 13.299967584452759, 52.502763735315952 ], [ 13.299965846489348, 52.502764559112173 ], [ 13.29996417295353, 52.502765431487575 ], [ 13.299962641768696, 52.502766394921494 ], [ 13.299961185527408, 52.502767401690996 ], [ 13.299959892703798, 52.502768488133171 ], [ 13.299958683971216, 52.502769609950285 ], [ 13.299957652498904, 52.502770796353964 ], [ 13.299956714230408, 52.502772011070533 ], [ 13.299955967134149, 52.502773273490327 ], [ 13.299955317971474, 52.502774556198908 ], [ 13.299954869440572, 52.502775870562402 ], [ 13.299954520627969, 52.502777197148276 ], [ 13.299954379065598, 52.502778536602627 ], [ 13.299954340513446, 52.502779879335449 ], [ 13.299954508397843, 52.502781217841765 ], [ 13.299892746476276, 52.502767261593405 ], [ 13.299878609300066, 52.502747371281956 ], [ 13.299925902765354, 52.502662812428149 ], [ 13.29991953597345, 52.502659613574295 ], [ 13.299925986861275, 52.502645665599836 ], [ 13.299954872948383, 52.502640650000593 ], [ 13.299982951506463, 52.502647054215501 ], [ 13.2999821723037, 52.502650943405811 ], [ 13.300133302199924, 52.50268447992439 ], [ 13.300151933121141, 52.502685624261012 ], [ 13.300152045035865, 52.502685625869027 ], [ 13.300153509085852, 52.502683156339515 ], [ 13.300182492944032, 52.502688934239131 ], [ 13.300297193870735, 52.502683247166615 ], [ 13.300306436555857, 52.502753628279166 ], [ 13.300296242168926, 52.502754050061952 ], [ 13.300300800541381, 52.502782891020054 ], [ 13.300310242501716, 52.502782648141377 ], [ 13.300319902220499, 52.502856274775873 ], [ 13.300297356020179, 52.502866331210448 ], [ 13.300206275600202, 52.502846058370984 ], [ 13.300207136047101, 52.502845371217482 ], [ 13.300207890660712, 52.502844639385572 ], [ 13.30020858425855, 52.502843885098116 ], [ 13.300209161368453, 52.50284309497038 ], [ 13.300209675712656, 52.50284228955492 ], [ 13.300210067262594, 52.502841458998049 ], [ 13.300210391455821, 52.502840617583104 ], [ 13.300210585110552, 52.502839760805792 ], [ 13.300210714110994, 52.502838899503075 ] ], [ [ 13.299753057331539, 52.502717955865698 ], [ 13.299735340032397, 52.502722458489174 ], [ 13.299717913720251, 52.502722208042421 ], [ 13.299713799654169, 52.50273199159404 ], [ 13.29972097002144, 52.502741283662708 ], [ 13.29970895966896, 52.502749436912765 ], [ 13.299697317776248, 52.502748080957971 ], [ 13.299684047425087, 52.502738373938278 ], [ 13.299662893945612, 52.502730933592119 ], [ 13.299649303892695, 52.502729548733882 ], [ 13.299643734593028, 52.502722331466373 ], [ 13.299628288111426, 52.502718540849841 ], [ 13.2995992041938, 52.502714555122552 ], [ 13.299583803604495, 52.502709575622561 ], [ 13.299576194346471, 52.502704708105888 ], [ 13.299552725645162, 52.502706749861538 ], [ 13.299535193316377, 52.502706497864025 ], [ 13.299507919987295, 52.502706105850947 ], [ 13.299507247772681, 52.502700007340707 ], [ 13.299496648323824, 52.502690348580416 ], [ 13.2995071618497, 52.502686468039293 ], [ 13.299516606600452, 52.502671837528297 ], [ 13.29952447445366, 52.502673440460626 ], [ 13.299563826997153, 52.502603274028033 ], [ 13.299575821864071, 52.502602354898457 ], [ 13.299615098852222, 52.502538532460598 ], [ 13.299602023360496, 52.5025383616127 ], [ 13.29951349157348, 52.502518122166492 ], [ 13.29952115585756, 52.502505301169478 ], [ 13.299473756229899, 52.502494835624049 ], [ 13.299476858323724, 52.502489551122316 ], [ 13.29946842787535, 52.502487752183534 ], [ 13.299467615037614, 52.502487854688212 ], [ 13.299450127212927, 52.502486413780005 ], [ 13.299432824419256, 52.502480217379812 ], [ 13.299430427191716, 52.50247964614605 ], [ 13.299216263820995, 52.502433959051103 ], [ 13.29921383761817, 52.502437420853965 ], [ 13.299160306749442, 52.502425599277338 ], [ 13.299192165094489, 52.502371335873271 ], [ 13.299196233848011, 52.502319180601326 ], [ 13.299254333117412, 52.502320554413132 ], [ 13.299254711630979, 52.502325138179629 ], [ 13.299525210179052, 52.502331889305964 ], [ 13.299525998031694, 52.502326975244522 ], [ 13.299580108033128, 52.502328257389699 ], [ 13.299579119849284, 52.502342255989483 ], [ 13.299573923651073, 52.502415770772672 ], [ 13.299583218008962, 52.502421717179089 ], [ 13.299570979764864, 52.502435814825951 ], [ 13.299556837737416, 52.50244869557082 ], [ 13.29955058023112, 52.502459310566216 ], [ 13.299548212438173, 52.502460038088827 ], [ 13.299526032178603, 52.502497146099266 ], [ 13.299607769232981, 52.502516189151301 ], [ 13.299622745847337, 52.502516194910896 ], [ 13.299626732438451, 52.502472989198104 ], [ 13.299638023474417, 52.502463620795695 ], [ 13.299638445578001, 52.502454249029142 ], [ 13.29971189943145, 52.502454505406163 ], [ 13.299722817416555, 52.502443769465813 ], [ 13.299793625156662, 52.502445169207796 ], [ 13.299801833893415, 52.502452255365689 ], [ 13.299898967908346, 52.502452316958475 ], [ 13.299896602657814, 52.502495131483393 ], [ 13.29989971990114, 52.502503580363999 ], [ 13.299899307010291, 52.502514280265309 ], [ 13.299895253850812, 52.502519508851954 ], [ 13.299894001453383, 52.502542151403063 ], [ 13.299884591292468, 52.502542029662017 ], [ 13.299884339331822, 52.502548559054972 ], [ 13.29985887665528, 52.502551761753722 ], [ 13.299833597489577, 52.502550208935446 ], [ 13.299804377532121, 52.502549789015426 ], [ 13.29978976735786, 52.502542769106761 ], [ 13.29978998170345, 52.502567223785107 ], [ 13.29975368017549, 52.502628933848193 ], [ 13.299761922549093, 52.502631445763818 ], [ 13.299753956186873, 52.502645490633952 ], [ 13.299757573252403, 52.502651410280833 ], [ 13.299757114478659, 52.502663298160293 ], [ 13.299764402619862, 52.502676486911483 ], [ 13.299759772163432, 52.502695452060784 ], [ 13.299759221627806, 52.502709717695737 ], [ 13.299753057331539, 52.502717955865698 ] ], [ [ 13.300133422851482, 52.502575574723529 ], [ 13.300036642234746, 52.502553822611887 ], [ 13.300032493589326, 52.502559311475281 ], [ 13.299983093635396, 52.502544436874246 ], [ 13.299977247621873, 52.502492765797825 ], [ 13.299971261604636, 52.502439988588087 ], [ 13.299985185377038, 52.502429018886929 ], [ 13.30001816881585, 52.502427438349891 ], [ 13.300019639913392, 52.50243360677937 ], [ 13.30005372973206, 52.502431876692 ], [ 13.300054475823426, 52.502436597008789 ], [ 13.300200280496968, 52.502428425825642 ], [ 13.300201062624927, 52.502424383825378 ], [ 13.300238157016194, 52.502422490955247 ], [ 13.300255947159572, 52.502430340529685 ], [ 13.300262225636219, 52.502469511929718 ], [ 13.300257720477346, 52.502469730425958 ], [ 13.300257502201543, 52.502475388156 ], [ 13.30025810328144, 52.502479170402914 ], [ 13.300260780010744, 52.50250553152776 ], [ 13.300268451140649, 52.502510438551404 ], [ 13.300271069039225, 52.502510254979498 ], [ 13.300271283779496, 52.502512250516922 ], [ 13.300275468033238, 52.502514927074976 ], [ 13.300280762247294, 52.50252927668398 ], [ 13.300278309556523, 52.502542325455124 ], [ 13.300275948597607, 52.502552996469902 ], [ 13.300287270831239, 52.502562675434355 ], [ 13.300288852129656, 52.502572213550735 ], [ 13.300294236614445, 52.502584185381636 ], [ 13.30028678784066, 52.50258558259452 ], [ 13.300286811186766, 52.502585894025799 ], [ 13.300277048970507, 52.502589550759346 ], [ 13.300257773061404, 52.50259030780763 ], [ 13.300252960516005, 52.502593108658623 ], [ 13.300217804234356, 52.502594981726794 ], [ 13.300182738181281, 52.502594477905816 ], [ 13.300169686407987, 52.502583724806996 ], [ 13.300167289354667, 52.502583186858274 ], [ 13.300140477099179, 52.502578407610855 ], [ 13.300133422851482, 52.502575574723529 ] ], [ [ 13.300273280023884, 52.502366520886596 ], [ 13.300320145579047, 52.502363791929291 ], [ 13.300324930541549, 52.502389776039678 ], [ 13.300276519729575, 52.502392572710193 ], [ 13.300273280023884, 52.502366520886596 ] ], [ [ 13.299669019456648, 52.502344759203709 ], [ 13.299674069470125, 52.502241661229959 ], [ 13.299681963340053, 52.502237548813135 ], [ 13.299688776350777, 52.502158899003398 ], [ 13.299683541559805, 52.502155919606714 ], [ 13.299703842878632, 52.50214267511064 ], [ 13.29971471469065, 52.502142219957754 ], [ 13.299721054828973, 52.502149085056438 ], [ 13.299757395969122, 52.502149563284554 ], [ 13.299761211385311, 52.50215106750133 ], [ 13.299765224805409, 52.502152365967447 ], [ 13.299769324780279, 52.502153559581132 ], [ 13.299773576088391, 52.502154535084799 ], [ 13.299777893578337, 52.502155399149345 ], [ 13.299782315661462, 52.502156034541848 ], [ 13.299786777593932, 52.502156553621113 ], [ 13.299791297136794, 52.50215683975663 ], [ 13.29979583159971, 52.502157006523333 ], [ 13.299800372237867, 52.502156936909707 ], [ 13.299804904200546, 52.502156748487231 ], [ 13.299809393675039, 52.502156324783421 ], [ 13.299813849336722, 52.502155784606828 ], [ 13.299818213708049, 52.50215501384227 ], [ 13.299822519094532, 52.502154129839738 ], [ 13.299826685652979, 52.50215302535549 ], [ 13.299844239873575, 52.502162860458775 ], [ 13.299843970717109, 52.502211108825385 ], [ 13.299852193856657, 52.502216369971336 ], [ 13.29985173834881, 52.502230083114576 ], [ 13.299864442777281, 52.502236660235695 ], [ 13.299841584583866, 52.502236938652942 ], [ 13.299841392404771, 52.502268721621071 ], [ 13.2998486415646, 52.502261385570193 ], [ 13.299874058196531, 52.502259371750043 ], [ 13.299889506012478, 52.502263162354723 ], [ 13.299894982105473, 52.502272756447219 ], [ 13.299908847619843, 52.502272955699347 ], [ 13.299909857398706, 52.502254614652614 ], [ 13.299962670453301, 52.50225559925822 ], [ 13.29997771872215, 52.502250156430023 ], [ 13.299999479979922, 52.502247988455608 ], [ 13.300001501690295, 52.502180548357778 ], [ 13.299996629285193, 52.502180319199148 ], [ 13.299998273003006, 52.502155170124766 ], [ 13.300052972197218, 52.502156336442511 ], [ 13.300052203305549, 52.502160684333383 ], [ 13.300110644615698, 52.50216162746581 ], [ 13.300111058124683, 52.502153621339204 ], [ 13.300228708633117, 52.502155042015609 ], [ 13.30023580869239, 52.502158709940367 ], [ 13.30023978182448, 52.502184997982951 ], [ 13.300233758764458, 52.502187975651175 ], [ 13.300237201455461, 52.502193222034009 ], [ 13.300242358054364, 52.502211137380996 ], [ 13.300245704009077, 52.502225459900068 ], [ 13.300231175040746, 52.502238104090971 ], [ 13.300235246092118, 52.502260670279838 ], [ 13.300222523745525, 52.502260437139803 ], [ 13.300230724572348, 52.502306453298381 ], [ 13.300239496382922, 52.502307080137932 ], [ 13.300241643582035, 52.502327422132595 ], [ 13.300203029069831, 52.502329688775902 ], [ 13.300200825791284, 52.502323059369211 ], [ 13.300063423107943, 52.502329575515198 ], [ 13.300062307739934, 52.502331065516323 ], [ 13.300049103779555, 52.502330254495583 ], [ 13.300033151926749, 52.50233101071769 ], [ 13.300031093867368, 52.502331806538109 ], [ 13.300021169454272, 52.502336422080262 ], [ 13.300019742933406, 52.502338262762763 ], [ 13.300019755104993, 52.50233852008629 ], [ 13.300019535140207, 52.502338531311501 ], [ 13.300012963891154, 52.502347009107289 ], [ 13.299999419818269, 52.502344435412098 ], [ 13.299979939444952, 52.502344155487208 ], [ 13.29997029027129, 52.502341637756977 ], [ 13.29995284979937, 52.50233900896518 ], [ 13.299937219956719, 52.502339973003004 ], [ 13.299913749992655, 52.50234201481102 ], [ 13.299896217805662, 52.502341762868198 ], [ 13.299870892881568, 52.5023413989368 ], [ 13.299835920265494, 52.502338517280037 ], [ 13.299831682628559, 52.502336347043233 ], [ 13.299799824712437, 52.502335908991967 ], [ 13.299798326107055, 52.502335875766647 ], [ 13.299796828590235, 52.502335928872569 ], [ 13.299795338244186, 52.502336025239345 ], [ 13.29979386812979, 52.502336208212469 ], [ 13.29979241549397, 52.502336434594589 ], [ 13.299791003878926, 52.502336743386223 ], [ 13.299789617209248, 52.502337092996797 ], [ 13.299788292384124, 52.502337519921426 ], [ 13.299787001374282, 52.502337986893345 ], [ 13.299785790122357, 52.502338525142925 ], [ 13.299784623166998, 52.502339099094819 ], [ 13.299783548027314, 52.502339737304681 ], [ 13.299782526192923, 52.502340406850756 ], [ 13.299781612684397, 52.502341132799963 ], [ 13.299780755668976, 52.502341883837296 ], [ 13.299780020613856, 52.502342681583457 ], [ 13.299779349622659, 52.502343499131825 ], [ 13.299778806898113, 52.502344352690166 ], [ 13.299728231334306, 52.502343188866405 ], [ 13.299727455257578, 52.502346385776953 ], [ 13.299669019456648, 52.502344759203709 ] ], [ [ 13.299513053479425, 52.50222580439226 ], [ 13.299500647133859, 52.502232653598391 ], [ 13.299447818308458, 52.502231582243944 ], [ 13.299447476803385, 52.50222600098558 ], [ 13.299345955264418, 52.502223887092143 ], [ 13.299344764699699, 52.502229500274588 ], [ 13.299292348057689, 52.502228438372271 ], [ 13.299279664997171, 52.502219058036452 ], [ 13.299284591676987, 52.502142460795717 ], [ 13.299299627923356, 52.50213446797288 ], [ 13.299502299851607, 52.502138910704431 ], [ 13.299517241518815, 52.502147605981968 ], [ 13.299513053479425, 52.50222580439226 ] ], [ [ 13.299118033529023, 52.502178962293129 ], [ 13.299111545207674, 52.502265395041405 ], [ 13.299102545985338, 52.502265621711054 ], [ 13.299098848097325, 52.502323242675814 ], [ 13.299089335667571, 52.502358973657024 ], [ 13.299096470553517, 52.502359829700026 ], [ 13.299041894469985, 52.502457210192688 ], [ 13.29904637517742, 52.502458579239217 ], [ 13.298997194850291, 52.502541101986743 ], [ 13.29900239595095, 52.50254865565779 ], [ 13.29899255198959, 52.502567401960484 ], [ 13.298993636940224, 52.50257402789881 ], [ 13.298967389061653, 52.502576767757624 ], [ 13.298967407993507, 52.502572194200361 ], [ 13.298852896467942, 52.502546534845401 ], [ 13.298845006747902, 52.502549963935039 ], [ 13.298821811490361, 52.502544238372764 ], [ 13.298816551698973, 52.502546523832095 ], [ 13.298804204845419, 52.502543318049895 ], [ 13.298796309215275, 52.502547663255825 ], [ 13.298782129168366, 52.502535537003624 ], [ 13.298788520285919, 52.502531654790531 ], [ 13.298796859059946, 52.50251724490068 ], [ 13.298802475152089, 52.50251656859794 ], [ 13.298853142720883, 52.502436099328342 ], [ 13.298858010865439, 52.502437011804808 ], [ 13.298915015424065, 52.50233802901294 ], [ 13.298921985986453, 52.502236140121056 ], [ 13.298915741391216, 52.502236267020379 ], [ 13.29891959032091, 52.502154400729218 ], [ 13.298913964922917, 52.50215440346166 ], [ 13.29891632149852, 52.502134504727209 ], [ 13.298934725889691, 52.502126970379116 ], [ 13.298992741752219, 52.502137519553152 ], [ 13.299000211773482, 52.502143012693423 ], [ 13.299026061387616, 52.502142338677864 ], [ 13.299036959375606, 52.502136168249905 ], [ 13.299038875917068, 52.502127932881137 ], [ 13.29906658788323, 52.502132295536526 ], [ 13.299098052510359, 52.502132994271768 ], [ 13.299129919121686, 52.502129119553487 ], [ 13.299125896731502, 52.502178965649172 ], [ 13.299118033529023, 52.502178962293129 ] ], [ [ 13.298525605926933, 52.502118774584545 ], [ 13.298753390822128, 52.502124599375918 ], [ 13.298752881995735, 52.502147468401425 ], [ 13.298743917393644, 52.502147066156589 ], [ 13.298742153534816, 52.502188166598742 ], [ 13.298725205707541, 52.502187930977172 ], [ 13.298720004326686, 52.502293365362007 ], [ 13.298729557992605, 52.502293813842478 ], [ 13.29872701093511, 52.502315437945114 ], [ 13.298692185648738, 52.502311261535347 ], [ 13.298684327033888, 52.502340212618229 ], [ 13.29867614495584, 52.502353426225319 ], [ 13.29868133370478, 52.502356413995848 ], [ 13.298681058248496, 52.502363547259058 ], [ 13.298669003373369, 52.502372889301668 ], [ 13.298664785670114, 52.502381154510587 ], [ 13.298668131157305, 52.502395476171024 ], [ 13.298667304815231, 52.502416875061741 ], [ 13.298666845751274, 52.50242876293494 ], [ 13.298656462108756, 52.502445266234254 ], [ 13.298648074029776, 52.502460608693312 ], [ 13.298647431317992, 52.502477252074947 ], [ 13.298635374931616, 52.502486594092453 ], [ 13.298627124570316, 52.502498369918357 ], [ 13.298617337708947, 52.502499418709654 ], [ 13.298590018608939, 52.502500215363227 ], [ 13.298588884141399, 52.502500100144651 ], [ 13.29858784134111, 52.50250047266897 ], [ 13.298587582392546, 52.502499967235288 ], [ 13.298576428663591, 52.502498830382585 ], [ 13.298553281387091, 52.502492550699486 ], [ 13.298529615325601, 52.502478492445711 ], [ 13.298520778152371, 52.502476620155555 ], [ 13.298512967725927, 52.502476507825804 ], [ 13.298511544937062, 52.502474663945272 ], [ 13.298484228190009, 52.502468876343258 ], [ 13.298481268678982, 52.502474700544823 ], [ 13.298414955148909, 52.502461081761361 ], [ 13.298427466299069, 52.502436151048464 ], [ 13.298444354942093, 52.50243250435441 ], [ 13.298450012583199, 52.502422435546137 ], [ 13.298451023475494, 52.502414954111373 ], [ 13.298461636763951, 52.502392506445297 ], [ 13.298471790660388, 52.502383670261835 ], [ 13.298480321508821, 52.502368485416149 ], [ 13.29850733060638, 52.502362322869736 ], [ 13.29854626166828, 52.502293719669282 ], [ 13.298534078908784, 52.502292256916959 ], [ 13.298537067067226, 52.502274740952956 ], [ 13.298550184033454, 52.502275209225587 ], [ 13.29855402920138, 52.502193801440541 ], [ 13.298541295294411, 52.50219333418169 ], [ 13.298542522028781, 52.502174807447837 ], [ 13.298530165100352, 52.502173201027979 ], [ 13.298531759916051, 52.502156741273012 ], [ 13.29853198513476, 52.50215636508289 ], [ 13.298532150430287, 52.502155976342429 ], [ 13.298532286448509, 52.502155582685262 ], [ 13.298532362231217, 52.502155184565297 ], [ 13.298532407194692, 52.502154783304746 ], [ 13.298532390241879, 52.502154382951929 ], [ 13.29853234092786, 52.502153981234635 ], [ 13.298532232434454, 52.502153585859162 ], [ 13.29853209435138, 52.502153193654614 ], [ 13.298531894005084, 52.502152811344054 ], [ 13.298531666944761, 52.502152434044014 ], [ 13.298531380323356, 52.502152072970695 ], [ 13.298531068391066, 52.502151718726338 ], [ 13.298530702614336, 52.502151385286474 ], [ 13.298530311387948, 52.502151062270052 ], [ 13.298529873575738, 52.502150762859912 ], [ 13.298529413154805, 52.502150476611448 ], [ 13.298528910426901, 52.502150217627261 ], [ 13.298528387965922, 52.502149973644336 ], [ 13.29852782894932, 52.502149760604944 ], [ 13.298527256055134, 52.502149563550098 ], [ 13.298526655371173, 52.502149399363113 ], [ 13.298526042178063, 52.502149253877732 ], [ 13.298525409926285, 52.502149144083099 ], [ 13.298524769652438, 52.502149051256396 ], [ 13.298524117613189, 52.502148996023578 ], [ 13.298523463337974, 52.502148960539266 ], [ 13.298522804729448, 52.502148960957491 ], [ 13.298525605926933, 52.502118774584545 ] ], [ [ 13.29844652701575, 52.502132718207037 ], [ 13.298437208113027, 52.50228062000204 ], [ 13.298356278654438, 52.502420479565714 ], [ 13.298253437570795, 52.502397665068465 ], [ 13.298240017877138, 52.502386456900318 ], [ 13.29825214575253, 52.502363593166663 ], [ 13.298261494202048, 52.50236588372988 ], [ 13.298316959155777, 52.502266168765999 ], [ 13.298326109594823, 52.502162578648012 ], [ 13.298315524730636, 52.502162126990847 ], [ 13.298316043802288, 52.50213789234801 ], [ 13.298333326048906, 52.502130804100595 ], [ 13.29844652701575, 52.502132718207037 ] ], [ [ 13.298097200539555, 52.502329454474484 ], [ 13.298076899566114, 52.502340424824887 ], [ 13.298004105660143, 52.502323013598328 ], [ 13.298019824596599, 52.502296402762312 ], [ 13.298013892938959, 52.502295522604598 ], [ 13.298007284168159, 52.502296761824695 ], [ 13.297978339975828, 52.502289208194433 ], [ 13.297965070108983, 52.502279501884203 ], [ 13.297955560327305, 52.502273417381559 ], [ 13.297943176812556, 52.502270515783223 ], [ 13.297913897780525, 52.502276778613108 ], [ 13.297838278284573, 52.502265083705126 ], [ 13.297831982614854, 52.502252269657788 ], [ 13.29780166969933, 52.502247233611378 ], [ 13.297768902893292, 52.502259148450655 ], [ 13.297649297604925, 52.502241391633959 ], [ 13.297681475515565, 52.502189808109556 ], [ 13.297683038305179, 52.50214219244792 ], [ 13.297807828217001, 52.502156018243312 ], [ 13.297830225171142, 52.502171987000203 ], [ 13.29785683216854, 52.50217245613095 ], [ 13.297866477375507, 52.502162525642142 ], [ 13.297956497544126, 52.502172499098492 ], [ 13.29798939018406, 52.502187148760285 ], [ 13.298020948864126, 52.502173208742093 ], [ 13.298060397011369, 52.502173695325851 ], [ 13.298062248694684, 52.50214647139417 ], [ 13.298135750724473, 52.50214787043128 ], [ 13.298149149452367, 52.502164119684018 ], [ 13.298143493256893, 52.50224532428178 ], [ 13.298097200539555, 52.502329454474484 ] ], [ [ 13.2978467927695, 52.502331823908975 ], [ 13.29782539422407, 52.502367540227013 ], [ 13.297745298393068, 52.502349937465752 ], [ 13.297763022587301, 52.502315055726498 ], [ 13.2978467927695, 52.502331823908975 ] ], [ [ 13.298204920954269, 52.502412771037818 ], [ 13.298183687346739, 52.502446169159306 ], [ 13.298104490997916, 52.502430142254923 ], [ 13.298124495951706, 52.502395635838532 ], [ 13.298204920954269, 52.502412771037818 ] ], [ [ 13.29915837616487, 52.502551098727977 ], [ 13.299167729049339, 52.502534537409304 ], [ 13.299399402449598, 52.502586293602569 ], [ 13.299377090915272, 52.502624011100771 ], [ 13.299371663784818, 52.502622807387482 ], [ 13.299369666786765, 52.502622364186223 ], [ 13.299345245074996, 52.502662951010755 ], [ 13.299341994028289, 52.502668352950955 ], [ 13.299258246460012, 52.502650319298986 ], [ 13.299260803231929, 52.502645231063944 ], [ 13.299214766048285, 52.502635613991238 ], [ 13.299212461714548, 52.502640460394339 ], [ 13.299127156301218, 52.502622098551868 ], [ 13.299141814491195, 52.502596386727362 ], [ 13.299141868749279, 52.502594981281931 ], [ 13.299148088644465, 52.502585381773855 ], [ 13.299154282212832, 52.502574517722621 ], [ 13.29914616720156, 52.50257271520374 ], [ 13.299157120468728, 52.502553322184411 ], [ 13.299157202722283, 52.502551191550666 ], [ 13.29915837616487, 52.502551098727977 ] ], [ [ 13.297829664323716, 52.502102986649916 ], [ 13.2978291487942, 52.502065609949398 ], [ 13.297918953488344, 52.502066892125555 ], [ 13.297917681350956, 52.502105046021214 ], [ 13.297829664323716, 52.502102986649916 ] ], [ [ 13.298212809537446, 52.50207118604235 ], [ 13.298300348894042, 52.502072336439333 ], [ 13.298298940510309, 52.502109105528746 ], [ 13.298210610441869, 52.502107521170018 ], [ 13.298212809537446, 52.50207118604235 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 72, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.300368736566293, 52.503572133542178 ], [ 13.300420365382791, 52.503486183804974 ], [ 13.300363696014202, 52.503475356181973 ], [ 13.300340364568569, 52.503473830557809 ], [ 13.300322648459639, 52.503478334186376 ], [ 13.300310637978416, 52.503486488394401 ], [ 13.300280085848792, 52.50352054333073 ], [ 13.300107235655728, 52.503480268919752 ], [ 13.300111411670265, 52.503485681389293 ], [ 13.30012055657404, 52.503501274968968 ], [ 13.300139368273992, 52.503515728892388 ], [ 13.300203039686888, 52.503531395592901 ], [ 13.300215142751485, 52.503525234278655 ], [ 13.300222614646165, 52.503533667490508 ], [ 13.30024993436648, 52.503532870465214 ], [ 13.300269919786366, 52.503520073591282 ], [ 13.300280736274596, 52.503542829294567 ], [ 13.300299987877128, 52.503549052665548 ], [ 13.300327078271248, 52.503554200012346 ], [ 13.300336400444158, 52.503564208085109 ], [ 13.300367728312779, 52.503571915856064 ], [ 13.300368736566293, 52.503572133542178 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 73, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299156376613047, 52.502572590446263 ], [ 13.299157120468733, 52.502553322184426 ], [ 13.299146167201563, 52.502572715203726 ], [ 13.299154282212841, 52.502574517722628 ], [ 13.299148088644467, 52.502585381773869 ], [ 13.299156376613047, 52.502572590446263 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 74, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299973275832571, 52.503449055186117 ], [ 13.299956367295154, 52.503445115930248 ], [ 13.299954853546607, 52.503451316095038 ], [ 13.29994279716318, 52.503460658244364 ], [ 13.299945995587672, 52.503468150724764 ], [ 13.299948533740137, 52.503468775222601 ], [ 13.299963996880559, 52.503466910563809 ], [ 13.2999664955985, 52.503452672924567 ], [ 13.299973275832571, 52.503449055186117 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 75, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.29899255198959, 52.502567401960498 ], [ 13.299002395950957, 52.502548655657804 ], [ 13.298997194850296, 52.502541101986729 ], [ 13.299046375177429, 52.502458579239224 ], [ 13.299041894469987, 52.502457210192688 ], [ 13.299096470553522, 52.502359829700033 ], [ 13.299089335667576, 52.502358973657032 ], [ 13.29909884809733, 52.502323242675807 ], [ 13.299102545985342, 52.502265621711061 ], [ 13.299111545207676, 52.50226539504142 ], [ 13.29911803352903, 52.502178962293144 ], [ 13.299125896731509, 52.502178965649186 ], [ 13.29912991912169, 52.502129119553487 ], [ 13.299098052510365, 52.502132994271776 ], [ 13.299066587883233, 52.502132295536541 ], [ 13.299038875917077, 52.502127932881145 ], [ 13.299036959375611, 52.502136168249898 ], [ 13.299026061387623, 52.502142338677871 ], [ 13.299000211773487, 52.502143012693416 ], [ 13.298992741752224, 52.502137519553152 ], [ 13.298934725889694, 52.50212697037913 ], [ 13.298916321498526, 52.502134504727188 ], [ 13.298913964922919, 52.502154403461667 ], [ 13.298919590320919, 52.502154400729232 ], [ 13.298915741391218, 52.502236267020379 ], [ 13.298921985986453, 52.50223614012107 ], [ 13.298915015424068, 52.502338029012932 ], [ 13.298858010865445, 52.502437011804815 ], [ 13.298853142720887, 52.502436099328349 ], [ 13.298802475152094, 52.502516568597947 ], [ 13.298796859059953, 52.502517244900694 ], [ 13.298788520285925, 52.502531654790531 ], [ 13.298782129168373, 52.502535537003624 ], [ 13.298796309215279, 52.502547663255832 ], [ 13.298804204845426, 52.502543318049909 ], [ 13.29881655169898, 52.502546523832116 ], [ 13.298821811490367, 52.502544238372742 ], [ 13.298845006747905, 52.502549963935046 ], [ 13.298852896467945, 52.502546534845393 ], [ 13.298967407993512, 52.502572194200383 ], [ 13.298967389061662, 52.502576767757631 ], [ 13.298993636940233, 52.502574027898817 ], [ 13.29899255198959, 52.502567401960498 ] ], [ [ 13.298880628175134, 52.502444921107625 ], [ 13.298881178989904, 52.502430655478506 ], [ 13.29888938483928, 52.502420068532551 ], [ 13.298903571481604, 52.50240599897046 ], [ 13.298906024570361, 52.50239295023092 ], [ 13.298920073489578, 52.502382447298722 ], [ 13.298931900308762, 52.502379048739435 ], [ 13.298961029808625, 52.502381846649897 ], [ 13.298988027557103, 52.502389371152987 ], [ 13.29899943979296, 52.502396672462254 ], [ 13.299012755825519, 52.502405189781115 ], [ 13.299020363496918, 52.502410057312147 ], [ 13.29902950776329, 52.502425651872322 ], [ 13.299021164245284, 52.502439805460483 ], [ 13.299016808899694, 52.50245163731455 ], [ 13.299014401740566, 52.502463497179129 ], [ 13.299004478665486, 52.50246811265589 ], [ 13.298996318735481, 52.502477510732575 ], [ 13.298980551086332, 52.502482042174101 ], [ 13.298959030668717, 52.502484111824081 ], [ 13.298945668755429, 52.502476782477892 ], [ 13.298930314192544, 52.502470614915275 ], [ 13.29891301147987, 52.502464418439686 ], [ 13.298885967829577, 52.502458081897963 ], [ 13.298880628175134, 52.502444921107625 ] ], [ [ 13.298947489112173, 52.502341789418104 ], [ 13.298951179996978, 52.502296642764236 ], [ 13.29898276967981, 52.502304714323259 ], [ 13.298973890390423, 52.502301147516903 ], [ 13.29895672540834, 52.502291385314535 ], [ 13.29894364040404, 52.502276923623846 ], [ 13.298942288917328, 52.502261441104686 ], [ 13.298958148294272, 52.502254531912655 ], [ 13.298978087594856, 52.502242924129931 ], [ 13.298999424291214, 52.502245609985088 ], [ 13.299004901659902, 52.502255204138329 ], [ 13.299020257596897, 52.502261372610732 ], [ 13.299034168782175, 52.502254435397859 ], [ 13.2990559185449, 52.50224642224449 ], [ 13.299069555800203, 52.502246618313293 ], [ 13.299072762241492, 52.502264506574853 ], [ 13.29906840840068, 52.502276338452596 ], [ 13.299060202621597, 52.502286925411816 ], [ 13.299069574864353, 52.502296576459308 ], [ 13.299072920477597, 52.502310898109577 ], [ 13.299070834482242, 52.502318523236454 ], [ 13.299075076044469, 52.502318644459926 ], [ 13.299069848682494, 52.502353064089306 ], [ 13.29899387539742, 52.502351971769365 ], [ 13.298994150802958, 52.502344838504968 ], [ 13.298947489112173, 52.502341789418104 ] ], [ [ 13.299019618324509, 52.502240531679831 ], [ 13.299002222380352, 52.502236713850081 ], [ 13.298994936010702, 52.502223525074662 ], [ 13.298989642251241, 52.502209175411295 ], [ 13.298995853989188, 52.502199748424765 ], [ 13.298996312960602, 52.502187860549064 ], [ 13.299008275915043, 52.502180896226697 ], [ 13.299026039001397, 52.502175203934449 ], [ 13.299041393441259, 52.5021813723828 ], [ 13.299060552475851, 52.502189973705292 ], [ 13.299063852180016, 52.502205484233428 ], [ 13.299061307351815, 52.502220910732049 ], [ 13.299055141558512, 52.502229147945968 ], [ 13.299039098642318, 52.50224081176242 ], [ 13.299019618324509, 52.502240531679831 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 76, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.300226871979616, 52.503384179675166 ], [ 13.300231179757313, 52.503373536633177 ], [ 13.300231821891753, 52.503356893240408 ], [ 13.300212753861274, 52.503345914347143 ], [ 13.300186006476713, 52.503382402998561 ], [ 13.299121869153081, 52.503126837689692 ], [ 13.299142589045534, 52.503095019867942 ], [ 13.299130945642574, 52.503093662937069 ], [ 13.299117263698475, 52.503094655771633 ], [ 13.299105438172392, 52.503098054368721 ], [ 13.299090974530792, 52.50311925629611 ], [ 13.299074426428581, 52.50314399686458 ], [ 13.299073783861965, 52.503160640247962 ], [ 13.299083156289235, 52.50317029129463 ], [ 13.299094614674656, 52.503176402819733 ], [ 13.299111531443382, 52.503142151251232 ], [ 13.300179796292101, 52.503391830067663 ], [ 13.300156715960259, 52.503434319084946 ], [ 13.300180093283181, 52.503434654968565 ], [ 13.300201933697497, 52.503424263832237 ], [ 13.300208420539605, 52.503407704414201 ], [ 13.300226871979616, 52.503384179675166 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 77, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.300286811186769, 52.502585894025806 ], [ 13.300286787840667, 52.502585582594534 ], [ 13.300282457180968, 52.502586395220447 ], [ 13.300260936768042, 52.502588465107323 ], [ 13.300257773061409, 52.502590307807637 ], [ 13.300277048970511, 52.502589550759367 ], [ 13.300286811186769, 52.502585894025806 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 78, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299833131533665, 52.503423398004514 ], [ 13.299842964419296, 52.503421161135222 ], [ 13.299859355484534, 52.503422511594813 ], [ 13.29967692090205, 52.503380002066322 ], [ 13.299676618232677, 52.503387844345163 ], [ 13.299668643280583, 52.503392486977297 ], [ 13.299665630157653, 52.503399168198008 ], [ 13.299734157172276, 52.503416028839943 ], [ 13.299771021898858, 52.503416558639316 ], [ 13.299795978953121, 52.503426432698845 ], [ 13.29981940362053, 52.503425579797202 ], [ 13.299833131533665, 52.503423398004514 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 79, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.300169513602363, 52.502583582960362 ], [ 13.300167289354667, 52.502583186858288 ], [ 13.300169686407989, 52.502583724806996 ], [ 13.300169513602363, 52.502583582960362 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 80, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.300414554469269, 52.503420181278756 ], [ 13.300436350430846, 52.503410978997799 ], [ 13.300461966681834, 52.503416945815168 ], [ 13.300508004635274, 52.503340288160523 ], [ 13.300500968778612, 52.503341405398587 ], [ 13.300487195094842, 52.503344775248785 ], [ 13.300475322268538, 52.503349362839948 ], [ 13.300473650652899, 52.503342202504072 ], [ 13.300471885874501, 52.503337419004616 ], [ 13.300480273495191, 52.503322076414463 ], [ 13.30048064035994, 52.503312566288123 ], [ 13.300478104171669, 52.503306925634426 ], [ 13.300477185454467, 52.503306831515872 ], [ 13.300465817093679, 52.503298342345538 ], [ 13.300458482779904, 52.503286342514315 ], [ 13.30045866623175, 52.503281587001865 ], [ 13.300461302366768, 52.503263782715955 ], [ 13.300477071587618, 52.503259251998493 ], [ 13.300477198925739, 52.503259082994774 ], [ 13.300280398871124, 52.503216648555572 ], [ 13.300276801218583, 52.503215874873909 ], [ 13.300274834670736, 52.503219415231413 ], [ 13.300279560570987, 52.503222871915391 ], [ 13.300296832818972, 52.503226662601222 ], [ 13.300327773597246, 52.503233054804149 ], [ 13.300333022043079, 52.503248593288063 ], [ 13.300315488019008, 52.503248341383177 ], [ 13.300296053110259, 52.503246872628964 ], [ 13.300285762863492, 52.503256153871057 ], [ 13.300354004541248, 52.503271817820334 ], [ 13.300333147868344, 52.50330720159554 ], [ 13.300437658314097, 52.503326546058119 ], [ 13.300407862218794, 52.503391538050359 ], [ 13.300340137171506, 52.503378670628877 ], [ 13.300333558684899, 52.503397606912046 ], [ 13.300414554469269, 52.503420181278756 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 81, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.300113937708867, 52.502558995486503 ], [ 13.300106649481172, 52.502545806755847 ], [ 13.300099269549612, 52.502534994882183 ], [ 13.300099774100316, 52.502521918122348 ], [ 13.30010027865063, 52.502508841362463 ], [ 13.300108392481745, 52.502500632085848 ], [ 13.300122213306111, 52.502496072521758 ], [ 13.300122442659729, 52.502490128131448 ], [ 13.300116781535035, 52.502485289540239 ], [ 13.300125031497963, 52.502473513607015 ], [ 13.300129386583821, 52.502461680811038 ], [ 13.300136995862408, 52.50246654829251 ], [ 13.300156246942539, 52.502472772582458 ], [ 13.300162045644241, 52.502474045436131 ], [ 13.300164223182545, 52.502468129037446 ], [ 13.300168532353254, 52.502457486016688 ], [ 13.300176140197612, 52.50246235257584 ], [ 13.300193536301403, 52.502466171133115 ], [ 13.300201373458133, 52.502465094198747 ], [ 13.300219274079318, 52.502455835991483 ], [ 13.300231282819354, 52.50244768176799 ], [ 13.300248952618563, 52.50244436792569 ], [ 13.300258464264777, 52.50245045136932 ], [ 13.300257868028423, 52.502465905886702 ], [ 13.300257720477349, 52.502469730425958 ], [ 13.300262225636223, 52.502469511929725 ], [ 13.300255947159576, 52.502430340529685 ], [ 13.300238157016199, 52.502422490955254 ], [ 13.300201062624932, 52.502424383825392 ], [ 13.300200280496972, 52.502428425825656 ], [ 13.300054475823432, 52.50243659700881 ], [ 13.300053729732067, 52.502431876692015 ], [ 13.300019639913396, 52.502433606779356 ], [ 13.300018168815853, 52.502427438349905 ], [ 13.299985185377041, 52.502429018886929 ], [ 13.299971261604645, 52.502439988588101 ], [ 13.299977247621879, 52.502492765797825 ], [ 13.299983093635403, 52.502544436874253 ], [ 13.300032493589333, 52.502559311475288 ], [ 13.300036642234751, 52.502553822611901 ], [ 13.300133422851488, 52.502575574723529 ], [ 13.300125120857867, 52.502572240180534 ], [ 13.300113937708867, 52.502558995486503 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 82, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299499353695612, 52.50333862767426 ], [ 13.299102826353637, 52.503246230635348 ], [ 13.299100851847708, 52.50326020246213 ], [ 13.299468492888257, 52.50335066298998 ], [ 13.299469501586199, 52.503350372686839 ], [ 13.299489257699745, 52.50334352033309 ], [ 13.299499353695612, 52.50333862767426 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 83, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299894001453387, 52.502542151403063 ], [ 13.299895253850815, 52.502519508851961 ], [ 13.299891101383952, 52.502524867283071 ], [ 13.29988502745533, 52.502530726784983 ], [ 13.299884591292471, 52.502542029662024 ], [ 13.299894001453387, 52.502542151403063 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 84, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.300114434843461, 52.503267186291794 ], [ 13.300129782779717, 52.503251656015422 ], [ 13.300116505680499, 52.503252618817811 ], [ 13.300105930935542, 52.503238914425197 ], [ 13.300095503026549, 52.503252640725172 ], [ 13.300114434843461, 52.503267186291794 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 85, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298588884141404, 52.502500100144658 ], [ 13.298587582392548, 52.502499967235288 ], [ 13.298587841341117, 52.502500472668984 ], [ 13.298588884141404, 52.502500100144658 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 86, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298995012436144, 52.503221108291932 ], [ 13.298800314841802, 52.503175739904009 ], [ 13.298707567524723, 52.503152504513039 ], [ 13.298704249416748, 52.503158571720384 ], [ 13.298703719631211, 52.503162485169128 ], [ 13.298805550823998, 52.50318754243159 ], [ 13.298808437446933, 52.503186238854539 ], [ 13.298816268159538, 52.503190179014283 ], [ 13.298982982937119, 52.503231200598108 ], [ 13.298985207581444, 52.503222084926001 ], [ 13.298995012436144, 52.503221108291932 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 87, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.300271283779505, 52.502512250516929 ], [ 13.300271069039232, 52.502510254979505 ], [ 13.300268451140653, 52.502510438551397 ], [ 13.300271283779505, 52.502512250516929 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 88, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.300163347203771, 52.503191423333313 ], [ 13.30014501013744, 52.503187468973387 ], [ 13.300109314838256, 52.503234459349819 ], [ 13.300122087892939, 52.503231552599438 ], [ 13.300136950873771, 52.503225077594159 ], [ 13.300141122804686, 52.503220857721608 ], [ 13.300160878792479, 52.503214004355527 ], [ 13.300169128884585, 52.503202228421699 ], [ 13.300169355013258, 52.503196367603856 ], [ 13.300163909254145, 52.50319171103547 ], [ 13.300163347203771, 52.503191423333313 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 89, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.30025810328145, 52.502479170402921 ], [ 13.300257502201546, 52.502475388156014 ], [ 13.300257317658589, 52.502480171525924 ], [ 13.3002549108311, 52.50249203141852 ], [ 13.300258348543313, 52.502503976180485 ], [ 13.300260780010751, 52.50250553152776 ], [ 13.30025810328145, 52.502479170402921 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 90, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298467881686207, 52.503092455136496 ], [ 13.298205318352514, 52.503029298803334 ], [ 13.298130014688574, 52.503011185312438 ], [ 13.297973486531466, 52.502973533314787 ], [ 13.29784874025151, 52.502938991684601 ], [ 13.297853036548386, 52.502941740072316 ], [ 13.297860599721352, 52.502947796574958 ], [ 13.297868302310826, 52.502956918389074 ], [ 13.29830571637785, 52.503064552598779 ], [ 13.298310280153201, 52.503063695744473 ], [ 13.298343260571833, 52.503067738732014 ], [ 13.298352279492159, 52.503076009097725 ], [ 13.298543208334484, 52.503122990099712 ], [ 13.298547783911046, 52.503121827704746 ], [ 13.298555194399448, 52.503114329513011 ], [ 13.298467881686207, 52.503092455136496 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 91, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.29852660504859, 52.502476703957768 ], [ 13.298520778152376, 52.502476620155548 ], [ 13.298529615325606, 52.502478492445732 ], [ 13.29852660504859, 52.502476703957768 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 92, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299523347324778, 52.503116822219475 ], [ 13.299529513159113, 52.503108584982634 ], [ 13.299519820819722, 52.50310889972674 ], [ 13.299511809061631, 52.503124116381834 ], [ 13.299516787852161, 52.503124378558127 ], [ 13.299523347324778, 52.503116822219475 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 93, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298481268678987, 52.502474700544845 ], [ 13.298484228190015, 52.502468876343265 ], [ 13.298511544937067, 52.502474663945264 ], [ 13.298503687362714, 52.502464479879713 ], [ 13.29850219831814, 52.502452563089847 ], [ 13.298496537377892, 52.502447724422652 ], [ 13.298461701050512, 52.502441275707348 ], [ 13.298448294756117, 52.502435136102562 ], [ 13.29845001258321, 52.502422435546123 ], [ 13.298444354942097, 52.502432504354424 ], [ 13.298427466299071, 52.502436151048471 ], [ 13.298414955148912, 52.502461081761361 ], [ 13.298481268678987, 52.502474700544845 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 94, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299493752797639, 52.50304700357767 ], [ 13.299073675403084, 52.502956415018822 ], [ 13.299045326682821, 52.502988948539198 ], [ 13.299065699911912, 52.503016599011268 ], [ 13.299121782103304, 52.503028110244763 ], [ 13.299142777300954, 52.502989160056558 ], [ 13.29947948739677, 52.503059677540442 ], [ 13.299479052217427, 52.503058164358364 ], [ 13.299483741214505, 52.503056734720452 ], [ 13.299482875557437, 52.503054388159441 ], [ 13.299493752797639, 52.50304700357767 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 95, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299381832303927, 52.502437853286622 ], [ 13.299407616141439, 52.502426329445413 ], [ 13.299408354276711, 52.502407320946006 ], [ 13.299378592515206, 52.50240864911563 ], [ 13.299370663567949, 52.50241210375065 ], [ 13.29934705733973, 52.502417712099664 ], [ 13.299340983354485, 52.50242357157326 ], [ 13.299325397855121, 52.502423347529735 ], [ 13.299304015159041, 52.502421850610133 ], [ 13.299282907789321, 52.502413221319927 ], [ 13.299273673120931, 52.502400004554858 ], [ 13.299287584311221, 52.502393067312354 ], [ 13.299272275621883, 52.502385710916293 ], [ 13.299270786336646, 52.50237379503286 ], [ 13.299280892935734, 52.502364424022964 ], [ 13.29929453022911, 52.502364620066125 ], [ 13.299321986877521, 52.502360257514873 ], [ 13.299341834383764, 52.502351026527208 ], [ 13.299357601914933, 52.502346495935342 ], [ 13.299349259989937, 52.502360649568992 ], [ 13.299348892893645, 52.502370159691239 ], [ 13.299368327381218, 52.50237162859775 ], [ 13.29937996912914, 52.502372985482694 ], [ 13.299376669302276, 52.502357474962736 ], [ 13.299379030467076, 52.502346803967356 ], [ 13.299404538947192, 52.502342412493427 ], [ 13.299427915681822, 52.502342748520789 ], [ 13.299453148823815, 52.502345490302346 ], [ 13.299472353898951, 52.502352902681473 ], [ 13.299470040082339, 52.502362385721042 ], [ 13.299481575967333, 52.502378624226672 ], [ 13.299508894980425, 52.502377827366374 ], [ 13.299518222926887, 52.50238866727809 ], [ 13.29951558647163, 52.502406471542727 ], [ 13.299542676105153, 52.502411618164743 ], [ 13.299568001065287, 52.502411982166713 ], [ 13.299573923651074, 52.502415770772679 ], [ 13.299579119849289, 52.502342255989497 ], [ 13.299580108033128, 52.502328257389692 ], [ 13.299525998031699, 52.502326975244507 ], [ 13.299525210179059, 52.502331889305978 ], [ 13.299254711630983, 52.502325138179614 ], [ 13.299254333117418, 52.502320554413124 ], [ 13.29919623384802, 52.502319180601312 ], [ 13.299192165094494, 52.502371335873271 ], [ 13.299160306749448, 52.502425599277331 ], [ 13.299213837618176, 52.502437420853973 ], [ 13.299216263821, 52.50243395905111 ], [ 13.299430427191718, 52.502479646146057 ], [ 13.299411579326495, 52.502475154745106 ], [ 13.299398356482614, 52.502464258837669 ], [ 13.299373444477855, 52.502453195799298 ], [ 13.299381832303927, 52.502437853286622 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 96, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298204920954273, 52.502412771037811 ], [ 13.298124495951715, 52.502395635838518 ], [ 13.298104490997925, 52.502430142254923 ], [ 13.298183687346743, 52.502446169159306 ], [ 13.298204920954273, 52.502412771037811 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 97, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.296692539544077, 52.502401935975186 ], [ 13.296693091066276, 52.502387670362168 ], [ 13.296706818801374, 52.502385488930472 ], [ 13.29671488730852, 52.502378467868937 ], [ 13.296717524857515, 52.502360664574859 ], [ 13.296720024552176, 52.50234642701006 ], [ 13.296706709020999, 52.502337908538294 ], [ 13.296685832026172, 52.502323334409361 ], [ 13.296644969149547, 52.502321556540011 ], [ 13.296630780347382, 52.502335625804328 ], [ 13.29662285120213, 52.502339080253485 ], [ 13.296608708352437, 52.502351960639061 ], [ 13.29661409328037, 52.502363932650397 ], [ 13.296609599402437, 52.502379331038327 ], [ 13.29659949223686, 52.502388701815136 ], [ 13.296608955922698, 52.502395974402575 ], [ 13.296620461163347, 52.502400898207362 ], [ 13.296634326799937, 52.502395150156339 ], [ 13.296642073569288, 52.502396451231483 ], [ 13.296653439448813, 52.502404941639696 ], [ 13.29666870320855, 52.502413487268122 ], [ 13.296696020806802, 52.502412691036788 ], [ 13.296692539544077, 52.502401935975186 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 98, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.297741223801516, 52.502909220414637 ], [ 13.297626606606826, 52.502877482991543 ], [ 13.297635221733991, 52.50288864906728 ], [ 13.29763609266155, 52.502899779234276 ], [ 13.29772278459064, 52.50292111211904 ], [ 13.297735213697498, 52.502913876802737 ], [ 13.297741223801516, 52.502909220414637 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 99, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298356278654442, 52.502420479565728 ], [ 13.298437208113032, 52.502280620002026 ], [ 13.298446527015754, 52.502132718207044 ], [ 13.29833332604891, 52.502130804100595 ], [ 13.298316043802297, 52.502137892348003 ], [ 13.298315524730643, 52.502162126990847 ], [ 13.298326109594829, 52.50216257864799 ], [ 13.298316959155784, 52.50226616876602 ], [ 13.298261494202054, 52.50236588372988 ], [ 13.298252145752533, 52.50236359316667 ], [ 13.298240017877141, 52.502386456900325 ], [ 13.298253437570803, 52.502397665068457 ], [ 13.298356278654442, 52.502420479565728 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 100, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.297089581990994, 52.502338271006813 ], [ 13.297092081564166, 52.502324033432998 ], [ 13.297092198615463, 52.502321005078613 ], [ 13.297093344332088, 52.502319685475683 ], [ 13.297092295382486, 52.502318501519113 ], [ 13.297092587003331, 52.502310956693087 ], [ 13.297086376680065, 52.502303944964972 ], [ 13.29708511742165, 52.502302522411298 ], [ 13.297071847749937, 52.502292816002495 ], [ 13.297058579556618, 52.502283109613472 ], [ 13.297043154596798, 52.502278924252316 ], [ 13.297040406492984, 52.502277292350527 ], [ 13.297025098260026, 52.502269934768485 ], [ 13.296988177727759, 52.502267024228495 ], [ 13.296966657330074, 52.502269093516212 ], [ 13.296963752109788, 52.502269849215772 ], [ 13.29693436303892, 52.502269426150939 ], [ 13.296920817705143, 52.502266852083757 ], [ 13.296917336398103, 52.502256097028123 ], [ 13.296884632436539, 52.502244921290703 ], [ 13.296871226459858, 52.502238780610803 ], [ 13.296851790650875, 52.502237311274072 ], [ 13.296834488293616, 52.502231115396143 ], [ 13.296824212375206, 52.502234067631527 ], [ 13.296810104583514, 52.50223472408981 ], [ 13.296799269600273, 52.50223456810356 ], [ 13.296799422591622, 52.502230610575054 ], [ 13.29678801076763, 52.502223309056824 ], [ 13.296768714288561, 52.502218273998174 ], [ 13.296749417848702, 52.502213238037776 ], [ 13.296722374674236, 52.502206901005152 ], [ 13.296714895920221, 52.502204270396589 ], [ 13.296713850637717, 52.50220360168597 ], [ 13.296712958276327, 52.502203588838363 ], [ 13.29670122196015, 52.502199460135202 ], [ 13.296677845334646, 52.502199123569852 ], [ 13.296656737157898, 52.502190492896219 ], [ 13.296643009481434, 52.502192674322693 ], [ 13.296617684685742, 52.502192309695829 ], [ 13.296590687474431, 52.502184784655995 ], [ 13.2965556232863, 52.502184279784188 ], [ 13.296538089720084, 52.502184027323189 ], [ 13.296537681111355, 52.50218438288654 ], [ 13.296530022728591, 52.502191047495515 ], [ 13.29652469540609, 52.502193629490314 ], [ 13.296523217047437, 52.502193720593773 ], [ 13.296517837536932, 52.502196852099225 ], [ 13.296488744795319, 52.502199969435154 ], [ 13.296476689505969, 52.502209311251022 ], [ 13.296462638594463, 52.502219813867697 ], [ 13.296446411125562, 52.502236232830164 ], [ 13.296453928014927, 52.502243478296599 ], [ 13.29646082436104, 52.502242271176783 ], [ 13.296460896027281, 52.502242780212377 ], [ 13.296464792380318, 52.502242836317635 ], [ 13.296486717045074, 52.502238999874677 ], [ 13.296498595261953, 52.502247689188557 ], [ 13.296511725416769, 52.502260962266924 ], [ 13.296530977354649, 52.50226718716312 ], [ 13.296585567879056, 52.502266783653411 ], [ 13.296593728279506, 52.502257385746788 ], [ 13.296618664152252, 52.502246241418199 ], [ 13.296620566680181, 52.502246268810964 ], [ 13.296638717270627, 52.502253275353063 ], [ 13.296640251804163, 52.502264002387811 ], [ 13.296624254173185, 52.502274477893828 ], [ 13.296631539837893, 52.502287666809146 ], [ 13.296648843660524, 52.502293862737879 ], [ 13.296669858485105, 52.502304871143906 ], [ 13.296699033742472, 52.502306480733722 ], [ 13.296728253491516, 52.502306901419153 ], [ 13.296720138557404, 52.502293057698935 ], [ 13.296720144567574, 52.502292902237471 ], [ 13.296722661794847, 52.50229071135464 ], [ 13.296733044047656, 52.502288972674684 ], [ 13.296739624885278, 52.502293182698772 ], [ 13.29675312278224, 52.502296945641469 ], [ 13.296770472552049, 52.502301953575156 ], [ 13.296774045748039, 52.502310330882679 ], [ 13.296789781685574, 52.502314437137755 ], [ 13.296790178688344, 52.50231849789116 ], [ 13.296803538752252, 52.50232582655773 ], [ 13.296830765848464, 52.50232740806814 ], [ 13.296829542677829, 52.502320021259372 ], [ 13.296846519309497, 52.502323248045037 ], [ 13.296846211944663, 52.502331199046964 ], [ 13.296855677097369, 52.502338472534767 ], [ 13.296877105617781, 52.50233878101978 ], [ 13.296871517729235, 52.502332286244375 ], [ 13.296872615780574, 52.502331971175153 ], [ 13.296880082457061, 52.502326758563107 ], [ 13.296889300239483, 52.502325871657149 ], [ 13.296904838254889, 52.502327284876152 ], [ 13.29691416554553, 52.502338124987702 ], [ 13.296921205069781, 52.502342628424358 ], [ 13.29692090378202, 52.502343371257055 ], [ 13.296920582118799, 52.502351692491288 ], [ 13.296930353261697, 52.502353032579819 ], [ 13.296932864693867, 52.502358614514172 ], [ 13.296969877209799, 52.502359147319709 ], [ 13.296983376619639, 52.502362910257617 ], [ 13.296989106316445, 52.502366118082698 ], [ 13.296989885093074, 52.502374100903907 ], [ 13.297017158181044, 52.502374493495566 ], [ 13.29702373446213, 52.502370665292268 ], [ 13.297041633860033, 52.502368507007432 ], [ 13.297053506769371, 52.502363919760953 ], [ 13.297073538520102, 52.502349934551738 ], [ 13.297089581990994, 52.502338271006813 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 101, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.297902582082846, 52.502891630072604 ], [ 13.297978823667597, 52.502765702692116 ], [ 13.297979253797143, 52.502764980591948 ], [ 13.298003145486824, 52.502725523805729 ], [ 13.298002615077976, 52.502725409179668 ], [ 13.297897934417936, 52.50270283045613 ], [ 13.297883686928456, 52.502724832870207 ], [ 13.297941898875639, 52.502731617159441 ], [ 13.297884525303433, 52.502854496422941 ], [ 13.297820698256842, 52.502841683630116 ], [ 13.297816387008641, 52.502852326538402 ], [ 13.297817600312221, 52.502871375695442 ], [ 13.297840609879609, 52.502881222152631 ], [ 13.297863803151891, 52.502886313997713 ], [ 13.297889128362749, 52.50288667836125 ], [ 13.297902582082846, 52.502891630072604 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 102, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298542955647271, 52.502305655610982 ], [ 13.298568464147998, 52.502301265216467 ], [ 13.298571855510598, 52.502314398002348 ], [ 13.298581045510371, 52.50232880371879 ], [ 13.298596721320932, 52.502326650084534 ], [ 13.298600755420221, 52.50232313948807 ], [ 13.29861837941006, 52.502321013868404 ], [ 13.298637584296415, 52.502328427280439 ], [ 13.298643199292213, 52.502334455716792 ], [ 13.298662266493727, 52.502345434857844 ], [ 13.298676144955845, 52.502353426225326 ], [ 13.298684327033891, 52.502340212618215 ], [ 13.298692185648743, 52.502311261535354 ], [ 13.298727010935119, 52.502315437945114 ], [ 13.298729557992612, 52.502293813842478 ], [ 13.298720004326688, 52.502293365362014 ], [ 13.298725205707544, 52.502187930977193 ], [ 13.298742153534819, 52.502188166598749 ], [ 13.298743917393649, 52.502147066156603 ], [ 13.298752881995739, 52.502147468401418 ], [ 13.298753390822135, 52.502124599375925 ], [ 13.298525605926939, 52.502118774584545 ], [ 13.298522804729453, 52.502148960957499 ], [ 13.298523463337977, 52.50214896053928 ], [ 13.298524117613198, 52.502148996023593 ], [ 13.298524769652442, 52.502149051256403 ], [ 13.298525409926286, 52.502149144083113 ], [ 13.29852604217807, 52.502149253877732 ], [ 13.298526655371175, 52.502149399363113 ], [ 13.298527256055142, 52.502149563550098 ], [ 13.298527828949325, 52.502149760604951 ], [ 13.298528387965927, 52.502149973644343 ], [ 13.298528910426908, 52.502150217627246 ], [ 13.298529413154808, 52.502150476611448 ], [ 13.298529873575742, 52.502150762859934 ], [ 13.298530311387957, 52.502151062270052 ], [ 13.298530702614341, 52.502151385286489 ], [ 13.298531068391069, 52.502151718726346 ], [ 13.298531380323359, 52.502152072970702 ], [ 13.298531666944768, 52.502152434044035 ], [ 13.298531894005091, 52.502152811344047 ], [ 13.298532094351382, 52.502153193654614 ], [ 13.298532232434459, 52.502153585859169 ], [ 13.298532340927862, 52.502153981234635 ], [ 13.298532390241885, 52.502154382951929 ], [ 13.298532407194692, 52.502154783304746 ], [ 13.298532362231224, 52.502155184565297 ], [ 13.298532286448509, 52.502155582685269 ], [ 13.298532150430292, 52.502155976342436 ], [ 13.298531985134764, 52.50215636508289 ], [ 13.29853175991606, 52.502156741272998 ], [ 13.298530165100352, 52.502173201027993 ], [ 13.298542522028786, 52.502174807447837 ], [ 13.298541295294415, 52.502193334181698 ], [ 13.298554029201384, 52.502193801440548 ], [ 13.298550184033463, 52.502275209225587 ], [ 13.29853706706723, 52.50227474095297 ], [ 13.298534078908791, 52.502292256916967 ], [ 13.298546261668283, 52.502293719669282 ], [ 13.298507330606384, 52.502362322869743 ], [ 13.29848032150883, 52.502368485416142 ], [ 13.298471790660392, 52.502383670261842 ], [ 13.298481805796019, 52.502374955261431 ], [ 13.298507406205699, 52.502368186227699 ], [ 13.298519598854647, 52.502355277570537 ], [ 13.298527988429807, 52.50233993514167 ], [ 13.298532711166482, 52.502318593188079 ], [ 13.298542955647271, 52.502305655610982 ] ], [ [ 13.298661844027198, 52.502167587991181 ], [ 13.298673852937409, 52.502159434825799 ], [ 13.298691109622759, 52.502166819313963 ], [ 13.298706419575971, 52.502174176703832 ], [ 13.298707908702886, 52.502186092593377 ], [ 13.298701651031806, 52.50219670754295 ], [ 13.298691634695086, 52.5022037007272 ], [ 13.298675775330338, 52.502210608984754 ], [ 13.298656432758952, 52.502206762210847 ], [ 13.298660788175319, 52.502194930370173 ], [ 13.298665189498793, 52.502181909652073 ], [ 13.298661844027198, 52.502167587991181 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 103, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.296543871212537, 52.502365300638431 ], [ 13.296546279029613, 52.502353440829552 ], [ 13.296546738664336, 52.502341552969284 ], [ 13.296549284379724, 52.502326126532573 ], [ 13.296547749866546, 52.502315399496908 ], [ 13.296536658325913, 52.502299776700845 ], [ 13.296517315910311, 52.502295929578473 ], [ 13.296497697689107, 52.502299215708177 ], [ 13.296484198341407, 52.502295452715288 ], [ 13.29646625251763, 52.502305899248533 ], [ 13.29645057661677, 52.502308052599638 ], [ 13.296442645990115, 52.502311507015463 ], [ 13.2964303148398, 52.502327982081049 ], [ 13.296431757384662, 52.50234108686962 ], [ 13.296450824029769, 52.502352066362427 ], [ 13.296444657732573, 52.502360303435808 ], [ 13.296466178162516, 52.502358235142303 ], [ 13.296481900049308, 52.502354892913438 ], [ 13.29649345123325, 52.502358627854562 ], [ 13.296506857227127, 52.502364767678408 ], [ 13.29651655216921, 52.502366096813631 ], [ 13.296543871212537, 52.502365300638431 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 104, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.297317273075336, 52.502795190901097 ], [ 13.297317632137171, 52.5027946305214 ], [ 13.297309257616179, 52.502799505512201 ], [ 13.297299057132228, 52.502811254079916 ], [ 13.297290312081705, 52.502814508015561 ], [ 13.297297175371815, 52.502816369072072 ], [ 13.297297261419613, 52.502816391889404 ], [ 13.297297833003904, 52.502816546672605 ], [ 13.297548603914814, 52.502878250499172 ], [ 13.297561929328152, 52.502868562708301 ], [ 13.297573156820613, 52.502862683075818 ], [ 13.297506779447499, 52.50284430291876 ], [ 13.297317273075336, 52.502795190901097 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 105, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.297846792769501, 52.502331823908989 ], [ 13.297763022587304, 52.502315055726505 ], [ 13.297745298393075, 52.502349937465759 ], [ 13.297825394224073, 52.502367540227027 ], [ 13.297846792769501, 52.502331823908989 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 106, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.29641189032492, 52.50230035830247 ], [ 13.296412671753464, 52.502280149210819 ], [ 13.296396949888431, 52.502283491430717 ], [ 13.296382992349171, 52.502291616307012 ], [ 13.296371716986899, 52.502280748999169 ], [ 13.296370418791428, 52.502280410217644 ], [ 13.296345918565404, 52.502332753121813 ], [ 13.296350030154077, 52.502337530920038 ], [ 13.296357455135016, 52.502347153245452 ], [ 13.296373268934198, 52.502341434178135 ], [ 13.296393071067362, 52.502333392566115 ], [ 13.296399053521485, 52.50232991010003 ], [ 13.296413240922607, 52.50231584084289 ], [ 13.29641189032492, 52.50230035830247 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 107, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.29776095774306, 52.502723067059357 ], [ 13.297789327581437, 52.502679405720336 ], [ 13.297627116871199, 52.502644415610355 ], [ 13.297626738739606, 52.502654201600528 ], [ 13.297627906019319, 52.502674439635882 ], [ 13.297592931828646, 52.502671557294015 ], [ 13.29755809690117, 52.502665109232318 ], [ 13.297532863703719, 52.502662367046099 ], [ 13.29752761631347, 52.502646828445485 ], [ 13.29753619005322, 52.502626730585355 ], [ 13.297534423504372, 52.502624442075749 ], [ 13.297490723462323, 52.502615016207073 ], [ 13.297489620062221, 52.5026213031691 ], [ 13.29746026082703, 52.502624448379258 ], [ 13.297455059409545, 52.502607720899192 ], [ 13.297453004083916, 52.502606881212657 ], [ 13.297130473611634, 52.502537300191996 ], [ 13.29708711545865, 52.502607507084413 ], [ 13.297100429672119, 52.502616025493069 ], [ 13.297115601687995, 52.502626948817216 ], [ 13.29711699849261, 52.502641242474795 ], [ 13.297108378641775, 52.502662528280375 ], [ 13.297101237663508, 52.502667204323807 ], [ 13.297103643832303, 52.502672842282607 ], [ 13.297104993209164, 52.502688324795159 ], [ 13.297128186326793, 52.502693415884394 ], [ 13.297145903871716, 52.502688913653529 ], [ 13.297173269057923, 52.502686928458495 ], [ 13.297192519838696, 52.502693152329115 ], [ 13.297209914291983, 52.502696971302321 ], [ 13.297231021347178, 52.50270560185831 ], [ 13.297241175875254, 52.502695042172476 ], [ 13.297245439824481, 52.502685588140999 ], [ 13.29726881671492, 52.502685924596385 ], [ 13.297276194534446, 52.502696735720832 ], [ 13.297275597246969, 52.502712190213678 ], [ 13.297292901292943, 52.50271838694853 ], [ 13.297294390052169, 52.502730302851781 ], [ 13.297280385112199, 52.502739616688643 ], [ 13.297282011677252, 52.502747966861811 ], [ 13.297311554829232, 52.50274006529299 ], [ 13.297317721020146, 52.502731828173971 ], [ 13.297318272346535, 52.502717562557152 ], [ 13.297332827120121, 52.50269398307745 ], [ 13.297333332529325, 52.502680905438105 ], [ 13.297370253433074, 52.502683815873297 ], [ 13.297397296995289, 52.50269015276065 ], [ 13.297395027220375, 52.502698445958977 ], [ 13.29737522510071, 52.502706487738365 ], [ 13.297380426498576, 52.502723215221543 ], [ 13.297381869336585, 52.502736320000196 ], [ 13.297381383808952, 52.502739428468139 ], [ 13.297416121908764, 52.502749031104081 ], [ 13.297435262157897, 52.502707675438998 ], [ 13.297686446190344, 52.502764815587646 ], [ 13.297664004981035, 52.502810881943645 ], [ 13.297699391244196, 52.502803064355696 ], [ 13.29772726173894, 52.502788002289812 ], [ 13.29776095774306, 52.502723067059357 ] ], [ [ 13.29738868741039, 52.502610334334733 ], [ 13.297400742620152, 52.502600992425819 ], [ 13.297421665927583, 52.5026143775547 ], [ 13.297421344355769, 52.502622698790731 ], [ 13.297446347807433, 52.502631385382379 ], [ 13.297442039435962, 52.502642028319151 ], [ 13.297432022798837, 52.502649021393729 ], [ 13.297420563345383, 52.502642908790399 ], [ 13.297396451398441, 52.502661593488135 ], [ 13.297371631685918, 52.5026481522792 ], [ 13.297370603832489, 52.502624347634438 ], [ 13.297374958164401, 52.502612515823984 ], [ 13.29738868741039, 52.502610334334733 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 108, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.300324930541557, 52.502389776039685 ], [ 13.30032014557905, 52.502363791929305 ], [ 13.300273280023886, 52.502366520886603 ], [ 13.300276519729577, 52.5023925727102 ], [ 13.300324930541557, 52.502389776039685 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 109, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.300012963891158, 52.502347009107282 ], [ 13.30001953514021, 52.502338531311494 ], [ 13.300019742933411, 52.502338262762756 ], [ 13.300021169454276, 52.502336422080248 ], [ 13.300031093867375, 52.502331806538109 ], [ 13.300033151926757, 52.502331010717697 ], [ 13.30003702869257, 52.502329512742499 ], [ 13.300049103779564, 52.50233025449559 ], [ 13.300062307739942, 52.50233106551633 ], [ 13.300063423107947, 52.502329575515198 ], [ 13.300068473360856, 52.502322828248587 ], [ 13.30008025420638, 52.502320618451655 ], [ 13.300100147374906, 52.502310199355769 ], [ 13.300102691845732, 52.502294772831938 ], [ 13.300103242261933, 52.502280507193461 ], [ 13.300099758737005, 52.502269751305136 ], [ 13.300086442531823, 52.502261234106967 ], [ 13.300071133786691, 52.502253876914757 ], [ 13.30004413593011, 52.502246352657806 ], [ 13.300009025756772, 52.502247037686899 ], [ 13.299999479979927, 52.502247988455601 ], [ 13.299977718722159, 52.502250156430037 ], [ 13.299962670453304, 52.502255599258241 ], [ 13.299961905412927, 52.502255875983479 ], [ 13.299942331856231, 52.502257973787593 ], [ 13.299941919014064, 52.502268672790962 ], [ 13.299926151534569, 52.502273204360151 ], [ 13.299908847619845, 52.502272955699354 ], [ 13.299894982105476, 52.502272756447226 ], [ 13.299889506012486, 52.502263162354708 ], [ 13.299874058196536, 52.50225937175005 ], [ 13.299848641564607, 52.502261385570193 ], [ 13.299841392404776, 52.502268721621064 ], [ 13.299840529203136, 52.502269594850439 ], [ 13.299832415331412, 52.502277805007559 ], [ 13.299818365188603, 52.502288308029264 ], [ 13.29980064950758, 52.502292811584134 ], [ 13.299794208600389, 52.502308181206331 ], [ 13.299813415155931, 52.502315594450295 ], [ 13.299815042222697, 52.502323943694506 ], [ 13.299826362823808, 52.50233362268095 ], [ 13.299831682628565, 52.502336347043247 ], [ 13.299835920265496, 52.502338517280037 ], [ 13.299870892881572, 52.502341398936814 ], [ 13.299896217805665, 52.502341762868198 ], [ 13.299913749992665, 52.50234201481102 ], [ 13.299937219956721, 52.502339973003004 ], [ 13.299952849799379, 52.502339008965194 ], [ 13.299970290271295, 52.502341637756999 ], [ 13.29997993944496, 52.502344155487208 ], [ 13.299999419818272, 52.502344435412105 ], [ 13.300012963891158, 52.502347009107282 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 110, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.296941469338972, 52.502593516072835 ], [ 13.29690881108017, 52.502581151464454 ], [ 13.296872395839948, 52.502565163249699 ], [ 13.296826147719848, 52.502551413441189 ], [ 13.296785606316186, 52.502541314385205 ], [ 13.296738852700887, 52.502540641280177 ], [ 13.296713527704009, 52.502540276672164 ], [ 13.296712976185388, 52.502554542284926 ], [ 13.296609773945656, 52.502551866871684 ], [ 13.296612135790868, 52.502541195937617 ], [ 13.29660244080732, 52.502539866809933 ], [ 13.296571930328891, 52.502540358100568 ], [ 13.296591907288992, 52.502548907763639 ], [ 13.296605129491304, 52.502559803080281 ], [ 13.296617985449526, 52.502580209423776 ], [ 13.296645258659781, 52.502580602102206 ], [ 13.296701659909758, 52.502583792321111 ], [ 13.296760148683097, 52.502583444852974 ], [ 13.296786962288776, 52.502595726258548 ], [ 13.2968101093595, 52.502602006285485 ], [ 13.296828946412916, 52.502618930098635 ], [ 13.296842352498064, 52.502625070783893 ], [ 13.296861512758722, 52.502633672481053 ], [ 13.296890778685336, 52.502632904252117 ], [ 13.296904553918161, 52.502629533943271 ], [ 13.296910812083922, 52.502618919093763 ], [ 13.296934464641767, 52.502612123257137 ], [ 13.296964006289919, 52.502604221753494 ], [ 13.296967141480799, 52.502603425307321 ], [ 13.296941469338972, 52.502593516072835 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 111, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299345245074996, 52.502662951010755 ], [ 13.299369666786765, 52.502622364186223 ], [ 13.299371663784818, 52.502622807387482 ], [ 13.299372326719737, 52.502621473630043 ], [ 13.29935674262267, 52.502621249611224 ], [ 13.299348261495266, 52.502638969855255 ], [ 13.299323074085153, 52.502635039172546 ], [ 13.299341799506369, 52.502604382181993 ], [ 13.299254549619707, 52.502592422993764 ], [ 13.29923990411462, 52.502618380474274 ], [ 13.299272561597119, 52.502630744423669 ], [ 13.299262133709348, 52.502648436675813 ], [ 13.299345245074996, 52.502662951010755 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 112, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298097200539562, 52.502329454474491 ], [ 13.298143493256894, 52.502245324281795 ], [ 13.298149149452373, 52.502164119684025 ], [ 13.298135750724478, 52.502147870431294 ], [ 13.298062248694688, 52.50214647139417 ], [ 13.298060397011373, 52.502173695325858 ], [ 13.298020948864128, 52.502173208742093 ], [ 13.297989390184064, 52.502187148760306 ], [ 13.297956497544135, 52.502172499098499 ], [ 13.297866477375516, 52.50216252564212 ], [ 13.297856832168542, 52.502172456130943 ], [ 13.297830225171147, 52.502171987000203 ], [ 13.297807828217005, 52.502156018243305 ], [ 13.297683038305186, 52.50214219244792 ], [ 13.297681475515574, 52.502189808109556 ], [ 13.297649297604931, 52.502241391633937 ], [ 13.297768902893297, 52.502259148450655 ], [ 13.297801669699334, 52.502247233611378 ], [ 13.297831982614859, 52.502252269657774 ], [ 13.297838278284571, 52.502265083705133 ], [ 13.297913897780528, 52.50227677861313 ], [ 13.297943176812566, 52.502270515783209 ], [ 13.297928516936327, 52.502267080622929 ], [ 13.297905461736359, 52.502258423061107 ], [ 13.297899984607904, 52.502248828859017 ], [ 13.297906426199139, 52.502233458446682 ], [ 13.297918527159815, 52.502222926707205 ], [ 13.297924417586071, 52.50222182281491 ], [ 13.297938696326959, 52.502205375616604 ], [ 13.297937482982775, 52.502186326458492 ], [ 13.297955108420007, 52.502184200958595 ], [ 13.297976261308991, 52.502191642504698 ], [ 13.29801535966177, 52.502188636379344 ], [ 13.298029272451886, 52.502181699306874 ], [ 13.298058583990178, 52.502179741909444 ], [ 13.298074215283922, 52.502178778140838 ], [ 13.298101534191057, 52.502177981604717 ], [ 13.298106963958048, 52.502188764653567 ], [ 13.298095046751252, 52.502194540905315 ], [ 13.298104512118273, 52.502201813396269 ], [ 13.298119636848854, 52.502213925449027 ], [ 13.298132675638394, 52.502229576105428 ], [ 13.298132216433329, 52.502241463975707 ], [ 13.298135469889617, 52.502258163403724 ], [ 13.298127034270433, 52.5022746946808 ], [ 13.29811316886285, 52.502280442908848 ], [ 13.298095544866626, 52.502282568453168 ], [ 13.298077873505411, 52.50228588195192 ], [ 13.29806586441657, 52.502294035954073 ], [ 13.298048332265463, 52.502293783737656 ], [ 13.298019065105393, 52.502294552233828 ], [ 13.298013892938965, 52.502295522604612 ], [ 13.298019824596604, 52.502296402762312 ], [ 13.29800410566015, 52.502323013598328 ], [ 13.298076899566114, 52.502340424824894 ], [ 13.298097200539562, 52.502329454474491 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 113, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299072762241492, 52.502264506574853 ], [ 13.299069555800203, 52.502246618313293 ], [ 13.2990559185449, 52.50224642224449 ], [ 13.299034168782175, 52.502254435397859 ], [ 13.299020257596897, 52.502261372610732 ], [ 13.299004901659902, 52.502255204138329 ], [ 13.298999424291214, 52.502245609985088 ], [ 13.298978087594856, 52.502242924129931 ], [ 13.298958148294272, 52.502254531912655 ], [ 13.298942288917328, 52.502261441104686 ], [ 13.29894364040404, 52.502276923623846 ], [ 13.29895672540834, 52.502291385314535 ], [ 13.298973890390423, 52.502301147516903 ], [ 13.29898276967981, 52.502304714323259 ], [ 13.298989246338884, 52.502307315993413 ], [ 13.298989062769621, 52.502312070604354 ], [ 13.298994492735847, 52.502322854512919 ], [ 13.299021765820452, 52.50232324664232 ], [ 13.299035403099287, 52.502323442715252 ], [ 13.299046907159862, 52.502328365366459 ], [ 13.299070651038537, 52.502319191343418 ], [ 13.299070834482242, 52.502318523236454 ], [ 13.299072920477597, 52.502310898109577 ], [ 13.299069574864353, 52.502296576459308 ], [ 13.299060202621597, 52.502286925411816 ], [ 13.29906840840068, 52.502276338452596 ], [ 13.299072762241492, 52.502264506574853 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 114, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299727455257582, 52.50234638577696 ], [ 13.29972823133431, 52.502343188866412 ], [ 13.299778806898116, 52.502344352690173 ], [ 13.299779349622664, 52.50234349913184 ], [ 13.299780020613857, 52.502342681583464 ], [ 13.299780755668982, 52.502341883837289 ], [ 13.299781612684404, 52.50234113279997 ], [ 13.299782526192924, 52.50234040685077 ], [ 13.299783548027319, 52.502339737304673 ], [ 13.299784623166998, 52.502339099094812 ], [ 13.299785790122362, 52.502338525142925 ], [ 13.299787001374291, 52.502337986893345 ], [ 13.299788292384127, 52.50233751992144 ], [ 13.299789617209253, 52.502337092996804 ], [ 13.299791003878932, 52.502336743386238 ], [ 13.29979241549397, 52.502336434594596 ], [ 13.299793868129791, 52.502336208212469 ], [ 13.299795338244188, 52.502336025239359 ], [ 13.299796828590241, 52.502335928872569 ], [ 13.299798326107062, 52.502335875766647 ], [ 13.299799824712441, 52.502335908991974 ], [ 13.299831682628565, 52.502336347043247 ], [ 13.299826362823808, 52.50233362268095 ], [ 13.299815042222697, 52.502323943694506 ], [ 13.299813415155931, 52.502315594450295 ], [ 13.299794208600389, 52.502308181206331 ], [ 13.29980064950758, 52.502292811584134 ], [ 13.299818365188603, 52.502288308029264 ], [ 13.299832415331412, 52.502277805007559 ], [ 13.299840529203136, 52.502269594850439 ], [ 13.299841392404776, 52.502268721621064 ], [ 13.299841584583875, 52.502236938652935 ], [ 13.299864442777285, 52.502236660235695 ], [ 13.299851738348815, 52.502230083114569 ], [ 13.299852193856665, 52.502216369971343 ], [ 13.299843970717115, 52.502211108825385 ], [ 13.299844239873581, 52.502162860458775 ], [ 13.299826685652983, 52.502153025355497 ], [ 13.29982251909454, 52.502154129839745 ], [ 13.299818213708054, 52.50215501384227 ], [ 13.299813849336726, 52.502155784606835 ], [ 13.299809393675041, 52.502156324783421 ], [ 13.299804904200551, 52.502156748487245 ], [ 13.299800372237868, 52.502156936909714 ], [ 13.299795831599717, 52.502157006523333 ], [ 13.299791297136805, 52.502156839756616 ], [ 13.299786777593937, 52.50215655362112 ], [ 13.299782315661465, 52.502156034541855 ], [ 13.299777893578339, 52.502155399149345 ], [ 13.299773576088397, 52.502154535084806 ], [ 13.299769324780288, 52.50215355958111 ], [ 13.299765224805414, 52.502152365967461 ], [ 13.299761211385315, 52.50215106750133 ], [ 13.299757395969122, 52.502149563284554 ], [ 13.29972105482898, 52.502149085056452 ], [ 13.299714714690658, 52.502142219957761 ], [ 13.299703842878635, 52.502142675110647 ], [ 13.29968354155981, 52.502155919606729 ], [ 13.299688776350784, 52.502158899003412 ], [ 13.299681963340056, 52.502237548813135 ], [ 13.299674069470127, 52.502241661229974 ], [ 13.299669019456649, 52.502344759203716 ], [ 13.299727455257582, 52.50234638577696 ] ], [ [ 13.29975281232551, 52.502207060944109 ], [ 13.29976296610176, 52.50219650193349 ], [ 13.299795577545204, 52.502210054615837 ], [ 13.29980055041535, 52.502232726390829 ], [ 13.299799724662662, 52.502254124396089 ], [ 13.299795231907487, 52.502269522914816 ], [ 13.299790509752384, 52.50229086582285 ], [ 13.299764817853319, 52.502300011993512 ], [ 13.299747606813273, 52.502291438782287 ], [ 13.299748891396632, 52.502258151998944 ], [ 13.299752261762652, 52.502221327478807 ], [ 13.29975281232551, 52.502207060944109 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 115, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298019065105393, 52.502294552233828 ], [ 13.298048332265463, 52.502293783737656 ], [ 13.29806586441657, 52.502294035954073 ], [ 13.298077873505411, 52.50228588195192 ], [ 13.298095544866626, 52.502282568453168 ], [ 13.29811316886285, 52.502280442908848 ], [ 13.298127034270433, 52.5022746946808 ], [ 13.298135469889617, 52.502258163403724 ], [ 13.298132216433329, 52.502241463975707 ], [ 13.298132675638394, 52.502229576105428 ], [ 13.298119636848854, 52.502213925449027 ], [ 13.298104512118273, 52.502201813396269 ], [ 13.298095046751252, 52.502194540905315 ], [ 13.298106963958048, 52.502188764653567 ], [ 13.298101534191057, 52.502177981604717 ], [ 13.298074215283922, 52.502178778140838 ], [ 13.298058583990178, 52.502179741909444 ], [ 13.298029272451886, 52.502181699306874 ], [ 13.29801535966177, 52.502188636379344 ], [ 13.297976261308991, 52.502191642504698 ], [ 13.297955108420007, 52.502184200958595 ], [ 13.297937482982775, 52.502186326458492 ], [ 13.297938696326959, 52.502205375616604 ], [ 13.297924417586071, 52.50222182281491 ], [ 13.297918527159815, 52.502222926707205 ], [ 13.297906426199139, 52.502233458446682 ], [ 13.297899984607904, 52.502248828859017 ], [ 13.297905461736359, 52.502258423061107 ], [ 13.297928516936327, 52.502267080622929 ], [ 13.297943176812566, 52.502270515783209 ], [ 13.297955560327305, 52.502273417381559 ], [ 13.297965070108988, 52.50227950188421 ], [ 13.297978339975835, 52.502289208194433 ], [ 13.298007284168161, 52.502296761824695 ], [ 13.298013892938965, 52.502295522604612 ], [ 13.298019065105393, 52.502294552233828 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 116, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.297065618216452, 52.502598871784784 ], [ 13.297103425457363, 52.502531466684623 ], [ 13.296827003258365, 52.50247184631656 ], [ 13.29682025566391, 52.502476331997919 ], [ 13.296791173648037, 52.502472345604843 ], [ 13.296775634113024, 52.502470932349347 ], [ 13.296770204674822, 52.502460148343694 ], [ 13.296762802831402, 52.502458004371391 ], [ 13.296762481579693, 52.502457929614899 ], [ 13.296448632062456, 52.502390236674046 ], [ 13.296463189403992, 52.502399560686719 ], [ 13.296478453124461, 52.502408106339345 ], [ 13.29647595334789, 52.502422343898253 ], [ 13.296451657283658, 52.502445783006408 ], [ 13.296439692350775, 52.502452747943323 ], [ 13.296429539196653, 52.502463306682188 ], [ 13.296424861361654, 52.502483460565379 ], [ 13.296434954387625, 52.502491870626493 ], [ 13.296492298183942, 52.502504975644214 ], [ 13.296552275369566, 52.502516545088561 ], [ 13.296634140846026, 52.502516534273539 ], [ 13.296706171980938, 52.502518760889366 ], [ 13.296780152785814, 52.502521015530121 ], [ 13.296826815969249, 52.502524065493269 ], [ 13.296882895420108, 52.502535578656193 ], [ 13.296909800981508, 52.502545481383301 ], [ 13.296950250505628, 52.502557958149183 ], [ 13.29697887450927, 52.502573833286014 ], [ 13.296996039155198, 52.502583595772123 ], [ 13.297013791420927, 52.502593441341389 ], [ 13.297017064069461, 52.502593091038541 ], [ 13.297017427805413, 52.502595459165491 ], [ 13.29702466319201, 52.502599470898083 ], [ 13.297065618216452, 52.502598871784784 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 117, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.300019755104996, 52.502338520086298 ], [ 13.300019742933411, 52.502338262762756 ], [ 13.30001953514021, 52.502338531311494 ], [ 13.300019755104996, 52.502338520086298 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 118, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.30016377136913, 52.502176703918977 ], [ 13.300160150229493, 52.50216951466664 ], [ 13.300138675885162, 52.502170395654915 ], [ 13.300111402879351, 52.502170003783711 ], [ 13.300095773065056, 52.502170968741694 ], [ 13.300085987781317, 52.502172017676578 ], [ 13.30007597166734, 52.502179010980008 ], [ 13.300065772097907, 52.502190758896312 ], [ 13.300065313414928, 52.502202646778535 ], [ 13.300056971744416, 52.502216800464602 ], [ 13.300029377636285, 52.502224729822132 ], [ 13.300027154219848, 52.502231835096573 ], [ 13.300042508857061, 52.502238002517657 ], [ 13.300063845620301, 52.502240688181359 ], [ 13.300073357162574, 52.502246772538122 ], [ 13.300084631964879, 52.502257639479701 ], [ 13.300097994004936, 52.50226496869859 ], [ 13.300109360559356, 52.502273457881657 ], [ 13.300110941810239, 52.502282996000481 ], [ 13.300114333597691, 52.502296129644684 ], [ 13.300133538765216, 52.502303541917314 ], [ 13.300164983400816, 52.502296857397418 ], [ 13.300175183003896, 52.502285108574156 ], [ 13.300194984397303, 52.502277067218238 ], [ 13.300197482964476, 52.502262829570157 ], [ 13.300209445787097, 52.502255864226342 ], [ 13.300227116983143, 52.502252550407739 ], [ 13.300229568198436, 52.502239501615875 ], [ 13.30023117504075, 52.502238104090978 ], [ 13.300245704009086, 52.50222545990006 ], [ 13.300242358054366, 52.502211137381003 ], [ 13.300237201455465, 52.502193222034016 ], [ 13.30023375876446, 52.502187975651175 ], [ 13.300231677991961, 52.502184815915065 ], [ 13.300212289422429, 52.502182158272632 ], [ 13.300192900820663, 52.502179501525703 ], [ 13.30016377136913, 52.502176703918977 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 119, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.296418064555114, 52.502530941505476 ], [ 13.296487308473955, 52.502531938581498 ], [ 13.296498767802058, 52.502538050375406 ], [ 13.296527989174168, 52.50253847113278 ], [ 13.296532386961939, 52.502536648098854 ], [ 13.296509117428849, 52.502533765832077 ], [ 13.29644719351541, 52.502522168334004 ], [ 13.296434925227569, 52.502519221482551 ], [ 13.296431091224317, 52.50252399185932 ], [ 13.296418064555114, 52.502530941505476 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 120, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.300049103779564, 52.50233025449559 ], [ 13.30003702869257, 52.502329512742499 ], [ 13.300033151926757, 52.502331010717697 ], [ 13.300049103779564, 52.50233025449559 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 121, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.296801398761433, 52.502179491599783 ], [ 13.296817351794271, 52.502170205864907 ], [ 13.296842676579855, 52.502170570448932 ], [ 13.296850329926887, 52.502174249241179 ], [ 13.296864105018484, 52.502170878935623 ], [ 13.296874397346251, 52.502156753550267 ], [ 13.296892159218679, 52.502151061559438 ], [ 13.296907972879112, 52.502145342419325 ], [ 13.296910288706151, 52.502135859455329 ], [ 13.296902679810339, 52.502130992668214 ], [ 13.296900915466439, 52.502126209118238 ], [ 13.296887693317915, 52.502115313834359 ], [ 13.296874333337533, 52.502107984278858 ], [ 13.296870896538771, 52.50209604032441 ], [ 13.296843991258493, 52.502086137590162 ], [ 13.296824648908279, 52.502082290518445 ], [ 13.296791623414414, 52.502079435990439 ], [ 13.296781560879815, 52.502087616988277 ], [ 13.296742278696991, 52.502095378210221 ], [ 13.296715005785675, 52.502094985556681 ], [ 13.296699421896284, 52.50209476118949 ], [ 13.296685646816425, 52.502098131476004 ], [ 13.296677763681558, 52.502100397053354 ], [ 13.296673132000134, 52.502119361174216 ], [ 13.296676752564348, 52.50212655052848 ], [ 13.296688348196017, 52.502129096553119 ], [ 13.296670402488605, 52.502139543118567 ], [ 13.296660156063577, 52.502152479609713 ], [ 13.296644112549105, 52.502164143096373 ], [ 13.296657104832757, 52.502180982786918 ], [ 13.296668288314232, 52.502194227820112 ], [ 13.29670530068702, 52.502194760707241 ], [ 13.296724644548046, 52.502198607819906 ], [ 13.296749831465084, 52.502202539052043 ], [ 13.296771581642652, 52.502194525423285 ], [ 13.296795142072089, 52.502190107364427 ], [ 13.296801398761433, 52.502179491599783 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 122, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.296418064555114, 52.502530941505476 ], [ 13.296415229888282, 52.502530900686892 ], [ 13.296407208783652, 52.502536731973983 ], [ 13.296418064555114, 52.502530941505476 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 123, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299069848682485, 52.502353064089306 ], [ 13.29907507604446, 52.50231864445994 ], [ 13.299070834482238, 52.50231852323644 ], [ 13.299070651038534, 52.50231919134341 ], [ 13.299046907159859, 52.502328365366445 ], [ 13.29903540309928, 52.502323442715245 ], [ 13.299021765820447, 52.502323246642312 ], [ 13.298994492735842, 52.502322854512904 ], [ 13.298989062769618, 52.502312070604361 ], [ 13.298989246338881, 52.502307315993406 ], [ 13.298982769679803, 52.502304714323259 ], [ 13.298951179996971, 52.502296642764229 ], [ 13.29894748911217, 52.502341789418118 ], [ 13.298994150802955, 52.502344838504975 ], [ 13.298993875397416, 52.502351971769365 ], [ 13.299069848682485, 52.502353064089306 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 124, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.300063423107947, 52.502329575515198 ], [ 13.300200825791286, 52.502323059369225 ], [ 13.300203029069836, 52.502329688775909 ], [ 13.300241643582043, 52.502327422132588 ], [ 13.300239496382929, 52.502307080137925 ], [ 13.300230724572355, 52.502306453298374 ], [ 13.30022252374553, 52.502260437139803 ], [ 13.300235246092123, 52.502260670279838 ], [ 13.30023117504075, 52.502238104090978 ], [ 13.300229568198436, 52.502239501615875 ], [ 13.300227116983143, 52.502252550407739 ], [ 13.300209445787097, 52.502255864226342 ], [ 13.300197482964476, 52.502262829570157 ], [ 13.300194984397303, 52.502277067218238 ], [ 13.300175183003896, 52.502285108574156 ], [ 13.300164983400816, 52.502296857397418 ], [ 13.300133538765216, 52.502303541917314 ], [ 13.300114333597691, 52.502296129644684 ], [ 13.300110941810239, 52.502282996000481 ], [ 13.300109360559356, 52.502273457881657 ], [ 13.300097994004936, 52.50226496869859 ], [ 13.300084631964879, 52.502257639479701 ], [ 13.300073357162574, 52.502246772538122 ], [ 13.300063845620301, 52.502240688181359 ], [ 13.300042508857061, 52.502238002517657 ], [ 13.300027154219848, 52.502231835096573 ], [ 13.300029377636285, 52.502224729822132 ], [ 13.300056971744416, 52.502216800464602 ], [ 13.300065313414928, 52.502202646778535 ], [ 13.300065772097907, 52.502190758896312 ], [ 13.30007597166734, 52.502179010980008 ], [ 13.300085987781317, 52.502172017676578 ], [ 13.300095773065056, 52.502170968741694 ], [ 13.300111402879351, 52.502170003783711 ], [ 13.300138675885162, 52.502170395654915 ], [ 13.300160150229493, 52.50216951466664 ], [ 13.30016377136913, 52.502176703918977 ], [ 13.300192900820663, 52.502179501525703 ], [ 13.300212289422429, 52.502182158272632 ], [ 13.300231677991961, 52.502184815915065 ], [ 13.30023375876446, 52.502187975651175 ], [ 13.300239781824484, 52.502184997982951 ], [ 13.300235808692392, 52.502158709940367 ], [ 13.300228708633119, 52.502155042015616 ], [ 13.300111058124687, 52.502153621339211 ], [ 13.300110644615701, 52.502161627465817 ], [ 13.300052203305556, 52.502160684333376 ], [ 13.300052972197223, 52.502156336442511 ], [ 13.299998273003011, 52.50215517012478 ], [ 13.299996629285197, 52.502180319199141 ], [ 13.300001501690302, 52.502180548357785 ], [ 13.299999479979927, 52.502247988455601 ], [ 13.300009025756772, 52.502247037686899 ], [ 13.30004413593011, 52.502246352657806 ], [ 13.300071133786691, 52.502253876914757 ], [ 13.300086442531823, 52.502261234106967 ], [ 13.300099758737005, 52.502269751305136 ], [ 13.300103242261933, 52.502280507193461 ], [ 13.300102691845732, 52.502294772831938 ], [ 13.300100147374906, 52.502310199355769 ], [ 13.30008025420638, 52.502320618451655 ], [ 13.300068473360856, 52.502322828248587 ], [ 13.300063423107947, 52.502329575515198 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 125, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.297383481432673, 52.502147428579512 ], [ 13.297378143736704, 52.502134267745994 ], [ 13.297356623420709, 52.502136337105405 ], [ 13.29733542324743, 52.502130084304738 ], [ 13.297310054005161, 52.502130908723984 ], [ 13.297297556271626, 52.502135120161604 ], [ 13.297292247885519, 52.502136908539029 ], [ 13.297286354309653, 52.502138894392708 ], [ 13.297276017677797, 52.502154207814023 ], [ 13.297271615913159, 52.502167229375644 ], [ 13.297271018635486, 52.502182683869833 ], [ 13.297294257454693, 52.502186586048467 ], [ 13.297307710894422, 52.502191537825688 ], [ 13.297321254756232, 52.502194111827414 ], [ 13.297352332198168, 52.502196938170542 ], [ 13.297370048082296, 52.502192434984096 ], [ 13.297376443904822, 52.502178253478384 ], [ 13.297378851486792, 52.502166393650157 ], [ 13.297383481432673, 52.502147428579512 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 126, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299795577545204, 52.502210054615823 ], [ 13.299762966101754, 52.502196501933483 ], [ 13.299752812325506, 52.502207060944095 ], [ 13.299752261762649, 52.502221327478814 ], [ 13.299748891396629, 52.502258151998923 ], [ 13.299747606813272, 52.502291438782279 ], [ 13.299764817853315, 52.502300011993505 ], [ 13.299790509752382, 52.502290865822843 ], [ 13.299795231907485, 52.502269522914808 ], [ 13.299799724662659, 52.502254124396089 ], [ 13.29980055041535, 52.502232726390815 ], [ 13.299795577545204, 52.502210054615823 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 127, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299962670453304, 52.502255599258241 ], [ 13.29990985739871, 52.502254614652635 ], [ 13.299908847619845, 52.502272955699354 ], [ 13.299926151534569, 52.502273204360151 ], [ 13.299941919014064, 52.502268672790962 ], [ 13.299942331856231, 52.502257973787593 ], [ 13.299961905412927, 52.502255875983479 ], [ 13.299962670453304, 52.502255599258241 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 128, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.30035928141019, 52.502025821610133 ], [ 13.3003528183384, 52.501935597262815 ], [ 13.300333152602526, 52.50193531473203 ], [ 13.300329760740398, 52.501922181991617 ], [ 13.300347430355508, 52.501918867233847 ], [ 13.300351300378582, 52.501914411043188 ], [ 13.300349385745676, 52.501887695823669 ], [ 13.300346720440219, 52.501886741327802 ], [ 13.300319676894309, 52.501880406013115 ], [ 13.300310258597285, 52.501871943940735 ], [ 13.300306087080786, 52.501879021232178 ], [ 13.300284704611116, 52.50187752449164 ], [ 13.300274688596344, 52.501884517813068 ], [ 13.300289997283796, 52.501891874079952 ], [ 13.300260777755881, 52.501891454276262 ], [ 13.30024936393, 52.501884153964859 ], [ 13.300220005368727, 52.501887299866127 ], [ 13.300215881176046, 52.501893188297153 ], [ 13.300217185762557, 52.501909859663478 ], [ 13.300192044553944, 52.501904740289923 ], [ 13.300180723945084, 52.501895062236748 ], [ 13.300183222492386, 52.50188082458795 ], [ 13.300165965697593, 52.501873439417281 ], [ 13.300134979990105, 52.501868236955737 ], [ 13.300120792442199, 52.50188230665033 ], [ 13.30012214433477, 52.501897789160388 ], [ 13.300135185256917, 52.501913438724657 ], [ 13.300144603528683, 52.501921900810721 ], [ 13.300159913679398, 52.501929257115449 ], [ 13.300181708948406, 52.501920054873402 ], [ 13.300184825557508, 52.501940320886966 ], [ 13.30019211224012, 52.501953509592312 ], [ 13.300201715474644, 52.501957216182198 ], [ 13.300215672247225, 52.501949089949434 ], [ 13.300223281448226, 52.501953957425087 ], [ 13.300197589834895, 52.501963103692646 ], [ 13.300194816079488, 52.50198447461085 ], [ 13.300217825729995, 52.501994320607693 ], [ 13.300233181750293, 52.502000488923585 ], [ 13.300241477455238, 52.501987524102042 ], [ 13.300252845439804, 52.501996013292519 ], [ 13.300267603769877, 52.502017636101414 ], [ 13.300280874072286, 52.502027342157412 ], [ 13.300319834545235, 52.502027901902551 ], [ 13.30033931478216, 52.502028181770292 ], [ 13.300358886746581, 52.50202608387827 ], [ 13.30035928141019, 52.502025821610133 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 129, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299041393441252, 52.5021813723828 ], [ 13.29902603900139, 52.502175203934463 ], [ 13.299008275915037, 52.502180896226704 ], [ 13.298996312960593, 52.502187860549064 ], [ 13.298995853989181, 52.502199748424758 ], [ 13.298989642251232, 52.502209175411288 ], [ 13.298994936010695, 52.502223525074662 ], [ 13.299002222380349, 52.502236713850067 ], [ 13.299019618324502, 52.502240531679831 ], [ 13.299039098642314, 52.502240811762412 ], [ 13.29905514155851, 52.502229147945989 ], [ 13.299061307351812, 52.502220910732049 ], [ 13.29906385218001, 52.502205484233414 ], [ 13.299060552475849, 52.502189973705285 ], [ 13.299041393441252, 52.5021813723828 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 130, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299500647133863, 52.502232653598391 ], [ 13.29951305347943, 52.502225804392268 ], [ 13.299517241518817, 52.502147605981982 ], [ 13.299502299851609, 52.502138910704431 ], [ 13.299299627923359, 52.502134467972866 ], [ 13.299284591676994, 52.502142460795731 ], [ 13.299279664997172, 52.502219058036459 ], [ 13.299292348057694, 52.502228438372278 ], [ 13.299344764699706, 52.502229500274595 ], [ 13.299345955264425, 52.502223887092136 ], [ 13.29944747680339, 52.502226000985587 ], [ 13.299447818308462, 52.502231582243951 ], [ 13.299500647133863, 52.502232653598391 ] ], [ [ 13.299417037052713, 52.502170120026484 ], [ 13.299477884977874, 52.502159099293216 ], [ 13.299507060257133, 52.502160708190637 ], [ 13.299506739049654, 52.502169030334876 ], [ 13.29950224620168, 52.502184428841922 ], [ 13.29950119087056, 52.502211771232744 ], [ 13.299499150918185, 52.502214120985599 ], [ 13.29945517171627, 52.502192078058727 ], [ 13.299417037052713, 52.502170120026484 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 131, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.300102915226448, 52.50194152304632 ], [ 13.30009567300519, 52.501927144537774 ], [ 13.300074428098773, 52.501922082023235 ], [ 13.30006636171424, 52.501929102442169 ], [ 13.300046880051317, 52.501928822508695 ], [ 13.300025405822614, 52.501929703477423 ], [ 13.300003656355129, 52.501937717710902 ], [ 13.299989561962132, 52.501949409654017 ], [ 13.299992770231205, 52.501967297915634 ], [ 13.299996206396584, 52.501979241765547 ], [ 13.29998990466396, 52.50199104568572 ], [ 13.299989354216819, 52.502005311324083 ], [ 13.300022057336459, 52.502016486187635 ], [ 13.3000277642294, 52.502020136803658 ], [ 13.300049376117906, 52.502015689200526 ], [ 13.300065053187238, 52.50201353628988 ], [ 13.300071171452677, 52.502006486979511 ], [ 13.300077520509589, 52.501993494197905 ], [ 13.300077703993988, 52.501988738685348 ], [ 13.300092075038636, 52.501969914382585 ], [ 13.300084557591344, 52.501962669142316 ], [ 13.300084970394327, 52.501951970137618 ], [ 13.300102915226448, 52.50194152304632 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 132, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.297917681350963, 52.502105046021221 ], [ 13.297918953488349, 52.502066892125569 ], [ 13.297829148794206, 52.502065609949398 ], [ 13.297829664323721, 52.502102986649923 ], [ 13.297917681350963, 52.502105046021221 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 133, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299798653379156, 52.501946666212262 ], [ 13.299787331374489, 52.501936988100958 ], [ 13.299786025477626, 52.501920316710184 ], [ 13.299757033864106, 52.501913952370955 ], [ 13.299733427951645, 52.501919560800218 ], [ 13.299737003156233, 52.501927938044439 ], [ 13.29975824799063, 52.50193300151787 ], [ 13.299759829154851, 52.501942539641121 ], [ 13.299732556295373, 52.501942147683785 ], [ 13.299712892579173, 52.501946623228179 ], [ 13.299710210352041, 52.501965616377205 ], [ 13.299723526395441, 52.501974133616748 ], [ 13.299734892803125, 52.501982622834959 ], [ 13.299744450124582, 52.501987518339632 ], [ 13.2997460312875, 52.501997056462955 ], [ 13.299726367547949, 52.502001532009345 ], [ 13.299727948707384, 52.502011070132866 ], [ 13.299763104539993, 52.502009197206313 ], [ 13.299782630642145, 52.502008288287705 ], [ 13.299792646762659, 52.502001295009002 ], [ 13.2997947784469, 52.501996567494849 ], [ 13.299802936643898, 52.501987169339024 ], [ 13.299814809168321, 52.501982581811838 ], [ 13.299824595853703, 52.5019815338188 ], [ 13.299821020662961, 52.501973155678449 ], [ 13.299809331654984, 52.501972987694408 ], [ 13.299795879466343, 52.501968036220902 ], [ 13.299804221171362, 52.501953882553003 ], [ 13.299798653379156, 52.501946666212262 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 134, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298298940510316, 52.502109105528746 ], [ 13.298300348894051, 52.50207233643934 ], [ 13.298212809537452, 52.50207118604235 ], [ 13.298210610441876, 52.502107521170025 ], [ 13.298298940510316, 52.502109105528746 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 135, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299422883831545, 52.501986465057527 ], [ 13.299446306265713, 52.501985612201935 ], [ 13.299457719982632, 52.501992912589756 ], [ 13.299490835902786, 52.501993388597732 ], [ 13.29951402890806, 52.501998480117656 ], [ 13.299531837707855, 52.501991599768957 ], [ 13.299563097229672, 52.501989669999013 ], [ 13.299558789434084, 52.50200031301889 ], [ 13.299576229712899, 52.502002942766239 ], [ 13.299595893467732, 52.501998467244952 ], [ 13.299603961412009, 52.501991446880083 ], [ 13.299588880755737, 52.501978146114858 ], [ 13.299569997015759, 52.501962411610592 ], [ 13.299533581262777, 52.501946425108152 ], [ 13.299516185422595, 52.501942606455749 ], [ 13.299492487726219, 52.5019505916935 ], [ 13.299449401565232, 52.501955920058698 ], [ 13.299424076868693, 52.501955556033536 ], [ 13.299418737110441, 52.501942395265566 ], [ 13.29943264960473, 52.501935458025258 ], [ 13.299417386936783, 52.50192691277082 ], [ 13.299402352248213, 52.501912423104585 ], [ 13.29937132075281, 52.501908408422715 ], [ 13.299347806577304, 52.501911639019191 ], [ 13.299347393595962, 52.501922338019902 ], [ 13.29934517155875, 52.501929443302252 ], [ 13.299331121414088, 52.501939946266617 ], [ 13.299319571564794, 52.501936211622386 ], [ 13.29929048822639, 52.50193222492468 ], [ 13.299272725271978, 52.501937917257983 ], [ 13.299278156771148, 52.501948700276884 ], [ 13.299291426797938, 52.501958407340609 ], [ 13.299318378455185, 52.501967120644792 ], [ 13.299343519593521, 52.501972240203379 ], [ 13.299354931817245, 52.501979540579839 ], [ 13.299366161956128, 52.501991596487123 ], [ 13.29939302036232, 52.502002688407444 ], [ 13.299410645660597, 52.502000562689418 ], [ 13.299422883831545, 52.501986465057527 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 136, "id": 1, "name": "impervious" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.3003528183384, 52.501935597262815 ], [ 13.300351300378582, 52.501914411043188 ], [ 13.300347430355508, 52.501918867233847 ], [ 13.300329760740398, 52.501922181991617 ], [ 13.300333152602526, 52.50193531473203 ], [ 13.3003528183384, 52.501935597262815 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 137, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298787194488989, 52.501897631162848 ], [ 13.298762007553945, 52.501893700364221 ], [ 13.298742114229691, 52.501904120133304 ], [ 13.298720502304306, 52.501908566598431 ], [ 13.298702785195868, 52.501913069968325 ], [ 13.298700287641337, 52.501927307602891 ], [ 13.298699644961639, 52.501943950986444 ], [ 13.298697100023245, 52.501959377476979 ], [ 13.29871621298601, 52.501969167731424 ], [ 13.298721736132686, 52.501977573918673 ], [ 13.2987352800153, 52.501980147758786 ], [ 13.298764271553559, 52.501986511448827 ], [ 13.298779855421378, 52.501986735543788 ], [ 13.298793676217249, 52.501982176134334 ], [ 13.298793859805407, 52.501977421523556 ], [ 13.298788428421895, 52.501966638483438 ], [ 13.298802293643483, 52.501960890174381 ], [ 13.298814349848483, 52.501951548137541 ], [ 13.29881109615444, 52.501934848725327 ], [ 13.298801952063675, 52.501919254148547 ], [ 13.298780936879472, 52.501908246117601 ], [ 13.298787194488989, 52.501897631162848 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 138, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298380807792133, 52.501922712876116 ], [ 13.298381404675032, 52.501907258372349 ], [ 13.298360114099571, 52.501903383530177 ], [ 13.298344528792104, 52.501903159359003 ], [ 13.298348103695673, 52.501911537541623 ], [ 13.29832472720287, 52.501911201302867 ], [ 13.298307332957902, 52.501907382494878 ], [ 13.298280106060181, 52.501905801325961 ], [ 13.298264981388835, 52.501893689293645 ], [ 13.298254965088338, 52.501900681542686 ], [ 13.29823915165246, 52.501906401763939 ], [ 13.298217126386856, 52.501921548029785 ], [ 13.298220470224219, 52.501935869681255 ], [ 13.298219781441967, 52.501953701937673 ], [ 13.298242744705865, 52.501964737191827 ], [ 13.298265891626414, 52.501971017832119 ], [ 13.298295112649365, 52.501971438150015 ], [ 13.298314501003611, 52.501974096104995 ], [ 13.298324241836303, 52.501974236214821 ], [ 13.298345670195955, 52.501974544432429 ], [ 13.298362972670796, 52.501980740090538 ], [ 13.298380643923362, 52.501977425649159 ], [ 13.298384677972352, 52.501973915958381 ], [ 13.298412270771824, 52.501965986065528 ], [ 13.298416442564875, 52.5019589097422 ], [ 13.298407162334, 52.501946881788641 ], [ 13.298401639251397, 52.501938475587181 ], [ 13.298389950261225, 52.501938307463021 ], [ 13.298370516000753, 52.501936838397576 ], [ 13.298380807792133, 52.501922712876116 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 139, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299133751202419, 52.501902614076691 ], [ 13.299114546380034, 52.501895201644189 ], [ 13.299104761136181, 52.50189625049827 ], [ 13.299091169886598, 52.501894865556906 ], [ 13.299089772459135, 52.501880571915663 ], [ 13.299105679044576, 52.501872473845701 ], [ 13.29911379146702, 52.501864264615833 ], [ 13.299100293494021, 52.5018605019416 ], [ 13.299077008814946, 52.501857788096565 ], [ 13.299053402849294, 52.501863396389723 ], [ 13.299048818079529, 52.501881172634292 ], [ 13.299028649501684, 52.501898723920071 ], [ 13.299023927019746, 52.501920066795975 ], [ 13.299011733168213, 52.501932975487122 ], [ 13.299012855173162, 52.501954402393906 ], [ 13.29902199934593, 52.501969996954998 ], [ 13.29905080732545, 52.501981116085126 ], [ 13.299075856677808, 52.501988612556801 ], [ 13.299113236066315, 52.501979634567732 ], [ 13.299133221097142, 52.501966837879394 ], [ 13.299149448944117, 52.501950418559474 ], [ 13.299140304729887, 52.501934824007847 ], [ 13.299126852629726, 52.501929872458916 ], [ 13.299135010955514, 52.5019204743502 ], [ 13.299133751202419, 52.501902614076691 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 140, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298063846666837, 52.501953837849442 ], [ 13.298066254050438, 52.501941978005142 ], [ 13.298080394905794, 52.501929096519916 ], [ 13.298090549014018, 52.501918537655214 ], [ 13.298081221483587, 52.501907698532577 ], [ 13.298081772546443, 52.501893432908076 ], [ 13.298031169187839, 52.501891515390739 ], [ 13.29799239259048, 52.501886199385623 ], [ 13.297985905155251, 52.501902758681055 ], [ 13.297972545018277, 52.501895430146909 ], [ 13.297931681003549, 52.501893652703657 ], [ 13.297931267678686, 52.501904351696545 ], [ 13.297920039429773, 52.501892295677514 ], [ 13.297912660143782, 52.501881483671838 ], [ 13.29792263056447, 52.501875680329022 ], [ 13.297929026161501, 52.501861498790824 ], [ 13.297923732791116, 52.501847149082209 ], [ 13.297898913368373, 52.501833707984602 ], [ 13.297879616962559, 52.501828672208624 ], [ 13.297868249482956, 52.501820182794063 ], [ 13.297827341083977, 52.501819594213352 ], [ 13.297805820975979, 52.50182166275745 ], [ 13.297807126120954, 52.501838334163949 ], [ 13.297796880099497, 52.501851270757584 ], [ 13.297802127496622, 52.5018668093483 ], [ 13.297782188028448, 52.501878417830959 ], [ 13.297789657709242, 52.501886851171214 ], [ 13.297796991068026, 52.501898851162487 ], [ 13.297794583614685, 52.501910711000768 ], [ 13.297781131641836, 52.501905760198788 ], [ 13.297761925612873, 52.50189834662882 ], [ 13.297753261730232, 52.501920822284369 ], [ 13.297762358042245, 52.501937605794602 ], [ 13.297785458979865, 52.501945074506345 ], [ 13.297799463557993, 52.501935760605427 ], [ 13.297806979183864, 52.501943005067893 ], [ 13.297796688677302, 52.501957130559028 ], [ 13.297813991031642, 52.501963327195341 ], [ 13.297823869654941, 52.501959900716081 ], [ 13.297849378057574, 52.501955509576611 ], [ 13.297862967810984, 52.501956894639278 ], [ 13.297880178314081, 52.501965469019538 ], [ 13.297911393422755, 52.501964728584547 ], [ 13.297934769938937, 52.501965064905178 ], [ 13.297941073688365, 52.501953261120242 ], [ 13.297954893085709, 52.501948701788251 ], [ 13.297974191025183, 52.501953737573558 ], [ 13.297983700776189, 52.501959821175866 ], [ 13.297995068278993, 52.501968311478201 ], [ 13.298012508481307, 52.501970940556546 ], [ 13.298031896817264, 52.501973598557676 ], [ 13.298047480674594, 52.501973822749036 ], [ 13.298049796212265, 52.501964340658944 ], [ 13.298063846666837, 52.501953837849442 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 141, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.297631910908644, 52.501903613068336 ], [ 13.297618550865932, 52.501896283596118 ], [ 13.297596477984326, 52.501912618600073 ], [ 13.297595834888115, 52.501929261974183 ], [ 13.297585406502828, 52.501946954076246 ], [ 13.297602662919704, 52.501954338721205 ], [ 13.297615932574718, 52.501964045969714 ], [ 13.297635412756124, 52.501964326282348 ], [ 13.297655214492652, 52.50195628445519 ], [ 13.297655857567063, 52.501939641080675 ], [ 13.297654276859074, 52.501930102933159 ], [ 13.297670457830343, 52.50191487267606 ], [ 13.297639427973909, 52.501910857562379 ], [ 13.297631910908644, 52.501903613068336 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 142, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.297094452627164, 52.501941077780998 ], [ 13.297102429087634, 52.501936434443998 ], [ 13.29711996108797, 52.501936686799361 ], [ 13.297123995267372, 52.501933176253679 ], [ 13.297124592591222, 52.50191772176003 ], [ 13.297130942500116, 52.501904729143646 ], [ 13.297141095355704, 52.501894170341082 ], [ 13.297117810788356, 52.501891456111316 ], [ 13.29710050856225, 52.501885259374163 ], [ 13.297069339453236, 52.501884810719304 ], [ 13.297057514100711, 52.501888209113766 ], [ 13.297024580642043, 52.501882976899218 ], [ 13.297014335819483, 52.501895914342747 ], [ 13.297025288134405, 52.501915102804624 ], [ 13.297032529382161, 52.501929480594008 ], [ 13.297033926142847, 52.501943774253753 ], [ 13.297053406309372, 52.501944054662097 ], [ 13.297070662599449, 52.501951440282525 ], [ 13.297086246441166, 52.501951664600405 ], [ 13.297094452627164, 52.501941077780998 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 143, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.2968449020247, 52.501892285716117 ], [ 13.296837660844275, 52.501877907915741 ], [ 13.296814146545566, 52.501881137108562 ], [ 13.296806261983646, 52.501883402673748 ], [ 13.296788775967006, 52.501881961395966 ], [ 13.296787241408481, 52.501871234362277 ], [ 13.296755612743976, 52.501882673487458 ], [ 13.296747362000032, 52.501894449180149 ], [ 13.296735443226074, 52.501900225273154 ], [ 13.296729185124304, 52.501910840115194 ], [ 13.296728541700608, 52.501927483481751 ], [ 13.296737776977642, 52.501940700460402 ], [ 13.296760969624875, 52.501945792517169 ], [ 13.296807722609651, 52.501946465608164 ], [ 13.296842834044, 52.501945781548741 ], [ 13.296845240282687, 52.501933921710844 ], [ 13.296839948730794, 52.501919571978021 ], [ 13.296836374114447, 52.501911193752292 ], [ 13.296838827783635, 52.501898145059528 ], [ 13.2968449020247, 52.501892285716117 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 144, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.2973902343267, 52.501953660794996 ], [ 13.297411754551828, 52.501951591428686 ], [ 13.297431234725661, 52.501951871774878 ], [ 13.297441343051405, 52.501942501843779 ], [ 13.297459104765515, 52.501936809766306 ], [ 13.297476682710419, 52.501935873192295 ], [ 13.297483308129738, 52.501915748195472 ], [ 13.297470223721561, 52.501901286345998 ], [ 13.297464838648498, 52.50188931347266 ], [ 13.297465298027753, 52.501877425605784 ], [ 13.297452671546331, 52.501851075866341 ], [ 13.297441627210452, 52.501834264296839 ], [ 13.297438465929279, 52.501815187098003 ], [ 13.29743704397443, 52.501814276504007 ], [ 13.297369737639228, 52.50181360996762 ], [ 13.297366342536304, 52.501815338669033 ], [ 13.297357998606712, 52.501829492137723 ], [ 13.297346494867586, 52.501824569324597 ], [ 13.297325020646893, 52.501825449803107 ], [ 13.297297472254149, 52.501832189645391 ], [ 13.297296874992764, 52.501847644140661 ], [ 13.297306018533847, 52.501863238829309 ], [ 13.297315344390455, 52.50187407799028 ], [ 13.297330928206764, 52.501874302275731 ], [ 13.297340806811899, 52.501870876735502 ], [ 13.297358292844068, 52.501872317931841 ], [ 13.297371424623281, 52.501885590938095 ], [ 13.297334456969747, 52.501883869363787 ], [ 13.297316189931204, 52.501902637266433 ], [ 13.297310023824863, 52.501910875286072 ], [ 13.29730761623993, 52.501922735113325 ], [ 13.297315179165347, 52.501928791649689 ], [ 13.297328768892342, 52.501930176773548 ], [ 13.297344032622705, 52.50193872231516 ], [ 13.29735131992318, 52.501951911209474 ], [ 13.2973902343267, 52.501953660794996 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 145, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299261200523388, 52.501883036457116 ], [ 13.299271492017967, 52.501868910855514 ], [ 13.299266152315395, 52.501855750080949 ], [ 13.299248849793878, 52.501849553655511 ], [ 13.299225060312919, 52.501859916595087 ], [ 13.299218848673345, 52.501869343595004 ], [ 13.299195885244476, 52.501858307629853 ], [ 13.299186511557664, 52.501848657469687 ], [ 13.299162997401433, 52.501851888029606 ], [ 13.299141293750282, 52.501858712327419 ], [ 13.299134623164338, 52.501880027199981 ], [ 13.299143905054001, 52.501892055119306 ], [ 13.29915912176042, 52.501901789286116 ], [ 13.299176379866642, 52.501909174623442 ], [ 13.299183987506643, 52.501914041245158 ], [ 13.299183436765469, 52.501928307776382 ], [ 13.299200555764267, 52.501939258823285 ], [ 13.299225972236448, 52.501937245140923 ], [ 13.299238028345972, 52.501927903060071 ], [ 13.29924414820311, 52.501920853814568 ], [ 13.299252260609082, 52.501912644575164 ], [ 13.299246647054282, 52.501906616188208 ], [ 13.299237135700027, 52.501900531766239 ], [ 13.299258977036578, 52.501890140817984 ], [ 13.299261200523388, 52.501883036457116 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 146, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298974461361928, 52.501843229676467 ], [ 13.298962911568863, 52.501839494997832 ], [ 13.298945333689025, 52.501840431793298 ], [ 13.29893132934612, 52.501849746730947 ], [ 13.298909212574186, 52.501867269984295 ], [ 13.298912603973422, 52.50188040366055 ], [ 13.298900547808843, 52.501889745707842 ], [ 13.298927591148999, 52.501896081345272 ], [ 13.298940815180478, 52.501906977325035 ], [ 13.298938362132311, 52.501920026066685 ], [ 13.298953624703586, 52.501928571382102 ], [ 13.298967765262814, 52.50191569068717 ], [ 13.298981861385734, 52.501903998889105 ], [ 13.298986124882433, 52.501894544789835 ], [ 13.298996185529157, 52.501886362680622 ], [ 13.298994742232596, 52.501873257916017 ], [ 13.298987410022535, 52.501861258017406 ], [ 13.29897423185882, 52.501849174063871 ], [ 13.298974461361928, 52.501843229676467 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 147, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.299897294413253, 52.501915968057837 ], [ 13.299909165436194, 52.501911380499699 ], [ 13.299924337883267, 52.501922304367376 ], [ 13.299941915778302, 52.501921367426519 ], [ 13.299942145151483, 52.501915423036209 ], [ 13.299954383129339, 52.501901325347475 ], [ 13.299948907067675, 52.501891731257473 ], [ 13.29994950340002, 52.501876276741022 ], [ 13.299936233250882, 52.50186656975 ], [ 13.299905293452241, 52.501860178350476 ], [ 13.299881595869262, 52.501868163667226 ], [ 13.299861932200798, 52.501872639236822 ], [ 13.299857531263008, 52.50188566000336 ], [ 13.299853223549016, 52.501896303034798 ], [ 13.299854527998271, 52.50191297440395 ], [ 13.299857782087045, 52.501929673790826 ], [ 13.299861311439292, 52.501939239909518 ], [ 13.299876941141015, 52.501938275880491 ], [ 13.299892847605252, 52.50193017770367 ], [ 13.299897294413253, 52.501915968057837 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 148, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.29956800662638, 52.501862467259564 ], [ 13.299552698071713, 52.501855110900372 ], [ 13.299523385335178, 52.501857068649272 ], [ 13.299501865246764, 52.501859138401059 ], [ 13.29948048281736, 52.501857641515471 ], [ 13.299449405465026, 52.501854815732074 ], [ 13.29944138488244, 52.501860647229933 ], [ 13.299431322850999, 52.501868829356653 ], [ 13.299423346679529, 52.501873471954312 ], [ 13.299407349845625, 52.501883947844156 ], [ 13.299408976821262, 52.501892297093761 ], [ 13.299430405153098, 52.501892605114634 ], [ 13.299429946303666, 52.501904492993603 ], [ 13.299423872366971, 52.501910353371258 ], [ 13.299437325967924, 52.501915304907818 ], [ 13.29944901348583, 52.501915472907321 ], [ 13.299474338159628, 52.501915836926955 ], [ 13.29951320825251, 52.501918773814943 ], [ 13.299530648496251, 52.501921403568701 ], [ 13.29954433006716, 52.501920410682963 ], [ 13.299554896756224, 52.501899152687734 ], [ 13.299563377651662, 52.501881432424859 ], [ 13.29956800662638, 52.501862467259564 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 149, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.296865421073189, 52.50181526565067 ], [ 13.296853966483106, 52.501808501196777 ], [ 13.29681366959689, 52.501808101792115 ], [ 13.296788500233259, 52.501784399141805 ], [ 13.296765409564136, 52.501780520573874 ], [ 13.296735821003768, 52.501789610888267 ], [ 13.296723719919243, 52.501800141607475 ], [ 13.296707537194175, 52.501815371711743 ], [ 13.296705129453141, 52.501827231525581 ], [ 13.296720393025458, 52.501835777146511 ], [ 13.296729534886559, 52.501851371856795 ], [ 13.29674688447929, 52.501856379792791 ], [ 13.296754170114626, 52.501869568701196 ], [ 13.296785660890892, 52.501861696204664 ], [ 13.296805232936981, 52.501859598901277 ], [ 13.296828701301019, 52.50185755768765 ], [ 13.296848595014461, 52.501847139142519 ], [ 13.296866450151898, 52.501839069423049 ], [ 13.296867001606602, 52.501824803807402 ], [ 13.296865421073189, 52.50181526565067 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 150, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298185616236259, 52.501879463645899 ], [ 13.298186259108586, 52.501862820266574 ], [ 13.298188758297401, 52.501848582665261 ], [ 13.298167835112215, 52.501835197671511 ], [ 13.298168248378614, 52.501824498677166 ], [ 13.298138797874058, 52.50183002181506 ], [ 13.298109393251526, 52.501834356967215 ], [ 13.298101187328278, 52.50184494385941 ], [ 13.298090988787996, 52.501856691623424 ], [ 13.298106388908243, 52.501861671314465 ], [ 13.298115578663928, 52.501876077066051 ], [ 13.298129122478487, 52.501878650974966 ], [ 13.298144937390786, 52.501872930789617 ], [ 13.298145212894259, 52.501865798426394 ], [ 13.298158710784818, 52.501869561208892 ], [ 13.298165906509112, 52.501885126910445 ], [ 13.298177502166938, 52.501887672789415 ], [ 13.298185616236259, 52.501879463645899 ] ] ] } },
+{ "type": "Feature", "properties": { "fid": 151, "id": 2, "name": "vegetation" }, "geometry": { "type": "Polygon", "coordinates": [ [ [ 13.298681841715108, 52.501849726897255 ], [ 13.298658648852939, 52.501844636114157 ], [ 13.298642927342366, 52.501847977736901 ], [ 13.298642192823619, 52.501866998874753 ], [ 13.298653422737935, 52.501879054848068 ], [ 13.298676294256449, 52.501892467773374 ], [ 13.29868992992699, 52.501892663863828 ], [ 13.298709869131303, 52.501881056124844 ], [ 13.298713994960716, 52.501875168667802 ], [ 13.298714316314486, 52.501866846526561 ], [ 13.298706844986157, 52.501858413221996 ], [ 13.298705126363856, 52.501852440819825 ], [ 13.298681841715108, 52.501849726897255 ] ] ] } }
+]
+}
diff --git a/eotimeseriesviewer/externals/qps/ui/subdatasetselectiondialog.ui b/eotimeseriesviewer/externals/qps/ui/subdatasetselectiondialog.ui
new file mode 100644
index 0000000000000000000000000000000000000000..a2b31edba90b264938cbca6aef318e8030158cc6
--- /dev/null
+++ b/eotimeseriesviewer/externals/qps/ui/subdatasetselectiondialog.ui
@@ -0,0 +1,73 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<ui version="4.0">
+ <class>Dialog</class>
+ <widget class="QDialog" name="Dialog">
+ <property name="geometry">
+ <rect>
+ <x>0</x>
+ <y>0</y>
+ <width>504</width>
+ <height>300</height>
+ </rect>
+ </property>
+ <property name="windowTitle">
+ <string>Dialog</string>
+ </property>
+ <layout class="QVBoxLayout" name="verticalLayout">
+ <item>
+ <widget class="QSplitter" name="splitter">
+ <property name="orientation">
+ <enum>Qt::Horizontal</enum>
+ </property>
+ <widget class="QTableView" name="tableView"/>
+ <widget class="QTableView" name="tableView_2"/>
+ </widget>
+ </item>
+ <item>
+ <widget class="QDialogButtonBox" name="buttonBox">
+ <property name="orientation">
+ <enum>Qt::Horizontal</enum>
+ </property>
+ <property name="standardButtons">
+ <set>QDialogButtonBox::Cancel|QDialogButtonBox::Ok</set>
+ </property>
+ </widget>
+ </item>
+ </layout>
+ </widget>
+ <resources/>
+ <connections>
+ <connection>
+ <sender>buttonBox</sender>
+ <signal>accepted()</signal>
+ <receiver>Dialog</receiver>
+ <slot>accept()</slot>
+ <hints>
+ <hint type="sourcelabel">
+ <x>248</x>
+ <y>254</y>
+ </hint>
+ <hint type="destinationlabel">
+ <x>157</x>
+ <y>274</y>
+ </hint>
+ </hints>
+ </connection>
+ <connection>
+ <sender>buttonBox</sender>
+ <signal>rejected()</signal>
+ <receiver>Dialog</receiver>
+ <slot>reject()</slot>
+ <hints>
+ <hint type="sourcelabel">
+ <x>316</x>
+ <y>260</y>
+ </hint>
+ <hint type="destinationlabel">
+ <x>286</x>
+ <y>274</y>
+ </hint>
+ </hints>
+ </connection>
+ </connections>
+</ui>
diff --git a/eotimeseriesviewer/externals/qps/utils.py b/eotimeseriesviewer/externals/qps/utils.py
index 4aa5f198f17eabd09611e456b4e8b31f9a640581..aa0b24c0d76219e72c4fd55e8de2cf1a29f97c4c 100644
--- a/eotimeseriesviewer/externals/qps/utils.py
+++ b/eotimeseriesviewer/externals/qps/utils.py
@@ -1,7 +1,7 @@
# -*- coding: utf-8 -*-
-import os, sys, importlib, re, fnmatch, io, zipfile, pathlib, warnings, collections, copy, shutil
+import os, sys, importlib, re, fnmatch, io, zipfile, pathlib, warnings, collections, copy, shutil, typing
from qgis.core import *
from qgis.core import QgsFeature, QgsPointXY, QgsRectangle
@@ -17,12 +17,17 @@ from qgis.PyQt import uic
from osgeo import gdal, ogr
import numpy as np
+from qgis.PyQt.QtWidgets import QAction
+
+REMOVE_setShortcutVisibleInContextMenu = hasattr(QAction, 'setShortcutVisibleInContextMenu')
+
from . import resourcemockup
try:
- import qps
-except:
+
from .. import qps
+except:
+ import qps
jp = os.path.join
dn = os.path.dirname
@@ -63,7 +68,12 @@ def mkDir(d, delete=False):
# for python development only. try to find a qgisresources directory
DIR_QGISRESOURCES = None
-MAP_LAYER_STORES = [QgsProject.instance()]
+
+# a QPS internal map layer store
+QPS_MAPLAYER_STORE = QgsMapLayerStore()
+
+# a list of all known maplayer stores.
+MAP_LAYER_STORES = [QPS_MAPLAYER_STORE, QgsProject.instance()]
def findUpwardPath(basepath, name, isDirectory=True):
@@ -281,6 +291,29 @@ def findMapLayer(layer)->QgsMapLayer:
return None
+def gdalFileSize(path) -> int:
+ """
+ Returns the size of a local gdal readible file (including metadata files etc.)
+ :param path: str
+ :return: int
+ """
+ ds = gdal.Open(path)
+ if not isinstance(ds, gdal.Dataset):
+ return 0
+ else:
+ size = 0
+ for file in ds.GetFileList():
+ size += os.stat(file).st_size
+
+ # recursively inspect VRT sources
+ if file.endswith('.vrt') and file != path:
+ size += gdalFileSize(file)
+
+ return size
+
+
+ s = ""
+
def qgisLayerTreeLayers() -> list:
"""
@@ -316,6 +349,8 @@ def createQgsField(name : str, exampleValue, comment:str=None):
return QgsField(name, QVariant.Double, 'double', comment=comment)
elif isinstance(exampleValue, np.ndarray):
return QgsField(name, QVariant.String, 'varchar', comment=comment)
+ elif isinstance(exampleValue, np.datetime64):
+ return QgsField(name, QVariant.String, 'varchar', comment=comment)
elif isinstance(exampleValue, list):
assert len(exampleValue) > 0, 'need at least one value in provided list'
v = exampleValue[0]
@@ -419,15 +454,16 @@ def showMessage(message:str, title:str, level):
v.showMessage(True)
-def gdalDataset(pathOrDataset, eAccess=gdal.GA_ReadOnly)->gdal.Dataset:
+def gdalDataset(pathOrDataset:typing.Union[str, QgsRasterLayer, QgsRasterDataProvider, gdal.Dataset], eAccess=gdal.GA_ReadOnly)->gdal.Dataset:
"""
Returns a gdal.Dataset object instance
- :param pathOrDataset: path | gdal.Dataset | QgsRasterLayer
+ :param pathOrDataset: path | gdal.Dataset | QgsRasterLayer | QgsRasterDataProvider
:return: gdal.Dataset
"""
-
if isinstance(pathOrDataset, QgsRasterLayer):
return gdalDataset(pathOrDataset.source())
+ elif isinstance(pathOrDataset, QgsRasterDataProvider):
+ return gdalDataset(pathOrDataset.dataSourceUri())
if not isinstance(pathOrDataset, gdal.Dataset):
pathOrDataset = gdal.Open(pathOrDataset, eAccess)
@@ -453,6 +489,37 @@ def ogrDataSource(pathOrDataSource)->ogr.DataSource:
return pathOrDataSource
+def qgsVectorLayer(source)->QgsVectorLayer:
+ """
+ Returns a QgsVectorLayer from different source types
+ :param source: QgsVectorLayer | ogr.DataSource | file path
+ :return: QgsVectorLayer
+ :rtype: QgsVectorLayer
+ """
+ if isinstance(source, QgsVectorLayer):
+ return source
+ if isinstance(source, str):
+ return QgsVectorLayer(source)
+ if isinstance(source, ogr.DataSource):
+ return QgsVectorLayer(source.GetDescription())
+
+ raise Exception('Unable to transform {} into QgsVectorLayer'.format(source))
+
+def qgsRasterLayer(source)->QgsRasterLayer:
+ """
+ Returns a QgsVectorLayer from different source types
+ :param source: QgsVectorLayer | ogr.DataSource | file path
+ :return: QgsVectorLayer
+ :rtype: QgsVectorLayer
+ """
+ if isinstance(source, QgsRasterLayer):
+ return source
+ if isinstance(source, str):
+ return QgsRasterLayer(source)
+ if isinstance(source, gdal.Dataset):
+ return QgsRasterLayer(source.GetDescription())
+
+ raise Exception('Unable to transform {} into QgsRasterLayer'.format(source))
def loadUI(basename: str):
@@ -548,6 +615,20 @@ def loadUIFormClass(pathUi:str, from_imports=False, resourceSuffix:str='', fixQG
doc = QDomDocument()
doc.setContent(txt)
+ if REMOVE_setShortcutVisibleInContextMenu and 'shortcutVisibleInContextMenu' in txt:
+ toRemove = []
+ actions = doc.elementsByTagName('action')
+ for iAction in range(actions.count()):
+ properties = actions.item(iAction).toElement().elementsByTagName('property')
+ for iProperty in range(properties.count()):
+ prop = properties.item(iProperty).toElement()
+ if prop.attribute('name') == 'shortcutVisibleInContextMenu':
+ toRemove.append(prop)
+ for prop in toRemove:
+ prop.parentNode().removeChild(prop)
+ del toRemove
+
+
elem = doc.elementsByTagName('customwidget')
for child in [elem.item(i) for i in range(elem.count())]:
child = child.toElement()
@@ -855,7 +936,7 @@ def displayBandNames(rasterSource, bands=None, leadingBandNumber=True):
return None
-def defaultBands(dataset):
+def defaultBands(dataset)->list:
"""
Returns a list of 3 default bands
:param dataset:
@@ -902,13 +983,13 @@ def defaultBands(dataset):
raise Exception()
-def bandClosestToWavelength(dataset, wl, wl_unit='nm'):
+def bandClosestToWavelength(dataset, wl, wl_unit='nm')->int:
"""
Returns the band index of an image dataset closest to wavelength `wl`.
:param dataset: str | gdal.Dataset
:param wl: wavelength to search the closed band for
:param wl_unit: unit of wavelength. Default = nm
- :return: band index | 0 of wavelength information is not provided
+ :return: band index | 0 if wavelength information is not provided
"""
if isinstance(wl, str):
assert wl.upper() in LUT_WAVELENGTH.keys(), wl
@@ -929,6 +1010,38 @@ def bandClosestToWavelength(dataset, wl, wl_unit='nm'):
pass
return 0
+def parseBadBandList(dataset)->typing.List[int]:
+ """
+ Returns the bad-band-list if it is specified explicitly
+ :param dataset:
+ :type dataset:
+ :return: list of booleans. True = valid band, False = excluded / bad band
+ :rtype:
+ """
+ bbl = None
+
+ try:
+ dataset = gdalDataset(dataset)
+ except:
+ pass
+
+ if not isinstance(dataset, gdal.Dataset):
+ return None
+
+
+
+ # 1. search for ENVI style definition of band band list
+ bblStr1 = dataset.GetMetadataItem('bbl')
+ bblStr2 = dataset.GetMetadataItem('bbl', 'ENVI')
+
+ for bblStr in [bblStr1, bblStr2]:
+ if isinstance(bblStr, str) and len(bblStr) > 0:
+ parts = bblStr.split(',')
+ if len(parts) == dataset.RasterCount:
+ bbl = [int(p) for p in parts]
+
+ return bbl
+
def parseWavelength(dataset):
"""
@@ -939,18 +1052,12 @@ def parseWavelength(dataset):
wl = None
wlu = None
+ try:
+ dataset = gdalDataset(dataset)
+ except:
+ pass
- if isinstance(dataset, str):
- return parseWavelength(gdal.Open(dataset))
- elif isinstance(dataset, QgsRasterDataProvider):
- return parseWavelength(dataset.dataSourceUri())
- elif isinstance(dataset, QgsRasterLayer):
- if dataset.dataProvider().name() == 'gdal':
- return parseWavelength(gdal.Open(dataset.source()))
- else:
- return None, None
- elif isinstance(dataset, gdal.Dataset):
-
+ if isinstance(dataset, gdal.Dataset):
for domain in dataset.GetMetadataDomainList():
# see http://www.harrisgeospatial.com/docs/ENVIHeaderFiles.html for supported wavelength units
@@ -969,7 +1076,7 @@ def parseWavelength(dataset):
.format(key, len(tmp), dataset.RasterCount), file=sys.stderr)
if re.search(r'wavelength.units?', key):
- if re.search(r'(Micrometers?|um)', values, re.I):
+ if re.search(r'(Micrometers?|um|μm)', values, re.I):
wlu = 'um' # fix with python 3 UTF
elif re.search(r'(Nanometers?|nm)', values, re.I):
wlu = 'nm'
@@ -1022,7 +1129,7 @@ def qgisAppQgisInterface()->QgisInterface:
return None
-def getDOMAttributes(elem):
+def getDOMAttributes(elem)->dict:
assert isinstance(elem, QDomElement)
values = dict()
attributes = elem.attributes()
@@ -1032,7 +1139,7 @@ def getDOMAttributes(elem):
return values
-def fileSizeString(num, suffix='B', div=1000):
+def fileSizeString(num, suffix='B', div=1000)->str:
"""
Returns a human-readable file size string.
thanks to Fred Cirera
@@ -1049,7 +1156,7 @@ def fileSizeString(num, suffix='B', div=1000):
return "{:.1f} {}{}".format(num, unit, suffix)
-def geo2pxF(geo, gt):
+def geo2pxF(geo, gt)->QPointF:
"""
Returns the pixel position related to a Geo-Coordinate in floating point precision.
:param geo: Geo-Coordinate as QgsPoint
@@ -1062,7 +1169,7 @@ def geo2pxF(geo, gt):
py = (geo.y() - gt[3]) / gt[5] # y pixel
return QPointF(px, py)
-def geo2px(geo, gt):
+def geo2px(geo, gt)->QPoint:
"""
Returns the pixel position related to a Geo-Coordinate as integer number.
Floating-point coordinate are casted to integer coordinate, e.g. the pixel coordinate (0.815, 23.42) is returned as (0,23)
@@ -1115,7 +1222,7 @@ def check_vsimem()->bool:
return False
return result
-def layerGeoTransform(rasterLayer:QgsRasterLayer)->tuple:
+def layerGeoTransform(rasterLayer:QgsRasterLayer)->typing.Tuple[float, float, float, float, float, float]:
"""
Returns the geo-transform vector from a QgsRasterLayer.
See https://www.gdal.org/gdal_datamodel.html
@@ -1131,7 +1238,7 @@ def layerGeoTransform(rasterLayer:QgsRasterLayer)->tuple:
0, -1 * rasterLayer.rasterUnitsPerPixelY())
return gt
-def px2geo(px, gt, pxCenter=True):
+def px2geo(px:QPoint, gt, pxCenter=True)->QgsPointXY:
"""
Converts a pixel coordinate into a geo-coordinate
:param px: QPoint() with pixel coordinates
@@ -1652,3 +1759,9 @@ class SelectMapLayersDialog(QgsDialog):
+class QgsTaskMock(QgsTask):
+ """
+ A mocked QgsTask
+ """
+ def __init__(self):
+ super(QgsTaskMock, self).__init__()
\ No newline at end of file
diff --git a/eotimeseriesviewer/main.py b/eotimeseriesviewer/main.py
index 9dcde82d130cb6591348af70d933dd5526683026..5d3609ca74edfda8ee45b90f0fd3a10111159c99 100644
--- a/eotimeseriesviewer/main.py
+++ b/eotimeseriesviewer/main.py
@@ -44,8 +44,11 @@ from qgis.gui import *
import qgis.utils
from eotimeseriesviewer.utils import *
from eotimeseriesviewer.timeseries import *
+from eotimeseriesviewer.mapcanvas import MapCanvas
from eotimeseriesviewer.profilevisualization import SpectralTemporalVisualization
+from eotimeseriesviewer.temporalprofiles import TemporalProfileLayer
from eotimeseriesviewer.mapvisualization import MapView, MapWidget
+import eotimeseriesviewer.settings as eotsvSettings
from eotimeseriesviewer import SpectralProfile, SpectralLibrary, SpectralLibraryPanel
from eotimeseriesviewer.externals.qps.maptools import MapTools, CursorLocationMapTool, QgsMapToolSelect, QgsMapToolSelectionHandler
from eotimeseriesviewer.externals.qps.cursorlocationvalue import CursorLocationInfoModel, CursorLocationInfoDock
@@ -339,9 +342,7 @@ class TimeSeriesViewer(QgisInterface, QObject):
QgisInterface.__init__(self)
QApplication.processEvents()
- self.mMapLayerStore = QgsMapLayerStore()
- import eotimeseriesviewer.utils
- eotimeseriesviewer.utils.MAP_LAYER_STORES.insert(0, self.mapLayerStore())
+
TimeSeriesViewer._instance = self
self.ui = TimeSeriesViewerUI()
@@ -349,6 +350,12 @@ class TimeSeriesViewer(QgisInterface, QObject):
mvd = self.ui.dockMapViews
dts = self.ui.dockTimeSeries
mw = self.ui.mMapWidget
+
+ self.mMapLayerStore = self.mapWidget().mMapLayerStore
+ import eotimeseriesviewer.utils
+ eotimeseriesviewer.utils.MAP_LAYER_STORES.insert(0, self.mapLayerStore())
+
+
from eotimeseriesviewer.timeseries import TimeSeriesDock
from eotimeseriesviewer.mapvisualization import MapViewDock, MapWidget
assert isinstance(mvd, MapViewDock)
@@ -359,6 +366,8 @@ class TimeSeriesViewer(QgisInterface, QObject):
TimeSeriesViewer._instance = None
self.ui.sigAboutToBeClosed.connect(onClosed)
+ QgsApplication.instance().messageLog().messageReceived.connect(self.logMessage)
+
# Save reference to the QGIS interface
import qgis.utils
@@ -369,6 +378,8 @@ class TimeSeriesViewer(QgisInterface, QObject):
self.mTimeSeries.setDateTimePrecision(DateTimePrecision.Day)
self.mSpatialMapExtentInitialized = False
self.mTimeSeries.sigTimeSeriesDatesAdded.connect(self.onTimeSeriesChanged)
+ self.mTimeSeries.sigTimeSeriesDatesRemoved.connect(self.onTimeSeriesChanged)
+ self.mTimeSeries.sigSensorAdded.connect(self.onSensorAdded)
dts.setTimeSeries(self.mTimeSeries)
self.ui.dockSensors.setTimeSeries(self.mTimeSeries)
@@ -378,9 +389,8 @@ class TimeSeriesViewer(QgisInterface, QObject):
self.spectralTemporalVis = SpectralTemporalVisualization(self.mTimeSeries, self.ui.dockProfiles)
- self.spectralTemporalVis.pixelLoader.sigLoadingFinished.connect(
- lambda dt: self.ui.dockSystemInfo.addTimeDelta('Pixel Profile', dt))
assert isinstance(self, TimeSeriesViewer)
+ self.spectralTemporalVis.sigMoveToDate.connect(self.setCurrentDate)
mw.sigSpatialExtentChanged.connect(self.timeSeries().setCurrentSpatialExtent)
mw.sigVisibleDatesChanged.connect(self.timeSeries().setVisibleDates)
@@ -547,7 +557,7 @@ class TimeSeriesViewer(QgisInterface, QObject):
w.setSizePolicy(QSizePolicy(QSizePolicy.Preferred, QSizePolicy.Preferred))
w.setMinimumSize(0, 0)
- def sensors(self)->list:
+ def sensors(self)->typing.List[SensorInstrument]:
"""
Returns the list of Sensors
:return: [list-of-Sensors]
@@ -654,7 +664,7 @@ class TimeSeriesViewer(QgisInterface, QObject):
mapView.addLayer(self.spectralTemporalVis.temporalProfileLayer())
mapView.addLayer(self.spectralLibrary())
- def temporalProfileLayer(self)->QgsVectorLayer:
+ def temporalProfileLayer(self)->TemporalProfileLayer:
"""
Returns the TemporalProfileLayer
:return:
@@ -689,15 +699,17 @@ class TimeSeriesViewer(QgisInterface, QObject):
return self.ui.actionZoomOut
- def setCurrentDate(self, tsd:TimeSeriesDate):
+ def setCurrentDate(self, tsd):
"""
Moves the viewport of the scroll window to a specific TimeSeriesDate
- :param tsd: TimeSeriesDate
+ :param tsd: TimeSeriesDate or numpy.datetime64
"""
- self.ui.mMapWidget.setCurrentDate(tsd)
+ tsd = self.timeSeries().findDate(tsd)
+ if isinstance(tsd, TimeSeriesDate):
+ self.ui.mMapWidget.setCurrentDate(tsd)
- def mapCanvases(self)->list:
+ def mapCanvases(self)->typing.List[MapCanvas]:
"""
Returns all MapCanvases of the spatial visualization
:return: [list-of-MapCanvases]
@@ -959,12 +971,13 @@ class TimeSeriesViewer(QgisInterface, QObject):
assert isinstance(spatialPoint, SpatialPoint)
assert isinstance(mapCanvas, QgsMapCanvas)
from eotimeseriesviewer.mapcanvas import MapTools
- assert mapToolKey in MapTools.mapToolKeys()
+ assert mapToolKey in MapTools.mapToolValues()
if mapToolKey == MapTools.TemporalProfile:
+
self.spectralTemporalVis.loadCoordinate(spatialPoint)
- elif mapToolKey == MapTools.SpectralProfile:
+ elif mapToolKey == MapTools.SpectralProfile:
tsd = None
from .mapcanvas import MapCanvas
if isinstance(mapCanvas, MapCanvas):
@@ -1007,7 +1020,7 @@ class TimeSeriesViewer(QgisInterface, QObject):
return self.ui.mMapWidget.messageBar()
- def loadTimeSeriesDefinition(self, path:str=None, n_max:int=None):
+ def loadTimeSeriesDefinition(self, path:str=None, n_max:int=None, runAsync=True):
"""
Loads a time series definition file
:param path:
@@ -1031,17 +1044,17 @@ class TimeSeriesViewer(QgisInterface, QObject):
s.setValue('file_ts_definition', path)
self.clearTimeSeries()
progressDialog = self._createProgressDialog()
- self.mTimeSeries.loadFromFile(path, n_max=n_max, progressDialog=progressDialog)
+ self.mTimeSeries.loadFromFile(path, n_max=n_max, progressDialog=progressDialog, runAsync=runAsync)
- def createMapView(self, name:str=None):
+ def createMapView(self, name:str=None)->MapView:
"""
Creates a new MapView.
:return: MapView
"""
return self.ui.dockMapViews.createMapView(name=name)
- def mapViews(self)->list:
+ def mapViews(self)->typing.List[MapView]:
"""
Returns all MapViews
:return: [list-of-MapViews]
@@ -1064,34 +1077,49 @@ class TimeSeriesViewer(QgisInterface, QObject):
"""
return self.spectralTemporalVis.temporalProfileLayer()[:]
- def logMessage(self, message, tag, level):
- m = message.split('\n')
- if '' in message.split('\n'):
- m = m[0:m.index('')]
- m = '\n'.join(m)
- if DEBUG: print(message)
- if not re.search('timeseriesviewer', m):
- return
+ def logMessage(self, message:str, tag:str, level):
+ """
- if level in [Qgis.Critical, Qgis.Warning]:
+ """
+ if tag == LOG_MESSAGE_TAG and level in [Qgis.Critical, Qgis.Warning]:
+ self.messageBar().pushMessage(tag, message, level)
- self.ui.messageBar.pushMessage(tag, message, level=level)
- print(r'{}({}): {}'.format(tag, level, message))
+ def onSensorAdded(self, sensor:SensorInstrument):
+ knownName = eotsvSettings.sensorName(sensor.id())
+ if isinstance(knownName, str) and len(knownName) > 0:
+ sensor.setName(knownName)
- def onTimeSeriesChanged(self, *args):
+ sensor.sigNameChanged.connect(lambda *args, s=sensor: self.onSensorNameChanged(sensor))
+ def onSensorNameChanged(self, sensor:SensorInstrument):
+ # save changed names to settings
+ from eotimeseriesviewer.settings import saveSensorName
+ if sensor in self.sensors():
+ saveSensorName(sensor)
+
+ def onTimeSeriesChanged(self, *args):
if not self.mSpatialMapExtentInitialized:
if len(self.mTimeSeries) > 0:
if len(self.ui.dockMapViews) == 0:
self.ui.dockMapViews.createMapView()
- extent = self.mTimeSeries.maxSpatialExtent()
+ extent = self.timeSeries().maxSpatialExtent()
+ if isinstance(extent, SpatialExtent):
+ self.ui.dockMapViews.setCrs(extent.crs())
+ self.ui.mMapWidget.setSpatialExtent(extent)
+ self.mSpatialMapExtentInitialized = True
+ else:
+ self.mSpatialMapExtentInitialized = False
+ print('Failed to calculate max. spatial extent of TimeSeries with length {}'.format(len(self.timeSeries())))
+ lastDate = self.ui.mMapWidget.currentDate()
+ if lastDate:
+ tsd = self.timeSeries().findDate(lastDate)
+ else:
+ tsd = self.timeSeries()[0]
+ self.setCurrentDate(tsd)
- self.ui.mMapWidget.setCrs(extent.crs())
- self.ui.mMapWidget.setSpatialExtent(extent)
- self.mSpatialMapExtentInitialized = True
@@ -1263,15 +1291,8 @@ class TimeSeriesViewer(QgisInterface, QObject):
progressDialog.setRange(0, len(files))
progressDialog.setLabelText('Start loading {} images....'.format(len(files)))
- if loadAsync:
- self.mTimeSeries.addSourcesAsync(files, progressDialog=progressDialog)
- else:
- self.mTimeSeries.addSources(files, progressDialog=progressDialog)
-
-
+ self.mTimeSeries.addSources(files, progressDialog=progressDialog, runAsync=loadAsync)
- #QCoreApplication.processEvents()
- #self.mTimeSeries.addSources(files)
def clearTimeSeries(self):
diff --git a/eotimeseriesviewer/mapcanvas.py b/eotimeseriesviewer/mapcanvas.py
index bc856e34775886d9f64f1a56fa1c0ae424e921be..ecdf440d641c891ac1904400b65d445faee61698 100644
--- a/eotimeseriesviewer/mapcanvas.py
+++ b/eotimeseriesviewer/mapcanvas.py
@@ -529,16 +529,38 @@ class MapCanvas(QgsMapCanvas):
"""
Updates map-canvas TSD variables
"""
- scope = self.expressionContextScope()
+ from .mapvisualization import MapView
+ from .main import TimeSeriesViewer
+
+
+ varMVNumber = None
+ varMVName = None
+ varDate = None
+ varDOY = None
+ varSensor = None
+
+
tsd = self.tsd()
if isinstance(tsd, TimeSeriesDate):
- scope.setVariable('map_date', str(tsd.date()), isStatic=False)
- scope.setVariable('map_doy', tsd.doy(), isStatic=False)
- scope.setVariable('map_sensor', tsd.sensor().name(), isStatic=False)
- else:
- scope.setVariable('map_date', None, isStatic=False)
- scope.setVariable('map_doy', None, isStatic=False)
- scope.setVariable('map_sensor', None, isStatic=False)
+ varDate = str(tsd.date())
+ varDOY = tsd.doy()
+ varSensor = tsd.sensor().name()
+
+ mv = self.mapView()
+ if isinstance(mv, MapView):
+ varMVName = mv.name()
+ if isinstance(TimeSeriesViewer.instance(), TimeSeriesViewer):
+ mapViews = TimeSeriesViewer.instance().mapViews()
+ if mv in mapViews:
+ varMVNumber = mapViews.index(mv) + 1
+
+ scope = self.expressionContextScope()
+ scope.setVariable('map_view_num', varMVNumber, isStatic=False)
+ scope.setVariable('map_view', varMVName, isStatic=False)
+ scope.setVariable('map_date', varDate, isStatic=False)
+ scope.setVariable('map_doy', varDOY, isStatic=False)
+ scope.setVariable('map_sensor', varSensor, isStatic=False)
+
def tsd(self)->TimeSeriesDate:
@@ -642,7 +664,7 @@ class MapCanvas(QgsMapCanvas):
self.mTimedRefreshPipeLine[MapCanvas.Command].append(a)
else:
- raise NotImplementedError('Unsupported argument: {}'.format(str(a)))
+ print('Unsupported argument: {} {}'.format(type(a), str(a)), file=sys.stderr)
def timedRefresh(self):
@@ -671,7 +693,8 @@ class MapCanvas(QgsMapCanvas):
if source in existingSources:
sourceLayer = existing[existingSources.index(source)]
else:
- sourceLayer = SensorProxyLayer(source, sensor=self.tsd().sensor())
+ loptions = QgsRasterLayer.LayerOptions(loadDefaultStyle=False)
+ sourceLayer = SensorProxyLayer(source, sensor=self.tsd().sensor(), options=loptions)
sourceLayer.setName(lyr.name())
sourceLayer.setCustomProperty('eotsv/sensorid', self.tsd().sensor().id())
try:
@@ -822,7 +845,7 @@ class MapCanvas(QgsMapCanvas):
def contextMenu(self, pos:QPoint)->QMenu:
"""
- Create the MapCanvas context menu with options relevant for pixel position ``pos``.
+ Creates the MapCanvas context menu with options relevant for pixel position ``pos``.
:param pos: QPoint
:return: QMenu
"""
@@ -864,34 +887,37 @@ class MapCanvas(QgsMapCanvas):
lyrWithSelectedFeatures = [l for l in quickLabelLayers() if l.isEditable() and l.selectedFeatureCount() > 0]
layerNames = ', '.join([l.name() for l in lyrWithSelectedFeatures])
- m = menu.addMenu('Quick Labels'.format(self.tsd().date()))
+ m = menu.addMenu('Quick Labels')
m.setToolTipsVisible(True)
nQuickLabelLayers = len(lyrWithSelectedFeatures)
m.setEnabled(nQuickLabelLayers > 0)
a = m.addAction('Set Date/Sensor attributes')
- a.setToolTip('Writes the date ate and sensor quick labels of selected features in {}.'.format(layerNames))
+ a.setToolTip('Writes the dates and sensor quick labels of selected features in {}.'.format(layerNames))
a.triggered.connect(lambda *args, tsd = self.tsd(), tss=tss: setQuickTSDLabelsForRegisteredLayers(tsd, tss))
- from .labeling import EDITOR_WIDGET_REGISTRY_KEY as QUICK_LABEL_KEY
from .labeling import CONFKEY_CLASSIFICATIONSCHEME, layerClassSchemes, setQuickClassInfo
+ if len(lyrWithSelectedFeatures) == 0:
+ a = m.addAction('No features selected.')
+ a.setToolTip('Select feature in the labeling panel to apply Quick label value on.')
+ a.setEnabled(False)
+ else:
+ for layer in lyrWithSelectedFeatures:
+ assert isinstance(layer, QgsVectorLayer)
- for layer in lyrWithSelectedFeatures:
- assert isinstance(layer, QgsVectorLayer)
-
- csf = layerClassSchemes(layer)
- if len(csf) > 0:
- m.addSection(layer.name())
- for (cs, field) in csf:
- assert isinstance(cs, ClassificationScheme)
- assert isinstance(field, QgsField)
+ csf = layerClassSchemes(layer)
+ if len(csf) > 0:
+ m.addSection(layer.name())
+ for (cs, field) in csf:
+ assert isinstance(cs, ClassificationScheme)
+ assert isinstance(field, QgsField)
- classMenu = m.addMenu('"{}" ({})'.format(field.name(), field.typeName()))
- for classInfo in cs:
- assert isinstance(classInfo, ClassInfo)
- a = classMenu.addAction('{} "{}"'.format(classInfo.label(), classInfo.name()))
- a.setIcon(classInfo.icon())
- a.triggered.connect(lambda _, vl=layer, f=field, c=classInfo: setQuickClassInfo(vl, f, c))
+ classMenu = m.addMenu('"{}" ({})'.format(field.name(), field.typeName()))
+ for classInfo in cs:
+ assert isinstance(classInfo, ClassInfo)
+ a = classMenu.addAction('{} "{}"'.format(classInfo.label(), classInfo.name()))
+ a.setIcon(classInfo.icon())
+ a.triggered.connect(lambda _, vl=layer, f=field, c=classInfo: setQuickClassInfo(vl, f, c))
if isinstance(refSensorLayer, SensorProxyLayer):
@@ -906,6 +932,7 @@ class MapCanvas(QgsMapCanvas):
action.triggered.connect(lambda *args, lyr=refSensorLayer: self.stretchToExtent(self.spatialExtent(), 'gaussian', layer=lyr, n=3))
+
menu.addSeparator()
from .externals.qps.layerproperties import pasteStyleFromClipboard, pasteStyleToClipboard
@@ -929,7 +956,11 @@ class MapCanvas(QgsMapCanvas):
for mapLayer in visibleLayers:
#sub = m.addMenu(mapLayer.name())
- sub = m.addMenu(os.path.basename(mapLayer.source()))
+ if isinstance(mapLayer, SensorProxyLayer):
+ name = os.path.basename(mapLayer.source())
+ else:
+ name = mapLayer.name()
+ sub = m.addMenu(name)
if isinstance(mapLayer, SensorProxyLayer):
sub.setIcon(QIcon(':/timeseriesviewer/icons/icon.svg'))
@@ -945,11 +976,8 @@ class MapCanvas(QgsMapCanvas):
sub.setIcon(QIcon(r':/images/themes/default/mIconPointLayer.svg'))
a = sub.addAction('Properties...')
- a.triggered.connect(lambda *args,
- lyr = mapLayer,
- c = self,
- b = isinstance(mapLayer, SensorProxyLayer) == False:
- showLayerPropertiesDialog(lyr, c, useQGISDialog=b))
+ a.triggered.connect(lambda *args, lyr = mapLayer: self.onSetLayerProperties(lyr))
+
a = sub.addAction('Zoom to Layer')
a.setIcon(QIcon(':/images/themes/default/mActionZoomToLayer.svg'))
@@ -981,12 +1009,12 @@ class MapCanvas(QgsMapCanvas):
action.setChecked(self.mCrosshairItem.visibility())
action.toggled.connect(self.setCrosshairVisibility)
- action = m.addAction('Style')
+ action = m.addAction('Set Style')
def onCrosshairChange(*args):
style = CrosshairDialog.getCrosshairStyle(parent=self,
mapCanvas=self,
- crosshairStyle=self.mCrosshairItem.crosshairStyle)
+ crosshair=self.mCrosshairItem.crosshairStyle)
if isinstance(style, CrosshairStyle):
self.setCrosshairStyle(style)
@@ -999,15 +1027,22 @@ class MapCanvas(QgsMapCanvas):
action = m.addAction('Date')
action.triggered.connect(lambda: QApplication.clipboard().setText(str(tsd.date())))
action.setToolTip('Sends "{}" to the clipboard.'.format(str(tsd.date())))
+
action = m.addAction('Sensor')
action.triggered.connect(lambda: QApplication.clipboard().setText(tsd.sensor().name()))
action.setToolTip('Sends "{}" to the clipboard.'.format(tsd.sensor().name()))
- action = m.addAction('Path')
+ action = m.addAction('Path')
paths = [QDir.toNativeSeparators(p) for p in tsd.sourceUris()]
-
action.triggered.connect(lambda _, paths=paths: QApplication.clipboard().setText('\n'.join(paths)))
action.setToolTip('Sends {} source URI(s) to the clipboard.'.format(len(tsd)))
+
+ extent = self.extent()
+ assert isinstance(extent, QgsRectangle)
+ action = m.addAction('Extent')
+ action.triggered.connect(lambda _, extent=extent: QApplication.clipboard().setText(extent.toString()))
+ action.setToolTip('Sends the map extent to the clipboard.')
+
action = m.addAction('Map')
action.triggered.connect(lambda: QApplication.clipboard().setPixmap(self.pixmap()))
action.setToolTip('Copies this map into the clipboard.')
@@ -1100,12 +1135,27 @@ class MapCanvas(QgsMapCanvas):
return menu
+ def onSetLayerProperties(self, lyr:QgsRasterLayer):
+ # b = isinstance(mapLayer, SensorProxyLayer) == False:
+
+ result = showLayerPropertiesDialog(lyr, self, useQGISDialog=True)
+
+ if result == QDialog.Accepted and isinstance(lyr, SensorProxyLayer):
+ r = lyr.renderer().clone()
+ proxyLayer = self.mMapView.sensorProxyLayer(lyr.sensor())
+ r.setInput(proxyLayer.dataProvider())
+ proxyLayer.setRenderer(r)
+
def onPasteStyleFromClipboard(self, lyr):
from .externals.qps.layerproperties import pasteStyleFromClipboard
pasteStyleFromClipboard(lyr)
if isinstance(lyr, SensorProxyLayer):
- self.mMapView.sensorProxyLayer(lyr.sensor()).setRenderer(lyr.renderer().clone())
+ r = lyr.renderer().clone()
+ proxyLayer = self.mMapView.sensorProxyLayer(lyr.sensor())
+ r.setInput(proxyLayer.dataProvider())
+ proxyLayer.setRenderer(r)
+
def contextMenuEvent(self, event:QContextMenuEvent):
"""
@@ -1132,9 +1182,11 @@ class MapCanvas(QgsMapCanvas):
lqgis.setRenderer(l.renderer().clone())
def stretchToCurrentExtent(self):
-
+ """
+ Stretches the top-raster layer band to the current spatial extent
+ """
se = self.spatialExtent()
- self.stretchToExtent(se)
+ self.stretchToExtent(se, stretchType='linear_minmax', p=0.05)
def stretchToExtent(self, spatialExtent:SpatialExtent, stretchType='linear_minmax', layer:QgsRasterLayer=None, **stretchArgs):
"""
@@ -1157,6 +1209,9 @@ class MapCanvas(QgsMapCanvas):
if not isinstance(layer, QgsRasterLayer):
return
+ if not isinstance(spatialExtent, SpatialExtent):
+ spatialExtent = SpatialExtent.fromLayer(layer)
+
r = layer.renderer()
dp = layer.dataProvider()
newRenderer = None
@@ -1224,7 +1279,7 @@ class MapCanvas(QgsMapCanvas):
if isinstance(layer, SensorProxyLayer):
self.mMapView.sensorProxyLayer(layer.sensor()).setRenderer(newRenderer)
elif isinstance(layer, QgsRasterLayer):
- layer.setRenderer(layer)
+ layer.setRenderer(newRenderer)
def saveMapImageDialog(self, fileType):
diff --git a/eotimeseriesviewer/mapvisualization.py b/eotimeseriesviewer/mapvisualization.py
index dba3a04d9f27b5bd734cf9ae6a429b5592a0c048..9683f186ba73314433a23936d51a984d4c91d2f4 100644
--- a/eotimeseriesviewer/mapvisualization.py
+++ b/eotimeseriesviewer/mapvisualization.py
@@ -108,7 +108,8 @@ class MapViewLayerTreeViewMenuProvider(QgsLayerTreeViewMenuProvider):
menu = QMenu(view)
isSensorGroup = isinstance(g, QgsLayerTreeGroup) and g.customProperty(KEY_SENSOR_GROUP) in [True, 'true']
- isSensorLayer = isinstance(l, QgsRasterLayer) and l.customProperty(KEY_SENSOR_LAYER) in [True, 'true']
+
+ if isinstance(self.mapView(), MapView):isSensorLayer = isinstance(l, QgsRasterLayer) and l.customProperty(KEY_SENSOR_LAYER) in [True, 'true']
self.actionRemove.setEnabled(not (isSensorGroup or isSensorLayer))
self.actionAddGroup.setEnabled(not (isSensorGroup or isSensorLayer))
menu.addAction(self.actionAddGroup)
@@ -127,26 +128,22 @@ class MapViewLayerTreeViewMenuProvider(QgsLayerTreeViewMenuProvider):
menu.addSeparator()
centerCanvas = None
- if isinstance(self.mapView(), MapView):
- visibleCanvases = self.mapView().visibleMapCanvases()
- if len(visibleCanvases) > 0:
- i = int(len(visibleCanvases) / 2)
- centerCanvas = visibleCanvases[i]
+ visibleCanvases = self.mapView().visibleMapCanvases()
+ if len(visibleCanvases) > 0:
+ i = int(len(visibleCanvases) / 2)
+ centerCanvas = visibleCanvases[i]
a = menu.addAction('Set Properties')
- a.triggered.connect(lambda *args,
- canvas = centerCanvas,
- lyr = l,
- b = not isinstance(l, SensorProxyLayer):
- showLayerPropertiesDialog(lyr, canvas, useQGISDialog=b))
+ a.triggered.connect(lambda *args, canvas = centerCanvas, lyr = l: self.onSetLayerProperties(lyr, canvas))
- a.setEnabled(isinstance(centerCanvas, QgsMapCanvas))
+ a.setEnabled(isinstance(centerCanvas, MapCanvas))
from .externals.qps.layerproperties import pasteStyleFromClipboard, pasteStyleToClipboard
a = menu.addAction('Copy Style')
a.setToolTip('Copy the current layer style to clipboard')
- a.triggered.connect(lambda *args, lyr=l: pasteStyleToClipboard(lyr))
+
+ a.triggered.connect(lambda *args, c=centerCanvas, lyr=l: pasteStyleToClipboard(lyr))
a = menu.addAction('Paste Style')
a.setEnabled('application/qgis.style' in QApplication.clipboard().mimeData().formats())
@@ -158,6 +155,10 @@ class MapViewLayerTreeViewMenuProvider(QgsLayerTreeViewMenuProvider):
return menu
+ def onSetLayerProperties(self, lyr:QgsRasterLayer, canvas:QgsMapCanvas):
+ if isinstance(canvas, MapCanvas):
+ canvas.onSetLayerProperties(lyr)
+
class MapViewLayerTreeModel(QgsLayerTreeModel):
"""
Layer Tree as shown in a MapView
@@ -469,7 +470,7 @@ class MapView(QFrame, loadUIFormClass(jp(DIR_UI, 'mapview.ui'))):
"""
return not self.actionToggleMapViewHidden.isChecked()
- def mapCanvases(self)->list:
+ def mapCanvases(self)->typing.List[MapCanvas]:
"""
Returns the MapCanvases related to this map view. Requires that this mapview was added to a MapWidget
:return: [list-of-MapCanvases]
@@ -595,7 +596,7 @@ class MapView(QFrame, loadUIFormClass(jp(DIR_UI, 'mapview.ui'))):
self.sigCrosshairChanged.emit()
- def sensorProxyLayers(self)->list:
+ def sensorProxyLayers(self)->typing.List[SensorProxyLayer]:
layers = [n.layer() for n in self.mLayerTreeSensorNode.findLayers()]
return [l for l in layers if isinstance(l, SensorProxyLayer)]
@@ -676,14 +677,14 @@ class MapView(QFrame, loadUIFormClass(jp(DIR_UI, 'mapview.ui'))):
:param sensor:
:return:
"""
- pair = None
- for i, t in enumerate(self.mSensorLayerList):
+ toRemove = []
+ for t in self.mSensorLayerList:
if t[0] == sensor:
- pair = t
- break
- assert pair is not None, 'Sensor "{}" not found'.format(sensor.name())
- self.mLayerTreeSensorNode.removeLayer(pair[1])
- self.mSensorLayerList.remove(pair)
+ toRemove.append(t)
+
+ for t in toRemove:
+ self.mLayerTreeSensorNode.removeLayer(t[1])
+ self.mSensorLayerList.remove(t)
def hasSensor(self, sensor)->bool:
@@ -850,10 +851,8 @@ class MapWidget(QFrame, loadUIFormClass(jp(DIR_UI, 'mapwidget.ui'))):
self.mCanvasSignals = dict()
self.mTimeSeries = None
-
self.mMapToolKey = MapTools.Pan
-
self.mViewMode = MapWidget.ViewMode.MapViewByRows
self.mMpMV = 3
@@ -870,9 +869,6 @@ class MapWidget(QFrame, loadUIFormClass(jp(DIR_UI, 'mapwidget.ui'))):
self.mMapRefreshTimer.setInterval(500)
self.mMapRefreshTimer.start()
- #self.setSizePolicy(QSizePolicy(QSizePolicy.Fixed, QSizePolicy.Fixed))
-
-
self.btnFirst.setDefaultAction(self.actionFirstDate)
self.btnLast.setDefaultAction(self.actionLastDate)
self.btnBackward.setDefaultAction(self.actionBackward)
@@ -957,7 +953,7 @@ class MapWidget(QFrame, loadUIFormClass(jp(DIR_UI, 'mapwidget.ui'))):
:param extent: SpatialExtent
:return: SpatialExtent the current SpatialExtent
"""
-
+ assert isinstance(extent, SpatialExtent)
if self.mSpatialExtent != extent:
self.mSpatialExtent = extent
@@ -1052,20 +1048,26 @@ class MapWidget(QFrame, loadUIFormClass(jp(DIR_UI, 'mapwidget.ui'))):
def _updateSliderRange(self):
+ slider = self.timeSlider()
+ assert isinstance(slider, QSlider)
n = len(self.timeSeries())
- self.mTimeSlider.setRange(0, n)
- self.mTimeSlider.setEnabled(n > 0)
+ slider.setRange(0, n)
+ slider.setEnabled(n > 0)
+
if n > 10:
pageStep = int(n/100)*10
+ slider.setTickInterval(pageStep)
else:
pageStep = 5
- self.timeSlider().setPageStep(pageStep)
+ slider.setTickInterval(0)
+
+ slider.setPageStep(pageStep)
+
if n > 0:
tsd = self.currentDate()
-
if isinstance(tsd, TimeSeriesDate) and tsd in self.timeSeries():
i = self.timeSeries()[:].index(tsd)
- self.mTimeSlider.setValue(i+1)
+ slider.setValue(i+1)
def onSliderReleased(self):
@@ -1087,7 +1089,12 @@ class MapWidget(QFrame, loadUIFormClass(jp(DIR_UI, 'mapwidget.ui'))):
self._updateGrid()
self.sigViewModeChanged.emit(self.mViewMode)
- def setMapsPerMapView(self, n:int):
+ def setMapsPerMapView(self, n:int)->int:
+ """
+ Sets the number of maps per map viewe
+ :param n: int
+ :return: int, number of maps per map view
+ """
assert n >= 0
if n != self.mMpMV:
@@ -1095,6 +1102,15 @@ class MapWidget(QFrame, loadUIFormClass(jp(DIR_UI, 'mapwidget.ui'))):
self._updateGrid()
self.timeSlider().setPageStep(max(1, n))
self.sigMapsPerMapViewChanged.emit(n)
+ return self.mapsPerMapView()
+
+
+ def mapsPerMapView(self)->int:
+ """
+ Returns the number of maps per map view
+ :return: int
+ """
+ return self.mMpMV
def setMapSize(self, size:QSize)->QSize:
"""
@@ -1120,14 +1136,14 @@ class MapWidget(QFrame, loadUIFormClass(jp(DIR_UI, 'mapwidget.ui'))):
"""
return self.mMapSize
- def mapCanvases(self)->list:
+ def mapCanvases(self)->typing.List[MapCanvas]:
"""
Returns all MapCanvases
:return: [list-of-MapCanvases]
"""
return self.findChildren(MapCanvas)
- def mapViewCanvases(self, mapView:MapView)->list:
+ def mapViewCanvases(self, mapView:MapView)->typing.List[MapCanvas]:
"""
Returns the MapCanvases related to a MapView
:param mapView: MapView
@@ -1188,7 +1204,7 @@ class MapWidget(QFrame, loadUIFormClass(jp(DIR_UI, 'mapwidget.ui'))):
"""
assert isinstance(tsd, TimeSeriesDate)
- b = tsd != self.mCurrentDate
+ b = tsd != self.mCurrentDate or (len(self.mapCanvases()) > 0 and self.mapCanvases()[0].tsd() is None)
self.mCurrentDate = tsd
if b:
@@ -1324,10 +1340,6 @@ class MapWidget(QFrame, loadUIFormClass(jp(DIR_UI, 'mapwidget.ui'))):
mapTools = mapCanvas.mapTools()
mapTools.activate(self.mMapToolKey)
- mt = mapCanvas.mapTool()
- if isinstance(mt, QgsMapToolSelect):
- mt.setSelectionMode(self.mMapToolMode)
-
# connect signals
self._connectCanvasSignals(mapCanvas)
return mapCanvas
@@ -1655,6 +1667,13 @@ class MapViewDock(QgsDockWidget, loadUI('mapviewdock.ui')):
self.btnAddMapView.setDefaultAction(self.actionAddMapView)
self.btnRemoveMapView.setDefaultAction(self.actionRemoveMapView)
+ self.btnCrs.setOptionVisible(QgsProjectionSelectionWidget.LayerCrs, True)
+ self.btnCrs.setOptionVisible(QgsProjectionSelectionWidget.ProjectCrs, True)
+ self.btnCrs.setOptionVisible(QgsProjectionSelectionWidget.CurrentCrs, True)
+ self.btnCrs.setOptionVisible(QgsProjectionSelectionWidget.DefaultCrs, True)
+ self.btnCrs.setOptionVisible(QgsProjectionSelectionWidget.RecentCrs, True)
+ #self.btnCrs.setOptionVisible(QgsProjectionSelectionWidget.CrsNotSet, True)
+
self.btnCrs.crsChanged.connect(self.sigCrsChanged)
self.btnMapCanvasColor.colorChanged.connect(self.sigMapCanvasColorChanged)
self.btnTextFormat.changed.connect(lambda *args: self.sigMapTextFormatChanged.emit(self.mapTextFormat()))
@@ -1710,7 +1729,7 @@ class MapViewDock(QgsDockWidget, loadUI('mapviewdock.ui')):
return self.mMapWidget
- def mapWidget(self):
+ def mapWidget(self)->MapWidget:
"""
Returns the connected MapWidget
:return: MapWidget
@@ -2033,7 +2052,8 @@ class MapViewDock(QgsDockWidget, loadUI('mapviewdock.ui')):
Removes a Sensor
:param sensor: SensorInstrument
"""
- for mapView in self.mMapViews:
+ for mapView in self.mapViews():
+ assert isinstance(mapView, MapView)
mapView.removeSensor(sensor)
def applyStyles(self):
diff --git a/eotimeseriesviewer/pixelloader.py b/eotimeseriesviewer/pixelloader.py
index 48fea99e181a70ac1dc7335d17c56ae82613c44c..c16434939ae871e0677aa478e63c78f419314bdc 100644
--- a/eotimeseriesviewer/pixelloader.py
+++ b/eotimeseriesviewer/pixelloader.py
@@ -38,10 +38,6 @@ if DEBUG:
logger = multiprocessing.log_to_stderr()
logger.setLevel(multiprocessing.SUBDEBUG)
-class TaskMock(QgsTask):
- def __init__(self):
- super(TaskMock, self).__init__()
-
def dprint(msg):
if DEBUG:
print('PixelLoader: {}'.format(msg))
@@ -60,29 +56,31 @@ def isOutOfImage(ds, px):
return False
-
class PixelLoaderTask(object):
"""
- An object to store the results of an loading from a single raster source.
+ An object to store the loading results from a *single* raster source.
"""
- @staticmethod
- def fromDump(byte_object):
- return pickle.loads(byte_object)
+ def __init__(self, source:str, temporalProfiles:list, bandIndices=None):
- def __init__(self, source:str, geometries, bandIndices=None, **kwargs):
+ assert isinstance(temporalProfiles, list)
- if not isinstance(geometries, list):
- geometries = [geometries]
- assert isinstance(geometries, list)
geometries = [g for g in geometries if isinstance(g, (SpatialExtent, SpatialPoint))]
self.mId = ''
# assert isinstance(source, str) or isinstance(source, unicode)
- self.sourcePath = source
- self.geometries = geometries
- self.bandIndices = bandIndices
+ self.mSourcePath = source
+ self.mGeometries = []
+ self.mTemporalProfileIDs = []
+
+ from .temporalprofiles import TemporalProfile
+ for tp in temporalProfiles:
+ assert isinstance(tp, TemporalProfile)
+ self.mTemporalProfileIDs.append(tp.id())
+ self.mGeometries.append(tp.geometry())
+
+ self.mBandIndices = bandIndices
# for internal use only
self.mIsDone = False
@@ -92,16 +90,10 @@ class PixelLoaderTask(object):
self.resGeoTransformation = None
self.resProfiles = None
self.resNoDataValues = None
+ self.resPixelCoordinates = None
self.exception = None
self.info = None
- # other, free keywords
- for k in kwargs.keys():
- assert isinstance(k, str)
- assert not k.startswith('_')
- if not k in self.__dict__.keys():
- self.__dict__[k] = kwargs[k]
-
def setId(self, idStr:str):
self.mId = idStr
@@ -154,15 +146,17 @@ class PixelLoaderTask(object):
def __repr__(self):
info = ['PixelLoaderTask:']
+ info.append('\t' + self.mSourcePath)
+ info.append('\t' + ','.join(str(g) for g in self.mGeometries))
if not self.mIsDone:
info.append('not started...')
else:
- if self.bandIndices:
- info.append('\tBandIndices {}:{}'.format(len(self.bandIndices), self.bandIndices))
+ if self.mBandIndices:
+ info.append('\tBandIndices {}:{}'.format(len(self.mBandIndices), self.mBandIndices))
if self.resProfiles:
info.append('\tProfileData: {}'.format(len(self.resProfiles)))
for i, p in enumerate(self.resProfiles):
- g = self.geometries[i]
+ g = self.mGeometries[i]
d = self.resProfiles[i]
if d in [INFO_OUT_OF_IMAGE, INFO_NO_DATA]:
info.append('\t{}: {}:{}'.format(i + 1, g, d))
@@ -187,24 +181,27 @@ def transformPoint2Px(trans, pt, gt):
return geo2px(QgsPointXY(x, y), gt)
-def doLoaderTask(taskWrapper:QgsTask, dump):
+def doLoaderTask(qgsTask:QgsTask, dump):
- assert isinstance(taskWrapper, QgsTask)
+ assert isinstance(qgsTask, QgsTask)
tasks = pickle.loads(dump)
results = []
- for task in tasks:
+ nTasks = len(tasks)
+ qgsTask.setProgress(0)
+
+ for iTask, task in enumerate(tasks):
assert isinstance(task, PixelLoaderTask)
result = task
- ds = gdal.Open(task.sourcePath, gdal.GA_ReadOnly)
+ ds = gdal.Open(task.mSourcePath, gdal.GA_ReadOnly)
nb, ns, nl = ds.RasterCount, ds.RasterXSize, ds.RasterYSize
- bandIndices = list(range(nb)) if task.bandIndices is None else list(task.bandIndices)
+ bandIndices = list(range(nb)) if task.mBandIndices is None else list(task.mBandIndices)
# ensure to load valid indices only
bandIndices = [i for i in bandIndices if i >= 0 and i < nb]
- task.bandIndices = bandIndices
+ task.mBandIndices = bandIndices
gt = ds.GetGeoTransform()
result.resGeoTransformation = gt
@@ -216,7 +213,7 @@ def doLoaderTask(taskWrapper:QgsTask, dump):
# convert Geometries into pixel indices to be extracted
PX_SUBSETS = []
- for geom in task.geometries:
+ for geom in task.mGeometries:
crsRequest = osr.SpatialReference()
if geom.crs().isValid():
@@ -225,6 +222,12 @@ def doLoaderTask(taskWrapper:QgsTask, dump):
crsRequest.ImportFromWkt(crsSrc.ExportToWkt())
trans = osr.CoordinateTransformation(crsRequest, crsSrc)
+ trans2 = QgsCoordinateTransform()
+ trans2.setSourceCrs(QgsCoordinateReferenceSystem(crsRequest.ExportToWkt()))
+ trans2.setDestinationCrs(QgsCoordinateReferenceSystem(crsSrc.ExportToWkt()))
+ lyr = QgsRasterLayer(task.mSourcePath)
+ geom2 = trans2.transform(geom)
+
if isinstance(geom, QgsPointXY):
ptUL = ptLR = QgsPointXY(geom)
elif isinstance(geom, QgsRectangle):
@@ -241,6 +244,7 @@ def doLoaderTask(taskWrapper:QgsTask, dump):
bLR = isOutOfImage(ds, pxLR)
if all([bUL, bLR]):
+
PX_SUBSETS.append(INFO_OUT_OF_IMAGE)
continue
@@ -266,8 +270,10 @@ def doLoaderTask(taskWrapper:QgsTask, dump):
size_x = abs(pxUL.x() - pxLR.x())
size_y = abs(pxUL.y() - pxLR.y())
- if size_x < 1: size_x = 1
- if size_y < 1: size_y = 1
+ if size_x < 1:
+ size_x = 1
+ if size_y < 1:
+ size_y = 1
PX_SUBSETS.append((pxUL, pxUL, size_x, size_y))
@@ -328,8 +334,6 @@ def doLoaderTask(taskWrapper:QgsTask, dump):
#PROFILE_DATA[i] = np.dstack(pd).transpose(2,0,1)
PROFILE_DATA[i] = np.vstack(pd)
-
-
# finally, ensure that there is on 2D array only
for i in range(len(PROFILE_DATA)):
d = PROFILE_DATA[i]
@@ -353,44 +357,13 @@ def doLoaderTask(taskWrapper:QgsTask, dump):
s = ""
task.resProfiles = PROFILE_DATA
+ task.resPixelCoordinates = PX_SUBSETS
task.mIsDone = True
results.append(task)
+ qgsTask.setProgress(100 * (iTask + 1) / nTasks)
return pickle.dumps(results)
-
-class LoadingProgress(object):
-
- def __init__(self, id, nFiles):
- assert isinstance(nFiles, int)
- assert isinstance(id, int)
- self.mID = id
- self.mSuccess = 0
- self.mTotal = nFiles
- self.mFailed = 0
-
- def addResult(self, success=True):
- assert self.done() <= self.mTotal
- if success:
- self.mSuccess += 1
- else:
- self.mFailed += 1
-
- def id(self):
- return self.mID
-
- def failed(self):
- return self.mFailed
-
-
- def done(self):
- return self.mSuccess + self.mFailed
-
- def total(self):
- return self.mTotal
-
-
-
class PixelLoader(QObject):
"""
Loads pixel from raster images
@@ -399,7 +372,7 @@ class PixelLoader(QObject):
sigPixelLoaded = pyqtSignal(PixelLoaderTask)
sigLoadingStarted = pyqtSignal()
sigLoadingFinished = pyqtSignal()
-
+ sigProgressChanged = pyqtSignal(float)
def __init__(self, *args, **kwds):
super(PixelLoader, self).__init__(*args, **kwds)
@@ -423,26 +396,24 @@ class PixelLoader(QObject):
dump = pickle.dumps(tasks)
+ self.sigLoadingStarted.emit()
+ qgsTask = QgsTask.fromFunction('Load band values', doLoaderTask, dump, on_finished=self.onLoadingFinished)
+ assert isinstance(qgsTask, QgsTask)
- if False:
- qgsTask = TaskMock()
- resultDump = doLoaderTask(qgsTask, dump)
- self.onLoadingFinished(TaskMock(), resultDump)
+ tid = id(qgsTask)
- else:
- qgsTask = QgsTask.fromFunction('Load band values', doLoaderTask, dump, on_finished=self.onLoadingFinished)
- tid = id(qgsTask)
- qgsTask.taskCompleted.connect(lambda *args, tid=tid: self.onRemoveTask(tid))
- qgsTask.taskTerminated.connect(lambda *args, tid=tid: self.onRemoveTask(tid))
- # todo: progress changed?
- self.mTasks[tid] = qgsTask
- tm = self.taskManager()
- tm.addTask(qgsTask)
+ qgsTask.taskCompleted.connect(lambda *args, tid=tid: self.onRemoveTask(tid))
+ qgsTask.taskTerminated.connect(lambda *args, tid=tid: self.onRemoveTask(tid))
+ qgsTask.progressChanged.connect(self.sigProgressChanged.emit)
+ self.mTasks[tid] = qgsTask
+ tm = self.taskManager()
+ tm.addTask(qgsTask)
def onRemoveTask(self, tid):
if tid in self.mTasks.keys():
- del self.mTasks[tid]
+ pass
+ #del self.mTasks[tid]
def onLoadingFinished(self, *args, **kwds):
@@ -454,6 +425,7 @@ class PixelLoader(QObject):
assert isinstance(plt, PixelLoaderTask)
#self.mTasks.pop(plt.id())
self.sigPixelLoaded.emit(plt)
+ self.sigLoadingFinished.emit()
def status(self)->tuple:
diff --git a/eotimeseriesviewer/profilevisualization.py b/eotimeseriesviewer/profilevisualization.py
index 82467bcf5f97b42f40385f8c55170e91f13878c7..38ebedbf9246040a61e2a654a1899f332e9473d7 100644
--- a/eotimeseriesviewer/profilevisualization.py
+++ b/eotimeseriesviewer/profilevisualization.py
@@ -32,11 +32,13 @@ from qgis.PyQt.QtGui import *
from .timeseries import *
from .utils import SpatialExtent, SpatialPoint, px2geo, loadUI, nextColor
from .externals.qps.plotstyling.plotstyling import PlotStyle, PlotStyleButton, PlotStyleDialog
+from .externals.pyqtgraph import ScatterPlotItem, SpotItem, GraphicsScene
+from .externals.qps.externals.pyqtgraph.GraphicsScene.mouseEvents import MouseClickEvent, MouseDragEvent
from .externals import pyqtgraph as pg
from .sensorvisualization import SensorListModel
-from .temporalprofiles2d import *
+from .temporalprofiles import *
from .temporalprofiles3d import *
-
+from .pixelloader import PixelLoaderTask, doLoaderTask
import numpy as np
@@ -519,7 +521,7 @@ class PlotSettingsModel2D(QAbstractTableModel):
- def requiredBandsIndices(self, sensor):
+ def requiredBandsIndices(self, sensor)->list:
"""
Returns the band indices required to calculate the values for
the different PlotStyle expressions making use of sensor
@@ -1330,10 +1332,10 @@ class SpectralTemporalVisualization(QObject):
assert isinstance(profileDock, ProfileViewDockUI)
self.ui = profileDock
-
- import eotimeseriesviewer.pixelloader
- if DEBUG:
- eotimeseriesviewer.pixelloader.DEBUG = True
+ self.mTasks = dict()
+ #import eotimeseriesviewer.pixelloader
+ #if DEBUG:
+ # eotimeseriesviewer.pixelloader.DEBUG = True
#the timeseries. will be set later
assert isinstance(timeSeries, TimeSeries)
@@ -1341,13 +1343,15 @@ class SpectralTemporalVisualization(QObject):
self.plot_initialized = False
self.plot2D = self.ui.plotWidget2D
+ assert isinstance(self.plot2D, DateTimePlotWidget)
self.plot2D.getViewBox().sigMoveToDate.connect(self.sigMoveToDate)
+ self.plot2D.getViewBox().scene().sigMouseClicked.connect(self.onPointsClicked2D)
self.plot3D = self.ui.plotWidget3D
+ self.mLast2DMouseClickPosition = None
# temporal profile collection to store loaded values
self.mTemporalProfileLayer = TemporalProfileLayer(self.TS)
self.mTemporalProfileLayer.sigTemporalProfilesAdded.connect(self.onTemporalProfilesAdded)
- #self.mTemporalProfileLayer.startEditing()
self.mTemporalProfileLayer.selectionChanged.connect(self.onTemporalProfileSelectionChanged)
# fix to not loose C++ reference on temporal profile layer in case it is removed from QGIS mapcanvas
@@ -1374,11 +1378,11 @@ class SpectralTemporalVisualization(QObject):
self.mTemporalProfilesTableConfig = config
self.mTemporalProfileLayer.setAttributeTableConfig(self.mTemporalProfilesTableConfig)
- self.pixelLoader = PixelLoader()
- self.pixelLoader.sigPixelLoaded.connect(self.onPixelLoaded)
- self.pixelLoader.sigLoadingStarted.connect(lambda: self.ui.progressInfo.setText('Start loading...'))
- # self.pixelLoader.sigLoadingStarted.connect(self.tpCollection.prune)
- self.pixelLoader.sigLoadingFinished.connect(lambda: self.plot2D.enableAutoRange('x', False))
+ #self.pixelLoader = PixelLoader()
+ #self.pixelLoader.sigPixelLoaded.connect(self.onPixelLoaded)
+ #self.pixelLoader.sigLoadingStarted.connect(self.onLoadingStarted)
+ #self.pixelLoader.sigLoadingFinished.connect(self.onLoadingFinished)
+ #self.pixelLoader.sigProgressChanged.connect(self.onLoadingProgressChanged)
# set the plot models for 2D
self.plotSettingsModel2D = PlotSettingsModel2D()
@@ -1409,7 +1413,6 @@ class SpectralTemporalVisualization(QObject):
self.ui.page3D.setHidden(True)
-
def onTemporalProfilesRemoved(removedProfiles):
#set to valid temporal profile
@@ -1462,6 +1465,23 @@ class SpectralTemporalVisualization(QObject):
#self.ui.stackedWidget.setCurrentPage(self.ui.pagePixel)
self.ui.onStackPageChanged(self.ui.stackedWidget.currentIndex())
+ def onLoadingStarted(self):
+ self.ui.progressInfo.setText('Start loading...')
+ self.ui.progressBar.setRange(0, 0)
+ self.ui.progressBar.setValue(0)
+
+ def onLoadingProgressChanged(self, progress):
+ if self.ui.progressBar.maximum() == 0:
+ self.ui.progressBar.setRange(0, 100)
+
+ value = int(progress)
+ self.ui.progressBar.setValue(value)
+
+ if value == 100:
+ self.plot2D.enableAutoRange('x', False)
+ self.ui.progressInfo.setText('')
+ self.ui.progressBar.setValue(0)
+
def plotStyles(self):
return self.plotSettingsModel2D[:]
@@ -1473,43 +1493,6 @@ class SpectralTemporalVisualization(QObject):
"""
return self.mTemporalProfileLayer
- def onTemporalProfilesContextMenu(self, event):
- assert isinstance(event, QContextMenuEvent)
- tableView = self.ui.tableViewTemporalProfiles
- selectionModel = self.ui.tableViewTemporalProfiles.selectionModel()
- assert isinstance(selectionModel, QItemSelectionModel)
-
- model = self.ui.tableViewTemporalProfiles.model()
- assert isinstance(model, TemporalProfileLayer)
-
- temporalProfiles = []
-
- if len(selectionModel.selectedIndexes()) > 0:
- for idx in selectionModel.selectedIndexes():
- tp = model.idx2tp(idx)
- if isinstance(tp, TemporalProfile) and not tp in temporalProfiles:
- temporalProfiles.append(tp)
- else:
- temporalProfiles = model[:]
-
- spatialPoints = [tp.coordinate() for tp in temporalProfiles]
-
-
- menu = QMenu()
-
- a = menu.addAction('Load missing')
- a.setToolTip('Loads missing band-pixels.')
- a.triggered.connect(lambda : self.loadCoordinate(spatialPoints=spatialPoints, mode='all'))
- s = ""
-
- a = menu.addAction('Reload')
- a.setToolTip('Reloads all band-pixels.')
- a.triggered.connect(lambda: self.loadCoordinate(spatialPoints=spatialPoints, mode='reload'))
-
- menu.popup(tableView.viewport().mapToGlobal(event.pos()))
- self.menu = menu
-
-
def selected2DPlotStyles(self):
result = []
@@ -1518,8 +1501,6 @@ class SpectralTemporalVisualization(QObject):
result.append(m.data(idx, Qt.UserRole))
return result
-
-
def removePlotStyles2D(self, plotStyles):
m = self.ui.tableView2DProfiles.model()
if isinstance(m.sourceModel(), PlotSettingsModel2D):
@@ -1557,8 +1538,8 @@ class SpectralTemporalVisualization(QObject):
pdi = plotStyle.createPlotItem(self.plot2D)
assert isinstance(pdi, TemporalProfilePlotDataItem)
- pdi.sigClicked.connect(self.onProfileClicked2D)
- pdi.sigPointsClicked.connect(self.onPointsClicked2D)
+ #pdi.sigClicked.connect(self.onProfileClicked2D)
+ #pdi.sigPointsClicked.connect(self.onPointsClicked2D)
self.plot2D.plotItem.addItem(pdi)
#self.plot2D.getPlotItem().addItem(pg.PlotDataItem(x=[1, 2, 3], y=[1, 2, 3]))
#plotItem.addDataItem(pdi)
@@ -1592,38 +1573,40 @@ class SpectralTemporalVisualization(QObject):
self.plot3D.addItems(plotItems)
#self.updatePlot3D()
- def onProfileClicked2D(self, pdi):
- if isinstance(pdi, TemporalProfilePlotDataItem):
- sensor = pdi.mPlotStyle.sensor()
- tp = pdi.mPlotStyle.temporalProfile()
- if isinstance(tp, TemporalProfile) and isinstance(sensor, SensorInstrument):
- c = tp.coordinate()
- info = ['Sensor:{}'.format(sensor.name()),
- 'Coordinate:{}, {}'.format(c.x(), c.y())]
- self.ui.tbInfo2D.setPlainText('\n'.join(info))
-
-
- def onPointsClicked2D(self, pdi, spottedItems):
+ def onPointsClicked2D(self, event: MouseClickEvent):
info = []
- if isinstance(pdi, TemporalProfilePlotDataItem) and isinstance(spottedItems, list):
- sensor = pdi.mPlotStyle.sensor()
- tp = pdi.mPlotStyle.temporalProfile()
- if isinstance(tp, TemporalProfile) and isinstance(sensor, SensorInstrument):
+ assert isinstance(event, MouseClickEvent)
+ for item in self.plot2D.scene().itemsNearEvent(event):
+
+ if isinstance(item, ScatterPlotItem) and isinstance(item.parentItem(), TemporalProfilePlotDataItem):
+ pdi = item.parentItem()
+ assert isinstance(pdi, TemporalProfilePlotDataItem)
+ tp = pdi.mPlotStyle.temporalProfile()
+ assert isinstance(tp, TemporalProfile)
c = tp.coordinate()
- info.append('Sensor: {}'.format(sensor.name()))
- info.append('Coordinate: {}, {}'.format(c.x(), c.y()))
- for item in spottedItems:
- pos = item.pos()
- x = pos.x()
- y = pos.y()
- date = num2date(x)
- info.append('Date: {}\nValue: {}'.format(date, y))
+ spottedItems = item.pointsAt(event.pos())
+ if len(spottedItems) > 0:
+ info.append('Sensor: {}'.format(pdi.mPlotStyle.sensor().name()))
+ info.append('Coordinate: {}, {}'.format(c.x(), c.y()))
+ for item in spottedItems:
+ if isinstance(item, SpotItem):
+ brush1 = item.brush()
+ brush2 = item.brush()
+ brush2.setColor(QColor('yellow'))
+ item.setBrush(brush2)
+ QTimer.singleShot(500, lambda *args, spotItem=item, brush=brush1: spotItem.setBrush(brush))
+ pos = item.pos()
+ self.mLast2DMouseClickPosition = pos
+ x = pos.x()
+ y = pos.y()
+ date = num2date(x)
+ info.append('{};{}'.format(date, y))
+
+ self.ui.tbInfo2D.setPlainText('\n'.join(info))
- else:
- self.ui.tbInfo2D.setPlainText('\n'.join(info))
def onTemporalProfilesAdded(self, profiles):
# self.mTemporalProfileLayer.prune()
@@ -1669,7 +1652,7 @@ class SpectralTemporalVisualization(QObject):
self.ui.actionReset3DCamera.triggered.connect(self.reset3DCamera)
self.ui.actionLoadTPFromOgr.triggered.connect(self.onLoadFromVector)
self.ui.actionLoadMissingValues.triggered.connect(lambda: self.loadMissingData())
- self.ui.actionSaveTemporalProfiles.triggered.connect(lambda *args : self.mTemporalProfileLayer.saveTemporalProfiles)
+ self.ui.actionSaveTemporalProfiles.triggered.connect(lambda *args : self.mTemporalProfileLayer.saveTemporalProfiles(None))
#set actions to be shown in the TemporalProfileTableView context menu
ma = [self.ui.actionSaveTemporalProfiles, self.ui.actionLoadMissingValues]
@@ -1732,23 +1715,39 @@ class SpectralTemporalVisualization(QObject):
self.sigMoveToTSD.emit(self.TS[i])
- def onPixelLoaded(self, d):
+ def onPixelLoaded(self, qgsTask ,dump)->typing.List[TemporalProfile]:
+ """
+ Updates TemporalProfiles
+ :param qgsTask:
+ :param dump:
+ :return: [updated TemporalProfiles]
+ """
+ tasks = pickle.loads(dump)
+ assert isinstance(tasks, list)
+ s = ""
+ t0 = time.time()
+ updatedTemporalProfiles = []
+ for task in tasks:
+ assert isinstance(task, TemporalProfileLoaderTask)
+
+ if len(task.mRESULTS) > 0:
+ for tpId, data in task.mRESULTS.items():
+ tp = self.mTemporalProfileLayer.mProfiles.get(tpId)
- if isinstance(d, PixelLoaderTask):
+ if isinstance(tp, TemporalProfile):
+ tsd = tp.timeSeries().getTSD(task.mSourcePath)
+ if isinstance(tsd, TimeSeriesDate):
+ tp.updateData(tsd, data)
+ if tp not in updatedTemporalProfiles:
+ updatedTemporalProfiles.append(tp)
- bn = os.path.basename(d.sourcePath)
- if d.success():
+ if len(task.mERRORS) > 0:
- t = 'Loaded {} pixel from {}.'.format(len(d.resProfiles), bn)
- self.mTemporalProfileLayer.addPixelLoaderResult(d)
- self.updateRequested = True
- else:
- t = 'Failed loading from {}.'.format(bn)
- if d.info and d.info != '':
- t += '({})'.format(d.info)
- # QgsApplication.processEvents()
- self.ui.progressInfo.setText(t)
+ s = ""
+ return updatedTemporalProfiles
+ if False:
+ print('WRESULTS {}'.format(time.time() - t0))
def requestUpdate(self, *args):
self.updateRequested = True
@@ -1778,13 +1777,7 @@ class SpectralTemporalVisualization(QObject):
self.ui.tableView3DProfiles.openPersistentEditor(idxExpr)
start += 1
- def onObservationClicked(self, plotDataItem, points):
- for p in points:
- tsd = p.data()
- #print(tsd)
-
-
- def loadMissingData(self, backgroundProcess=False):
+ def loadMissingData(self, backgroundProcess=True):
"""
Loads all band values of collected locations that have not been loaded until now
"""
@@ -1810,9 +1803,6 @@ class SpectralTemporalVisualization(QObject):
:param spatialPoints: SpatialPoint | [list-of-SpatialPoints]
"""
assert mode in SpectralTemporalVisualization.LOADING_MODES
-
-
-
if isinstance(spatialPoints, SpatialPoint):
spatialPoints = [spatialPoints]
@@ -1827,10 +1817,8 @@ class SpectralTemporalVisualization(QObject):
assert isinstance(self.TS, TimeSeries)
# Get or create the TimeSeriesProfiles which will store the loaded values
-
tasks = []
- TPs = []
- theGeometries = []
+ TemporalProfiles = []
# Define which (new) bands need to be loaded for each sensor
if LUT_bandIndices is None:
@@ -1847,14 +1835,11 @@ class SpectralTemporalVisualization(QObject):
# update new / existing points
-
-
-
for spatialPoint in spatialPoints:
assert isinstance(spatialPoint, SpatialPoint)
TP = self.mTemporalProfileLayer.fromSpatialPoint(spatialPoint)
- # if no TemporaProfile existed before, create an empty one
+ # if no TemporalProfile existed before, create an empty one
if not isinstance(TP, TemporalProfile):
TP = self.mTemporalProfileLayer.createTemporalProfiles(spatialPoint)[0]
@@ -1876,20 +1861,8 @@ class SpectralTemporalVisualization(QObject):
if len(self.plotSettingsModel3D) == 0:
self.createNewPlotStyle3D()
+ TemporalProfiles.append(TP)
-
- TPs.append(TP)
- theGeometries.append(TP.coordinate())
-
- if len(theGeometries) == 0:
- return
-
- bbox = QgsRectangle()
- for i, g in enumerate(theGeometries):
- bbox.include(g)
-
-
- TP_ids = [TP.id() for TP in TPs]
# each TSD is a Task
s = ""
# a Task defines which bands are to be loaded
@@ -1908,7 +1881,7 @@ class SpectralTemporalVisualization(QObject):
if mode == 'missing':
missingIndices = set()
- for TP in TPs:
+ for TP in TemporalProfiles:
assert isinstance(TP, TemporalProfile)
need2load = TP.missingBandIndices(tsd, requiredIndices=requiredIndices)
missingIndices = missingIndices.union(need2load)
@@ -1920,34 +1893,58 @@ class SpectralTemporalVisualization(QObject):
if len(missingIndices) > 0:
for tss in tsd.sources():
assert isinstance(tss, TimeSeriesSource)
- if bbox.intersects(tss.spatialExtent().toCrs(TPs[0].coordinate().crs())):
- task = PixelLoaderTask(tss.uri(), theGeometries,
- # bandIndices=missingIndices, load all indices!
- temporalProfileIDs=TP_ids)
+
+ intersectingTPs = []
+ tssExtent = tss.spatialExtent()
+ for TP in TemporalProfiles:
+ assert isinstance(TP, TemporalProfile)
+ if tssExtent.contains(TP.coordinate().toCrs(tssExtent.crs())):
+ intersectingTPs.append(TP)
+
+ if len(intersectingTPs) > 0:
+ task = TemporalProfileLoaderTask(tss, intersectingTPs)
tasks.append(task)
- break
+ # pickle.loads(doLoaderTask(mock, pickle.dumps([t])))[0]
if len(tasks) > 0:
-
- if DEBUG:
- print('Start loading for {} geometries from {} sources...'.format(
- len(theGeometries), len(tasks)
- ))
- if backgroundProcess:
- self.pixelLoader.startLoading(tasks)
- else:
- import eotimeseriesviewer.pixelloader
- tasks = [PixelLoaderTask.fromDump(eotimeseriesviewer.pixelloader.doLoaderTask(None, task.toDump())) for task in tasks]
- l = len(tasks)
- for i, task in enumerate(tasks):
- self.pixelLoader.sigPixelLoaded.emit(task)
+ self.loadTemporalProfileTasks(tasks, runAsync=backgroundProcess)
else:
if DEBUG:
print('Data for geometries already loaded')
+ def loadTemporalProfileTasks(self, tasks:typing.Iterable[TemporalProfileLoaderTask], runAsync=True)->typing.List[TemporalProfile]:
+ """
+ Loads data into TemporalProfiles
+ :param tasks:
+ :param runAsync:
+ :return: [list-of-updated TemporalProfiles], empty if runAsyn
+ """
+ dump = pickle.dumps(tasks)
+ if runAsync:
+ qgsTask = QgsTask.fromFunction('Load Profiles', doLoadTemporalProfileTasks, dump,
+ on_finished=self.onPixelLoaded)
+ else:
+ qgsTask = TaskMock()
+
+ tid = id(qgsTask)
+ qgsTask.progressChanged.connect(self.onLoadingProgressChanged)
+ qgsTask.taskCompleted.connect(lambda *args, tid=tid: self.onRemoveTask(tid))
+ qgsTask.taskTerminated.connect(lambda *args, tid=tid: self.onRemoveTask(tid))
+ self.mTasks[tid] = qgsTask
+
+ if runAsync:
+ tm = QgsApplication.taskManager()
+ assert isinstance(tm, QgsTaskManager)
+ tm.addTask(qgsTask, 1000)
+ return []
+ else:
+ return self.onPixelLoaded(qgsTask, doLoadTemporalProfileTasks(qgsTask, dump))
+ def onRemoveTask(self, tid):
+ if tid in self.mTasks.keys():
+ del self.mTasks[tid]
@QtCore.pyqtSlot()
def onDataUpdate(self):
diff --git a/eotimeseriesviewer/sensorvisualization.py b/eotimeseriesviewer/sensorvisualization.py
index 5994a3b3af891a78688a8e3b962735bdee2738ef..7bda62c15e72f968cfff748aa2c8830a98bd646e 100644
--- a/eotimeseriesviewer/sensorvisualization.py
+++ b/eotimeseriesviewer/sensorvisualization.py
@@ -231,7 +231,7 @@ class SensorTableModel(QAbstractTableModel):
if orientation == Qt.Horizontal and role == Qt.DisplayRole:
return self.mColumNames[col]
elif orientation == Qt.Vertical and role == Qt.DisplayRole:
- return col
+ return col + 1
return None
diff --git a/eotimeseriesviewer/settings.py b/eotimeseriesviewer/settings.py
index 81b5bf9e17fe4b89d785d0713e3f9565a7f9855e..87078fe700ec2bdbd8ff67519052c6f8cb1b2e3e 100644
--- a/eotimeseriesviewer/settings.py
+++ b/eotimeseriesviewer/settings.py
@@ -1,5 +1,6 @@
-import os, enum, pathlib, re
+import os, enum, pathlib, re, json
+from collections import namedtuple
from qgis.core import *
from qgis.gui import *
from qgis.PyQt.QtCore import *
@@ -8,6 +9,9 @@ from qgis.PyQt.QtGui import *
from eotimeseriesviewer import *
from eotimeseriesviewer.utils import loadUI
+from eotimeseriesviewer.timeseries import SensorMatching, SensorInstrument
+
+
class Keys(enum.Enum):
@@ -19,13 +23,15 @@ class Keys(enum.Enum):
MapUpdateInterval = 'map_update_interval'
MapBackgroundColor = 'map_background_color'
MapTextFormat = 'map_text_format'
- SensorNames = 'sensor_names'
+ SensorSpecs = 'sensor_specs'
+ SensorMatching = 'sensor_matching'
ScreenShotDirectory = 'screen_shot_directory'
RasterSourceDirectory = 'raster_source_directory'
VectorSourceDirectory = 'vector_source_directory'
MapImageExportDirectory = 'map_image_export_directory'
+
def defaultValues() -> dict:
"""
Returns the official hard-coded dictionary of default values.
@@ -40,7 +46,8 @@ def defaultValues() -> dict:
d[Keys.RasterSourceDirectory] = str(home)
d[Keys.VectorSourceDirectory] = str(home)
d[Keys.DateTimePrecision] = DateTimePrecision.Day
- d[Keys.SensorNames] = dict()
+ d[Keys.SensorSpecs] = dict()
+ d[Keys.SensorMatching] = SensorMatching.DIMS_WL_Name
# map visualization
d[Keys.MapUpdateInterval] = 500 # milliseconds
@@ -100,6 +107,14 @@ def value(key:Keys, default=None):
if value and key == Keys.MapTextFormat:
s = ""
+ if isinstance(value, str) and key == Keys.SensorSpecs:
+ value = json.loads(value)
+ assert isinstance(value, dict)
+ for k in value.keys():
+ if not isinstance(value[k], dict):
+ value[k] = {'name': None}
+
+
except TypeError as error:
value = None
settings().setValue(key.value, None)
@@ -107,6 +122,41 @@ def value(key:Keys, default=None):
return value
+def saveSensorName(sensor:SensorInstrument):
+ """
+ Saves the sensor name
+ :param sensor: SensorInstrument
+ :return:
+ """
+ assert isinstance(sensor, SensorInstrument)
+
+ sensorSpecs = value(Keys.SensorSpecs, default=dict())
+ assert isinstance(sensorSpecs, dict)
+
+ sSpecs = sensorSpecs.get(sensor.id(), dict())
+ sSpecs['name'] = sensor.name()
+
+ sensorSpecs[sensor.id()] = sSpecs
+
+ setValue(Keys.SensorSpecs, sensorSpecs)
+
+def sensorName(id:str)->str:
+ """
+ Retuns the sensor name stored for a certain sensor id
+ :param id: str
+ :return: str
+ """
+ if isinstance(id, SensorInstrument):
+ id = id.id()
+
+ sensorSpecs = value(Keys.SensorSpecs, default=dict())
+ assert isinstance(sensorSpecs, dict)
+ sSpecs = sensorSpecs.get(id, dict())
+ return sSpecs.get('name', None)
+
+
+
+
def setValue(key:Keys, value):
"""
Shortcut to save a value into the EOTSV settings
@@ -118,6 +168,9 @@ def setValue(key:Keys, value):
if isinstance(value, QgsTextFormat):
value = value.toMimeData()
+ if isinstance(value, dict) and key == Keys.SensorSpecs:
+ settings().setValue(key.value, json.dumps(value))
+
settings().setValue(key.value, value)
@@ -132,6 +185,148 @@ def setValues(values: dict):
for key, val in values.items():
setValue(key, val)
+class SensorSettingsTableModel(QAbstractTableModel):
+ """
+ A table to visualize sensor-specific settings
+ """
+ def __init__(self):
+ super(SensorSettingsTableModel, self).__init__()
+
+ self.mSensors = []
+ self.mCNKey = 'Key'
+ self.mCNName = 'Name'
+ self.loadSettings()
+
+ def clear(self):
+ """Removes all entries"""
+ self.removeRows(0, self.rowCount())
+ assert len(self.mSensors) == 0
+
+ def reload(self):
+ """
+ Reloads the entire table
+ :return:
+ """
+ self.clear()
+ self.loadSettings()
+
+ def removeRows(self, row: int, count: int, parent: QModelIndex = QModelIndex()) -> bool:
+
+ if count > 0:
+ self.beginRemoveRows(parent, row, row+count-1)
+
+ for i in reversed(range(row, row+count)):
+ del self.mSensors[i]
+
+ self.endRemoveRows()
+
+ def loadSettings(self):
+ sensorSpecs = value(Keys.SensorSpecs, default={})
+
+ sensors = []
+ for id, specs in sensorSpecs.items():
+ sensor = SensorInstrument(id)
+ sensor.setName(specs['name'])
+ sensors.append(sensor)
+ self.addSensors(sensors)
+
+ def removeSensors(self, sensors:typing.List[SensorInstrument]):
+ assert isinstance(sensors, list)
+ n = len(sensors)
+
+ if n > 0:
+ self.beginInsertRows(QModelIndex(), self.rowCount() - 1, self.rowCount() - 1 + n)
+ self.mSensors.extend(sensors)
+ self.endInsertRows()
+
+
+ def addSensors(self, sensors:typing.List[SensorInstrument]):
+ assert isinstance(sensors, list)
+ n = len(sensors)
+
+ if n > 0:
+ self.beginInsertRows(QModelIndex(), self.rowCount()-1, self.rowCount() -1 + n)
+ self.mSensors.extend(sensors)
+ self.endInsertRows()
+
+ def saveSettings(self):
+
+ specs = dict()
+ for sensor in self.mSensors:
+ assert isinstance(sensor, SensorInstrument)
+ specs[sensor.id()] = sensor.name()
+ setValue(Keys.SensorSpecs, specs)
+
+ def rowCount(self, parent: QModelIndex = QModelIndex())->int:
+ return len(self.mSensors)
+
+ def columnNames(self)->typing.List[str]:
+ return [self.mCNKey, self.mCNName]
+
+ def columnCount(self, parent: QModelIndex):
+ return len(self.columnNames())
+
+ def flags(self, index: QModelIndex):
+ flags = Qt.ItemIsEnabled | Qt.ItemIsSelectable
+ cn = self.columnNames()[index.column()]
+ if cn == self.mCNName:
+ flags = flags | Qt.ItemIsEditable
+
+ return flags
+
+ def headerData(self, section, orientation, role):
+ assert isinstance(section, int)
+ if orientation == Qt.Horizontal and role == Qt.DisplayRole:
+ return self.columnNames()[section]
+ elif orientation == Qt.Vertical and role == Qt.DisplayRole:
+ return section + 1
+ else:
+ return None
+
+ def sensor(self, index)->SensorInstrument:
+ if isinstance(index, int):
+ return self.mSensors[index]
+ else:
+ return self.mSensors[index.row()]
+
+ def data(self, index: QModelIndex, role: int):
+
+ if not index.isValid():
+ return None
+
+ sensor = self.sensor(index)
+ cn = self.columnNames()[index.column()]
+
+ if role in [Qt.DisplayRole, Qt.EditRole]:
+ if cn == self.mCNName:
+ return sensor.name()
+ if cn == self.mCNKey:
+ return sensor.id()
+
+ if role == Qt.BackgroundColorRole and not (self.flags(index) & Qt.ItemIsEditable):
+ return QColor('gray')
+
+
+ return None
+
+ def setData(self, index: QModelIndex, value: typing.Any, role: int = ...) -> bool:
+
+ if not index.isValid():
+ return False
+
+ changed = False
+ sensor = self.sensor(index)
+ cn = self.columnNames()[index.column()]
+
+ if cn == self.mCNName and isinstance(value, str):
+ sensor.setName(value)
+ changed = True
+
+ if changed:
+ self.dataChanged.emit(index, index, [role])
+ return changed
+
+
class SettingsDialog(QDialog, loadUI('settingsdialog.ui')):
"""
@@ -148,11 +343,16 @@ class SettingsDialog(QDialog, loadUI('settingsdialog.ui')):
assert isinstance(e, enum.Enum)
self.cbDateTimePrecission.addItem(e.name, e)
+ for e in SensorMatching:
+ assert isinstance(e, enum.Enum)
+ self.cbSensorMatching.addItem(e.value, e)
+
self.mFileWidgetScreenshots.setStorageMode(QgsFileWidget.GetDirectory)
self.mFileWidgetRasterSources.setStorageMode(QgsFileWidget.GetDirectory)
self.mFileWidgetVectorSources.setStorageMode(QgsFileWidget.GetDirectory)
self.cbDateTimePrecission.currentIndexChanged.connect(self.validate)
+ self.cbSensorMatching.currentIndexChanged.connect(self.validate)
self.sbMapSizeX.valueChanged.connect(self.validate)
self.sbMapSizeY.valueChanged.connect(self.validate)
self.sbMapRefreshIntervall.valueChanged.connect(self.validate)
@@ -166,18 +366,49 @@ class SettingsDialog(QDialog, loadUI('settingsdialog.ui')):
self.mLastValues = dict()
+ self.mSensorSpecsModel = SensorSettingsTableModel()
+ self.mSensorSpecsProxyModel = QSortFilterProxyModel()
+ self.mSensorSpecsProxyModel.setSourceModel(self.mSensorSpecsModel)
+
+ self.tableViewSensorSettings.setModel(self.mSensorSpecsProxyModel)
+ sm = self.tableViewSensorSettings.selectionModel()
+ assert isinstance(sm, QItemSelectionModel)
+ sm.selectionChanged.connect(self.onSensorSettingsSelectionChanged)
+
+ self.btnDeleteSelectedSensors.setDefaultAction(self.actionDeleteSelectedSensors)
+ self.btnReloadSensorSettings.setDefaultAction(self.actionRefreshSensorList)
+ self.actionRefreshSensorList.triggered.connect(self.mSensorSpecsModel.reload)
+
+ self.actionDeleteSelectedSensors.triggered.connect(self.onRemoveSelectedSensors)
+ self.actionDeleteSelectedSensors.setEnabled(len(sm.selectedRows()) > 0)
+ self.mSensorSpecsModel.clear()
self.setValues(settings())
+
+ def onRemoveSelectedSensors(self):
+
+ sm = self.tableViewSensorSettings.selectionModel()
+ assert isinstance(sm, QItemSelectionModel)
+
+ for r in sm.selectedRows():
+ s = ""
+
+ def onSensorSettingsSelectionChanged(self, selected:QItemSelection, deselected:QItemSelection):
+ self.actionDeleteSelectedSensors.setEnabled(len(selected) > 0)
+
def validate(self, *args):
values = self.values()
def onAccept(self):
- pass
+
self.setResult(QDialog.Accepted)
values = self.values()
setValues(values)
+
+ self.mSensorSpecsModel.saveSettings()
+
if values != self.mLastValues:
pass
@@ -194,6 +425,7 @@ class SettingsDialog(QDialog, loadUI('settingsdialog.ui')):
d[Keys.VectorSourceDirectory] = self.mFileWidgetVectorSources.filePath()
d[Keys.DateTimePrecision] = self.cbDateTimePrecission.currentData()
+ d[Keys.SensorMatching] = self.cbSensorMatching.currentData()
d[Keys.MapSize] = QSize(self.sbMapSizeX.value(), self.sbMapSizeY.value())
d[Keys.MapUpdateInterval] = self.sbMapRefreshIntervall.value()
d[Keys.MapBackgroundColor] = self.mCanvasColorButton.color()
@@ -210,7 +442,10 @@ class SettingsDialog(QDialog, loadUI('settingsdialog.ui')):
if isinstance(values, QSettings):
d = dict()
for k in values.allKeys():
- d[k] = values.value(k)
+ try:
+ d[k] = values.value(k)
+ except Exception as ex:
+ s = "" #TypeError: unable to convert a QVariant back to a Python object
values = d
assert isinstance(values, dict)
@@ -232,6 +467,11 @@ class SettingsDialog(QDialog, loadUI('settingsdialog.ui')):
if i > -1:
self.cbDateTimePrecission.setCurrentIndex(i)
+ if checkKey(key, Keys.SensorMatching):
+ i = self.cbSensorMatching.findData(value)
+ if i > -1:
+ self.cbSensorMatching.setCurrentIndex(i)
+
if checkKey(key, Keys.MapSize) and isinstance(value, QSize):
self.sbMapSizeX.setValue(value.width())
self.sbMapSizeY.setValue(value.height())
@@ -247,5 +487,3 @@ class SettingsDialog(QDialog, loadUI('settingsdialog.ui')):
-
-
diff --git a/eotimeseriesviewer/stackedbandinput.py b/eotimeseriesviewer/stackedbandinput.py
index c6ff847a920f196f2ea1b2e4b7915399f3fb3461..347a698c0bc6aa29ba5e897444834980b5e197be 100644
--- a/eotimeseriesviewer/stackedbandinput.py
+++ b/eotimeseriesviewer/stackedbandinput.py
@@ -38,10 +38,17 @@ def datesFromDataset(dataset:gdal.Dataset)->list:
return False
return True
- searchedKeys = []
- searchedKeys.append(re.compile('acquisition[ ]*dates$', re.I))
- searchedKeys.append(re.compile('observation[ ]*dates$', re.I))
- searchedKeys.append(re.compile('wavelength$', re.I))
+ searchedKeysDataSet = []
+ searchedKeysDataSet.append(re.compile('acquisition[ ]*dates$', re.I))
+ searchedKeysDataSet.append(re.compile('observation[ ]*dates$', re.I))
+ searchedKeysDataSet.append(re.compile('dates$', re.I))
+ searchedKeysDataSet.append(re.compile('wavelength$', re.I))
+
+ searchedKeysBand = []
+ searchedKeysBand.append(re.compile('acquisition[ ]*date$', re.I))
+ searchedKeysBand.append(re.compile('observation[ ]*date$', re.I))
+ searchedKeysBand.append(re.compile('date$', re.I))
+ searchedKeysBand.append(re.compile('wavelength$', re.I))
#1. Check Metadata
for domain in dataset.GetMetadataDomainList():
@@ -49,7 +56,7 @@ def datesFromDataset(dataset:gdal.Dataset)->list:
assert isinstance(domainData, dict)
for key, values in domainData.items():
- for regex in searchedKeys:
+ for regex in searchedKeysDataSet:
if regex.search(key.strip()):
values = re.sub('[{}]', '', values)
values = values.split(',')
@@ -58,12 +65,46 @@ def datesFromDataset(dataset:gdal.Dataset)->list:
return dateValues
- #2. Check Band Names
+ # 2. Search in band metadata
+ # 2.1. via GetDescription
bandDates = [extractDateTimeGroup(dataset.GetRasterBand(b+1).GetDescription()) for b in range(nb)]
bandDates = [b for b in bandDates if isinstance(b, np.datetime64)]
if checkDates(bandDates):
return bandDates
+ # 2.2 via Band Metadata
+ bandDates = []
+ for b in range(nb):
+ band = dataset.GetRasterBand(b+1)
+ assert isinstance(band, gdal.Band)
+ bandDate = None
+ for domain in band.GetMetadataDomainList():
+
+ md = band.GetMetadata_Dict(domain)
+
+ candidates = []
+ for k in md.keys():
+ for rx in searchedKeysBand:
+ if rx.search(k):
+ candidates.append(k)
+
+ for key in candidates:
+ assert isinstance(key, str)
+ DTG = extractDateTimeGroup(md[key])
+ if isinstance(DTG, np.datetime64):
+ bandDate = DTG
+ break
+
+ if isinstance(bandDate, np.datetime64):
+ break
+
+ if isinstance(bandDate, np.datetime64):
+ bandDates.append(bandDate)
+
+ if checkDates(bandDates):
+ return bandDates
+
+
return []
class InputStackInfo(object):
@@ -109,6 +150,7 @@ class InputStackInfo(object):
self.bandnames = []
self.nodatavalues = []
+
for b in range(self.nb):
band = dataset.GetRasterBand(b+1)
assert isinstance(band, gdal.Band)
diff --git a/eotimeseriesviewer/temporalprofiles2d.py b/eotimeseriesviewer/temporalprofiles.py
similarity index 84%
rename from eotimeseriesviewer/temporalprofiles2d.py
rename to eotimeseriesviewer/temporalprofiles.py
index eef24c79c9fc54bd111e5831d0d9cba31d4c8a59..0bdbf343c9f305c1c5748e353e040cbea2a0cc95 100644
--- a/eotimeseriesviewer/temporalprofiles2d.py
+++ b/eotimeseriesviewer/temporalprofiles.py
@@ -31,14 +31,15 @@ from qgis.PyQt.QtWidgets import *
import numpy as np
from osgeo import ogr, osr, gdal
from .externals import pyqtgraph as pg
-from .externals.pyqtgraph import functions as fn, AxisItem
+from .externals.pyqtgraph import functions as fn, AxisItem, ScatterPlotItem, SpotItem, GraphicsScene
from .externals.qps.plotstyling.plotstyling import PlotStyle
-from .timeseries import TimeSeries, TimeSeriesDate, SensorInstrument
+from .timeseries import TimeSeries, TimeSeriesDate, SensorInstrument, TimeSeriesSource
from .pixelloader import PixelLoader, PixelLoaderTask
from .utils import *
from .externals.qps.speclib.spectrallibraries import createQgsField
+
LABEL_EXPRESSION_2D = 'DN or Index'
LABEL_TIME = 'Date'
DEBUG = False
@@ -50,15 +51,25 @@ FN_ID = 'fid'
FN_X = 'x'
FN_Y = 'y'
FN_NAME = 'name'
+
+FN_DOY = 'DOY'
+FN_DTG = 'DTG'
+FN_IS_NODATA ='is_nodata'
+FN_GEO_X = 'geo_x'
+FN_GEO_Y = 'geo_y'
+FN_PX_X = 'px_x'
+FN_PX_Y = 'px_y'
+
#FN_N_TOTAL = 'n'
#FN_N_NODATA = 'no_data'
#FN_N_LOADED = 'loaded'
#FN_N_LOADED_PERCENT = 'percent'
-
regBandKey = re.compile(r"(?<!\w)b\d+(?!\w)", re.IGNORECASE)
regBandKeyExact = re.compile(r'^' + regBandKey.pattern + '$', re.IGNORECASE)
+
+
try:
import OpenGL
@@ -69,36 +80,58 @@ except:
-def sensorExampleQgsFeature(sensor, singleBandOnly=False):
- # populate with exemplary band values (generally stored as floats)
+def temporalProfileFeatureFields(sensor: SensorInstrument, singleBandOnly=False) -> QgsFields:
+ """
+ Returns the fields of a single temporal profile
+ :return:
+ """
+ assert isinstance(sensor, SensorInstrument)
+ fields = QgsFields()
+ fields.append(createQgsField(FN_DTG, '2011-09-12', comment='Date-time-group'))
+ fields.append(createQgsField(FN_DOY, 42, comment='Day-of-year'))
+ fields.append(createQgsField(FN_GEO_X, 12.1233, comment='geo-coordinate x/east value'))
+ fields.append(createQgsField(FN_GEO_Y, 12.1233, comment='geo-coordinate y/north value'))
+ fields.append(createQgsField(FN_PX_X, 42, comment='pixel-coordinate x index'))
+ fields.append(createQgsField(FN_PX_Y, 24, comment='pixel-coordinate y index'))
- if sensor is None:
- singleBandOnly = True
- fieldValues = collections.OrderedDict()
- if singleBandOnly:
- fieldValues['b'] = 1.0
- else:
- assert isinstance(sensor, SensorInstrument)
- for b in range(sensor.nb):
- fn = bandIndex2bandKey(b)
- fieldValues[fn] = 1.0
+ for b in range(sensor.nb):
+ bandKey = bandIndex2bandKey(b)
+ fields.append(createQgsField(bandKey, 1.0, comment='value band {}'.format(b+1)))
- date = datetime.date.today()
- doy = dateDOY(date)
- fieldValues['doy'] = doy
- fieldValues['date'] = str(date)
+ return fields
+def sensorExampleQgsFeature(sensor:SensorInstrument, singleBandOnly=False)->QgsFeature:
+ """
+ Returns an exemplary QgsFeature with value for a specific sensor
+ :param sensor: SensorInstrument
+ :param singleBandOnly:
+ :return:
+ """
+ # populate with exemplary band values (generally stored as floats)
- fields = QgsFields()
- for k, v in fieldValues.items():
- fields.append(createQgsField(k,v))
+ fields = temporalProfileFeatureFields(sensor)
f = QgsFeature(fields)
- for k, v in fieldValues.items():
- f.setAttribute(k, v)
+ pt = QgsPointXY(12.34567, 12.34567)
+ f.setGeometry(QgsGeometry.fromPointXY(pt))
+ f.setAttribute(FN_GEO_X, pt.x())
+ f.setAttribute(FN_GEO_Y, pt.y())
+ f.setAttribute(FN_PX_X, 1)
+ f.setAttribute(FN_PX_Y, 1)
+ dtg = datetime.date.today()
+ doy = dateDOY(dtg)
+ f.setAttribute(FN_DTG, str(dtg))
+ f.setAttribute(FN_DOY, doy)
+
+ for b in range(sensor.nb):
+ bandKey = bandIndex2bandKey(b)
+ f.setAttribute(bandKey, 1.0)
+
return f
+
+
def dateDOY(date):
if isinstance(date, np.datetime64):
date = date.astype(datetime.date)
@@ -179,6 +212,7 @@ class DateTimePlotWidget(pg.PlotWidget):
"""
Subclass of PlotWidget
"""
+
def __init__(self, parent=None):
"""
Constructor of the widget
@@ -208,12 +242,14 @@ class DateTimePlotWidget(pg.PlotWidget):
pi.addItem(self.mCrosshairLineV, ignoreBounds=True)
pi.addItem(self.mCrosshairLineH, ignoreBounds=True)
+ assert isinstance(self.scene(), pg.GraphicsScene)
self.proxy2D = pg.SignalProxy(self.scene().sigMouseMoved, rateLimit=60, slot=self.onMouseMoved2D)
def resetViewBox(self):
self.plotItem.getViewBox().autoRange()
+
def onMouseMoved2D(self, evt):
pos = evt[0] ## using signal proxy turns original arguments into a tuple
@@ -328,6 +364,7 @@ class DateTimeViewBox(pg.ViewBox):
Subclass of ViewBox
"""
sigMoveToDate = pyqtSignal(np.datetime64)
+ sigMoveToLocation = pyqtSignal(SpatialPoint)
def __init__(self, parent=None):
"""
Constructor of the CustomViewBox
@@ -337,6 +374,7 @@ class DateTimeViewBox(pg.ViewBox):
#self.menu = self.getMenu() # Create the menu
#self.menu = None
self.mCurrentDate = np.datetime64('today')
+
self.mXAxisUnit = 'date'
xAction = [a for a in self.menu.actions() if a.text() == 'X Axis'][0]
yAction = [a for a in self.menu.actions() if a.text() == 'Y Axis'][0]
@@ -382,7 +420,11 @@ class DateTimeViewBox(pg.ViewBox):
self.menu.removeAction(xAction)
self.mActionMoveToDate = self.menu.addAction('Move to {}'.format(self.mCurrentDate))
- self.mActionMoveToDate.triggered.connect(lambda : self.sigMoveToDate.emit(self.mCurrentDate))
+ self.mActionMoveToDate.triggered.connect(lambda *args : self.sigMoveToDate.emit(self.mCurrentDate))
+
+ #self.mActionMoveToProfile = self.menu.addAction('Move to profile location')
+ #self.mActionMoveToProfile.triggered.connect(lambda *args: self.sigM.emit(self.mCurrentDate))
+
self.mActionShowCrosshair = self.menu.addAction('Show Crosshair')
self.mActionShowCrosshair.setCheckable(True)
self.mActionShowCrosshair.setChecked(True)
@@ -429,6 +471,9 @@ class DateTimeViewBox(pg.ViewBox):
pt = self.mapDeviceToView(ev.pos())
self.updateCurrentDate(num2date(pt.x(), dt64=True))
+ plotDataItems = [item for item in self.scene().itemsNearEvent(ev) if isinstance(item, ScatterPlotItem) and isinstance(item.parentItem(), TemporalProfilePlotDataItem)]
+
+
xRange, yRange = self.viewRange()
t0 = num2date(xRange[0], qDate=True)
t1 = num2date(xRange[1], qDate=True)
@@ -436,158 +481,28 @@ class DateTimeViewBox(pg.ViewBox):
self.dateEditX1.setDate(t1)
menu = self.getMenu(ev)
- self.scene().addParentContextMenus(self, menu, ev)
- menu.exec_(ev.screenPos().toPoint())
-
-
-class TemporalProfilePlotStyleBase(PlotStyle):
-
- sigStyleUpdated = pyqtSignal()
- sigDataUpdated = pyqtSignal()
- sigExpressionUpdated = pyqtSignal()
- sigSensorChanged = pyqtSignal(SensorInstrument)
-
- def __init__(self, parent=None, temporalProfile=None):
- super(TemporalProfilePlotStyleBase, self).__init__()
- self.mSensor = None
- self.mTP = None
- self.mExpression = 'b1'
- self.mPlotItems = []
- self.mIsVisible = True
- self.mShowLastLocation = True
-
- if isinstance(temporalProfile, TemporalProfile):
- self.setTemporalProfile(temporalProfile)
-
- def showLastLocation(self)->bool:
- """
- """
- return self.mShowLastLocation
-
- def isPlotable(self):
- return self.isVisible() and isinstance(self.temporalProfile(), TemporalProfile) and isinstance(self.sensor(), SensorInstrument)
-
- def createPlotItem(self):
- raise NotImplementedError()
-
- def temporalProfile(self):
- return self.mTP
-
- def setTemporalProfile(self, temporalPofile):
-
- b = temporalPofile != self.mTP
- self.mTP = temporalPofile
- if temporalPofile in [None, QVariant()]:
- s =""
- else:
- assert isinstance(temporalPofile, TemporalProfile)
- if b:
- self.updateDataProperties()
-
- def setSensor(self, sensor):
- assert sensor is None or isinstance(sensor, SensorInstrument)
- b = sensor != self.mSensor
- self.mSensor = sensor
- if b:
- self.update()
- self.sigSensorChanged.emit(sensor)
-
- def sensor(self):
- return self.mSensor
-
- def updateStyleProperties(self):
- raise NotImplementedError()
-
- def updateDataProperties(self):
- raise NotImplementedError()
-
- def update(self):
- self.updateDataProperties()
-
- def setExpression(self, exp):
- assert isinstance(exp, str)
- b = self.mExpression != exp
- self.mExpression = exp
- self.updateDataProperties()
- if b:
- self
- self.sigExpressionUpdated.emit()
-
- def expression(self):
- return self.mExpression
-
- def __reduce_ex__(self, protocol):
- return self.__class__, (), self.__getstate__()
-
- def __getstate__(self):
- result = super(TemporalProfile2DPlotStyle, self).__getstate__()
- #remove
- del result['mTP']
- del result['mSensor']
-
- return result
-
- def isVisible(self):
- return self.mIsVisible
-
- def setVisibility(self, b):
- assert isinstance(b, bool)
- old = self.isVisible()
- self.mIsVisible = b
-
- if b != old:
- self.updateStyleProperties()
- #self.update()
-
- def copyFrom(self, plotStyle):
- if isinstance(plotStyle, PlotStyle):
- super(TemporalProfilePlotStyleBase, self).copyFrom(plotStyle)
- self.updateStyleProperties()
-
- if isinstance(plotStyle, TemporalProfilePlotStyleBase):
- self.setExpression(plotStyle.expression())
- self.setSensor(plotStyle.sensor())
- self.setTemporalProfile(plotStyle.temporalProfile())
- self.updateDataProperties()
-
-
-
-
-class TemporalProfile2DPlotStyle(TemporalProfilePlotStyleBase):
+ if len(plotDataItems) > 0:
+ s = ""
- def __init__(self, temporalProfile=None):
- super(TemporalProfile2DPlotStyle, self).__init__(temporalProfile=temporalProfile)
- #PlotStyle.__init__(self)
- #TemporalProfilePlotStyleBase.__init__(self, temporalProfile=temporalProfile)
+ self.scene().addParentContextMenus(self, menu, ev)
+ menu.exec_(ev.screenPos().toPoint())
- def createPlotItem(self, plotWidget):
- pdi = TemporalProfilePlotDataItem(self)
- self.mPlotItems.append(pdi)
- return pdi
-
- def updateStyleProperties(self):
- for pdi in self.mPlotItems:
- assert isinstance(pdi, TemporalProfilePlotDataItem)
- pdi.updateStyle()
-
- def updateDataProperties(self):
- for pdi in self.mPlotItems:
- assert isinstance(pdi, TemporalProfilePlotDataItem)
- pdi.updateDataAndStyle()
class TemporalProfile(QObject):
sigNameChanged = pyqtSignal(str)
- sigDataChanged = pyqtSignal()
+ #sigDataChanged = pyqtSignal()
- def __init__(self, layer, fid):
+ def __init__(self, layer, fid:int, geometry:QgsGeometry):
super(TemporalProfile, self).__init__()
+ assert isinstance(geometry, QgsGeometry)
assert isinstance(layer, TemporalProfileLayer)
assert fid >= 0
+
self.mID = fid
self.mLayer = layer
self.mTimeSeries = layer.timeSeries()
@@ -598,15 +513,26 @@ class TemporalProfile(QObject):
for tsd in self.mTimeSeries:
assert isinstance(tsd, TimeSeriesDate)
- meta = {'doy': tsd.mDOY,
- 'date': str(tsd.mDate),
- 'nodata': False}
+ meta = {FN_DOY: tsd.mDOY,
+ FN_DTG: str(tsd.mDate),
+ FN_IS_NODATA: False}
self.updateData(tsd, meta, skipStatusUpdate=True)
- #self.updateLoadingStatus()
- s = ""
+ self.mGEOM_CACHE = dict()
+ def printData(self, sensor:SensorInstrument=None):
+ """
+ Prints the entire temporal profile. For debug purposes.
+ """
+ for tsd in sorted(self.mData.keys()):
+ assert isinstance(tsd, TimeSeriesDate)
+ data = self.mData[tsd]
+ if isinstance(sensor, SensorInstrument) and tsd.sensor() != sensor:
+ continue
+ assert isinstance(data, dict)
+ info = '{}:{}={}'.format(tsd.date(), tsd.sensor().name(), str(data))
+ print(info)
def __hash__(self):
return hash('{}{}'.format(self.mID, self.mLayer.layerId()))
@@ -623,8 +549,24 @@ class TemporalProfile(QObject):
return other.mID == self.mID and self.mLayer == other.mLayer
- def geometry(self):
- return self.mLayer.getFeature(self.mID).geometry()
+ def geometry(self, crs:QgsCoordinateReferenceSystem=None)->QgsGeometry:
+ """
+ Returns the geometry
+ :param crs:
+ :return: QgsGeometry. usually a QgsPoint
+ """
+ g = self.mLayer.getFeature(self.mID).geometry()
+
+ if not isinstance(g, QgsGeometry):
+ return None
+
+ if isinstance(crs, QgsCoordinateReferenceSystem) and crs != self.mLayer.crs():
+ trans = QgsCoordinateTransform()
+ trans.setSourceCrs(self.mLayer.crs())
+ trans.setDestinationCrs(crs)
+ g.transform(trans)
+ return g
+
def coordinate(self)->SpatialPoint:
"""
@@ -662,58 +604,32 @@ class TemporalProfile(QObject):
def timeSeries(self):
return self.mTimeSeries
- def pullDataUpdate(self, d):
- assert isinstance(d, PixelLoaderTask)
- if d.success() and self.mID in d.temporalProfileIDs:
- i = d.temporalProfileIDs.index(self.mID)
- tsd = self.mTimeSeries.getTSD(d.sourcePath)
- assert isinstance(tsd, TimeSeriesDate)
-
- values = {}
- if d.validPixelValues(i):
- profileData = d.resProfiles[i]
-
- vMean, vStd = profileData
-
- validValues = not isinstance(vMean, str)
- # 1. add the pixel values per returned band
- for iBand, bandIndex in enumerate(d.bandIndices):
- key = 'b{}'.format(bandIndex + 1)
- values[key] = vMean[iBand] if validValues else None
- key = 'std{}'.format(bandIndex + 1)
- values[key] = vStd[iBand] if validValues else None
- else:
- values['nodata'] = True
-
- self.updateData(tsd, values)
-
-
- def loadMissingData(self, showGUI=False):
+ def loadMissingData(self):
"""
- Loads the missing data for this profile.
- :return:
+ Loads the missing data for this profile (synchronous eexecution, may take some time).
"""
- from eotimeseriesviewer.pixelloader import PixelLoaderTask, doLoaderTask
tasks = []
for tsd in self.mTimeSeries:
assert isinstance(tsd, TimeSeriesDate)
missingIndices = self.missingBandIndices(tsd)
if len(missingIndices) > 0:
-
- for pathImg in tsd.sourceUris():
-
- task = PixelLoaderTask(pathImg, [self.coordinate()],
- bandIndices=missingIndices,
- temporalProfileIDs=[self.mID])
- tasks.append(task)
-
-
- for task in tasks:
- result = PixelLoaderTask.fromDump(doLoaderTask(None, task))
- assert isinstance(result, PixelLoaderTask)
- self.pullDataUpdate(result)
+ for tss in tsd:
+ assert isinstance(tss, TimeSeriesSource)
+ if tss.spatialExtent().contains(self.coordinate().toCrs(tss.crs())):
+ task = TemporalProfileLoaderTask(tss, [self], bandIndices=missingIndices)
+ tasks.append(task)
+
+ results = doLoadTemporalProfileTasks(TaskMock(), pickle.dumps(tasks))
+ ts = self.timeSeries()
+ for result in pickle.loads(results):
+ assert isinstance(result, TemporalProfileLoaderTask)
+ tsd = ts.getTSD(result.mSourcePath)
+ assert isinstance(tsd, TimeSeriesDate)
+ for tpId, data in result.mRESULTS.items():
+ if tpId == self.id():
+ self.updateData(tsd, data)
def missingBandIndices(self, tsd, requiredIndices=None):
"""
@@ -726,7 +642,12 @@ class TemporalProfile(QObject):
if requiredIndices is None:
requiredIndices = list(range(tsd.mSensor.nb))
requiredIndices = [i for i in requiredIndices if i >= 0 and i < tsd.mSensor.nb]
+
existingBandIndices = [bandKey2bandIndex(k) for k in self.data(tsd).keys() if regBandKeyExact.search(k)]
+
+ if FN_PX_X not in self.data(tsd).keys() and len(requiredIndices) == 0:
+ requiredIndices.append(0)
+
return [i for i in requiredIndices if i not in existingBandIndices]
@@ -751,13 +672,22 @@ class TemporalProfile(QObject):
assert isinstance(values, dict)
if tsd not in self.mData.keys():
- self.mData[tsd] = {}
+ self.mData[tsd] = dict()
+
+ values2 = self.mData.get(tsd)
+ assert isinstance(values2, dict)
+ for k, v in values.items():
+ if v in [None, np.NaN] and k not in values2.keys():
+ values2[k] = v
+ else:
+ values2[k] = v
+
+ #self.mData[tsd].update(values)
- self.mData[tsd].update(values)
if not skipStatusUpdate:
#self.updateLoadingStatus()
self.mUpdated = True
- self.sigDataChanged.emit()
+ #self.sigDataChanged.emit()
def resetUpdatedFlag(self):
self.mUpdated = False
@@ -765,7 +695,7 @@ class TemporalProfile(QObject):
def updated(self):
return self.mUpdated
- def dataFromExpression(self, sensor, expression:str, dateType='date'):
+ def dataFromExpression(self, sensor:SensorInstrument, expression:str, dateType='date'):
assert dateType in ['date', 'doy']
x = []
y = []
@@ -776,39 +706,52 @@ class TemporalProfile(QObject):
assert isinstance(expression, QgsExpression)
expression = QgsExpression(expression)
- # define required QgsFields
- fields = QgsFields()
+
+
sensorTSDs = sorted([tsd for tsd in self.mData.keys() if tsd.sensor() == sensor])
- for tsd in sensorTSDs:
- data = self.mData[tsd]
- for k, v in data.items():
- if v is not None and fields.indexFromName(k) == -1:
- fields.append(createQgsField(k, v))
+
+ # define required QgsFields
+ fields = temporalProfileFeatureFields(sensor)
+
+ geo_x = self.geometry().centroid().get().x()
+ geo_y = self.geometry().centroid().get().y()
for i, tsd in enumerate(sensorTSDs):
assert isinstance(tsd, TimeSeriesDate)
data = self.mData[tsd]
+
+ if dateType == 'date':
+ xValue = date2num(tsd.mDate)
+ elif dateType == 'doy':
+ xValue = tsd.mDOY
+
context = QgsExpressionContext()
context.setFields(fields)
- #scope = QgsExpressionContextScope()
f = QgsFeature(fields)
- for k, v in data.items():
- setQgsFieldValue(f, k, v)
+
+ # set static properties (same for all TSDs)
+ f.setGeometry(QgsGeometry(self.geometry()))
+ f.setAttribute(FN_GEO_X, geo_x)
+ f.setAttribute(FN_GEO_Y, geo_y)
+
+ # set TSD specific properties
+ f.setAttribute(FN_DOY, tsd.doy())
+ f.setAttribute(FN_DTG, str(tsd.date()))
+
+ for fn in fields.names():
+ if fn in data.keys():
+ setQgsFieldValue(f, fn, data[fn])
context.setFeature(f)
- value = expression.evaluate(context)
+ yValue = expression.evaluate(context)
+ if yValue in [None, QVariant()]:
+ yValue = np.NaN
- if value in [None, QVariant()]:
- s = ""
- else:
- if dateType == 'date':
- x.append(date2num(tsd.mDate))
- elif dateType == 'doy':
- x.append(tsd.mDOY)
- y.append(value)
+ y.append(yValue)
+ x.append(xValue)
#return np.asarray(x), np.asarray(y)
assert len(x) == len(y)
@@ -868,7 +811,7 @@ class TemporalProfile(QObject):
def isNoData(self, tsd):
assert isinstance(tsd, TimeSeriesDate)
- return self.mData[tsd]['nodata']
+ return self.mData[tsd][FN_IS_NODATA]
def hasData(self, tsd):
assert isinstance(tsd, TimeSeriesDate)
@@ -878,6 +821,245 @@ class TemporalProfile(QObject):
return 'TemporalProfile {} "{}"'.format(self.id(), self.name())
+class TemporalProfilePlotStyleBase(PlotStyle):
+
+ sigStyleUpdated = pyqtSignal()
+ sigDataUpdated = pyqtSignal()
+ sigExpressionUpdated = pyqtSignal()
+ sigSensorChanged = pyqtSignal(SensorInstrument)
+
+ def __init__(self, parent=None, temporalProfile=None):
+ super(TemporalProfilePlotStyleBase, self).__init__()
+ self.mSensor = None
+ self.mTP = None
+ self.mExpression = 'b1'
+ self.mPlotItems = []
+ self.mIsVisible = True
+ self.mShowLastLocation = True
+
+ if isinstance(temporalProfile, TemporalProfile):
+ self.setTemporalProfile(temporalProfile)
+
+ def showLastLocation(self)->bool:
+ """
+ """
+ return self.mShowLastLocation
+
+ def isPlotable(self):
+ return self.isVisible() and isinstance(self.temporalProfile(), TemporalProfile) and isinstance(self.sensor(), SensorInstrument)
+
+ def createPlotItem(self):
+ raise NotImplementedError()
+
+ def temporalProfile(self):
+ return self.mTP
+
+ def setTemporalProfile(self, temporalPofile):
+
+ b = temporalPofile != self.mTP
+ self.mTP = temporalPofile
+ if temporalPofile in [None, QVariant()]:
+ s =""
+ else:
+ assert isinstance(temporalPofile, TemporalProfile)
+ if b:
+ self.updateDataProperties()
+
+ def setSensor(self, sensor):
+ assert sensor is None or isinstance(sensor, SensorInstrument)
+ b = sensor != self.mSensor
+ self.mSensor = sensor
+ if b:
+ self.update()
+ self.sigSensorChanged.emit(sensor)
+
+ def sensor(self):
+ return self.mSensor
+
+ def updateStyleProperties(self):
+ raise NotImplementedError()
+
+ def updateDataProperties(self):
+ raise NotImplementedError()
+
+ def update(self):
+ self.updateDataProperties()
+
+ def setExpression(self, exp):
+ assert isinstance(exp, str)
+ b = self.mExpression != exp
+ self.mExpression = exp
+ self.updateDataProperties()
+ if b:
+ self
+ self.sigExpressionUpdated.emit()
+
+ def expression(self):
+ return self.mExpression
+
+ def __reduce_ex__(self, protocol):
+ return self.__class__, (), self.__getstate__()
+
+ def __getstate__(self):
+ result = super(TemporalProfile2DPlotStyle, self).__getstate__()
+ #remove
+ del result['mTP']
+ del result['mSensor']
+
+ return result
+
+ def isVisible(self):
+ return self.mIsVisible
+
+ def setVisibility(self, b):
+ assert isinstance(b, bool)
+ old = self.isVisible()
+ self.mIsVisible = b
+
+ if b != old:
+ self.updateStyleProperties()
+ #self.update()
+
+ def copyFrom(self, plotStyle):
+ if isinstance(plotStyle, PlotStyle):
+ super(TemporalProfilePlotStyleBase, self).copyFrom(plotStyle)
+ self.updateStyleProperties()
+
+ if isinstance(plotStyle, TemporalProfilePlotStyleBase):
+ self.setExpression(plotStyle.expression())
+ self.setSensor(plotStyle.sensor())
+ self.setTemporalProfile(plotStyle.temporalProfile())
+ self.updateDataProperties()
+
+
+
+
+class TemporalProfile2DPlotStyle(TemporalProfilePlotStyleBase):
+
+
+ def __init__(self, temporalProfile=None):
+ super(TemporalProfile2DPlotStyle, self).__init__(temporalProfile=temporalProfile)
+ #PlotStyle.__init__(self)
+ #TemporalProfilePlotStyleBase.__init__(self, temporalProfile=temporalProfile)
+
+ def createPlotItem(self, plotWidget):
+ pdi = TemporalProfilePlotDataItem(self)
+ self.mPlotItems.append(pdi)
+ return pdi
+
+ def updateStyleProperties(self):
+ for pdi in self.mPlotItems:
+ assert isinstance(pdi, TemporalProfilePlotDataItem)
+ pdi.updateStyle()
+
+ def updateDataProperties(self):
+ for pdi in self.mPlotItems:
+ assert isinstance(pdi, TemporalProfilePlotDataItem)
+ pdi.updateDataAndStyle()
+
+
+
+
+
+
+
+
+
+class TemporalProfileLoaderTask(object):
+ """
+ An object to loading temporal profile values from a *single* raster source.
+ """
+
+ def __init__(self, tss:TimeSeriesSource, temporalProfiles: list, bandIndices=None):
+
+ assert isinstance(temporalProfiles, list)
+
+ self.mId = ''
+ self.mTSS = tss
+ # assert isinstance(source, str) or isinstance(source, unicode)
+ self.mSourcePath = tss.uri()
+ self.mGeometries = {}
+ self.mRESULTS = {}
+ self.mERRORS = []
+
+ for tp in temporalProfiles:
+ assert isinstance(tp, TemporalProfile)
+ # save geometry as WKT to be pickable
+ self.mGeometries[tp.id()] = tp.geometry(tss.crs()).asWkt()
+
+ if bandIndices is None:
+ bandIndices = list(range(tss.nb))
+ self.mBandIndices = bandIndices
+
+
+
+
+def doLoadTemporalProfileTasks(qgsTask:QgsTask, dump):
+
+ assert isinstance(qgsTask, QgsTask)
+ tasks = pickle.loads(dump)
+ assert isinstance(tasks, list)
+ n = len(tasks)
+ qgsTask.setProgress(0)
+ results = []
+
+ for i, task in enumerate(tasks):
+ assert isinstance(task, TemporalProfileLoaderTask)
+ try:
+ ds = gdal.Open(task.mSourcePath)
+ assert isinstance(ds, gdal.Dataset)
+ nb, ns, nl = ds.RasterCount, ds.RasterXSize, ds.RasterYSize
+ gt = ds.GetGeoTransform()
+ pxIndices = {}
+
+
+
+ # calculate pixel indices to load
+ for tpId, wkt in task.mGeometries.items():
+ geom = QgsGeometry.fromWkt(wkt)
+ assert isinstance(geom, QgsGeometry)
+ pt = geom.centroid().asPoint()
+
+ px = geo2px(pt, gt)
+ if px.x() < 0 or px.x() > ns or px.y() < 0 or px.y() > nl:
+ task.mERRORS.append('TemporalProfile {} is out of image bounds: {} = pixel {}'.format(tpId, geom, px))
+ continue
+
+ task.mRESULTS[tpId] = {'px_x':px.x(),
+ 'px_y':px.y(),
+ 'geo_x':pt.x(),
+ 'geo_y':px.y(),
+ 'gt':gt}
+ pxIndices[tpId] = px
+
+ # todo: implement load balancing
+
+ for j, bandIndex in enumerate([b for b in task.mBandIndices if b >= 0 and b < nb]):
+
+ band = ds.GetRasterBand(bandIndex + 1)
+ assert isinstance(band, gdal.Band)
+ no_data = band.GetNoDataValue()
+
+ bandName = 'b{}'.format(bandIndex + 1)
+
+ for tpId, px in pxIndices.items():
+ assert isinstance(px, QPoint)
+
+ value = band.ReadAsArray(px.x(), px.y(), 1, 1).flatten()[0]
+ if no_data and value == no_data:
+ value = np.NaN
+
+ task.mRESULTS[tpId][bandName] = value
+
+
+ except Exception as ex:
+ task.mERRORS.append('Error source image {}:\n{}'.format(task.mSourcePath, ex))
+ results.append(task)
+ qgsTask.setProgress(100 * (i + 1) / n)
+ return pickle.dumps(results)
+
+
+
class TemporalProfilePlotDataItem(pg.PlotDataItem):
def __init__(self, plotStyle, parent=None):
@@ -946,10 +1128,9 @@ class TemporalProfilePlotDataItem(pg.PlotDataItem):
if isinstance(TP, TemporalProfile) and isinstance(sensor, SensorInstrument):
x, y = TP.dataFromExpression(self.mPlotStyle.sensor(), self.mPlotStyle.expression(), dateType='date')
- if len(y) > 0:
- #x = np.asarray(x, dtype=np.float)
- #y = np.asarray(y, dtype=np.float)
- self.setData(x=x, y=y)
+
+ if np.any(np.isfinite(y)):
+ self.setData(x=x, y=y, connect='finite')
else:
self.setData(x=[], y=[]) # dummy
else:
@@ -1100,69 +1281,7 @@ class TemporalProfileLayer(QgsVectorLayer):
def __getitem__(self, slice):
return list(self.mProfiles.values())[slice]
- def loadMissingData(self, backgroundProcess=False):
- assert isinstance(self.mTimeSeries, TimeSeries)
-
- # Get or create the TimeSeriesProfiles which will store the loaded values
- tasks = []
-
- theGeometries = []
-
- # Define which (new) bands need to be loaded for each sensor
- LUT_bandIndices = dict()
- for sensor in self.mTimeSeries.sensors():
- LUT_bandIndices[sensor] = list(range(sensor.nb))
-
- PL = PixelLoader()
- PL.sigPixelLoaded.connect(self.addPixelLoaderResult)
- # update new / existing points
-
- for tsd in self.mTimeSeries:
- assert isinstance(tsd, TimeSeriesDate)
-
-
- requiredIndices = LUT_bandIndices[tsd.mSensor]
- requiredIndexKeys = [bandIndex2bandKey(b) for b in requiredIndices]
- TPs = []
- missingIndices = set()
- for TP in self.mProfiles.values():
- assert isinstance(TP, TemporalProfile)
- dataValues = TP.mData[tsd]
- existingKeys = list(dataValues.keys())
- missingIdx = [bandKey2bandIndex(k) for k in requiredIndexKeys if k not in existingKeys]
- if len(missingIdx) > 0:
- TPs.append(TP)
- missingIndices.union(set(missingIdx))
-
- if len(TPs) > 0:
- theGeometries = [tp.coordinate() for tp in TPs]
- theIDs = [tp.id() for tp in TPs]
- for pathImg in tsd.sourceUris():
- task = PixelLoaderTask(pathImg, theGeometries,
- bandIndices=requiredIndices,
- temporalProfileIDs=theIDs)
- tasks.append(task)
-
-
- if len(tasks) > 0:
-
- if backgroundProcess:
- PL.startLoading(tasks)
- else:
- import eotimeseriesviewer.pixelloader
- tasks = [PixelLoaderTask.fromDump(eotimeseriesviewer.pixelloader.doLoaderTask(None, task.toDump())) for task in tasks]
- l = len(tasks)
- for i, task in enumerate(tasks):
- PL.sigPixelLoaded.emit(task)
-
-
- else:
- if DEBUG:
- print('Data for geometries already loaded')
-
- s = ""
-
- def saveTemporalProfiles(self, pathVector, loadMissingValues=False, sep='\t'):
+ def saveTemporalProfiles(self, pathVector, sep='\t'):
if pathVector is None or len(pathVector) == 0:
global DEFAULT_SAVE_PATH
if DEFAULT_SAVE_PATH == None:
@@ -1177,11 +1296,6 @@ class TemporalProfileLayer(QgsVectorLayer):
else:
DEFAULT_SAVE_PATH = pathVector
- if loadMissingValues:
- self.loadMissingData(backgroundProcess=False)
- for p in self.mProfiles.values():
- assert isinstance(p, TemporalProfile)
- p.loadMissingData()
drvName = QgsVectorFileWriter.driverForExtension(os.path.splitext(pathVector)[-1])
QgsVectorFileWriter.writeAsVectorFormat(self, pathVector, 'utf-8', destCRS=self.crs(), driverName=drvName)
@@ -1190,7 +1304,7 @@ class TemporalProfileLayer(QgsVectorLayer):
# write a flat list of profiles
csvLines = ['Temporal Profiles']
nBands = max([s.nb for s in self.mTimeSeries.sensors()])
- csvLines.append(sep.join(['id', 'name', 'sensor', 'date', 'doy', 'sensor'] + ['b{}'.format(b+1) for b in range(nBands)]))
+ csvLines.append(sep.join(['id', 'name', 'sensor', 'date', 'doy'] + ['b{}'.format(b+1) for b in range(nBands)]))
for p in list(self.getFeatures()):
@@ -1244,7 +1358,7 @@ class TemporalProfileLayer(QgsVectorLayer):
fid = feature.id()
if fid < 0:
continue
- tp = TemporalProfile(self, fid)
+ tp = TemporalProfile(self, fid, feature.geometry())
self.mProfiles[fid] = tp
temporalProfiles.append(tp)
@@ -1360,7 +1474,7 @@ class TemporalProfileLayer(QgsVectorLayer):
self.committedFeaturesAdded.connect(onFeaturesAdded)
self.beginEditCommand('Add {} profile locations'.format(len(features)))
- success = self.addFeatures(features)
+ self.addFeatures(features)
self.endEditCommand()
self.saveEdits(leaveEditable=b)
self.committedFeaturesAdded.disconnect(onFeaturesAdded)
@@ -1369,7 +1483,6 @@ class TemporalProfileLayer(QgsVectorLayer):
profiles = [self.mProfiles[f.id()] for f in newFeatures]
return profiles
-
def saveEdits(self, leaveEditable=False, triggerRepaint=True):
"""
function to save layer changes-
@@ -1402,7 +1515,6 @@ class TemporalProfileLayer(QgsVectorLayer):
self.dataProvider().addAttributes(missingFields)
self.saveEdits(leaveEditable=b)
-
def __len__(self):
return self.dataProvider().featureCount()
@@ -1414,7 +1526,6 @@ class TemporalProfileLayer(QgsVectorLayer):
def __contains__(self, item):
return item in self.mProfiles.values()
-
def temporalProfileToLocationFeature(self, tp:TemporalProfile):
self.mLocations.selectByIds([tp.id()])
@@ -1424,29 +1535,12 @@ class TemporalProfileLayer(QgsVectorLayer):
return None
-
def fromSpatialPoint(self, spatialPoint):
""" Tests if a Temporal Profile already exists for the given spatialPoint"""
-
-
for p in list(self.mProfiles.values()):
assert isinstance(p, TemporalProfile)
if p.coordinate() == spatialPoint:
return p
- """
- spatialPoint = spatialPoint.toCrs(self.crs())
- unit = QgsUnitTypes.toAbbreviatedString(self.crs().mapUnits()).lower()
- x = spatialPoint.x() + 0.00001
- y = spatialPoint.y() + 0.
-
- if 'degree' in unit:
- dx = dy = 0.000001
- else:
- dx = dy = 0.1
- rect = QgsRectangle(x-dx,y-dy, x+dy,y+dy)
- for f in self.getFeatures(rect):
- return self.mProfiles[f.id()]
- """
return None
def removeTemporalProfiles(self, temporalProfiles):
@@ -1527,8 +1621,21 @@ class TemporalProfileLayer(QgsVectorLayer):
else:
pass
s = ""
+ else:
+ s = ""
def clear(self):
+ """
+ Removes all temporal profiles
+ """
+ b = self.isEditable()
+ self.startEditing()
+ fids = self.allFeatureIds()
+ self.deleteFeatures(fids)
+ self.commitChanges()
+
+ if b:
+ self.startEditing()
#todo: remove TS Profiles
#self.mTemporalProfiles.clear()
#self.sensorPxLayers.clear()
diff --git a/eotimeseriesviewer/temporalprofiles3d.py b/eotimeseriesviewer/temporalprofiles3d.py
index 0fb19a7034f4a9312be2c34dfc8714a6fd68e579..fba43b5453b69c8ad4650f9bfe61e3c52adebf0d 100644
--- a/eotimeseriesviewer/temporalprofiles3d.py
+++ b/eotimeseriesviewer/temporalprofiles3d.py
@@ -27,7 +27,7 @@ from PyQt5.QtGui import *
from eotimeseriesviewer.externals.qps.models import Option, OptionListModel
-from eotimeseriesviewer.temporalprofiles2d import *
+from eotimeseriesviewer.temporalprofiles import *
LABEL_EXPRESSION_3D = 'Scaling'
diff --git a/eotimeseriesviewer/temporalprofiles3dGL.py b/eotimeseriesviewer/temporalprofiles3dGL.py
index 0bc439016068e2f0ef3012172346954773e1ca96..53537e7855962a86999445b0d58b745d1e52ba3e 100644
--- a/eotimeseriesviewer/temporalprofiles3dGL.py
+++ b/eotimeseriesviewer/temporalprofiles3dGL.py
@@ -33,7 +33,7 @@ from pyqtgraph.opengl import *
from pyqtgraph.opengl.GLGraphicsItem import GLGraphicsItem
from pyqtgraph.Vector import Vector
-from eotimeseriesviewer.temporalprofiles2d import *
+from eotimeseriesviewer.temporalprofiles import *
diff --git a/eotimeseriesviewer/tests.py b/eotimeseriesviewer/tests.py
index febf4ab9c1b8e9eafa4068e0a12b73dbe443030b..732c3becc7615ce23f5950771b67a5507aafc80b 100644
--- a/eotimeseriesviewer/tests.py
+++ b/eotimeseriesviewer/tests.py
@@ -73,7 +73,7 @@ class TestObjects(eotimeseriesviewer.externals.qps.testing.TestObjects):
TS = TimeSeries()
files = file_search(DIR_EXAMPLES, '*.tif', recursive=True)
- TS.addSources(list(files))
+ TS.addSources(list(files), runAsync=False)
assert len(TS) > 0
return TS
@@ -108,7 +108,7 @@ class TestObjects(eotimeseriesviewer.externals.qps.testing.TestObjects):
@staticmethod
def createTimeSeriesStacks():
vsiDir = '/vsimem/tmp'
- from eotimeseriesviewer.temporalprofiles2d import date2num
+ from eotimeseriesviewer.temporalprofiles import date2num
ns = 50
nl = 100
diff --git a/eotimeseriesviewer/timeseries.py b/eotimeseriesviewer/timeseries.py
index f318a53b706c7562d7cf58e405ed0aaf597b8f5a..87ba3d75ae412b8d1a7233edabd341ec52847864 100644
--- a/eotimeseriesviewer/timeseries.py
+++ b/eotimeseriesviewer/timeseries.py
@@ -33,6 +33,7 @@ from qgis.PyQt.QtGui import *
from qgis.PyQt.QtWidgets import *
from qgis.PyQt.QtCore import *
+DEFAULT_WKT = QgsCoordinateReferenceSystem('EPSG:4326').toWkt()
LUT_WAVELENGTH_UNITS = {}
for siUnit in [r'nm', r'μm', r'mm', r'cm', r'dm']:
@@ -46,8 +47,9 @@ LUT_WAVELENGTH_UNITS[r'decimeters'] = r'dm'
from osgeo import gdal
+from eotimeseriesviewer import LOG_MESSAGE_TAG
from eotimeseriesviewer.dateparser import DOYfromDatetime64
-from eotimeseriesviewer.utils import SpatialExtent, loadUI, px2geo
+from eotimeseriesviewer.utils import SpatialExtent, loadUI, px2geo, geo2px, SpatialPoint
gdal.SetConfigOption('VRT_SHARED_SOURCE', '0') #!important. really. do not change this.
@@ -114,7 +116,7 @@ def getDS(pathOrDataset)->gdal.Dataset:
-def sensorID(nb:int, px_size_x:float, px_size_y:float, dt:int, wl:list, wlu:str)->str:
+def sensorID(nb:int, px_size_x:float, px_size_y:float, dt:int, wl:list, wlu:str, name:str)->str:
"""
Create a sensor ID
:param nb: number of bands
@@ -136,7 +138,10 @@ def sensorID(nb:int, px_size_x:float, px_size_y:float, dt:int, wl:list, wlu:str)
if wlu != None:
assert isinstance(wlu, str)
- return json.dumps((nb, px_size_x, px_size_y, dt, wl, wlu))
+ if name != None:
+ assert isinstance(name, str)
+
+ return json.dumps((nb, px_size_x, px_size_y, dt, wl, wlu, name))
def sensorIDtoProperties(idString:str)->tuple:
"""
@@ -144,17 +149,24 @@ def sensorIDtoProperties(idString:str)->tuple:
:param idString: str
:return: (ns, px_size_x, px_size_y, [wl], wlu)
"""
- nb, px_size_x, px_size_y, dt, wl, wlu = json.loads(idString)
+ try:
+ nb, px_size_x, px_size_y, dt, wl, wlu, name = json.loads(idString)
+ except ValueError as ex:
+ if ex.args[0] == 'not enough values to unpack (expected 7, got 6)':
+ nb, px_size_x, px_size_y, dt, wl, wlu = json.loads(idString)
+ name = None
+
assert isinstance(dt, int) and dt >= 0
assert isinstance(nb, int)
- assert isinstance(px_size_x, (int,float)) and px_size_x > 0
+ assert isinstance(px_size_x, (int, float)) and px_size_x > 0
assert isinstance(px_size_y, (int, float)) and px_size_y > 0
if wl != None:
assert isinstance(wl, list)
if wlu != None:
assert isinstance(wlu, str)
-
- return nb, px_size_x, px_size_y, dt, wl, wlu
+ if name != None:
+ assert isinstance(name, str)
+ return nb, px_size_x, px_size_y, dt, wl, wlu, name
class SensorInstrument(QObject):
@@ -173,12 +185,18 @@ class SensorInstrument(QObject):
'swIR2': 2150
})
- def __init__(self, sid:str, sensor_name:str=None, band_names:list = None):
+ def __init__(self, sid:str, band_names:list = None):
super(SensorInstrument, self).__init__()
self.mId = sid
-
- self.nb, self.px_size_x, self.px_size_y, self.dataType, self.wl, self.wlu = sensorIDtoProperties(self.mId)
+ self.nb:int
+ self.px_size_x:float
+ self.px_size_y:float
+ self.dataType:int
+ self.wl:list
+ self.wlu:str
+ self.nb, self.px_size_x, self.px_size_y, self.dataType, self.wl, self.wlu, self.mNameOriginal = sensorIDtoProperties(self.mId)
+ self.mName = ''
if not isinstance(band_names, list):
band_names = ['Band {}'.format(b+1) for b in range(self.nb)]
@@ -191,13 +209,17 @@ class SensorInstrument(QObject):
else:
self.wl = np.asarray(self.wl)
- if sensor_name is None:
- from eotimeseriesviewer.settings import value, Keys
- sensorNames = value(Keys.SensorNames)
- sensor_name = sensorNames.get(sid, '{}bands@{}m'.format(self.nb, self.px_size_x))
- self.mName = ''
- self.setName(sensor_name)
+
+ if self.mNameOriginal in [None, '']:
+ from eotimeseriesviewer.settings import sensorName
+ sensor_name = sensorName(sid)
+ if sensor_name is None:
+ sensor_name = '{}bands@{}m'.format(self.nb, self.px_size_x)
+ self.setName(sensor_name)
+ else:
+ self.setName(self.mNameOriginal)
+
self.hashvalue = hash(self.mId)
@@ -205,6 +227,14 @@ class SensorInstrument(QObject):
import uuid
path = '/vsimem/mockupImage.{}.bsq'.format(uuid.uuid4())
self.mMockupDS = TestObjects.inMemoryImage(path=path, nb=self.nb, eType=self.dataType, ns=2, nl=2)
+ if self.wl is not None:
+ self.mMockupDS.SetMetadataItem('wavelength', '{{{}}}'.format(','.join(str(wl) for wl in self.wl)))
+ if self.wlu is not None:
+ self.mMockupDS.SetMetadataItem('wavelength units', self.wlu)
+ self.mMockupDS.FlushCache()
+ s = ""
+
+
def bandIndexClosestToWavelength(self, wl, wl_unit='nm')->int:
"""
@@ -251,14 +281,12 @@ class SensorInstrument(QObject):
Sets the sensor/product name
:param name: str
"""
+
if name != self.mName:
+ assert isinstance(name, str)
self.mName = name
- from eotimeseriesviewer.settings import Keys, value, setValue
-
- sensorNames = value(Keys.SensorNames)
- sensorNames[self.id()] = name
- setValue(Keys.SensorNames, sensorNames)
-
+ from eotimeseriesviewer.settings import saveSensorName
+ saveSensorName(self)
self.sigNameChanged.emit(self.name())
def name(self)->str:
@@ -377,6 +405,7 @@ class TimeSeriesSource(object):
if provider == 'gdal':
ds = gdal.Open(lyr.source())
+ s = ""
elif provider == 'wcs':
parts = urllib.parse.parse_qs(lyr.source())
url = re.search(r'^[^?]+', parts['url'][0]).group()
@@ -397,11 +426,12 @@ class TimeSeriesSource(object):
elif isinstance(source, str):
ds = gdal.Open(source)
+ s = ""
elif isinstance(source, gdal.Dataset):
ds = source
- else:
+ if not isinstance(ds, gdal.Dataset):
raise Exception('Unsupported source: {}'.format(source))
return TimeSeriesSource(ds)
@@ -410,7 +440,6 @@ class TimeSeriesSource(object):
self.mUri = None
self.mDrv = None
- self.mGT = None
self.mWKT = None
self.mCRS = None
self.mWL = None
@@ -449,17 +478,24 @@ class TimeSeriesSource(object):
self.mWKT = dataset.GetProjection()
if self.mWKT == '':
# no CRS? try with QGIS API
- lyr = QgsRasterLayer(self.mUri)
+ loptions = QgsRasterLayer.LayerOptions(loadDefaultStyle=False)
+ lyr = QgsRasterLayer(self.mUri, options=loptions)
if lyr.crs().isValid():
self.mWKT = lyr.crs().toWkt()
+ if self.mWKT == '':
+ # default to WGS-84 lat lon
+ self.mWKT = str(DEFAULT_WKT)
+
self.mCRS = QgsCoordinateReferenceSystem(self.mWKT)
px_x = float(abs(self.mGeoTransform[1]))
px_y = float(abs(self.mGeoTransform[5]))
self.mGSD = (px_x, px_y)
self.mDataType = dataset.GetRasterBand(1).DataType
- self.mSid = sensorID(self.nb, px_x, px_y, self.mDataType, self.mWL, self.mWLU)
+
+ sName = sensorName(dataset)
+ self.mSidOriginal = self.mSid = sensorID(self.nb, px_x, px_y, self.mDataType, self.mWL, self.mWLU, sName)
self.mUL = QgsPointXY(*px2geo(QPoint(0, 0), self.mGeoTransform, pxCenter=False))
@@ -504,6 +540,7 @@ class TimeSeriesSource(object):
self.mUL = QgsPointXY(QgsGeometry.fromWkt(self.mUL).asPoint())
self.mLR = QgsPointXY(QgsGeometry.fromWkt(self.mLR).asPoint())
self.mDate = np.datetime64(self.mDate)
+ self.mSpatialExtent = None
def __getstate__(self):
@@ -546,6 +583,30 @@ class TimeSeriesSource(object):
uri.layerType = 'raster'
return uri
+ def asRasterLayer(self)->QgsRasterLayer:
+ return QgsRasterLayer(self.uri(), self.name(), 'gdal')
+
+ def pixelCoordinate(self, geometry)->QPoint:
+ """
+
+ :param QgsGeometry | QgsPoint | SpatialPoint:
+ :return: QPoint, if coordinate interects with source raster, None else
+ """
+
+ if isinstance(geometry, QgsGeometry):
+ geometry = geometry.asPoint()
+ if isinstance(geometry, QgsPoint):
+ geometry = QgsPointXY(geometry.x(), geometry.y())
+ if isinstance(geometry, SpatialPoint):
+ geometry = geometry.toCrs(self.crs())
+ assert isinstance(geometry, QgsPointXY)
+ px = geo2px(geometry, self.mGeoTransform)
+ assert isinstance(px, QPoint)
+
+ if px.x() < 0 or px.y() < 0 or px.x() >= self.ns or px.y() > self.nl:
+ return None
+ return px
+
def sid(self)->str:
"""
Returns the sensor id
@@ -574,7 +635,9 @@ class TimeSeriesSource(object):
return self.mCRS
def spatialExtent(self)->SpatialExtent:
- return SpatialExtent(self.mCRS, self.mUL, self.mLR)
+ if not isinstance(self.mSpatialExtent, SpatialExtent):
+ self.mSpatialExtent = SpatialExtent(self.mCRS, self.mUL, self.mLR)
+ return self.mSpatialExtent
def __eq__(self, other):
if not isinstance(other, TimeSeriesSource):
@@ -584,7 +647,7 @@ class TimeSeriesSource(object):
class TimeSeriesDate(QAbstractTableModel):
"""
- A containe to store all image source related to a single observation date and sensor.
+ A container to store all source images related to a single observation date and sensor.
"""
sigSourcesAdded = pyqtSignal(list)
sigSourcesRemoved = pyqtSignal(list)
@@ -676,7 +739,7 @@ class TimeSeriesDate(QAbstractTableModel):
"""
return self.mSensor
- def sources(self)->list:
+ def sources(self)->typing.List[TimeSeriesSource]:
"""
Returns the source images
:return: [list-of-TimeSeriesSource]
@@ -684,7 +747,7 @@ class TimeSeriesDate(QAbstractTableModel):
return self.mSources
- def sourceUris(self)->list:
+ def sourceUris(self)->typing.List[str]:
"""
Returns all source URIs as list of strings-
:return: [list-of-str]
@@ -988,23 +1051,39 @@ class DateTimePrecision(enum.Enum):
Milisecond = 'ms'
Original = 0
+class SensorMatching(enum.Enum):
+ """
+ Describes when two different sources should be considered to be from the same sensor
+ """
+ DIMS = 'Image Dimensions only'
+ DIMS_WL = 'Image Dimensions + Wavelength'
+ DIMS_Name = 'Image Dimensions + Name'
+ DIMS_WL_Name = 'Image Dimensions + Wavelength + Name'
-def doLoadTimeSeriesSourcesTask(taskWrapper:QgsTask, dump):
+
+def doLoadTimeSeriesSourcesTask(qgsTask:QgsTask, dump):
sources = pickle.loads(dump)
- assert isinstance(taskWrapper, QgsTask)
+ assert isinstance(qgsTask, QgsTask)
results = []
+ invalidSources = list()
n = len(sources)
for i, source in enumerate(sources):
- if taskWrapper.isCanceled():
+ if qgsTask.isCanceled():
return pickle.dumps(results)
- s = TimeSeriesSource.create(source)
- if isinstance(s, TimeSeriesSource):
- results.append(s)
- taskWrapper.setProgress(i+1)
- return pickle.dumps(results)
- s = ""
+
+ try:
+ tss = TimeSeriesSource.create(source)
+ assert isinstance(tss, TimeSeriesSource)
+ results.append(tss)
+ except Exception as ex:
+ invalidSources.append((source, ex))
+
+ qgsTask.setProgress(i + 1)
+
+ return pickle.dumps(results), pickle.dumps(invalidSources)
+
class TimeSeries(QAbstractItemModel):
"""
@@ -1029,10 +1108,12 @@ class TimeSeries(QAbstractItemModel):
self.mTSDs = list()
self.mSensors = []
self.mShape = None
+
self.mDateTimePrecision = DateTimePrecision.Original
+ self.mProductSimilarity = SensorMatching.DIMS
self.mLoadingProgressDialog = None
-
+ self.mLUT_Path2TSD = {}
self.mVisibleDate = []
self.mCurrentSpatialExtent = None
@@ -1060,8 +1141,13 @@ class TimeSeries(QAbstractItemModel):
if isinstance(spatialExtent, SpatialExtent) and self.mCurrentSpatialExtent != spatialExtent:
self.mCurrentSpatialExtent = spatialExtent
- def focusVisibilityToExtent(self):
- ext = self.currentSpatialExtent()
+ def focusVisibilityToExtent(self, ext:SpatialExtent=None):
+ """
+ Changes TSDs visibility according to its intersection with a SpatialExtent
+ :param ext: SpatialExtent
+ """
+ if ext is None:
+ ext = self.currentSpatialExtent()
if isinstance(ext, SpatialExtent):
changed = False
for tsd in self:
@@ -1099,6 +1185,39 @@ class TimeSeries(QAbstractItemModel):
idx2 = self.index(idx.row(), self.columnCount()-1)
self.dataChanged.emit(idx, idx2, [Qt.BackgroundColorRole])
+ def findMatchingSensor(self, sensorID:str)->SensorInstrument:
+ if isinstance(sensorID, str):
+ nb, px_size_x, px_size_y, dt, wl, wlu, name = sensorIDtoProperties(sensorID)
+
+ else:
+ assert isinstance(sensorID, tuple) and len(sensorID) == 7
+ nb, px_size_x, px_size_y, dt, wl, wlu, name = sensorID
+
+ DIMS = (nb, px_size_y, px_size_x, dt)
+ for sensor in self.sensors():
+ DIMS2 = (sensor.nb, sensor.px_size_y, sensor.px_size_x, sensor.dataType)
+
+ bName = sensor.mNameOriginal == name
+ bWL = wlu == sensor.wlu and np.array_equal(wl, sensor.wl)
+
+ if DIMS != DIMS2:
+ # self.mProductSimilarity == SensorMatching.DIMS:
+ continue
+
+ if self.mProductSimilarity == SensorMatching.DIMS:
+ return sensor
+
+ elif self.mProductSimilarity == SensorMatching.DIMS_Name and bName:
+ return sensor
+
+ elif self.mProductSimilarity == SensorMatching.DIMS_WL and bWL:
+ return sensor
+
+ elif self.mProductSimilarity == SensorMatching.DIMS_WL_Name and bName and bWL:
+ return sensor
+
+ return None
+
def sensor(self, sensorID:str)->SensorInstrument:
"""
Returns the sensor with sid = sid
@@ -1106,21 +1225,26 @@ class TimeSeries(QAbstractItemModel):
:return: SensorInstrument
"""
assert isinstance(sensorID, str)
- for sensor in self.mSensors:
- assert isinstance(sensor, SensorInstrument)
- if sensor.id() == sensorID:
+
+ nb, px_size_x, px_size_y, dt, wl, wlu, name = sensorIDtoProperties(sensorID)
+
+ for sensor in self.sensors():
+ if (sensor.nb, sensor.px_size_y, sensor.px_size_x, sensor.dataType, sensor.wl, sensor.wlu,
+ sensor.mNameOriginal) == (
+ nb, px_size_y, px_size_x, dt, wl, wlu, name):
return sensor
+
return None
- def sensors(self)->list:
+ def sensors(self)->typing.List[SensorInstrument]:
"""
Returns the list of sensors derived from the TimeSeries data sources
:return: [list-of-SensorInstruments]
"""
return self.mSensors[:]
- def loadFromFile(self, path, n_max=None, progressDialog:QProgressDialog=None):
+ def loadFromFile(self, path, n_max=None, progressDialog:QProgressDialog=None, runAsync=True):
"""
Loads a CSV file with source images of a TimeSeries
:param path: str, Path of CSV file
@@ -1151,7 +1275,7 @@ class TimeSeries(QAbstractItemModel):
progressDialog.setValue(0)
progressDialog.setLabelText('Start loading {} images....'.format(len(images)))
- self.addSourcesAsync(images, progressDialog=progressDialog)
+ self.addSources(images, progressDialog=progressDialog, runAsync=runAsync)
def saveToFile(self, path):
"""
@@ -1214,10 +1338,14 @@ class TimeSeries(QAbstractItemModel):
:param pathOfInterest: str, image source uri
:return: TimeSeriesDate
"""
- for tsd in self.mTSDs:
- assert isinstance(tsd, TimeSeriesDate)
- if pathOfInterest in tsd.sourceUris():
- return tsd
+ tsd = self.mLUT_Path2TSD.get(pathOfInterest)
+ if isinstance(tsd, TimeSeriesDate):
+ return tsd
+ else:
+ for tsd in self.mTSDs:
+ assert isinstance(tsd, TimeSeriesDate)
+ if pathOfInterest in tsd.sourceUris():
+ return tsd
return None
def tsd(self, date: np.datetime64, sensor)->TimeSeriesDate:
@@ -1306,7 +1434,7 @@ class TimeSeries(QAbstractItemModel):
if isinstance(t, TimeSeriesSource):
toRemove.add(t.timeSeriesDate())
- for tsd in list(toRemove):
+ for tsd in list(sorted(list(toRemove), reverse=True)):
assert isinstance(tsd, TimeSeriesDate)
@@ -1322,6 +1450,11 @@ class TimeSeries(QAbstractItemModel):
self.endRemoveRows()
if len(removed) > 0:
+ pathsToRemove = [path for path, tsd in self.mLUT_Path2TSD.items() if tsd in removed]
+ for path in pathsToRemove:
+ self.mLUT_Path2TSD.pop(path)
+
+ self.checkSensorList()
self.sigTimeSeriesDatesRemoved.emit(removed)
def tsds(self, date:np.datetime64=None, sensor:SensorInstrument=None)->list:
@@ -1385,7 +1518,14 @@ class TimeSeries(QAbstractItemModel):
return sensor
return None
- def addSourcesAsync(self, sources:list, nWorkers:int = 1, progressDialog:QProgressDialog=None):
+ def addSources(self, sources:list, nWorkers:int = 1, progressDialog:QProgressDialog=None, runAsync=True):
+ """
+ Adds source images to the TimeSeries
+ :param sources: list of source images, e.g. a list of file paths
+ :param nWorkers: not used yet
+ :param progressDialog: QProgressDialog
+ :param runAsync: bool
+ """
tm = QgsApplication.taskManager()
assert isinstance(tm, QgsTaskManager)
@@ -1394,49 +1534,35 @@ class TimeSeries(QAbstractItemModel):
self.mLoadingProgressDialog = progressDialog
- if True:
- n = len(sources)
- taskDescription = 'Load {} images'.format(n)
- dump = pickle.dumps(sources)
+ n = len(sources)
+ taskDescription = 'Load {} images'.format(n)
+ dump = pickle.dumps(sources)
+
+
+ if runAsync:
qgsTask = QgsTask.fromFunction(taskDescription, doLoadTimeSeriesSourcesTask, dump,
on_finished = self.onAddSourcesAsyncFinished)
- tid = id(qgsTask)
- qgsTask.taskCompleted.connect(lambda *args, tid=tid: self.onRemoveTask(tid))
- qgsTask.taskTerminated.connect(lambda *args, tid=tid: self.onRemoveTask(tid))
- self.mTasks[tid] = qgsTask
-
- if False: # for debugging only
- resultDump = doLoadTimeSeriesSourcesTask(qgsTask, dump)
- self.onAddSourcesAsyncFinished(None, resultDump)
- else:
- tm.addTask(qgsTask)
-
else:
- # see https://stackoverflow.com/questions/312443/how-do-you-split-a-list-into-evenly-sized-chunks
+ from .utils import TaskMock
+ qgsTask = TaskMock()
- def chunks(l, n):
- """Yield successive n-sized chunks from l."""
- for i in range(0, len(l), n):
- yield l[i:i + n]
-
- n = int(len(sources) / nWorkers)
- for subset in chunks(sources, 50):
-
- dump = pickle.dumps(subset)
+ tid = id(qgsTask)
+ qgsTask.taskCompleted.connect(lambda *args, tid=tid: self.onRemoveTask(tid))
+ qgsTask.taskTerminated.connect(lambda *args, tid=tid: self.onRemoveTask(tid))
+ if isinstance(progressDialog, QProgressDialog):
+ qgsTask.progressChanged.connect(progressDialog.setValue)
+ progressDialog.setLabelText('Read images')
+ progressDialog.setRange(0, n)
+ progressDialog.setValue(0)
- taskDescription = 'Load {} images'.format(len(subset))
- qgsTask = QgsTask.fromFunction(taskDescription, doLoadTimeSeriesSourcesTask, dump, on_finished=self.onAddSourcesAsyncFinished)
- tid = id(qgsTask)
- self.mTasks[tid] = qgsTask
- qgsTask.taskCompleted.connect(lambda *args, tid=tid: self.onRemoveTask(tid))
- qgsTask.taskTerminated.connect(lambda *args, tid=tid: self.onRemoveTask(tid))
+ self.mTasks[tid] = qgsTask
- if False: # for debugging only
- resultDump = doLoadTimeSeriesSourcesTask(qgsTask, dump)
- self.onAddSourcesAsyncFinished(None, resultDump)
- else:
- tm.addTask(qgsTask)
- s = ""
+ if runAsync:
+ tm.addTask(qgsTask)
+ else:
+ # for debugging only
+ resultDump = doLoadTimeSeriesSourcesTask(qgsTask, dump)
+ self.onAddSourcesAsyncFinished(None, resultDump)
def onRemoveTask(self, key):
self.mTasks.pop(key)
@@ -1444,21 +1570,40 @@ class TimeSeries(QAbstractItemModel):
def onAddSourcesAsyncFinished(self, *args):
# print(':: onAddSourcesAsyncFinished')
error = args[0]
+
+ hasProgressDialog = isinstance(self.mLoadingProgressDialog, QProgressDialog)
+
if error is None:
try:
- addedDates = []
- dump = args[1]
- sources = pickle.loads(dump)
- for source in sources:
- if isinstance(self.mLoadingProgressDialog, QProgressDialog):
- self.increaseProgressBar()
- newTSD = self._addSource(source)
- if isinstance(newTSD, TimeSeriesDate):
- addedDates.append(newTSD)
+ sources, invalidSources = args[1]
+ sources = pickle.loads(sources)
+ invalidSources = pickle.loads(invalidSources)
- if len(addedDates) > 0:
- self.sigTimeSeriesDatesAdded.emit(addedDates)
+ if len(invalidSources) > 0:
+ info = ['Unable to load {} data source(s):'.format(len(invalidSources))]
+ for s, ex in invalidSources:
+ info.append('Path="{}" Error="{}"'.format(str(s), str(ex).replace('\n', ' ')))
+ info = '\n'.join(info)
+ messageLog(info, Qgis.Critical)
+
+ if len(sources) > 0:
+ addedDates = []
+ if hasProgressDialog:
+ self.mLoadingProgressDialog.setLabelText('Add Images')
+ self.mLoadingProgressDialog.setRange(0, len(sources))
+ self.mLoadingProgressDialog.setValue(0)
+
+ for i, source in enumerate(sources):
+ newTSD = self._addSource(source)
+ if isinstance(newTSD, TimeSeriesDate):
+ addedDates.append(newTSD)
+
+ if hasProgressDialog:
+ self.mLoadingProgressDialog.setValue(i+1)
+
+ if len(addedDates) > 0:
+ self.sigTimeSeriesDatesAdded.emit(addedDates)
except Exception as ex:
import traceback
@@ -1468,57 +1613,8 @@ class TimeSeries(QAbstractItemModel):
s = ""
if isinstance(self.mLoadingProgressDialog, QProgressDialog):
- if self.mLoadingProgressDialog.wasCanceled() or self.mLoadingProgressDialog.value() == -1:
- self.mLoadingProgressDialog = None
-
- def increaseProgressBar(self):
- if isinstance(self.mLoadingProgressDialog, QProgressDialog):
- v = self.mLoadingProgressDialog.value() + 1
- self.mLoadingProgressDialog.setValue(v)
- self.mLoadingProgressDialog.setLabelText('{}/{}'.format(v, self.mLoadingProgressDialog.maximum()))
-
- if v == 1 or v % 25 == 0:
- QApplication.processEvents()
-
- def addSources(self, sources:list, progressDialog:QProgressDialog=None):
- """
- Adds new data sources to the TimeSeries
- :param sources: [list-of-TimeSeriesSources]
- """
- assert isinstance(sources, list)
- self.mLoadingProgressDialog = progressDialog
- nMax = len(sources)
- # 1. read sources
- # this could be excluded into a parallel process
- addedDates = []
- for i, source in enumerate(sources):
- newTSD = None
- msg = None
- if False: #debug
- newTSD = self._addSource(source)
- else:
- try:
- newTSD = self._addSource(source)
- except Exception as ex:
- msg = 'Unable to add: {}\n{}'.format(str(source), str(ex))
- print(msg, file=sys.stderr)
-
- if isinstance(self.mLoadingProgressDialog, QProgressDialog):
- if self.mLoadingProgressDialog.wasCanceled():
- break
- self.increaseProgressBar()
-
- if isinstance(newTSD, TimeSeriesDate):
- addedDates.append(newTSD)
-
- #if len(addedDates) > 0:
-
- if isinstance(progressDialog, QProgressDialog):
- progressDialog.setLabelText('Create map widgets...')
-
- if len(addedDates) > 0:
- self.sigTimeSeriesDatesAdded.emit(addedDates)
- self.mLoadingProgressDialog = None
+ self.mLoadingProgressDialog.hide()
+ self.mLoadingProgressDialog = None
def _addSource(self, source:TimeSeriesSource)->TimeSeriesDate:
@@ -1538,20 +1634,31 @@ class TimeSeries(QAbstractItemModel):
tsdDate = self.date2date(tss.date())
tssDate = tss.date()
sid = tss.sid()
- sensor = self.sensor(sid)
+
+
+ sensor = self.findMatchingSensor(sid)
+
# if necessary, add a new sensor instance
if not isinstance(sensor, SensorInstrument):
sensor = self.addSensor(SensorInstrument(sid))
+
assert isinstance(sensor, SensorInstrument)
tsd = self.tsd(tsdDate, sensor)
+
# if necessary, add a new TimeSeriesDate instance
if not isinstance(tsd, TimeSeriesDate):
tsd = self.insertTSD(TimeSeriesDate(self, tsdDate, sensor))
newTSD = tsd
# addedDates.append(tsd)
assert isinstance(tsd, TimeSeriesDate)
+
+ # ensure that the source refers to the sensor ID of the linked sensor (which might be different from its orginal sensor id)
+ tss.mSid = sensor.id()
+
# add the source
+
tsd.addSource(tss)
+ self.mLUT_Path2TSD[tss.uri()] = tsd
return newTSD
def setDateTimePrecision(self, mode:DateTimePrecision):
@@ -1564,6 +1671,15 @@ class TimeSeries(QAbstractItemModel):
#do we like to update existing sources?
+ def setSensorMatching(self, mode:SensorMatching):
+ """
+ Sets the mode under which two source images can be considered as to be from the same sensor/product
+ :param mode:
+ :return:
+ """
+ assert isinstance(mode, SensorMatching)
+ self.mProductSimilarity = mode
+
def date2date(self, date:np.datetime64)->np.datetime64:
"""
@@ -1605,7 +1721,7 @@ class TimeSeries(QAbstractItemModel):
def __len__(self):
return len(self.mTSDs)
- def __iter__(self):
+ def __iter__(self)->typing.Iterator[TimeSeriesDate]:
return iter(self.mTSDs)
def __getitem__(self, slice):
@@ -1867,7 +1983,7 @@ class TimeSeries(QAbstractItemModel):
def findDate(self, date)->TimeSeriesDate:
"""
- Returns a TimeSeriesDate closes to that in date
+ Returns a TimeSeriesDate closest to that in date
:param date: numpy.datetime64 | str | TimeSeriesDate
:return: TimeSeriesDate
"""
@@ -1895,6 +2011,43 @@ class TimeSeries(QAbstractItemModel):
flags = flags | Qt.ItemIsUserCheckable
return flags
+regSensorName = re.compile(r'(SATELLITEID|sensor[ _]?type|product[ _]?type)', re.IGNORECASE)
+#regSensorName = re.compile(r'(SATELLITEID|sensor[ _]?type)', re.IGNORECASE)
+
+def sensorName(dataset:gdal.Dataset)->str:
+ """
+ Reads the sensor/product name. Returns None if a proper name can not be extracted.
+ :param dataset: gdal.Dataset
+ :return: str
+ """
+ assert isinstance(dataset, gdal.Dataset)
+ domains = dataset.GetMetadataDomainList()
+ if isinstance(domains, list):
+ for domain in domains:
+ md = dataset.GetMetadata_Dict(domain)
+ if isinstance(md, dict):
+ for key, value in md.items():
+ if regSensorName.search(key):
+ return str(value)
+
+ for b in range(dataset.RasterCount):
+ band = dataset.GetRasterBand(b+1)
+ if isinstance(band, gdal.Band):
+ domains = band.GetMetadataDomainList()
+ if isinstance(domains, list):
+ for domain in domains:
+ md = band.GetMetadata_Dict(domain)
+ if isinstance(md, dict):
+ for key, value in md.items():
+ if regSensorName.search(key):
+ return str(value)
+
+ return None
+
+
+
+
+
def getSpatialPropertiesFromDataset(ds):
assert isinstance(ds, gdal.Dataset)
@@ -1931,14 +2084,27 @@ def extractWavelengthsFromGDALMetaData(ds:gdal.Dataset)->(list, str):
for b in range(ds.RasterCount):
band = ds.GetRasterBand(b + 1)
assert isinstance(band, gdal.Band)
- md = band.GetMetadata_Dict()
+ domains = band.GetMetadataDomainList()
+ if not isinstance(domains, list):
+ continue
+ for domain in domains:
+ md = band.GetMetadata_Dict(domain)
- keyWLU = findKey(md, regWLUkey)
- keyWL = findKey(md, regWLkey)
+ keyWLU = findKey(md, regWLUkey)
+ keyWL = findKey(md, regWLkey)
- if isinstance(keyWL, str) and isinstance(keyWLU, str):
- wl.append(float(md[keyWL]))
- wlu.append(LUT_WAVELENGTH_UNITS[md[keyWLU].lower()])
+ if isinstance(keyWL, str) and isinstance(keyWLU, str):
+
+ valueWL = float(md[keyWL])
+ valueWLU = str(md[keyWLU]).lower()
+
+ if valueWL > 0:
+ wl.append(valueWL)
+
+ if valueWLU in LUT_WAVELENGTH_UNITS.keys():
+ wlu.append(LUT_WAVELENGTH_UNITS[valueWLU])
+
+ break
if len(wlu) == len(wl) and len(wl) == ds.RasterCount:
return wl, wlu[0]
@@ -1977,7 +2143,7 @@ def extractWavelengthsFromRapidEyeXML(ds:gdal.Dataset, dom:QDomDocument)->(list,
0.5 * (520 + 590),
0.5 * (630 + 685),
0.5 * (760 + 850),
- 0.5 * (760 - 850)
+ 0.5 * (760 + 850)
]
return wl, wlu
return None, None
diff --git a/eotimeseriesviewer/ui/profileviewdock.ui b/eotimeseriesviewer/ui/profileviewdock.ui
index 38697fce7a0ebee279d20054ec538248117f61a1..2c298d7dd3f1ab794a06ec6144d505c909a5eb5c 100644
--- a/eotimeseriesviewer/ui/profileviewdock.ui
+++ b/eotimeseriesviewer/ui/profileviewdock.ui
@@ -964,7 +964,7 @@ background-color: rgb(0, 0, 0);</string>
<customwidget>
<class>DateTimePlotWidget</class>
<extends>QGraphicsView</extends>
- <header>eotimeseriesviewer.temporalprofiles2d</header>
+ <header>eotimeseriesviewer.temporalprofiles</header>
</customwidget>
<customwidget>
<class>PlotSettingsTableView</class>
diff --git a/eotimeseriesviewer/ui/settingsdialog.ui b/eotimeseriesviewer/ui/settingsdialog.ui
index 0ea0ca00981a6d74297133b602dbf31cd54dda4f..c2b8ee40e4378bf3fa6319de3907f1cb2880c4b2 100644
--- a/eotimeseriesviewer/ui/settingsdialog.ui
+++ b/eotimeseriesviewer/ui/settingsdialog.ui
@@ -6,7 +6,7 @@
<rect>
<x>0</x>
<y>0</y>
- <width>411</width>
+ <width>606</width>
<height>326</height>
</rect>
</property>
@@ -46,12 +46,17 @@
<string>Maps</string>
</property>
</item>
+ <item>
+ <property name="text">
+ <string>Sensors</string>
+ </property>
+ </item>
</widget>
</item>
<item>
<widget class="QStackedWidget" name="stackedWidget">
<property name="currentIndex">
- <number>1</number>
+ <number>2</number>
</property>
<widget class="QWidget" name="pageGeneral">
<layout class="QVBoxLayout" name="verticalLayout_3">
@@ -69,8 +74,8 @@
</widget>
</item>
<item row="0" column="1">
- <widget class="QgsFileWidget" name="mFileWidgetScreenshots">
- <property name="fileWidgetButtonVisible">
+ <widget class="QgsFileWidget" name="mFileWidgetScreenshots" native="true">
+ <property name="fileWidgetButtonVisible" stdset="0">
<bool>true</bool>
</property>
</widget>
@@ -90,10 +95,10 @@
</widget>
</item>
<item row="1" column="1">
- <widget class="QgsFileWidget" name="mFileWidgetRasterSources"/>
+ <widget class="QgsFileWidget" name="mFileWidgetRasterSources" native="true"/>
</item>
<item row="2" column="1">
- <widget class="QgsFileWidget" name="mFileWidgetVectorSources"/>
+ <widget class="QgsFileWidget" name="mFileWidgetVectorSources" native="true"/>
</item>
</layout>
</widget>
@@ -113,6 +118,26 @@
</item>
<item row="0" column="1">
<widget class="QComboBox" name="cbDateTimePrecission">
+ <property name="toolTip">
+ <string>Defines the accuracy with which source images of same sensor but different time stamps are combined into the same image group.</string>
+ </property>
+ <property name="whatsThis">
+ <string>Selects the precission used to extract time stamps from raster meta data.</string>
+ </property>
+ </widget>
+ </item>
+ <item row="1" column="0">
+ <widget class="QLabel" name="label_10">
+ <property name="text">
+ <string>Sensor/Product Matching</string>
+ </property>
+ </widget>
+ </item>
+ <item row="1" column="1">
+ <widget class="QComboBox" name="cbSensorMatching">
+ <property name="toolTip">
+ <string>Specifies when source images should be considered to be from the same sensor/image product.</string>
+ </property>
<property name="whatsThis">
<string>Selects the precission used to extract time stamps from raster meta data.</string>
</property>
@@ -205,6 +230,19 @@
</property>
</widget>
</item>
+ <item>
+ <spacer name="horizontalSpacer">
+ <property name="orientation">
+ <enum>Qt::Horizontal</enum>
+ </property>
+ <property name="sizeHint" stdset="0">
+ <size>
+ <width>40</width>
+ <height>20</height>
+ </size>
+ </property>
+ </spacer>
+ </item>
</layout>
</item>
<item row="1" column="0">
@@ -236,9 +274,6 @@
<property name="styleSheet">
<string notr="true">);</string>
</property>
- <property name="mode">
- <enum>QgsFontButton::ModeTextRenderer</enum>
- </property>
</widget>
</item>
<item row="3" column="0">
@@ -256,6 +291,9 @@
<height>16777215</height>
</size>
</property>
+ <property name="toolTip">
+ <string>Intervall to check if updates are available for map canvases, e.g. to render new layers or apply renderer changes.</string>
+ </property>
<property name="suffix">
<string>msec</string>
</property>
@@ -275,6 +313,75 @@
</item>
</layout>
</widget>
+ <widget class="QWidget" name="pageSensors">
+ <layout class="QVBoxLayout" name="verticalLayout_2">
+ <item>
+ <layout class="QHBoxLayout" name="horizontalLayout_3">
+ <property name="topMargin">
+ <number>0</number>
+ </property>
+ <item>
+ <widget class="QLabel" name="label_12">
+ <property name="text">
+ <string>Sensor Names </string>
+ </property>
+ </widget>
+ </item>
+ <item>
+ <spacer name="horizontalSpacer_2">
+ <property name="orientation">
+ <enum>Qt::Horizontal</enum>
+ </property>
+ <property name="sizeHint" stdset="0">
+ <size>
+ <width>40</width>
+ <height>20</height>
+ </size>
+ </property>
+ </spacer>
+ </item>
+ <item>
+ <widget class="QToolButton" name="btnReloadSensorSettings">
+ <property name="text">
+ <string>Reload</string>
+ </property>
+ <property name="icon">
+ <iconset resource="../../../../QGIS/images/images.qrc">
+ <normaloff>:/images/themes/default/mActionReload.svg</normaloff>:/images/themes/default/mActionReload.svg</iconset>
+ </property>
+ <property name="autoRaise">
+ <bool>true</bool>
+ </property>
+ </widget>
+ </item>
+ <item>
+ <widget class="QToolButton" name="btnDeleteSelectedSensors">
+ <property name="text">
+ <string>Clear</string>
+ </property>
+ <property name="icon">
+ <iconset resource="../../../../QGIS/images/images.qrc">
+ <normaloff>:/images/themes/default/mActionDeleteSelected.svg</normaloff>:/images/themes/default/mActionDeleteSelected.svg</iconset>
+ </property>
+ <property name="autoRaise">
+ <bool>true</bool>
+ </property>
+ </widget>
+ </item>
+ </layout>
+ </item>
+ <item>
+ <widget class="QTableView" name="tableViewSensorSettings">
+ <property name="styleSheet">
+ <string notr="true"/>
+ </property>
+ <property name="sortingEnabled">
+ <bool>true</bool>
+ </property>
+ </widget>
+ </item>
+ </layout>
+ </widget>
</widget>
</item>
</layout>
@@ -290,26 +397,46 @@
</widget>
</item>
</layout>
+ <action name="actionRefreshSensorList">
+ <property name="icon">
+ <iconset resource="../../../../QGIS/images/images.qrc">
+ <normaloff>:/images/themes/default/mActionReload.svg</normaloff>:/images/themes/default/mActionReload.svg</iconset>
+ </property>
+ <property name="text">
+ <string>RefreshSensorList</string>
+ </property>
+ </action>
+ <action name="actionDeleteSelectedSensors">
+ <property name="icon">
+ <iconset resource="../../../../QGIS/images/images.qrc">
+ <normaloff>:/images/themes/default/mActionDeleteSelected.svg</normaloff>:/images/themes/default/mActionDeleteSelected.svg</iconset>
+ </property>
+ <property name="text">
+ <string>DeleteSelectedSensors</string>
+ </property>
+ </action>
</widget>
<customwidgets>
+ <customwidget>
+ <class>QgsFileWidget</class>
+ <extends>QWidget</extends>
+ <header>qgsfilewidget.h</header>
+ </customwidget>
<customwidget>
<class>QgsColorButton</class>
<extends>QToolButton</extends>
<header>qgscolorbutton.h</header>
<container>1</container>
</customwidget>
- <customwidget>
- <class>QgsFileWidget</class>
- <extends>QWidget</extends>
- <header>qgsfilewidget.h</header>
- </customwidget>
<customwidget>
<class>QgsFontButton</class>
<extends>QToolButton</extends>
<header>qgsfontbutton.h</header>
</customwidget>
</customwidgets>
- <resources/>
+ <resources>
+ <include location="../../../../QGIS/images/images.qrc"/>
+ </resources>
<connections>
<connection>
<sender>buttonBox</sender>
diff --git a/eotimeseriesviewer/ui/timeseriesviewer.ui b/eotimeseriesviewer/ui/timeseriesviewer.ui
index 928be2e1c6f1564a799a1a3818bb444994aca838..008cac9bf2ddf2dafcdb5ecf0ff95951773f57f1 100644
--- a/eotimeseriesviewer/ui/timeseriesviewer.ui
+++ b/eotimeseriesviewer/ui/timeseriesviewer.ui
@@ -768,9 +768,6 @@
<property name="iconVisibleInMenu">
<bool>false</bool>
</property>
- <property name="shortcutVisibleInContextMenu">
- <bool>true</bool>
- </property>
</action>
<action name="actionExportMapsToImages">
<property name="icon">
diff --git a/eotimeseriesviewer/utils.py b/eotimeseriesviewer/utils.py
index 609e4a9a369df18778dc54d15683126f5204c009..a1ea2f8a3a9a7b25d4cc4b9280fe64c2dc32449b 100644
--- a/eotimeseriesviewer/utils.py
+++ b/eotimeseriesviewer/utils.py
@@ -73,3 +73,7 @@ def fixMenuButtons(w:QWidget):
if isinstance(toolButton.defaultAction(), QAction) and isinstance(toolButton.defaultAction().menu(), QMenu)\
or isinstance(toolButton.menu(), QMenu):
toolButton.setPopupMode(QToolButton.MenuButtonPopup)
+
+class TaskMock(QgsTask):
+ def __init__(self):
+ super(TaskMock, self).__init__()
\ No newline at end of file
diff --git a/example/exampleEvents.gpkg b/example/exampleEvents.gpkg
index 826a2a726d71dac012e4067fe942bc683cc85960..b0b913914ecf33c7247367cd549be345febc6943 100644
--- a/example/exampleEvents.gpkg
+++ b/example/exampleEvents.gpkg
@@ -1,3 +1,3 @@
version https://git-lfs.github.com/spec/v1
-oid sha256:f5cde8206cc45a57b417237aff68909cc06c98717cf510609cf83f3ee1933e21
+oid sha256:6bfd5c8fcc8d30ee3f1c9798d88b197f0fec4d64f3ab9f148fa3423feb05d6ce
size 385024
diff --git a/make/deploy.py b/make/deploy.py
index 77aff59561337f5d6923e99e64f2bf08de0c6506..b2351241b5d795c86f6edfb651b88662e2f2bd76 100644
--- a/make/deploy.py
+++ b/make/deploy.py
@@ -41,7 +41,7 @@ import eotimeseriesviewer
DIR_BUILD = jp(DIR_REPO, 'build')
DIR_DEPLOY = jp(DIR_REPO, 'deploy')
-DIR_DOC_SOURCE = jp(DIR_REPO, *['doc','source'])
+DIR_DOC_SOURCE = jp(DIR_REPO, *['doc', 'source'])
QGIS_MIN = '3.4'
QGIS_MAX = '3.99'
@@ -127,7 +127,7 @@ class QGISMetadataFileWriter(object):
self.mDescription = None
self.mVersion = None
- self.mQgisMinimumVersion = '3.4'
+ self.mQgisMinimumVersion = '3.8'
self.mQgisMaximumVersion = '3.99'
self.mAuthor = None
self.mAbout = None
@@ -270,13 +270,16 @@ def build():
if True:
# 1. clean an existing directory = plugin folder
- pb_tool.clean_deployment(ask_first=False)
+ try:
+ pb_tool.clean_deployment(ask_first=False)
+ except:
+ pass
import make
make.compileResourceFiles()
# 3. Deploy = write the data to the new plugin folder
- pb_tool.deploy_files(pathCfg, DIR_DEPLOY, quick=True, confirm=False)
+ pb_tool.deploy_files(pathCfg, DIR_DEPLOY, 'default', quick=True, confirm=False)
# 4. As long as we can not specify in the pb_tool.cfg which file types are not to deploy,
# we need to remove them afterwards.
@@ -378,7 +381,7 @@ def updateInfoHTMLs():
from eotimeseriesviewer import PATH_CHANGELOG
from docutils.core import publish_string
- urlIssueTracke = r'https://bitbucket.org/jakimowb/eo-time-series-viewer/issues/'
+ urlIssueTracker = r'https://bitbucket.org/jakimowb/eo-time-series-viewer/issues/'
def readTextFile(path):
with open(path, 'r', encoding='utf-8') as f:
@@ -402,7 +405,7 @@ def updateInfoHTMLs():
# CHANGELOG -> CHANGELOG.html
txt = readTextFile(PATH_CHANGELOG)
- txt = re.sub(r'(#(\d+))', r'`#\2 <{}\2>`_'.format(urlIssueTracke), txt)
+ txt = re.sub(r'(#(\d+))', r'`#\2 <{}\2>`_'.format(urlIssueTracker), txt)
txt = publish_string(txt, writer_name='html').decode('utf-8')
diff --git a/tests/test_fileFormatLoading.py b/tests/test_fileFormatLoading.py
index be99a1ff1e2a7112d4bb05d54304619b9caea0da..dc8ab352fa6db9251dc307ec0d7a5cbd617e4b20 100644
--- a/tests/test_fileFormatLoading.py
+++ b/tests/test_fileFormatLoading.py
@@ -6,12 +6,12 @@ import qgis.testing
from unittest import TestCase
from eotimeseriesviewer import *
from eotimeseriesviewer.utils import *
-from eotimeseriesviewer.timeseries import TimeSeries
+from eotimeseriesviewer.timeseries import *
DIR_SENTINEL = r''
DIR_PLEIADES = r'H:\Pleiades'
-DIR_RAPIDEYE = jp(DIR_EXAMPLES, 'Images')
+DIR_RAPIDEYE = r'Y:\RapidEye\3A'
DIR_LANDSAT = jp(DIR_EXAMPLES, 'Images')
DIR_VRT = r'O:\SenseCarbonProcessing\BJ_NOC\01_RasterData\02_CuttedVRT'
@@ -49,8 +49,11 @@ class TestFileFormatLoading(TestCase):
if not os.path.isdir(searchDir):
print('data directory undefined. skip test.')
return
- files = list(file_search(searchDir, 're_*.bsq', recursive=True))
- self.TS.addSources(files)
+ files = list(file_search(searchDir, 're_*.tif', recursive=True))
+ for file in files:
+ tss = TimeSeriesSource.create(file)
+ self.assertIsInstance(tss, TimeSeriesSource)
+ self.TS.addSources(files, runAsync=False)
self.assertEqual(len(files), len(self.TS))
def test_loadLandsat(self):
@@ -59,11 +62,62 @@ class TestFileFormatLoading(TestCase):
print('DIR_LANDSAT undefined. skip test.')
return
files = list(file_search(searchDir, '*_L*_BOA.bsq'))[0:3]
- self.TS.addSources(files)
+ self.TS.addSources(files, runAsync=False)
self.assertEqual(len(files), len(self.TS))
s = ""
+
+ def test_loadOSARIS_GRD(self):
+
+ testDir = r'Q:\Processing_BJ\99_OSARIS_Testdata\Loibl-2019-OSARIS-Ala-Archa\Coherences'
+ if os.path.isdir(testDir):
+ files = file_search(testDir, re.compile(r'.*\.grd$'))
+ for i, path in enumerate(files):
+
+ tss = TimeSeriesSource.create(path)
+ self.assertIsInstance(tss, TimeSeriesSource)
+ self.assertTrue(tss.crs().isValid())
+ self.TS.addSources([path], runAsync=False)
+ self.assertEqual(len(self.TS), i+1)
+
+ tss = self.TS[0][0]
+ self.assertIsInstance(tss, TimeSeriesSource)
+ sensor = self.TS[0].sensor()
+ self.assertIsInstance(sensor, SensorInstrument)
+
+
+ def test_ForceLevel2(self):
+
+ path = r'J:\diss_bj\level2\s-america\X0050_Y0025\20140601_LEVEL2_LND08_BOA.tif'
+ path = r'J:\diss_bj\level2\s-america\X0049_Y0025\20140531_LEVEL2_LND07_BOA.tif'
+
+ testData = r'J:\diss_bj\level2\s-america\X0049_Y0025'
+ if os.path.isdir(testData):
+ files = file_search(testData, '*IMP.tif')
+ for path in files:
+
+ self.TS.addSources([path], runAsync=False)
+ self.assertEqual(len(self.TS), 1)
+
+ tss = self.TS[0][0]
+ self.assertIsInstance(tss, TimeSeriesSource)
+ sensor = self.TS[0].sensor()
+ self.assertIsInstance(sensor, SensorInstrument)
+
+ s = ""
+
+ def test_badtimeformat(self):
+
+ p = r'C:\Users\geo_beja\Desktop\23042014_LEVEL2_LND08_VZN.tif'
+
+ if os.path.isfile(p):
+ tss = TimeSeriesSource.create(p)
+ s = ""
+
+
+
+
def test_nestedVRTs(self):
# load VRTs pointing to another VRT pointing to Landsat imagery
searchDir = DIR_VRT
@@ -71,7 +125,7 @@ class TestFileFormatLoading(TestCase):
print('DIR_VRT undefined. skip test.')
return
files = list(file_search(searchDir, '*BOA.vrt', recursive=True))[0:3]
- self.TS.addSources(files)
+ self.TS.addSources(files, runAsync=False)
self.assertEqual(len(files), len(self.TS))
def test_loadRapidEye(self):
@@ -81,9 +135,17 @@ class TestFileFormatLoading(TestCase):
print('DIR_RAPIDEYE undefined. skip test.')
return
files = file_search(searchDir, '*.tif', recursive=True)
- files = [f for f in files if not re.search('_(udm|browse)\.tif$', f)]
- self.TS.addSources(files)
- self.assertEqual(len(files), len(self.TS))
+ files = [f for f in files if not re.search(r'_(udm|browse)\.tif$', f)]
+ self.TS.addSources(files, runAsync=False)
+ self.assertEqual(len(files), len(self.TS.sourceUris()))
+
+ tsd = self.TS[0]
+ self.assertIsInstance(tsd, TimeSeriesDate)
+ for wl in tsd.sensor().wl:
+ self.assertTrue(wl > 0)
+ tss = tsd[0]
+ self.assertIsInstance(tss, TimeSeriesSource)
+
@@ -95,7 +157,7 @@ class TestFileFormatLoading(TestCase):
return
#files = file_search(searchDir, 'DIM*.xml', recursive=True)
files = list(file_search(searchDir, '*.jp2', recursive=True))[0:3]
- self.TS.addSources(files)
+ self.TS.addSources(files, runAsync=False)
self.assertEqual(len(files), len(self.TS))
def test_loadSentinel2(self):
@@ -105,7 +167,7 @@ class TestFileFormatLoading(TestCase):
print('DIR_SENTINEL undefined. skip test.')
return
files = list(file_search(searchDir, '*MSIL1C.xml', recursive=True))
- self.TS.addSources(files)
+ self.TS.addSources(files, runAsync=False)
#self.assertRegexpMatches(self.stderr.getvalue().strip(), 'Unable to add:')
self.assertEqual(0, len(self.TS)) # do not add a containers
@@ -113,7 +175,7 @@ class TestFileFormatLoading(TestCase):
for file in files:
subs = gdal.Open(file).GetSubDatasets()
subdatasets.extend(s[0] for s in subs)
- self.TS.addSources(subdatasets)
+ self.TS.addSources(subdatasets, runAsync=False)
self.assertEqual(len(subdatasets), len(self.TS)) # add subdatasets
diff --git a/tests/test_main.py b/tests/test_main.py
index fbd9e4d8516bfda7aae9bf446fef7cb6e99258cf..bb00299a37f600144ed0240743061f96af53a931 100644
--- a/tests/test_main.py
+++ b/tests/test_main.py
@@ -105,11 +105,27 @@ class TestInit(TestCase):
while QgsApplication.taskManager().countActiveTasks() > 0 or len(TSV.timeSeries().mTasks) > 0:
QCoreApplication.processEvents()
- tsd = TSV.timeSeries()[-1]
- TSV.setCurrentDate(tsd)
+ if len(TSV.timeSeries()) > 0:
+ tsd = TSV.timeSeries()[-1]
+ TSV.setCurrentDate(tsd)
if SHOW_GUI:
QGIS_APP.exec_()
+
+ def test_TimeSeriesViewerInvalidSource(self):
+
+ from eotimeseriesviewer.main import TimeSeriesViewer
+
+ TSV = TimeSeriesViewer()
+ imgages = ['not-existing-source']
+ TSV.addTimeSeriesImages(imgages, loadAsync=False)
+ while QgsApplication.taskManager().countActiveTasks() > 0 or len(TSV.timeSeries().mTasks) > 0:
+ QCoreApplication.processEvents()
+
+ if SHOW_GUI:
+ QGIS_APP.exec_()
+
+
def test_TimeSeriesViewerMultiSource(self):
from eotimeseriesviewer.main import TimeSeriesViewer
diff --git a/tests/test_mapvisualization.py b/tests/test_mapvisualization.py
index acecb075bb6e238dd68eb1c2c080c469141149d3..9af4c0befb9f34a67a60639d4fbdb46581b63245 100644
--- a/tests/test_mapvisualization.py
+++ b/tests/test_mapvisualization.py
@@ -34,7 +34,7 @@ QGIS_APP = initQgisApplication(loadProcessingFramework=False)
from eotimeseriesviewer import initResources
initResources()
-SHOW_GUI = True and os.environ.get('CI') is None
+SHOW_GUI = False and os.environ.get('CI') is None
def getChildElements(node):
@@ -390,109 +390,22 @@ class testclassMapVisualization(unittest.TestCase):
rClone = r1.clone()
self.assertTrue(type(r1), type(rClone))
- xmlClone = rendererToXml(rClone)
+ xmlClone = rendererToXml(rClone)
self.assertIsInstance(xmlClone, QDomDocument)
similar = compareXML(xml1.firstChild(), xml2.firstChild())
self.assertTrue(similar)
-
-
-
-
-
+ del rClone, xmlClone
for path in styleFiles:
with open(path, encoding='utf8') as f:
xml = ''.join(f.readlines())
-
-
renderer = rendererFromXml(xml)
self.assertTrue(renderer != None)
+ self.assertIsInstance(renderer, (QgsRasterRenderer, QgsFeatureRenderer))
- s =""
-
-
-
-
- def test_spatialTemporalVisualization(self):
- from eotimeseriesviewer.main import TimeSeriesViewer
-
- TSV = TimeSeriesViewer()
- TSV.loadExampleTimeSeries()
- TSV.show()
-
- SV = TSV.spatialTemporalVis
- self.assertIsInstance(SV, SpatialTemporalVisualization)
- QApplication.processEvents()
- # TSV.createMapView()
-
- import time
- time.sleep(5)
-
- SV.timedCanvasRefresh()
-
-
- visibleCanvases = []
- withLayers = []
- empty = []
- extent = None
- for mapCanvas in SV.mapCanvases():
- self.assertIsInstance(mapCanvas, MapCanvas)
- self.assertIsInstance(mapCanvas.spatialExtent(), SpatialExtent)
-
- if extent is None:
- extent = mapCanvas.spatialExtent()
- else:
- self.assertTrue(mapCanvas.spatialExtent() == extent)
-
- if len(mapCanvas.layers()) == 0:
- empty.append(mapCanvas)
- else:
- withLayers.append(mapCanvas)
-
- if True:
- QGIS_APP.exec_()
-
- self.assertTrue(len(withLayers) > 0)
- self.assertTrue(len(empty) > 0)
-
- # shift spatial extent
- extent2 = extent.setCenter(SpatialPoint(extent.crs(), extent.center().x()-100, extent.center().y()))
- SV.setSpatialExtent(extent2)
- SV.timedCanvasRefresh()
- for mapCanvas in SV.mapCanvases():
- self.assertIsInstance(mapCanvas, MapCanvas)
- if mapCanvas.isVisibleToViewport():
- self.assertTrue(mapCanvas.spatialExtent() == extent2)
-
-
- # shift spatial extent of single map canvas
- extent3 = extent.setCenter(SpatialPoint(extent.crs(), extent.center().x() + 100, extent.center().y()))
- canvas = SV.mapCanvases()[0]
- self.assertIsInstance(canvas, MapCanvas)
- canvas.setSpatialExtent(extent3)
- SV.timedCanvasRefresh()
- for mapCanvas in SV.mapCanvases():
- if mapCanvas.isVisibleToViewport():
- self.assertTrue(mapCanvas.spatialExtent() == extent3)
-
- # test map render changes
- for canvas in SV.mapCanvases():
- self.assertIsInstance(canvas, MapCanvas)
- menu = canvas.contextMenu()
- self.assertIsInstance(menu, QMenu)
- if canvas.isVisibleToViewport():
-
- for action in menu.findChildren(QAction):
- self.assertIsInstance(action, QAction)
- text = action.text()
- if text in ['', 'Style', 'PNG', 'JPEG']:
- # skip menu / blocking dialog options
- continue
- else:
- print('Test QAction "{}"'.format(action.text()))
- action.trigger()
- break
- s = ""
+if __name__ == '__main__':
+ os.environ['CI'] = True
+ unittest.main()
diff --git a/tests/test_pixelloader.py b/tests/test_pixelloader.py
index a3fa6583ad3939c3507ae83e7ed0ccaca8e86fe1..6cd7e97675c65af258b17dc92b7586dfe4726a32 100644
--- a/tests/test_pixelloader.py
+++ b/tests/test_pixelloader.py
@@ -148,11 +148,36 @@ class PixelLoaderTest(unittest.TestCase):
if os.path.isfile(p):
lyr = QgsRasterLayer(p)
task = PixelLoaderTask(p, [SpatialPoint.fromMapLayerCenter(lyr)])
+ from eotimeseriesviewer.utils import TaskMock
+ result = doLoaderTask(TaskMock(), task.toDump())
- result = doLoaderTask(None, task.toDump())
s = ""
+ def test_pixelLoader_OOImg(self):
+
+ from eotimeseriesviewer.utils import TaskMock
+ from eotimeseriesviewer.pixelloader import PixelLoaderTask, doLoaderTask
+
+ if os.path.isfile(path):
+ crs = QgsCoordinateReferenceSystem('EPSG:4326')
+ pt = SpatialPoint(crs, -55.41314771195199995, -6.92449242268311593)
+
+ lyr = QgsRasterLayer(path)
+ ext = lyr.extent()
+ pt2 = pt.toCrs(lyr.crs())
+
+
+
+ task = PixelLoaderTask(path, [p])
+ result = doLoaderTask(TaskMock(), task.toDump())
+
+ s = ""
+
+
+ PixelLoaderTask()
+
+
def test_pixelLoader(self):
from eotimeseriesviewer.pixelloader import doLoaderTask, PixelLoaderTask, INFO_OUT_OF_IMAGE, INFO_NO_DATA
from eotimeseriesviewer import px2geo
@@ -186,8 +211,8 @@ class PixelLoaderTest(unittest.TestCase):
self.assertIsInstance(result, PixelLoaderTask)
self.assertTrue(result.success())
- self.assertEqual(result.sourcePath, source)
- self.assertSequenceEqual(result.bandIndices, [0,1,2,3,4,5])
+ self.assertEqual(result.mSourcePath, source)
+ self.assertSequenceEqual(result.mBandIndices, [0, 1, 2, 3, 4, 5])
self.assertIs(result.exception, None)
diff --git a/tests/test_sensorvisualization.py b/tests/test_sensorvisualization.py
index 7b98f3d92a2bc381b2c6c8c69a88e0149e6f83f7..4c75e2f2738af57cb79e8b5839f078f8578e0732 100644
--- a/tests/test_sensorvisualization.py
+++ b/tests/test_sensorvisualization.py
@@ -19,7 +19,7 @@ class TestInit(unittest.TestCase):
def createTestDatasets(self):
vsiDir = '/vsimem/tmp'
- from eotimeseriesviewer.temporalprofiles2d import date2num
+ from eotimeseriesviewer.temporalprofiles import date2num
ns = 50
nl = 100
@@ -67,7 +67,7 @@ class TestInit(unittest.TestCase):
model = SensorListModel(TS)
self.assertTrue(model.rowCount() == 0)
- TS.addSources(pathes)
+ TS.addSources(pathes, runAsync=False)
self.assertTrue(len(TS) == len(pathes))
self.assertTrue(model.rowCount() == 2)
diff --git a/tests/test_settings.py b/tests/test_settings.py
index fb501838cf85d15033558b8ed3fdfeec63b88123..ceb99185c52f12bae7cd6d284e45b55a40fcd968 100644
--- a/tests/test_settings.py
+++ b/tests/test_settings.py
@@ -24,7 +24,7 @@ from PyQt5.QtCore import *
import unittest, tempfile
from eotimeseriesviewer.mapcanvas import *
-from eotimeseriesviewer.crosshair import *
+from eotimeseriesviewer import *
from eotimeseriesviewer.utils import *
resourceDir = os.path.join(DIR_REPO, 'qgisresources')
QGIS_APP = initQgisApplication()
@@ -78,6 +78,15 @@ class testclassSettingsTest(unittest.TestCase):
self.assertIsInstance(defaults, dict)
+ def test_SensorModel(self):
+
+ tb = QTableView()
+ m = SensorSettingsTableModel()
+ tb.setModel(m)
+ tb.show()
+
+ if SHOW_GUI:
+ QGIS_APP.exec_()
if __name__ == "__main__":
diff --git a/tests/test_stackedbandinput.py b/tests/test_stackedbandinput.py
index f7c0324106f2ce8bcbb2b1f62f8aaf4eba9a3c2b..1e0da56b362717b4801bb0ed816ae66eccc37bc5 100644
--- a/tests/test_stackedbandinput.py
+++ b/tests/test_stackedbandinput.py
@@ -33,14 +33,12 @@ from example.Images import Img_2014_06_16_LE72270652014167CUB00_BOA, Img_2014_05
QGIS_APP = initQgisApplication()
-class testclassDialogTest(unittest.TestCase):
- """Test rerources work."""
-
+class testclassStackedInputTests(unittest.TestCase):
def createTestDatasets(self):
vsiDir = '/vsimem/tmp'
- from eotimeseriesviewer.temporalprofiles2d import date2num
+ from eotimeseriesviewer.temporalprofiles import date2num
ns = 50
nl = 100
@@ -105,6 +103,19 @@ class testclassDialogTest(unittest.TestCase):
return datasets
+ def test_FORCEStacks(self):
+
+ pathStack = r'T:\4BJ\2018-2018_000-000_LEVEL4_TSA_SEN2L_EVI_C0_S0_TSS.tif'
+
+ if os.path.isfile(pathStack):
+ d = StackedBandInputDialog()
+ d.show()
+ d.addSources([pathStack])
+
+ if SHOW_GUI:
+ QGIS_APP.exec_()
+ s =""
+
def test_inputmodel(self):
testData = self.createTestDatasets()
diff --git a/tests/test_temporalprofiles.py b/tests/test_temporalprofiles.py
index dfde14e72401c858f4d61311850e35918fb5c38c..6071fd0a1ac9133757a681ea5bd6f4c5235630bb 100644
--- a/tests/test_temporalprofiles.py
+++ b/tests/test_temporalprofiles.py
@@ -18,13 +18,13 @@ from qgis.gui import *
from PyQt5.QtGui import QIcon
import example.Images
from eotimeseriesviewer.timeseries import TimeSeries, TimeSeriesDate
-from eotimeseriesviewer.temporalprofiles2d import *
+from eotimeseriesviewer.temporalprofiles import *
from eotimeseriesviewer.profilevisualization import *
from eotimeseriesviewer.utils import *
from eotimeseriesviewer.tests import initQgisApplication
from osgeo import ogr, osr
QGIS_APP = initQgisApplication()
-SHOW_GUI = True and os.environ.get('CI') is None and not os.environ.get('CI')
+SHOW_GUI = False and os.environ.get('CI') is None
class testclassUtilityTests(unittest.TestCase):
"""Test temporal profiles"""
@@ -34,7 +34,8 @@ class testclassUtilityTests(unittest.TestCase):
self.TS = TimeSeries()
files = list(file_search(os.path.dirname(example.Images.__file__), '*.tif'))
- self.TS.addSources(files)
+ self.TS.addSources(files, runAsync=False)
+ self.assertTrue(len(self.TS) > 0)
self.dirTmp = tempfile.mkdtemp(prefix='EOTSV_Test')
def tearDown(self):
@@ -56,6 +57,68 @@ class testclassUtilityTests(unittest.TestCase):
self.assertIsInstance(p, TemporalProfile)
return results
+ def test_loadTemporalProfiles(self):
+
+ center = self.TS.maxSpatialExtent().spatialCenter()
+
+ lyr = TemporalProfileLayer(self.TS)
+ tp1 = lyr.createTemporalProfiles(center)[0]
+ tp2 = lyr.createTemporalProfiles(center)[0]
+ tProfiles = [tp1, tp2]
+
+ tss = self.TS[0][0]
+ self.assertIsInstance(tss, TimeSeriesSource)
+
+ tasks = []
+ for tss in self.TS[0]:
+ tasks.append(TemporalProfileLoaderTask(tss, tProfiles))
+
+ self.lastProgress = -1
+ def onProgress(p):
+ self.lastProgress = p
+
+ qgsTask = TaskMock()
+ qgsTask.progressChanged.connect(onProgress)
+ dump = doLoadTemporalProfileTasks(qgsTask, pickle.dumps(tasks))
+ tasks = pickle.loads(dump)
+ self.assertIsInstance(tasks, list)
+
+
+ for task in tasks:
+ self.assertIsInstance(task, TemporalProfileLoaderTask)
+ self.assertTrue(len(task.mERRORS) > 0 or len(task.mRESULTS) > 0)
+ self.assertTrue(len(task.mRESULTS) == len(tProfiles))
+ self.assertAlmostEqual(self.lastProgress, 100)
+
+
+ tasks = []
+ bandIndices = [-12, 0, 4, 999]
+ tasks.append(TemporalProfileLoaderTask(tss, tProfiles, bandIndices=bandIndices))
+ dump = doLoadTemporalProfileTasks(qgsTask, pickle.dumps(tasks))
+ tasks = pickle.loads(dump)
+ self.assertIsInstance(tasks, list)
+ for task in tasks:
+ self.assertIsInstance(task, TemporalProfileLoaderTask)
+ self.assertTrue(task.mTSS, TimeSeriesSource)
+ for tpId, data in task.mRESULTS.items():
+ # check returned data
+ self.assertIsInstance(data, dict)
+ self.assertTrue('px_x' in data.keys())
+ self.assertTrue('px_y' in data.keys())
+
+ for idx in bandIndices:
+ bandName = 'b{}'.format(idx+1)
+ if idx < 0 or idx >= task.mTSS.nb - 1:
+ self.assertTrue(bandName not in data.keys())
+ else:
+ self.assertTrue(bandName in data.keys())
+
+ self.assertTrue(len(task.mRESULTS) == len(tProfiles))
+
+
+ # todo: test-nodata values
+
+
def test_createTemporalProfile(self):
center = self.TS.maxSpatialExtent().spatialCenter()
@@ -63,9 +126,8 @@ class testclassUtilityTests(unittest.TestCase):
lyr = TemporalProfileLayer(self.TS)
tp = lyr.createTemporalProfiles(center)[0]
-
self.assertIsInstance(tp, TemporalProfile)
- tp.loadMissingData(False)
+ tp.loadMissingData()
temporalProfiles = [tp]
temporalProfiles.extend(lyr.createTemporalProfiles((SpatialPoint(center.crs(), center.x() - 50, center.y() + 50))))
@@ -118,7 +180,7 @@ class testclassUtilityTests(unittest.TestCase):
self.assertEqual(tp, tp2)
p = tempfile.mktemp('.shp', 'testtemporalprofiles')
- writtenFiles = lyr1.saveTemporalProfiles(p, loadMissingValues=True)
+ writtenFiles = lyr1.saveTemporalProfiles(p)
self.assertTrue(len(writtenFiles) == 2)
for f in writtenFiles:
self.assertTrue(os.path.isfile(f))
@@ -172,7 +234,7 @@ class testclassUtilityTests(unittest.TestCase):
for sensor in self.TS.sensors():
self.assertIsInstance(sensor, SensorInstrument)
for expression in expressions:
- x , y = tp.dataFromExpression(sensor, expression)
+ x, y = tp.dataFromExpression(sensor, expression)
self.assertIsInstance(x, list)
self.assertIsInstance(y, list)
self.assertEqual(len(x), len(y))
diff --git a/tests/test_timeseries.py b/tests/test_timeseries.py
index f40590f37cd2bf6ba63ba6877b6709a9d758e436..6c773058a62f1d259c0e5c181095b53f78ceed77 100644
--- a/tests/test_timeseries.py
+++ b/tests/test_timeseries.py
@@ -15,12 +15,19 @@ QAPP = initQgisApplication()
SHOW_GUI = False and os.environ.get('CI') is None
+import eotimeseriesviewer.settings
+
+s = eotimeseriesviewer.settings.settings()
+s.clear()
+s.sync()
+s = ""
+
class TestInit(unittest.TestCase):
def createTestDatasets(self):
vsiDir = '/vsimem/tmp'
- from eotimeseriesviewer.temporalprofiles2d import date2num
+ from eotimeseriesviewer.temporalprofiles import date2num
ns = 50
nl = 100
@@ -158,7 +165,6 @@ class TestInit(unittest.TestCase):
self.assertIsInstance(tss.spatialExtent(), SpatialExtent)
self.assertIsInstance(tss, TimeSeriesSource)
-
if not isinstance(ref, TimeSeriesSource):
ref = tss
else:
@@ -259,7 +265,7 @@ class TestInit(unittest.TestCase):
w.show()
TS = TimeSeries()
- TS.addSourcesAsync(files, nWorkers=1)
+ TS.addSources(files, nWorkers=1)
while QgsApplication.taskManager().countActiveTasks() > 0 or len(TS.mTasks) > 0:
QCoreApplication.processEvents()
@@ -352,6 +358,9 @@ class TestInit(unittest.TestCase):
ds = gdal.Open(p)
self.assertIsInstance(ds, gdal.Dataset)
band = ds.GetRasterBand(1)
+
+
+
self.assertIsInstance(band, gdal.Band)